From ecb587ae2f21f3a9f455c8c759209d08de71b3fe Mon Sep 17 00:00:00 2001 From: Christian Koop Date: Sun, 1 Nov 2020 02:27:31 +0100 Subject: [PATCH] Initial commit --- .gitattributes | 1 + .github/dependabot.yml | 11 + .github/workflows/build.yml | 34 + .gitignore | 4 + LICENSE | 21 + action.yml | 37 + dist/index.js | 2 + dist/index.js.map | 1 + dist/package.json | 47 + dist/sourcemap-register.js | 3910 +++++++++++++++++++++++++++++++++++ package-lock.json | 202 ++ package.json | 47 + src/index.ts | 130 ++ src/utils.ts | 138 ++ tsconfig.json | 6 + 15 files changed, 4591 insertions(+) create mode 100644 .gitattributes create mode 100644 .github/dependabot.yml create mode 100644 .github/workflows/build.yml create mode 100644 .gitignore create mode 100644 LICENSE create mode 100644 action.yml create mode 100644 dist/index.js create mode 100644 dist/index.js.map create mode 100644 dist/package.json create mode 100644 dist/sourcemap-register.js create mode 100644 package-lock.json create mode 100644 package.json create mode 100644 src/index.ts create mode 100644 src/utils.ts create mode 100644 tsconfig.json diff --git a/.gitattributes b/.gitattributes new file mode 100644 index 0000000..2e2c7b2 --- /dev/null +++ b/.gitattributes @@ -0,0 +1 @@ +dist/** -diff linguist-generated=true \ No newline at end of file diff --git a/.github/dependabot.yml b/.github/dependabot.yml new file mode 100644 index 0000000..e574638 --- /dev/null +++ b/.github/dependabot.yml @@ -0,0 +1,11 @@ +# To get started with Dependabot version updates, you'll need to specify which +# package ecosystems to update and where the package manifests are located. +# Please see the documentation for all configuration options: +# https://help.github.com/github/administering-a-repository/configuration-options-for-dependency-updates + +version: 2 +updates: + - package-ecosystem: "npm" # See documentation for possible values + directory: "/" # Location of package manifests + schedule: + interval: "weekly" diff --git a/.github/workflows/build.yml b/.github/workflows/build.yml new file mode 100644 index 0000000..d3abff5 --- /dev/null +++ b/.github/workflows/build.yml @@ -0,0 +1,34 @@ +name: 'Build & Run' +on: + push: + branches: [ master ] + pull_request: + +jobs: + # Make sure clean build works properly + build: + runs-on: ubuntu-latest + steps: + - uses: actions/checkout@v2 + - run: | + npm i + npm run build + + # Make sure the action works on a clean machine without building + run: + runs-on: ubuntu-latest + steps: + - uses: actions/checkout@v2 + - uses: ./ + with: + versions: latest, 1.8 + + # Run the original BuildTools in GitHub Actions to easily compare the build times etc. + original-run: + runs-on: ubuntu-latest + steps: + - name: Run original Spigot-BuildTools + run: | + wget https://hub.spigotmc.org/jenkins/job/BuildTools/lastSuccessfulBuild/artifact/target/BuildTools.jar -O BuildTools.jar + java -jar BuildTools.jar --rev latest --compile Spigot + java -jar BuildTools.jar --rev 1.8 --compile Spigot \ No newline at end of file diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..b51325d --- /dev/null +++ b/.gitignore @@ -0,0 +1,4 @@ +/node_modules/ +/build/ + +/.idea/ \ No newline at end of file diff --git a/LICENSE b/LICENSE new file mode 100644 index 0000000..7f301b7 --- /dev/null +++ b/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2020 Christian Koop + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/action.yml b/action.yml new file mode 100644 index 0000000..c5183fa --- /dev/null +++ b/action.yml @@ -0,0 +1,37 @@ +name: Compile Minecraft Spigot (BuildTools) +description: Makes it easier to compile multiple Spigot versions at the same time and speed up clean builds +author: Christian Koop + +inputs: + versions: + required: false + default: latest + description: Versions to build (sperate multiple with ',') + target: + required: false + default: Spigot + description: Select what exactly you want to compile (none, Spigot, CraftBukkit) (sperate multiple with ',') + forceRun: + required: false + default: 'false' + description: Disables the check for existing files in the local maven repository + generateSrc: + required: false + default: 'false' + description: Should sources be generated? + generateDoc: + required: false + default: 'false' + description: Should the documentation be generated? + disableJavaCheck: + required: false + default: 'false' + description: Should we disable the BuildTools's Java-Version-Check + threads: + required: false + default: '-1' + description: The amount of builds allowed to run at a time, set to '-1' to use system's cpu count + +runs: + using: node12 + main: dist/index.js \ No newline at end of file diff --git a/dist/index.js b/dist/index.js new file mode 100644 index 0000000..6e47548 --- /dev/null +++ b/dist/index.js @@ -0,0 +1,2 @@ +require('./sourcemap-register.js');module.exports=(()=>{var e={7351:function(e,t,r){"use strict";var n=this&&this.__importStar||function(e){if(e&&e.__esModule)return e;var t={};if(e!=null)for(var r in e)if(Object.hasOwnProperty.call(e,r))t[r]=e[r];t["default"]=e;return t};Object.defineProperty(t,"__esModule",{value:true});const i=n(r(2087));const o=r(5278);function issueCommand(e,t,r){const n=new Command(e,t,r);process.stdout.write(n.toString()+i.EOL)}t.issueCommand=issueCommand;function issue(e,t=""){issueCommand(e,{},t)}t.issue=issue;const c="::";class Command{constructor(e,t,r){if(!e){e="missing.command"}this.command=e;this.properties=t;this.message=r}toString(){let e=c+this.command;if(this.properties&&Object.keys(this.properties).length>0){e+=" ";let t=true;for(const r in this.properties){if(this.properties.hasOwnProperty(r)){const n=this.properties[r];if(n){if(t){t=false}else{e+=","}e+=`${r}=${escapeProperty(n)}`}}}}e+=`${c}${escapeData(this.message)}`;return e}}function escapeData(e){return o.toCommandValue(e).replace(/%/g,"%25").replace(/\r/g,"%0D").replace(/\n/g,"%0A")}function escapeProperty(e){return o.toCommandValue(e).replace(/%/g,"%25").replace(/\r/g,"%0D").replace(/\n/g,"%0A").replace(/:/g,"%3A").replace(/,/g,"%2C")}},2186:function(e,t,r){"use strict";var n=this&&this.__awaiter||function(e,t,r,n){function adopt(e){return e instanceof r?e:new r(function(t){t(e)})}return new(r||(r=Promise))(function(r,i){function fulfilled(e){try{step(n.next(e))}catch(e){i(e)}}function rejected(e){try{step(n["throw"](e))}catch(e){i(e)}}function step(e){e.done?r(e.value):adopt(e.value).then(fulfilled,rejected)}step((n=n.apply(e,t||[])).next())})};var i=this&&this.__importStar||function(e){if(e&&e.__esModule)return e;var t={};if(e!=null)for(var r in e)if(Object.hasOwnProperty.call(e,r))t[r]=e[r];t["default"]=e;return t};Object.defineProperty(t,"__esModule",{value:true});const o=r(7351);const c=r(717);const s=r(5278);const a=i(r(2087));const u=i(r(5622));var f;(function(e){e[e["Success"]=0]="Success";e[e["Failure"]=1]="Failure"})(f=t.ExitCode||(t.ExitCode={}));function exportVariable(e,t){const r=s.toCommandValue(t);process.env[e]=r;const n=process.env["GITHUB_ENV"]||"";if(n){const t="_GitHubActionsFileCommandDelimeter_";const n=`${e}<<${t}${a.EOL}${r}${a.EOL}${t}`;c.issueCommand("ENV",n)}else{o.issueCommand("set-env",{name:e},r)}}t.exportVariable=exportVariable;function setSecret(e){o.issueCommand("add-mask",{},e)}t.setSecret=setSecret;function addPath(e){const t=process.env["GITHUB_PATH"]||"";if(t){c.issueCommand("PATH",e)}else{o.issueCommand("add-path",{},e)}process.env["PATH"]=`${e}${u.delimiter}${process.env["PATH"]}`}t.addPath=addPath;function getInput(e,t){const r=process.env[`INPUT_${e.replace(/ /g,"_").toUpperCase()}`]||"";if(t&&t.required&&!r){throw new Error(`Input required and not supplied: ${e}`)}return r.trim()}t.getInput=getInput;function setOutput(e,t){o.issueCommand("set-output",{name:e},t)}t.setOutput=setOutput;function setCommandEcho(e){o.issue("echo",e?"on":"off")}t.setCommandEcho=setCommandEcho;function setFailed(e){process.exitCode=f.Failure;error(e)}t.setFailed=setFailed;function isDebug(){return process.env["RUNNER_DEBUG"]==="1"}t.isDebug=isDebug;function debug(e){o.issueCommand("debug",{},e)}t.debug=debug;function error(e){o.issue("error",e instanceof Error?e.toString():e)}t.error=error;function warning(e){o.issue("warning",e instanceof Error?e.toString():e)}t.warning=warning;function info(e){process.stdout.write(e+a.EOL)}t.info=info;function startGroup(e){o.issue("group",e)}t.startGroup=startGroup;function endGroup(){o.issue("endgroup")}t.endGroup=endGroup;function group(e,t){return n(this,void 0,void 0,function*(){startGroup(e);let r;try{r=yield t()}finally{endGroup()}return r})}t.group=group;function saveState(e,t){o.issueCommand("save-state",{name:e},t)}t.saveState=saveState;function getState(e){return process.env[`STATE_${e}`]||""}t.getState=getState},717:function(e,t,r){"use strict";var n=this&&this.__importStar||function(e){if(e&&e.__esModule)return e;var t={};if(e!=null)for(var r in e)if(Object.hasOwnProperty.call(e,r))t[r]=e[r];t["default"]=e;return t};Object.defineProperty(t,"__esModule",{value:true});const i=n(r(5747));const o=n(r(2087));const c=r(5278);function issueCommand(e,t){const r=process.env[`GITHUB_${e}`];if(!r){throw new Error(`Unable to find environment variable for file command ${e}`)}if(!i.existsSync(r)){throw new Error(`Missing file at path: ${r}`)}i.appendFileSync(r,`${c.toCommandValue(t)}${o.EOL}`,{encoding:"utf8"})}t.issueCommand=issueCommand},5278:(e,t)=>{"use strict";Object.defineProperty(t,"__esModule",{value:true});function toCommandValue(e){if(e===null||e===undefined){return""}else if(typeof e==="string"||e instanceof String){return e}return JSON.stringify(e)}t.toCommandValue=toCommandValue},5768:(e,t,r)=>{e.exports=r(6196)().Promise},4549:e=>{"use strict";var t="@@any-promise/REGISTRATION",r=null;e.exports=function(e,n){return function register(i,o){i=i||null;o=o||{};var c=o.global!==false;if(r===null&&c){r=e[t]||null}if(r!==null&&i!==null&&r.implementation!==i){throw new Error('any-promise already defined as "'+r.implementation+'". You can only register an implementation before the first '+' call to require("any-promise") and an implementation cannot be changed')}if(r===null){if(i!==null&&typeof o.Promise!=="undefined"){r={Promise:o.Promise,implementation:i}}else{r=n(i)}if(c){e[t]=r}}return r}}},6196:(e,t,r)=>{"use strict";e.exports=r(4549)(global,loadImplementation);function loadImplementation(e){var t=null;if(shouldPreferGlobalPromise(e)){t={Promise:global.Promise,implementation:"global.Promise"}}else if(e){var r=require(e);t={Promise:r.Promise||r,implementation:e}}else{t=tryAutoDetect()}if(t===null){throw new Error("Cannot find any-promise implementation nor"+" global.Promise. You must install polyfill or call"+' require("any-promise/register") with your preferred'+' implementation, e.g. require("any-promise/register/bluebird")'+' on application load prior to any require("any-promise").')}return t}function shouldPreferGlobalPromise(e){if(e){return e==="global.Promise"}else if(typeof global.Promise!=="undefined"){var t=/v(\d+)\.(\d+)\.(\d+)/.exec(process.version);return!(t&&+t[1]==0&&+t[2]<12)}return false}function tryAutoDetect(){var e=["es6-promise","promise","native-promise-only","bluebird","rsvp","when","q","pinkie","lie","vow"];var t=0,r=e.length;for(;te(...t,...r)}function initialParams(e){return function(...t){var r=t.pop();return e.call(this,t,r)}}var t=typeof setImmediate==="function"&&setImmediate;var r=typeof process==="object"&&typeof process.nextTick==="function";function fallback(e){setTimeout(e,0)}function wrap(e){return(t,...r)=>e(()=>t(...r))}var n;if(t){n=setImmediate}else if(r){n=process.nextTick}else{n=fallback}var i=wrap(n);function asyncify(e){if(isAsync(e)){return function(...t){const r=t.pop();const n=e.apply(this,t);return handlePromise(n,r)}}return initialParams(function(t,r){var n;try{n=e.apply(this,t)}catch(e){return r(e)}if(n&&typeof n.then==="function"){return handlePromise(n,r)}else{r(null,n)}})}function handlePromise(e,t){return e.then(e=>{invokeCallback(t,null,e)},e=>{invokeCallback(t,e&&e.message?e:new Error(e))})}function invokeCallback(e,t,r){try{e(t,r)}catch(e){i(e=>{throw e},e)}}function isAsync(e){return e[Symbol.toStringTag]==="AsyncFunction"}function isAsyncGenerator(e){return e[Symbol.toStringTag]==="AsyncGenerator"}function isAsyncIterable(e){return typeof e[Symbol.asyncIterator]==="function"}function wrapAsync(e){if(typeof e!=="function")throw new Error("expected a function");return isAsync(e)?asyncify(e):e}function awaitify(e,t=e.length){if(!t)throw new Error("arity is undefined");function awaitable(...r){if(typeof r[t-1]==="function"){return e.apply(this,r)}return new Promise((n,i)=>{r[t-1]=((e,...t)=>{if(e)return i(e);n(t.length>1?t:t[0])});e.apply(this,r)})}return awaitable}function applyEach(e){return function applyEach(t,...r){const n=awaitify(function(n){var i=this;return e(t,(e,t)=>{wrapAsync(e).apply(i,r.concat(t))},n)});return n}}function _asyncMap(e,t,r,n){t=t||[];var i=[];var o=0;var c=wrapAsync(r);return e(t,(e,t,r)=>{var n=o++;c(e,(e,t)=>{i[n]=t;r(e)})},e=>{n(e,i)})}function isArrayLike(e){return e&&typeof e.length==="number"&&e.length>=0&&e.length%1===0}const o={};function once(e){function wrapper(...t){if(e===null)return;var r=e;e=null;r.apply(this,t)}Object.assign(wrapper,e);return wrapper}function getIterator(e){return e[Symbol.iterator]&&e[Symbol.iterator]()}function createArrayIterator(e){var t=-1;var r=e.length;return function next(){return++t=t||s||i)return;s=true;e.next().then(({value:e,done:t})=>{if(c||i)return;s=false;if(t){i=true;if(a<=0){n(null)}return}a++;r(e,u,iterateeCallback);u++;replenish()}).catch(handleError)}function iterateeCallback(e,t){a-=1;if(c)return;if(e)return handleError(e);if(e===false){i=true;c=true;return}if(t===o||i&&a<=0){i=true;return n(null)}replenish()}function handleError(e){if(c)return;s=false;i=true;n(e)}replenish()}var c=e=>{return(t,r,n)=>{n=once(n);if(e<=0){throw new RangeError("concurrency limit cannot be less than 1")}if(!t){return n(null)}if(isAsyncGenerator(t)){return asyncEachOfLimit(t,e,r,n)}if(isAsyncIterable(t)){return asyncEachOfLimit(t[Symbol.asyncIterator](),e,r,n)}var i=createIterator(t);var c=false;var s=false;var a=0;var u=false;function iterateeCallback(e,t){if(s)return;a-=1;if(e){c=true;n(e)}else if(e===false){c=true;s=true}else if(t===o||c&&a<=0){c=true;return n(null)}else if(!u){replenish()}}function replenish(){u=true;while(a1?n:n[0])}callback[m]=new Promise((r,n)=>{e=r,t=n});return callback}function auto(e,t,r){if(typeof t!=="number"){r=t;t=null}r=once(r||promiseCallback());var n=Object.keys(e).length;if(!n){return r(null)}if(!t){t=n}var i={};var o=0;var c=false;var s=false;var a=Object.create(null);var u=[];var f=[];var l={};Object.keys(e).forEach(t=>{var r=e[t];if(!Array.isArray(r)){enqueueTask(t,[r]);f.push(t);return}var n=r.slice(0,r.length-1);var i=n.length;if(i===0){enqueueTask(t,r);f.push(t);return}l[t]=i;n.forEach(o=>{if(!e[o]){throw new Error("async.auto task `"+t+"` has a non-existent dependency `"+o+"` in "+n.join(", "))}addListener(o,()=>{i--;if(i===0){enqueueTask(t,r)}})})});checkForDeadlocks();processQueue();function enqueueTask(e,t){u.push(()=>runTask(e,t))}function processQueue(){if(c)return;if(u.length===0&&o===0){return r(null,i)}while(u.length&&oe());processQueue()}function runTask(e,t){if(s)return;var n=onlyOnce((t,...n)=>{o--;if(t===false){c=true;return}if(n.length<2){[n]=n}if(t){var u={};Object.keys(i).forEach(e=>{u[e]=i[e]});u[e]=n;s=true;a=Object.create(null);if(c)return;r(t,u)}else{i[e]=n;taskComplete(e)}});o++;var u=wrapAsync(t[t.length-1]);if(t.length>1){u(i,n)}else{u(n)}}function checkForDeadlocks(){var e;var t=0;while(f.length){e=f.pop();t++;getDependents(e).forEach(e=>{if(--l[e]===0){f.push(e)}})}if(t!==n){throw new Error("async.auto cannot execute tasks due to a recursive dependency")}}function getDependents(t){var r=[];Object.keys(e).forEach(n=>{const i=e[n];if(Array.isArray(i)&&i.indexOf(t)>=0){r.push(n)}});return r}return r[m]}var h=/^(?:async\s+)?(?:function)?\s*\w*\s*\(\s*([^)]+)\s*\)(?:\s*{)/;var d=/^(?:async\s+)?\(?\s*([^)=]+)\s*\)?(?:\s*=>)/;var v=/,/;var S=/(=.+)?(\s*)$/;var w=/((\/\/.*$)|(\/\*[\s\S]*?\*\/))/gm;function parseParams(e){const t=e.toString().replace(w,"");let r=t.match(h);if(!r){r=t.match(d)}if(!r)throw new Error("could not parse args in autoInject\nSource:\n"+t);let[,n]=r;return n.replace(/\s/g,"").split(v).map(e=>e.replace(S,"").trim())}function autoInject(e,t){var r={};Object.keys(e).forEach(t=>{var n=e[t];var i;var o=isAsync(n);var c=!o&&n.length===1||o&&n.length===0;if(Array.isArray(n)){i=[...n];n=i.pop();r[t]=i.concat(i.length>0?newTask:n)}else if(c){r[t]=n}else{i=parseParams(n);if(n.length===0&&!o&&i.length===0){throw new Error("autoInject task functions require explicit parameters.")}if(!o)i.pop();r[t]=i.concat(newTask)}function newTask(e,t){var r=i.map(t=>e[t]);r.push(t);wrapAsync(n)(...r)}});return auto(r,t)}class DLL{constructor(){this.head=this.tail=null;this.length=0}removeLink(e){if(e.prev)e.prev.next=e.next;else this.head=e.next;if(e.next)e.next.prev=e.prev;else this.tail=e.prev;e.prev=e.next=null;this.length-=1;return e}empty(){while(this.head)this.shift();return this}insertAfter(e,t){t.prev=e;t.next=e.next;if(e.next)e.next.prev=t;else this.tail=t;e.next=t;this.length+=1}insertBefore(e,t){t.prev=e.prev;t.next=e;if(e.prev)e.prev.next=t;else this.head=t;e.prev=t;this.length+=1}unshift(e){if(this.head)this.insertBefore(this.head,e);else setInitial(this,e)}push(e){if(this.tail)this.insertAfter(this.tail,e);else setInitial(this,e)}shift(){return this.head&&this.removeLink(this.head)}pop(){return this.tail&&this.removeLink(this.tail)}toArray(){return[...this]}*[Symbol.iterator](){var e=this.head;while(e){yield e.data;e=e.next}}remove(e){var t=this.head;while(t){var{next:r}=t;if(e(t)){this.removeLink(t)}t=r}return this}}function setInitial(e,t){e.length=1;e.head=e.tail=t}function queue(e,t,r){if(t==null){t=1}else if(t===0){throw new RangeError("Concurrency must not be zero")}var n=wrapAsync(e);var o=0;var c=[];const s={error:[],drain:[],saturated:[],unsaturated:[],empty:[]};function on(e,t){s[e].push(t)}function once(e,t){const r=(...n)=>{off(e,r);t(...n)};s[e].push(r)}function off(e,t){if(!e)return Object.keys(s).forEach(e=>s[e]=[]);if(!t)return s[e]=[];s[e]=s[e].filter(e=>e!==t)}function trigger(e,...t){s[e].forEach(e=>e(...t))}var a=false;function _insert(e,t,r,n){if(n!=null&&typeof n!=="function"){throw new Error("task callback must be a function")}l.started=true;var o,c;function promiseCallback(e,...t){if(e)return r?c(e):o();if(t.length<=1)return o(t[0]);o(t)}var s={data:e,callback:r?promiseCallback:n||promiseCallback};if(t){l._tasks.unshift(s)}else{l._tasks.push(s)}if(!a){a=true;i(()=>{a=false;l.process()})}if(r||!n){return new Promise((e,t)=>{o=e;c=t})}}function _createCB(e){return function(t,...r){o-=1;for(var n=0,i=e.length;n0){c.splice(a,1)}s.callback(t,...r);if(t!=null){trigger("error",t,s.data)}}if(o<=l.concurrency-l.buffer){trigger("unsaturated")}if(l.idle()){trigger("drain")}l.process()}}function _maybeDrain(e){if(e.length===0&&l.idle()){i(()=>trigger("drain"));return true}return false}const u=e=>t=>{if(!t){return new Promise((t,r)=>{once(e,(e,n)=>{if(e)return r(e);t(n)})})}off(e);on(e,t)};var f=false;var l={_tasks:new DLL,*[Symbol.iterator](){yield*l._tasks[Symbol.iterator]()},concurrency:t,payload:r,buffer:t/4,started:false,paused:false,push(e,t){if(Array.isArray(e)){if(_maybeDrain(e))return;return e.map(e=>_insert(e,false,false,t))}return _insert(e,false,false,t)},pushAsync(e,t){if(Array.isArray(e)){if(_maybeDrain(e))return;return e.map(e=>_insert(e,false,true,t))}return _insert(e,false,true,t)},kill(){off();l._tasks.empty()},unshift(e,t){if(Array.isArray(e)){if(_maybeDrain(e))return;return e.map(e=>_insert(e,true,false,t))}return _insert(e,true,false,t)},unshiftAsync(e,t){if(Array.isArray(e)){if(_maybeDrain(e))return;return e.map(e=>_insert(e,true,true,t))}return _insert(e,true,true,t)},remove(e){l._tasks.remove(e)},process(){if(f){return}f=true;while(!l.paused&&o{i(t,e,(e,r)=>{t=r;n(e)})},e=>n(e,t))}var g=awaitify(reduce,4);function seq(...e){var t=e.map(wrapAsync);return function(...e){var r=this;var n=e[e.length-1];if(typeof n=="function"){e.pop()}else{n=promiseCallback()}g(t,e,(e,t,n)=>{t.apply(r,e.concat((e,...t)=>{n(e,t)}))},(e,t)=>n(e,...t));return n[m]}}function compose(...e){return seq(...e.reverse())}function mapLimit(e,t,r,n){return _asyncMap(c(t),e,r,n)}var E=awaitify(mapLimit,4);function concatLimit(e,t,r,n){var i=wrapAsync(r);return E(e,t,(e,t)=>{i(e,(e,...r)=>{if(e)return t(e);return t(e,r)})},(e,t)=>{var r=[];for(var i=0;i{var s=false;var a;const u=wrapAsync(i);r(n,(r,n,i)=>{u(r,(n,c)=>{if(n||n===false)return i(n);if(e(c)&&!a){s=true;a=t(true,r);return i(null,o)}i()})},e=>{if(e)return c(e);c(null,s?a:t(false))})}}function detect(e,t,r){return _createTester(e=>e,(e,t)=>t)(a,e,t,r)}var O=awaitify(detect,3);function detectLimit(e,t,r,n){return _createTester(e=>e,(e,t)=>t)(c(t),e,r,n)}var A=awaitify(detectLimit,4);function detectSeries(e,t,r){return _createTester(e=>e,(e,t)=>t)(c(1),e,t,r)}var F=awaitify(detectSeries,3);function consoleFunc(e){return(t,...r)=>wrapAsync(t)(...r,(t,...r)=>{if(typeof console==="object"){if(t){if(console.error){console.error(t)}}else if(console[e]){r.forEach(t=>console[e](t))}}})}var P=consoleFunc("dir");function doWhilst(e,t,r){r=onlyOnce(r);var n=wrapAsync(e);var i=wrapAsync(t);var o;function next(e,...t){if(e)return r(e);if(e===false)return;o=t;i(...t,check)}function check(e,t){if(e)return r(e);if(e===false)return;if(!t)return r(null,...o);n(next)}return check(null,true)}var _=awaitify(doWhilst,3);function doUntil(e,t,r){const n=wrapAsync(t);return _(e,(...e)=>{const t=e.pop();n(...e,(e,r)=>t(e,!r))},r)}function _withoutIndex(e){return(t,r,n)=>e(t,n)}function eachLimit(e,t,r){return a(e,_withoutIndex(wrapAsync(t)),r)}var L=awaitify(eachLimit,3);function eachLimit$1(e,t,r,n){return c(t)(e,_withoutIndex(wrapAsync(r)),n)}var C=awaitify(eachLimit$1,4);function eachSeries(e,t,r){return C(e,1,t,r)}var D=awaitify(eachSeries,3);function ensureAsync(e){if(isAsync(e))return e;return function(...t){var r=t.pop();var n=true;t.push((...e)=>{if(n){i(()=>r(...e))}else{r(...e)}});e.apply(this,t);n=false}}function every(e,t,r){return _createTester(e=>!e,e=>!e)(a,e,t,r)}var j=awaitify(every,3);function everyLimit(e,t,r,n){return _createTester(e=>!e,e=>!e)(c(t),e,r,n)}var I=awaitify(everyLimit,4);function everySeries(e,t,r){return _createTester(e=>!e,e=>!e)(l,e,t,r)}var N=awaitify(everySeries,3);function filterArray(e,t,r,n){var i=new Array(t.length);e(t,(e,t,n)=>{r(e,(e,r)=>{i[t]=!!r;n(e)})},e=>{if(e)return n(e);var r=[];for(var o=0;o{r(e,(r,o)=>{if(r)return n(r);if(o){i.push({index:t,value:e})}n(r)})},e=>{if(e)return n(e);n(null,i.sort((e,t)=>e.index-t.index).map(e=>e.value))})}function _filter(e,t,r,n){var i=isArrayLike(t)?filterArray:filterGeneric;return i(e,t,wrapAsync(r),n)}function filter(e,t,r){return _filter(a,e,t,r)}var T=awaitify(filter,3);function filterLimit(e,t,r,n){return _filter(c(t),e,r,n)}var M=awaitify(filterLimit,4);function filterSeries(e,t,r){return _filter(l,e,t,r)}var $=awaitify(filterSeries,3);function forever(e,t){var r=onlyOnce(t);var n=wrapAsync(ensureAsync(e));function next(e){if(e)return r(e);if(e===false)return;n(next)}return next()}var R=awaitify(forever,2);function groupByLimit(e,t,r,n){var i=wrapAsync(r);return E(e,t,(e,t)=>{i(e,(r,n)=>{if(r)return t(r);return t(r,{key:n,val:e})})},(e,t)=>{var r={};var{hasOwnProperty:i}=Object.prototype;for(var o=0;o{o(e,t,(e,n)=>{if(e)return r(e);i[t]=n;r(e)})},e=>n(e,i))}var q=awaitify(mapValuesLimit,4);function mapValues(e,t,r){return q(e,Infinity,t,r)}function mapValuesSeries(e,t,r){return q(e,1,t,r)}function memoize(e,t=(e=>e)){var r=Object.create(null);var n=Object.create(null);var o=wrapAsync(e);var c=initialParams((e,c)=>{var s=t(...e);if(s in r){i(()=>c(null,...r[s]))}else if(s in n){n[s].push(c)}else{n[s]=[c];o(...e,(e,...t)=>{if(!e){r[s]=t}var i=n[s];delete n[s];for(var o=0,c=i.length;o{var n=isArrayLike(t)?[]:{};e(t,(e,t,r)=>{wrapAsync(e)((e,...i)=>{if(i.length<2){[i]=i}n[t]=i;r(e)})},e=>r(e,n))},3);function parallel$1(e,t){return V(a,e,t)}function parallelLimit(e,t,r){return V(c(t),e,r)}function queue$1(e,t){var r=wrapAsync(e);return queue((e,t)=>{r(e[0],t)},t,1)}class Heap{constructor(){this.heap=[];this.pushCount=Number.MIN_SAFE_INTEGER}get length(){return this.heap.length}empty(){this.heap=[];return this}percUp(e){let t;while(e>0&&smaller(this.heap[e],this.heap[t=parent(e)])){let r=this.heap[e];this.heap[e]=this.heap[t];this.heap[t]=r;e=t}}percDown(e){let t;while((t=leftChi(e))=0;e--){this.percDown(e)}return this}}function leftChi(e){return(e<<1)+1}function parent(e){return(e+1>>1)-1}function smaller(e,t){if(e.priority!==t.priority){return e.priority{})){if(typeof n!=="function"){throw new Error("task callback must be a function")}r.started=true;if(!Array.isArray(e)){e=[e]}if(e.length===0&&r.idle()){return i(()=>r.drain())}for(var o=0,c=e.length;o{let n={};if(e){n.error=e}if(t.length>0){var i=t;if(t.length<=1){[i]=t}n.value=i}r(null,n)});return t.apply(this,e)})}function reflectAll(e){var t;if(Array.isArray(e)){t=e.map(reflect)}else{t={};Object.keys(e).forEach(r=>{t[r]=reflect.call(this,e[r])})}return t}function reject(e,t,r,n){const i=wrapAsync(r);return _filter(e,t,(e,t)=>{i(e,(e,r)=>{t(e,!r)})},n)}function reject$1(e,t,r){return reject(a,e,t,r)}var z=awaitify(reject$1,3);function rejectLimit(e,t,r,n){return reject(c(t),e,r,n)}var Y=awaitify(rejectLimit,4);function rejectSeries(e,t,r){return reject(l,e,t,r)}var Q=awaitify(rejectSeries,3);function constant$1(e){return function(){return e}}const H=5;const K=0;function retry(e,t,r){var n={times:H,intervalFunc:constant$1(K)};if(arguments.length<3&&typeof e==="function"){r=t||promiseCallback();t=e}else{parseTimes(n,e);r=r||promiseCallback()}if(typeof t!=="function"){throw new Error("Invalid arguments for async.retry")}var i=wrapAsync(t);var o=1;function retryAttempt(){i((e,...t)=>{if(e===false)return;if(e&&o++{if(t.lengthe)(a,e,t,r)}var X=awaitify(some,3);function someLimit(e,t,r,n){return _createTester(Boolean,e=>e)(c(t),e,r,n)}var Z=awaitify(someLimit,4);function someSeries(e,t,r){return _createTester(Boolean,e=>e)(l,e,t,r)}var ee=awaitify(someSeries,3);function sortBy(e,t,r){var n=wrapAsync(t);return u(e,(e,t)=>{n(e,(r,n)=>{if(r)return t(r);t(r,{value:e,criteria:n})})},(e,t)=>{if(e)return r(e);r(null,t.sort(comparator).map(e=>e.value))});function comparator(e,t){var r=e.criteria,n=t.criteria;return rn?1:0}}var te=awaitify(sortBy,3);function timeout(e,t,r){var n=wrapAsync(e);return initialParams((i,o)=>{var c=false;var s;function timeoutCallback(){var t=e.name||"anonymous";var n=new Error('Callback function "'+t+'" timed out.');n.code="ETIMEDOUT";if(r){n.info=r}c=true;o(n)}i.push((...e)=>{if(!c){o(...e);clearTimeout(s)}});s=setTimeout(timeoutCallback,t);n(...i)})}function range(e){var t=Array(e);while(e--){t[e]=e}return t}function timesLimit(e,t,r,n){var i=wrapAsync(r);return E(range(e),t,i,n)}function times(e,t,r){return timesLimit(e,Infinity,t,r)}function timesSeries(e,t,r){return timesLimit(e,1,t,r)}function transform(e,t,r,n){if(arguments.length<=3&&typeof t==="function"){n=r;r=t;t=Array.isArray(e)?[]:{}}n=once(n||promiseCallback());var i=wrapAsync(r);a(e,(e,r,n)=>{i(t,e,r,n)},e=>n(e,t));return n[m]}function tryEach(e,t){var r=null;var n;return D(e,(e,t)=>{wrapAsync(e)((e,...i)=>{if(e===false)return t(e);if(i.length<2){[n]=i}else{n=i}r=e;t(e?null:{})})},()=>t(r,n))}var re=awaitify(tryEach);function unmemoize(e){return(...t)=>{return(e.unmemoized||e)(...t)}}function whilst(e,t,r){r=onlyOnce(r);var n=wrapAsync(t);var i=wrapAsync(e);var o=[];function next(e,...t){if(e)return r(e);o=t;if(e===false)return;i(check)}function check(e,t){if(e)return r(e);if(e===false)return;if(!t)return r(null,...o);n(next)}return i(check)}var ne=awaitify(whilst,3);function until(e,t,r){const n=wrapAsync(e);return ne(e=>n((t,r)=>e(t,!r)),t,r)}function waterfall(e,t){t=once(t);if(!Array.isArray(e))return t(new Error("First argument to waterfall must be an array of functions"));if(!e.length)return t();var r=0;function nextTask(t){var n=wrapAsync(e[r++]);n(...t,onlyOnce(next))}function next(n,...i){if(n===false)return;if(n||r===e.length){return t(n,...i)}nextTask(i)}nextTask([])}var ie=awaitify(waterfall);var oe={apply:apply,applyEach:f,applyEachSeries:y,asyncify:asyncify,auto:auto,autoInject:autoInject,cargo:cargo,cargoQueue:cargo$1,compose:compose,concat:b,concatLimit:k,concatSeries:x,constant:constant,detect:O,detectLimit:A,detectSeries:F,dir:P,doUntil:doUntil,doWhilst:_,each:L,eachLimit:C,eachOf:a,eachOfLimit:s,eachOfSeries:l,eachSeries:D,ensureAsync:ensureAsync,every:j,everyLimit:I,everySeries:N,filter:T,filterLimit:M,filterSeries:$,forever:R,groupBy:groupBy,groupByLimit:B,groupBySeries:groupBySeries,log:W,map:u,mapLimit:E,mapSeries:p,mapValues:mapValues,mapValuesLimit:q,mapValuesSeries:mapValuesSeries,memoize:memoize,nextTick:J,parallel:parallel$1,parallelLimit:parallelLimit,priorityQueue:priorityQueue,queue:queue$1,race:U,reduce:g,reduceRight:reduceRight,reflect:reflect,reflectAll:reflectAll,reject:z,rejectLimit:Y,rejectSeries:Q,retry:retry,retryable:retryable,seq:seq,series:series,setImmediate:i,some:X,someLimit:Z,someSeries:ee,sortBy:te,timeout:timeout,times:times,timesLimit:timesLimit,timesSeries:timesSeries,transform:transform,tryEach:re,unmemoize:unmemoize,until:until,waterfall:ie,whilst:ne,all:j,allLimit:I,allSeries:N,any:X,anyLimit:Z,anySeries:ee,find:O,findLimit:A,findSeries:F,flatMap:b,flatMapLimit:k,flatMapSeries:x,forEach:L,forEachSeries:D,forEachLimit:C,forEachOf:a,forEachOfSeries:l,forEachOfLimit:s,inject:g,foldl:g,foldr:reduceRight,select:T,selectLimit:M,selectSeries:$,wrapSync:asyncify,during:ne,doDuring:_};e.default=oe;e.apply=apply;e.applyEach=f;e.applyEachSeries=y;e.asyncify=asyncify;e.auto=auto;e.autoInject=autoInject;e.cargo=cargo;e.cargoQueue=cargo$1;e.compose=compose;e.concat=b;e.concatLimit=k;e.concatSeries=x;e.constant=constant;e.detect=O;e.detectLimit=A;e.detectSeries=F;e.dir=P;e.doUntil=doUntil;e.doWhilst=_;e.each=L;e.eachLimit=C;e.eachOf=a;e.eachOfLimit=s;e.eachOfSeries=l;e.eachSeries=D;e.ensureAsync=ensureAsync;e.every=j;e.everyLimit=I;e.everySeries=N;e.filter=T;e.filterLimit=M;e.filterSeries=$;e.forever=R;e.groupBy=groupBy;e.groupByLimit=B;e.groupBySeries=groupBySeries;e.log=W;e.map=u;e.mapLimit=E;e.mapSeries=p;e.mapValues=mapValues;e.mapValuesLimit=q;e.mapValuesSeries=mapValuesSeries;e.memoize=memoize;e.nextTick=J;e.parallel=parallel$1;e.parallelLimit=parallelLimit;e.priorityQueue=priorityQueue;e.queue=queue$1;e.race=U;e.reduce=g;e.reduceRight=reduceRight;e.reflect=reflect;e.reflectAll=reflectAll;e.reject=z;e.rejectLimit=Y;e.rejectSeries=Q;e.retry=retry;e.retryable=retryable;e.seq=seq;e.series=series;e.setImmediate=i;e.some=X;e.someLimit=Z;e.someSeries=ee;e.sortBy=te;e.timeout=timeout;e.times=times;e.timesLimit=timesLimit;e.timesSeries=timesSeries;e.transform=transform;e.tryEach=re;e.unmemoize=unmemoize;e.until=until;e.waterfall=ie;e.whilst=ne;e.all=j;e.allLimit=I;e.allSeries=N;e.any=X;e.anyLimit=Z;e.anySeries=ee;e.find=O;e.findLimit=A;e.findSeries=F;e.flatMap=b;e.flatMapLimit=k;e.flatMapSeries=x;e.forEach=L;e.forEachSeries=D;e.forEachLimit=C;e.forEachOf=a;e.forEachOfSeries=l;e.forEachOfLimit=s;e.inject=g;e.foldl=g;e.foldr=reduceRight;e.select=T;e.selectLimit=M;e.selectSeries=$;e.wrapSync=asyncify;e.during=ne;e.doDuring=_;Object.defineProperty(e,"__esModule",{value:true})})},5995:e=>{e.exports=(e=>{const t=process.versions.node.split(".").map(e=>parseInt(e,10));e=e.split(".").map(e=>parseInt(e,10));return t[0]>e[0]||t[0]===e[0]&&(t[1]>e[1]||t[1]===e[1]&&t[2]>=e[2])})},3338:(e,t,r)=>{"use strict";const n=r(7758);const i=r(5622);const o=r(8605).mkdirsSync;const c=r(2548).utimesMillisSync;const s=r(3901);function copySync(e,t,r){if(typeof r==="function"){r={filter:r}}r=r||{};r.clobber="clobber"in r?!!r.clobber:true;r.overwrite="overwrite"in r?!!r.overwrite:r.clobber;if(r.preserveTimestamps&&process.arch==="ia32"){console.warn(`fs-extra: Using the preserveTimestamps option in 32-bit node is not recommended;\n\n see https://github.com/jprichardson/node-fs-extra/issues/269`)}const{srcStat:n,destStat:i}=s.checkPathsSync(e,t,"copy");s.checkParentPathsSync(e,n,t,"copy");return handleFilterAndCopy(i,e,t,r)}function handleFilterAndCopy(e,t,r,c){if(c.filter&&!c.filter(t,r))return;const s=i.dirname(r);if(!n.existsSync(s))o(s);return startCopy(e,t,r,c)}function startCopy(e,t,r,n){if(n.filter&&!n.filter(t,r))return;return getStats(e,t,r,n)}function getStats(e,t,r,i){const o=i.dereference?n.statSync:n.lstatSync;const c=o(t);if(c.isDirectory())return onDir(c,e,t,r,i);else if(c.isFile()||c.isCharacterDevice()||c.isBlockDevice())return onFile(c,e,t,r,i);else if(c.isSymbolicLink())return onLink(e,t,r,i)}function onFile(e,t,r,n,i){if(!t)return copyFile(e,r,n,i);return mayCopyFile(e,r,n,i)}function mayCopyFile(e,t,r,i){if(i.overwrite){n.unlinkSync(r);return copyFile(e,t,r,i)}else if(i.errorOnExist){throw new Error(`'${r}' already exists`)}}function copyFile(e,t,r,i){n.copyFileSync(t,r);if(i.preserveTimestamps)handleTimestamps(e.mode,t,r);return setDestMode(r,e.mode)}function handleTimestamps(e,t,r){if(fileIsNotWritable(e))makeFileWritable(r,e);return setDestTimestamps(t,r)}function fileIsNotWritable(e){return(e&128)===0}function makeFileWritable(e,t){return setDestMode(e,t|128)}function setDestMode(e,t){return n.chmodSync(e,t)}function setDestTimestamps(e,t){const r=n.statSync(e);return c(t,r.atime,r.mtime)}function onDir(e,t,r,n,i){if(!t)return mkDirAndCopy(e.mode,r,n,i);if(t&&!t.isDirectory()){throw new Error(`Cannot overwrite non-directory '${n}' with directory '${r}'.`)}return copyDir(r,n,i)}function mkDirAndCopy(e,t,r,i){n.mkdirSync(r);copyDir(t,r,i);return setDestMode(r,e)}function copyDir(e,t,r){n.readdirSync(e).forEach(n=>copyDirItem(n,e,t,r))}function copyDirItem(e,t,r,n){const o=i.join(t,e);const c=i.join(r,e);const{destStat:a}=s.checkPathsSync(o,c,"copy");return startCopy(a,o,c,n)}function onLink(e,t,r,o){let c=n.readlinkSync(t);if(o.dereference){c=i.resolve(process.cwd(),c)}if(!e){return n.symlinkSync(c,r)}else{let e;try{e=n.readlinkSync(r)}catch(e){if(e.code==="EINVAL"||e.code==="UNKNOWN")return n.symlinkSync(c,r);throw e}if(o.dereference){e=i.resolve(process.cwd(),e)}if(s.isSrcSubdir(c,e)){throw new Error(`Cannot copy '${c}' to a subdirectory of itself, '${e}'.`)}if(n.statSync(r).isDirectory()&&s.isSrcSubdir(e,c)){throw new Error(`Cannot overwrite '${e}' with '${c}'.`)}return copyLink(c,r)}}function copyLink(e,t){n.unlinkSync(t);return n.symlinkSync(e,t)}e.exports=copySync},1135:(e,t,r)=>{"use strict";e.exports={copySync:r(3338)}},8834:(e,t,r)=>{"use strict";const n=r(7758);const i=r(5622);const o=r(8605).mkdirs;const c=r(3835).pathExists;const s=r(2548).utimesMillis;const a=r(3901);function copy(e,t,r,n){if(typeof r==="function"&&!n){n=r;r={}}else if(typeof r==="function"){r={filter:r}}n=n||function(){};r=r||{};r.clobber="clobber"in r?!!r.clobber:true;r.overwrite="overwrite"in r?!!r.overwrite:r.clobber;if(r.preserveTimestamps&&process.arch==="ia32"){console.warn(`fs-extra: Using the preserveTimestamps option in 32-bit node is not recommended;\n\n see https://github.com/jprichardson/node-fs-extra/issues/269`)}a.checkPaths(e,t,"copy",(i,o)=>{if(i)return n(i);const{srcStat:c,destStat:s}=o;a.checkParentPaths(e,c,t,"copy",i=>{if(i)return n(i);if(r.filter)return handleFilter(checkParentDir,s,e,t,r,n);return checkParentDir(s,e,t,r,n)})})}function checkParentDir(e,t,r,n,s){const a=i.dirname(r);c(a,(i,c)=>{if(i)return s(i);if(c)return startCopy(e,t,r,n,s);o(a,i=>{if(i)return s(i);return startCopy(e,t,r,n,s)})})}function handleFilter(e,t,r,n,i,o){Promise.resolve(i.filter(r,n)).then(c=>{if(c)return e(t,r,n,i,o);return o()},e=>o(e))}function startCopy(e,t,r,n,i){if(n.filter)return handleFilter(getStats,e,t,r,n,i);return getStats(e,t,r,n,i)}function getStats(e,t,r,i,o){const c=i.dereference?n.stat:n.lstat;c(t,(n,c)=>{if(n)return o(n);if(c.isDirectory())return onDir(c,e,t,r,i,o);else if(c.isFile()||c.isCharacterDevice()||c.isBlockDevice())return onFile(c,e,t,r,i,o);else if(c.isSymbolicLink())return onLink(e,t,r,i,o)})}function onFile(e,t,r,n,i,o){if(!t)return copyFile(e,r,n,i,o);return mayCopyFile(e,r,n,i,o)}function mayCopyFile(e,t,r,i,o){if(i.overwrite){n.unlink(r,n=>{if(n)return o(n);return copyFile(e,t,r,i,o)})}else if(i.errorOnExist){return o(new Error(`'${r}' already exists`))}else return o()}function copyFile(e,t,r,i,o){n.copyFile(t,r,n=>{if(n)return o(n);if(i.preserveTimestamps)return handleTimestampsAndMode(e.mode,t,r,o);return setDestMode(r,e.mode,o)})}function handleTimestampsAndMode(e,t,r,n){if(fileIsNotWritable(e)){return makeFileWritable(r,e,i=>{if(i)return n(i);return setDestTimestampsAndMode(e,t,r,n)})}return setDestTimestampsAndMode(e,t,r,n)}function fileIsNotWritable(e){return(e&128)===0}function makeFileWritable(e,t,r){return setDestMode(e,t|128,r)}function setDestTimestampsAndMode(e,t,r,n){setDestTimestamps(t,r,t=>{if(t)return n(t);return setDestMode(r,e,n)})}function setDestMode(e,t,r){return n.chmod(e,t,r)}function setDestTimestamps(e,t,r){n.stat(e,(e,n)=>{if(e)return r(e);return s(t,n.atime,n.mtime,r)})}function onDir(e,t,r,n,i,o){if(!t)return mkDirAndCopy(e.mode,r,n,i,o);if(t&&!t.isDirectory()){return o(new Error(`Cannot overwrite non-directory '${n}' with directory '${r}'.`))}return copyDir(r,n,i,o)}function mkDirAndCopy(e,t,r,i,o){n.mkdir(r,n=>{if(n)return o(n);copyDir(t,r,i,t=>{if(t)return o(t);return setDestMode(r,e,o)})})}function copyDir(e,t,r,i){n.readdir(e,(n,o)=>{if(n)return i(n);return copyDirItems(o,e,t,r,i)})}function copyDirItems(e,t,r,n,i){const o=e.pop();if(!o)return i();return copyDirItem(e,o,t,r,n,i)}function copyDirItem(e,t,r,n,o,c){const s=i.join(r,t);const u=i.join(n,t);a.checkPaths(s,u,"copy",(t,i)=>{if(t)return c(t);const{destStat:a}=i;startCopy(a,s,u,o,t=>{if(t)return c(t);return copyDirItems(e,r,n,o,c)})})}function onLink(e,t,r,o,c){n.readlink(t,(t,s)=>{if(t)return c(t);if(o.dereference){s=i.resolve(process.cwd(),s)}if(!e){return n.symlink(s,r,c)}else{n.readlink(r,(t,u)=>{if(t){if(t.code==="EINVAL"||t.code==="UNKNOWN")return n.symlink(s,r,c);return c(t)}if(o.dereference){u=i.resolve(process.cwd(),u)}if(a.isSrcSubdir(s,u)){return c(new Error(`Cannot copy '${s}' to a subdirectory of itself, '${u}'.`))}if(e.isDirectory()&&a.isSrcSubdir(u,s)){return c(new Error(`Cannot overwrite '${u}' with '${s}'.`))}return copyLink(s,r,c)})}})}function copyLink(e,t,r){n.unlink(t,i=>{if(i)return r(i);return n.symlink(e,t,r)})}e.exports=copy},1335:(e,t,r)=>{"use strict";const n=r(9046).E;e.exports={copy:n(r(8834))}},6970:(e,t,r)=>{"use strict";const n=r(9046).E;const i=r(7758);const o=r(5622);const c=r(8605);const s=r(7357);const a=n(function emptyDir(e,t){t=t||function(){};i.readdir(e,(r,n)=>{if(r)return c.mkdirs(e,t);n=n.map(t=>o.join(e,t));deleteItem();function deleteItem(){const e=n.pop();if(!e)return t();s.remove(e,e=>{if(e)return t(e);deleteItem()})}})});function emptyDirSync(e){let t;try{t=i.readdirSync(e)}catch{return c.mkdirsSync(e)}t.forEach(t=>{t=o.join(e,t);s.removeSync(t)})}e.exports={emptyDirSync:emptyDirSync,emptydirSync:emptyDirSync,emptyDir:a,emptydir:a}},2164:(e,t,r)=>{"use strict";const n=r(9046).E;const i=r(5622);const o=r(7758);const c=r(8605);function createFile(e,t){function makeFile(){o.writeFile(e,"",e=>{if(e)return t(e);t()})}o.stat(e,(r,n)=>{if(!r&&n.isFile())return t();const s=i.dirname(e);o.stat(s,(e,r)=>{if(e){if(e.code==="ENOENT"){return c.mkdirs(s,e=>{if(e)return t(e);makeFile()})}return t(e)}if(r.isDirectory())makeFile();else{o.readdir(s,e=>{if(e)return t(e)})}})})}function createFileSync(e){let t;try{t=o.statSync(e)}catch{}if(t&&t.isFile())return;const r=i.dirname(e);try{if(!o.statSync(r).isDirectory()){o.readdirSync(r)}}catch(e){if(e&&e.code==="ENOENT")c.mkdirsSync(r);else throw e}o.writeFileSync(e,"")}e.exports={createFile:n(createFile),createFileSync:createFileSync}},55:(e,t,r)=>{"use strict";const n=r(2164);const i=r(3797);const o=r(2549);e.exports={createFile:n.createFile,createFileSync:n.createFileSync,ensureFile:n.createFile,ensureFileSync:n.createFileSync,createLink:i.createLink,createLinkSync:i.createLinkSync,ensureLink:i.createLink,ensureLinkSync:i.createLinkSync,createSymlink:o.createSymlink,createSymlinkSync:o.createSymlinkSync,ensureSymlink:o.createSymlink,ensureSymlinkSync:o.createSymlinkSync}},3797:(e,t,r)=>{"use strict";const n=r(9046).E;const i=r(5622);const o=r(7758);const c=r(8605);const s=r(3835).pathExists;function createLink(e,t,r){function makeLink(e,t){o.link(e,t,e=>{if(e)return r(e);r(null)})}s(t,(n,a)=>{if(n)return r(n);if(a)return r(null);o.lstat(e,n=>{if(n){n.message=n.message.replace("lstat","ensureLink");return r(n)}const o=i.dirname(t);s(o,(n,i)=>{if(n)return r(n);if(i)return makeLink(e,t);c.mkdirs(o,n=>{if(n)return r(n);makeLink(e,t)})})})})}function createLinkSync(e,t){const r=o.existsSync(t);if(r)return undefined;try{o.lstatSync(e)}catch(e){e.message=e.message.replace("lstat","ensureLink");throw e}const n=i.dirname(t);const s=o.existsSync(n);if(s)return o.linkSync(e,t);c.mkdirsSync(n);return o.linkSync(e,t)}e.exports={createLink:n(createLink),createLinkSync:createLinkSync}},3727:(e,t,r)=>{"use strict";const n=r(5622);const i=r(7758);const o=r(3835).pathExists;function symlinkPaths(e,t,r){if(n.isAbsolute(e)){return i.lstat(e,t=>{if(t){t.message=t.message.replace("lstat","ensureSymlink");return r(t)}return r(null,{toCwd:e,toDst:e})})}else{const c=n.dirname(t);const s=n.join(c,e);return o(s,(t,o)=>{if(t)return r(t);if(o){return r(null,{toCwd:s,toDst:e})}else{return i.lstat(e,t=>{if(t){t.message=t.message.replace("lstat","ensureSymlink");return r(t)}return r(null,{toCwd:e,toDst:n.relative(c,e)})})}})}}function symlinkPathsSync(e,t){let r;if(n.isAbsolute(e)){r=i.existsSync(e);if(!r)throw new Error("absolute srcpath does not exist");return{toCwd:e,toDst:e}}else{const o=n.dirname(t);const c=n.join(o,e);r=i.existsSync(c);if(r){return{toCwd:c,toDst:e}}else{r=i.existsSync(e);if(!r)throw new Error("relative srcpath does not exist");return{toCwd:e,toDst:n.relative(o,e)}}}}e.exports={symlinkPaths:symlinkPaths,symlinkPathsSync:symlinkPathsSync}},8254:(e,t,r)=>{"use strict";const n=r(7758);function symlinkType(e,t,r){r=typeof t==="function"?t:r;t=typeof t==="function"?false:t;if(t)return r(null,t);n.lstat(e,(e,n)=>{if(e)return r(null,"file");t=n&&n.isDirectory()?"dir":"file";r(null,t)})}function symlinkTypeSync(e,t){let r;if(t)return t;try{r=n.lstatSync(e)}catch{return"file"}return r&&r.isDirectory()?"dir":"file"}e.exports={symlinkType:symlinkType,symlinkTypeSync:symlinkTypeSync}},2549:(e,t,r)=>{"use strict";const n=r(9046).E;const i=r(5622);const o=r(7758);const c=r(8605);const s=c.mkdirs;const a=c.mkdirsSync;const u=r(3727);const f=u.symlinkPaths;const l=u.symlinkPathsSync;const p=r(8254);const y=p.symlinkType;const m=p.symlinkTypeSync;const h=r(3835).pathExists;function createSymlink(e,t,r,n){n=typeof r==="function"?r:n;r=typeof r==="function"?false:r;h(t,(c,a)=>{if(c)return n(c);if(a)return n(null);f(e,t,(c,a)=>{if(c)return n(c);e=a.toDst;y(a.toCwd,r,(r,c)=>{if(r)return n(r);const a=i.dirname(t);h(a,(r,i)=>{if(r)return n(r);if(i)return o.symlink(e,t,c,n);s(a,r=>{if(r)return n(r);o.symlink(e,t,c,n)})})})})})}function createSymlinkSync(e,t,r){const n=o.existsSync(t);if(n)return undefined;const c=l(e,t);e=c.toDst;r=m(c.toCwd,r);const s=i.dirname(t);const u=o.existsSync(s);if(u)return o.symlinkSync(e,t,r);a(s);return o.symlinkSync(e,t,r)}e.exports={createSymlink:n(createSymlink),createSymlinkSync:createSymlinkSync}},1176:(e,t,r)=>{"use strict";const n=r(9046).E;const i=r(7758);const o=["access","appendFile","chmod","chown","close","copyFile","fchmod","fchown","fdatasync","fstat","fsync","ftruncate","futimes","lchmod","lchown","link","lstat","mkdir","mkdtemp","open","opendir","readdir","readFile","readlink","realpath","rename","rmdir","stat","symlink","truncate","unlink","utimes","writeFile"].filter(e=>{return typeof i[e]==="function"});Object.keys(i).forEach(e=>{if(e==="promises"){return}t[e]=i[e]});o.forEach(e=>{t[e]=n(i[e])});t.exists=function(e,t){if(typeof t==="function"){return i.exists(e,t)}return new Promise(t=>{return i.exists(e,t)})};t.read=function(e,t,r,n,o,c){if(typeof c==="function"){return i.read(e,t,r,n,o,c)}return new Promise((c,s)=>{i.read(e,t,r,n,o,(e,t,r)=>{if(e)return s(e);c({bytesRead:t,buffer:r})})})};t.write=function(e,t,...r){if(typeof r[r.length-1]==="function"){return i.write(e,t,...r)}return new Promise((n,o)=>{i.write(e,t,...r,(e,t,r)=>{if(e)return o(e);n({bytesWritten:t,buffer:r})})})};if(typeof i.writev==="function"){t.writev=function(e,t,...r){if(typeof r[r.length-1]==="function"){return i.writev(e,t,...r)}return new Promise((n,o)=>{i.writev(e,t,...r,(e,t,r)=>{if(e)return o(e);n({bytesWritten:t,buffers:r})})})}}if(typeof i.realpath.native==="function"){t.realpath.native=n(i.realpath.native)}},5630:(e,t,r)=>{"use strict";e.exports={...r(1176),...r(1135),...r(1335),...r(6970),...r(55),...r(213),...r(8605),...r(9665),...r(1497),...r(6570),...r(3835),...r(7357)};const n=r(5747);if(Object.getOwnPropertyDescriptor(n,"promises")){Object.defineProperty(e.exports,"promises",{get(){return n.promises}})}},213:(e,t,r)=>{"use strict";const n=r(9046).p;const i=r(8970);i.outputJson=n(r(531));i.outputJsonSync=r(9421);i.outputJSON=i.outputJson;i.outputJSONSync=i.outputJsonSync;i.writeJSON=i.writeJson;i.writeJSONSync=i.writeJsonSync;i.readJSON=i.readJson;i.readJSONSync=i.readJsonSync;e.exports=i},8970:(e,t,r)=>{"use strict";const n=r(6160);e.exports={readJson:n.readFile,readJsonSync:n.readFileSync,writeJson:n.writeFile,writeJsonSync:n.writeFileSync}},9421:(e,t,r)=>{"use strict";const{stringify:n}=r(5902);const{outputFileSync:i}=r(6570);function outputJsonSync(e,t,r){const o=n(t,r);i(e,o,r)}e.exports=outputJsonSync},531:(e,t,r)=>{"use strict";const{stringify:n}=r(5902);const{outputFile:i}=r(6570);async function outputJson(e,t,r={}){const o=n(t,r);await i(e,o,r)}e.exports=outputJson},8605:(e,t,r)=>{"use strict";const n=r(9046).p;const{makeDir:i,makeDirSync:o}=r(2751);const c=n(i);e.exports={mkdirs:c,mkdirsSync:o,mkdirp:c,mkdirpSync:o,ensureDir:c,ensureDirSync:o}},2751:(e,t,r)=>{"use strict";const n=r(1176);const i=r(5622);const o=r(5995);const c=o("10.12.0");const s=e=>{if(process.platform==="win32"){const t=/[<>:"|?*]/.test(e.replace(i.parse(e).root,""));if(t){const t=new Error(`Path contains invalid characters: ${e}`);t.code="EINVAL";throw t}}};const a=e=>{const t={mode:511};if(typeof e==="number")e={mode:e};return{...t,...e}};const u=e=>{const t=new Error(`operation not permitted, mkdir '${e}'`);t.code="EPERM";t.errno=-4048;t.path=e;t.syscall="mkdir";return t};e.exports.makeDir=(async(e,t)=>{s(e);t=a(t);if(c){const r=i.resolve(e);return n.mkdir(r,{mode:t.mode,recursive:true})}const r=async e=>{try{await n.mkdir(e,t.mode)}catch(t){if(t.code==="EPERM"){throw t}if(t.code==="ENOENT"){if(i.dirname(e)===e){throw u(e)}if(t.message.includes("null bytes")){throw t}await r(i.dirname(e));return r(e)}try{const r=await n.stat(e);if(!r.isDirectory()){throw new Error("The path is not a directory")}}catch{throw t}}};return r(i.resolve(e))});e.exports.makeDirSync=((e,t)=>{s(e);t=a(t);if(c){const r=i.resolve(e);return n.mkdirSync(r,{mode:t.mode,recursive:true})}const r=e=>{try{n.mkdirSync(e,t.mode)}catch(t){if(t.code==="EPERM"){throw t}if(t.code==="ENOENT"){if(i.dirname(e)===e){throw u(e)}if(t.message.includes("null bytes")){throw t}r(i.dirname(e));return r(e)}try{if(!n.statSync(e).isDirectory()){throw new Error("The path is not a directory")}}catch{throw t}}};return r(i.resolve(e))})},9665:(e,t,r)=>{"use strict";e.exports={moveSync:r(6445)}},6445:(e,t,r)=>{"use strict";const n=r(7758);const i=r(5622);const o=r(1135).copySync;const c=r(7357).removeSync;const s=r(8605).mkdirpSync;const a=r(3901);function moveSync(e,t,r){r=r||{};const n=r.overwrite||r.clobber||false;const{srcStat:o}=a.checkPathsSync(e,t,"move");a.checkParentPathsSync(e,o,t,"move");s(i.dirname(t));return doRename(e,t,n)}function doRename(e,t,r){if(r){c(t);return rename(e,t,r)}if(n.existsSync(t))throw new Error("dest already exists.");return rename(e,t,r)}function rename(e,t,r){try{n.renameSync(e,t)}catch(n){if(n.code!=="EXDEV")throw n;return moveAcrossDevice(e,t,r)}}function moveAcrossDevice(e,t,r){const n={overwrite:r,errorOnExist:true};o(e,t,n);return c(e)}e.exports=moveSync},1497:(e,t,r)=>{"use strict";const n=r(9046).E;e.exports={move:n(r(2231))}},2231:(e,t,r)=>{"use strict";const n=r(7758);const i=r(5622);const o=r(1335).copy;const c=r(7357).remove;const s=r(8605).mkdirp;const a=r(3835).pathExists;const u=r(3901);function move(e,t,r,n){if(typeof r==="function"){n=r;r={}}const o=r.overwrite||r.clobber||false;u.checkPaths(e,t,"move",(r,c)=>{if(r)return n(r);const{srcStat:a}=c;u.checkParentPaths(e,a,t,"move",r=>{if(r)return n(r);s(i.dirname(t),r=>{if(r)return n(r);return doRename(e,t,o,n)})})})}function doRename(e,t,r,n){if(r){return c(t,i=>{if(i)return n(i);return rename(e,t,r,n)})}a(t,(i,o)=>{if(i)return n(i);if(o)return n(new Error("dest already exists."));return rename(e,t,r,n)})}function rename(e,t,r,i){n.rename(e,t,n=>{if(!n)return i();if(n.code!=="EXDEV")return i(n);return moveAcrossDevice(e,t,r,i)})}function moveAcrossDevice(e,t,r,n){const i={overwrite:r,errorOnExist:true};o(e,t,i,t=>{if(t)return n(t);return c(e,n)})}e.exports=move},6570:(e,t,r)=>{"use strict";const n=r(9046).E;const i=r(7758);const o=r(5622);const c=r(8605);const s=r(3835).pathExists;function outputFile(e,t,r,n){if(typeof r==="function"){n=r;r="utf8"}const a=o.dirname(e);s(a,(o,s)=>{if(o)return n(o);if(s)return i.writeFile(e,t,r,n);c.mkdirs(a,o=>{if(o)return n(o);i.writeFile(e,t,r,n)})})}function outputFileSync(e,...t){const r=o.dirname(e);if(i.existsSync(r)){return i.writeFileSync(e,...t)}c.mkdirsSync(r);i.writeFileSync(e,...t)}e.exports={outputFile:n(outputFile),outputFileSync:outputFileSync}},3835:(e,t,r)=>{"use strict";const n=r(9046).p;const i=r(1176);function pathExists(e){return i.access(e).then(()=>true).catch(()=>false)}e.exports={pathExists:n(pathExists),pathExistsSync:i.existsSync}},7357:(e,t,r)=>{"use strict";const n=r(9046).E;const i=r(8761);e.exports={remove:n(i),removeSync:i.sync}},8761:(e,t,r)=>{"use strict";const n=r(7758);const i=r(5622);const o=r(2357);const c=process.platform==="win32";function defaults(e){const t=["unlink","chmod","stat","lstat","rmdir","readdir"];t.forEach(t=>{e[t]=e[t]||n[t];t=t+"Sync";e[t]=e[t]||n[t]});e.maxBusyTries=e.maxBusyTries||3}function rimraf(e,t,r){let n=0;if(typeof t==="function"){r=t;t={}}o(e,"rimraf: missing path");o.strictEqual(typeof e,"string","rimraf: path should be a string");o.strictEqual(typeof r,"function","rimraf: callback function required");o(t,"rimraf: invalid options argument provided");o.strictEqual(typeof t,"object","rimraf: options should be object");defaults(t);rimraf_(e,t,function CB(i){if(i){if((i.code==="EBUSY"||i.code==="ENOTEMPTY"||i.code==="EPERM")&&nrimraf_(e,t,CB),r)}if(i.code==="ENOENT")i=null}r(i)})}function rimraf_(e,t,r){o(e);o(t);o(typeof r==="function");t.lstat(e,(n,i)=>{if(n&&n.code==="ENOENT"){return r(null)}if(n&&n.code==="EPERM"&&c){return fixWinEPERM(e,t,n,r)}if(i&&i.isDirectory()){return rmdir(e,t,n,r)}t.unlink(e,n=>{if(n){if(n.code==="ENOENT"){return r(null)}if(n.code==="EPERM"){return c?fixWinEPERM(e,t,n,r):rmdir(e,t,n,r)}if(n.code==="EISDIR"){return rmdir(e,t,n,r)}}return r(n)})})}function fixWinEPERM(e,t,r,n){o(e);o(t);o(typeof n==="function");t.chmod(e,438,i=>{if(i){n(i.code==="ENOENT"?null:r)}else{t.stat(e,(i,o)=>{if(i){n(i.code==="ENOENT"?null:r)}else if(o.isDirectory()){rmdir(e,t,r,n)}else{t.unlink(e,n)}})}})}function fixWinEPERMSync(e,t,r){let n;o(e);o(t);try{t.chmodSync(e,438)}catch(e){if(e.code==="ENOENT"){return}else{throw r}}try{n=t.statSync(e)}catch(e){if(e.code==="ENOENT"){return}else{throw r}}if(n.isDirectory()){rmdirSync(e,t,r)}else{t.unlinkSync(e)}}function rmdir(e,t,r,n){o(e);o(t);o(typeof n==="function");t.rmdir(e,i=>{if(i&&(i.code==="ENOTEMPTY"||i.code==="EEXIST"||i.code==="EPERM")){rmkids(e,t,n)}else if(i&&i.code==="ENOTDIR"){n(r)}else{n(i)}})}function rmkids(e,t,r){o(e);o(t);o(typeof r==="function");t.readdir(e,(n,o)=>{if(n)return r(n);let c=o.length;let s;if(c===0)return t.rmdir(e,r);o.forEach(n=>{rimraf(i.join(e,n),t,n=>{if(s){return}if(n)return r(s=n);if(--c===0){t.rmdir(e,r)}})})})}function rimrafSync(e,t){let r;t=t||{};defaults(t);o(e,"rimraf: missing path");o.strictEqual(typeof e,"string","rimraf: path should be a string");o(t,"rimraf: missing options");o.strictEqual(typeof t,"object","rimraf: options should be object");try{r=t.lstatSync(e)}catch(r){if(r.code==="ENOENT"){return}if(r.code==="EPERM"&&c){fixWinEPERMSync(e,t,r)}}try{if(r&&r.isDirectory()){rmdirSync(e,t,null)}else{t.unlinkSync(e)}}catch(r){if(r.code==="ENOENT"){return}else if(r.code==="EPERM"){return c?fixWinEPERMSync(e,t,r):rmdirSync(e,t,r)}else if(r.code!=="EISDIR"){throw r}rmdirSync(e,t,r)}}function rmdirSync(e,t,r){o(e);o(t);try{t.rmdirSync(e)}catch(n){if(n.code==="ENOTDIR"){throw r}else if(n.code==="ENOTEMPTY"||n.code==="EEXIST"||n.code==="EPERM"){rmkidsSync(e,t)}else if(n.code!=="ENOENT"){throw n}}}function rmkidsSync(e,t){o(e);o(t);t.readdirSync(e).forEach(r=>rimrafSync(i.join(e,r),t));if(c){const r=Date.now();do{try{const r=t.rmdirSync(e,t);return r}catch{}}while(Date.now()-r<500)}else{const r=t.rmdirSync(e,t);return r}}e.exports=rimraf;rimraf.sync=rimrafSync},3901:(e,t,r)=>{"use strict";const n=r(1176);const i=r(5622);const o=r(1669);const c=r(5995);const s=c("10.5.0");const a=e=>s?n.stat(e,{bigint:true}):n.stat(e);const u=e=>s?n.statSync(e,{bigint:true}):n.statSync(e);function getStats(e,t){return Promise.all([a(e),a(t).catch(e=>{if(e.code==="ENOENT")return null;throw e})]).then(([e,t])=>({srcStat:e,destStat:t}))}function getStatsSync(e,t){let r;const n=u(e);try{r=u(t)}catch(e){if(e.code==="ENOENT")return{srcStat:n,destStat:null};throw e}return{srcStat:n,destStat:r}}function checkPaths(e,t,r,n){o.callbackify(getStats)(e,t,(i,o)=>{if(i)return n(i);const{srcStat:c,destStat:s}=o;if(s&&areIdentical(c,s)){return n(new Error("Source and destination must not be the same."))}if(c.isDirectory()&&isSrcSubdir(e,t)){return n(new Error(errMsg(e,t,r)))}return n(null,{srcStat:c,destStat:s})})}function checkPathsSync(e,t,r){const{srcStat:n,destStat:i}=getStatsSync(e,t);if(i&&areIdentical(n,i)){throw new Error("Source and destination must not be the same.")}if(n.isDirectory()&&isSrcSubdir(e,t)){throw new Error(errMsg(e,t,r))}return{srcStat:n,destStat:i}}function checkParentPaths(e,t,r,o,c){const a=i.resolve(i.dirname(e));const u=i.resolve(i.dirname(r));if(u===a||u===i.parse(u).root)return c();const f=(n,i)=>{if(n){if(n.code==="ENOENT")return c();return c(n)}if(areIdentical(t,i)){return c(new Error(errMsg(e,r,o)))}return checkParentPaths(e,t,u,o,c)};if(s)n.stat(u,{bigint:true},f);else n.stat(u,f)}function checkParentPathsSync(e,t,r,n){const o=i.resolve(i.dirname(e));const c=i.resolve(i.dirname(r));if(c===o||c===i.parse(c).root)return;let s;try{s=u(c)}catch(e){if(e.code==="ENOENT")return;throw e}if(areIdentical(t,s)){throw new Error(errMsg(e,r,n))}return checkParentPathsSync(e,t,c,n)}function areIdentical(e,t){if(t.ino&&t.dev&&t.ino===e.ino&&t.dev===e.dev){if(s||t.inoe);const n=i.resolve(t).split(i.sep).filter(e=>e);return r.reduce((e,t,r)=>e&&n[r]===t,true)}function errMsg(e,t,r){return`Cannot ${r} '${e}' to a subdirectory of itself, '${t}'.`}e.exports={checkPaths:checkPaths,checkPathsSync:checkPathsSync,checkParentPaths:checkParentPaths,checkParentPathsSync:checkParentPathsSync,isSrcSubdir:isSrcSubdir}},2548:(e,t,r)=>{"use strict";const n=r(7758);function utimesMillis(e,t,r,i){n.open(e,"r+",(e,o)=>{if(e)return i(e);n.futimes(o,t,r,e=>{n.close(o,t=>{if(i)i(e||t)})})})}function utimesMillisSync(e,t,r){const i=n.openSync(e,"r+");n.futimesSync(i,t,r);return n.closeSync(i)}e.exports={utimesMillis:utimesMillis,utimesMillisSync:utimesMillisSync}},7356:e=>{"use strict";e.exports=clone;function clone(e){if(e===null||typeof e!=="object")return e;if(e instanceof Object)var t={__proto__:e.__proto__};else var t=Object.create(null);Object.getOwnPropertyNames(e).forEach(function(r){Object.defineProperty(t,r,Object.getOwnPropertyDescriptor(e,r))});return t}},7758:(e,t,r)=>{var n=r(5747);var i=r(263);var o=r(3086);var c=r(7356);var s=r(1669);var a;var u;if(typeof Symbol==="function"&&typeof Symbol.for==="function"){a=Symbol.for("graceful-fs.queue");u=Symbol.for("graceful-fs.previous")}else{a="___graceful-fs.queue";u="___graceful-fs.previous"}function noop(){}function publishQueue(e,t){Object.defineProperty(e,a,{get:function(){return t}})}var f=noop;if(s.debuglog)f=s.debuglog("gfs4");else if(/\bgfs4\b/i.test(process.env.NODE_DEBUG||""))f=function(){var e=s.format.apply(s,arguments);e="GFS4: "+e.split(/\n/).join("\nGFS4: ");console.error(e)};if(!n[a]){var l=global[a]||[];publishQueue(n,l);n.close=function(e){function close(t,r){return e.call(n,t,function(e){if(!e){retry()}if(typeof r==="function")r.apply(this,arguments)})}Object.defineProperty(close,u,{value:e});return close}(n.close);n.closeSync=function(e){function closeSync(t){e.apply(n,arguments);retry()}Object.defineProperty(closeSync,u,{value:e});return closeSync}(n.closeSync);if(/\bgfs4\b/i.test(process.env.NODE_DEBUG||"")){process.on("exit",function(){f(n[a]);r(2357).equal(n[a].length,0)})}}if(!global[a]){publishQueue(global,n[a])}e.exports=patch(c(n));if(process.env.TEST_GRACEFUL_FS_GLOBAL_PATCH&&!n.__patched){e.exports=patch(n);n.__patched=true}function patch(e){i(e);e.gracefulify=patch;e.createReadStream=createReadStream;e.createWriteStream=createWriteStream;var t=e.readFile;e.readFile=readFile;function readFile(e,r,n){if(typeof r==="function")n=r,r=null;return go$readFile(e,r,n);function go$readFile(e,r,n){return t(e,r,function(t){if(t&&(t.code==="EMFILE"||t.code==="ENFILE"))enqueue([go$readFile,[e,r,n]]);else{if(typeof n==="function")n.apply(this,arguments);retry()}})}}var r=e.writeFile;e.writeFile=writeFile;function writeFile(e,t,n,i){if(typeof n==="function")i=n,n=null;return go$writeFile(e,t,n,i);function go$writeFile(e,t,n,i){return r(e,t,n,function(r){if(r&&(r.code==="EMFILE"||r.code==="ENFILE"))enqueue([go$writeFile,[e,t,n,i]]);else{if(typeof i==="function")i.apply(this,arguments);retry()}})}}var n=e.appendFile;if(n)e.appendFile=appendFile;function appendFile(e,t,r,i){if(typeof r==="function")i=r,r=null;return go$appendFile(e,t,r,i);function go$appendFile(e,t,r,i){return n(e,t,r,function(n){if(n&&(n.code==="EMFILE"||n.code==="ENFILE"))enqueue([go$appendFile,[e,t,r,i]]);else{if(typeof i==="function")i.apply(this,arguments);retry()}})}}var c=e.readdir;e.readdir=readdir;function readdir(e,t,r){var n=[e];if(typeof t!=="function"){n.push(t)}else{r=t}n.push(go$readdir$cb);return go$readdir(n);function go$readdir$cb(e,t){if(t&&t.sort)t.sort();if(e&&(e.code==="EMFILE"||e.code==="ENFILE"))enqueue([go$readdir,[n]]);else{if(typeof r==="function")r.apply(this,arguments);retry()}}}function go$readdir(t){return c.apply(e,t)}if(process.version.substr(0,4)==="v0.8"){var s=o(e);ReadStream=s.ReadStream;WriteStream=s.WriteStream}var a=e.ReadStream;if(a){ReadStream.prototype=Object.create(a.prototype);ReadStream.prototype.open=ReadStream$open}var u=e.WriteStream;if(u){WriteStream.prototype=Object.create(u.prototype);WriteStream.prototype.open=WriteStream$open}Object.defineProperty(e,"ReadStream",{get:function(){return ReadStream},set:function(e){ReadStream=e},enumerable:true,configurable:true});Object.defineProperty(e,"WriteStream",{get:function(){return WriteStream},set:function(e){WriteStream=e},enumerable:true,configurable:true});var f=ReadStream;Object.defineProperty(e,"FileReadStream",{get:function(){return f},set:function(e){f=e},enumerable:true,configurable:true});var l=WriteStream;Object.defineProperty(e,"FileWriteStream",{get:function(){return l},set:function(e){l=e},enumerable:true,configurable:true});function ReadStream(e,t){if(this instanceof ReadStream)return a.apply(this,arguments),this;else return ReadStream.apply(Object.create(ReadStream.prototype),arguments)}function ReadStream$open(){var e=this;open(e.path,e.flags,e.mode,function(t,r){if(t){if(e.autoClose)e.destroy();e.emit("error",t)}else{e.fd=r;e.emit("open",r);e.read()}})}function WriteStream(e,t){if(this instanceof WriteStream)return u.apply(this,arguments),this;else return WriteStream.apply(Object.create(WriteStream.prototype),arguments)}function WriteStream$open(){var e=this;open(e.path,e.flags,e.mode,function(t,r){if(t){e.destroy();e.emit("error",t)}else{e.fd=r;e.emit("open",r)}})}function createReadStream(t,r){return new e.ReadStream(t,r)}function createWriteStream(t,r){return new e.WriteStream(t,r)}var p=e.open;e.open=open;function open(e,t,r,n){if(typeof r==="function")n=r,r=null;return go$open(e,t,r,n);function go$open(e,t,r,n){return p(e,t,r,function(i,o){if(i&&(i.code==="EMFILE"||i.code==="ENFILE"))enqueue([go$open,[e,t,r,n]]);else{if(typeof n==="function")n.apply(this,arguments);retry()}})}}return e}function enqueue(e){f("ENQUEUE",e[0].name,e[1]);n[a].push(e)}function retry(){var e=n[a].shift();if(e){f("RETRY",e[0].name,e[1]);e[0].apply(null,e[1])}}},3086:(e,t,r)=>{var n=r(2413).Stream;e.exports=legacy;function legacy(e){return{ReadStream:ReadStream,WriteStream:WriteStream};function ReadStream(t,r){if(!(this instanceof ReadStream))return new ReadStream(t,r);n.call(this);var i=this;this.path=t;this.fd=null;this.readable=true;this.paused=false;this.flags="r";this.mode=438;this.bufferSize=64*1024;r=r||{};var o=Object.keys(r);for(var c=0,s=o.length;cthis.end){throw new Error("start must be <= end")}this.pos=this.start}if(this.fd!==null){process.nextTick(function(){i._read()});return}e.open(this.path,this.flags,this.mode,function(e,t){if(e){i.emit("error",e);i.readable=false;return}i.fd=t;i.emit("open",t);i._read()})}function WriteStream(t,r){if(!(this instanceof WriteStream))return new WriteStream(t,r);n.call(this);this.path=t;this.fd=null;this.writable=true;this.flags="w";this.encoding="binary";this.mode=438;this.bytesWritten=0;r=r||{};var i=Object.keys(r);for(var o=0,c=i.length;o= zero")}this.pos=this.start}this.busy=false;this._queue=[];if(this.fd===null){this._open=e.open;this._queue.push([this._open,this.path,this.flags,this.mode,undefined]);this.flush()}}}},263:(e,t,r)=>{var n=r(7619);var i=process.cwd;var o=null;var c=process.env.GRACEFUL_FS_PLATFORM||process.platform;process.cwd=function(){if(!o)o=i.call(process);return o};try{process.cwd()}catch(e){}var s=process.chdir;process.chdir=function(e){o=null;s.call(process,e)};e.exports=patch;function patch(e){if(n.hasOwnProperty("O_SYMLINK")&&process.version.match(/^v0\.6\.[0-2]|^v0\.5\./)){patchLchmod(e)}if(!e.lutimes){patchLutimes(e)}e.chown=chownFix(e.chown);e.fchown=chownFix(e.fchown);e.lchown=chownFix(e.lchown);e.chmod=chmodFix(e.chmod);e.fchmod=chmodFix(e.fchmod);e.lchmod=chmodFix(e.lchmod);e.chownSync=chownFixSync(e.chownSync);e.fchownSync=chownFixSync(e.fchownSync);e.lchownSync=chownFixSync(e.lchownSync);e.chmodSync=chmodFixSync(e.chmodSync);e.fchmodSync=chmodFixSync(e.fchmodSync);e.lchmodSync=chmodFixSync(e.lchmodSync);e.stat=statFix(e.stat);e.fstat=statFix(e.fstat);e.lstat=statFix(e.lstat);e.statSync=statFixSync(e.statSync);e.fstatSync=statFixSync(e.fstatSync);e.lstatSync=statFixSync(e.lstatSync);if(!e.lchmod){e.lchmod=function(e,t,r){if(r)process.nextTick(r)};e.lchmodSync=function(){}}if(!e.lchown){e.lchown=function(e,t,r,n){if(n)process.nextTick(n)};e.lchownSync=function(){}}if(c==="win32"){e.rename=function(t){return function(r,n,i){var o=Date.now();var c=0;t(r,n,function CB(s){if(s&&(s.code==="EACCES"||s.code==="EPERM")&&Date.now()-o<6e4){setTimeout(function(){e.stat(n,function(e,o){if(e&&e.code==="ENOENT")t(r,n,CB);else i(s)})},c);if(c<100)c+=10;return}if(i)i(s)})}}(e.rename)}e.read=function(t){function read(r,n,i,o,c,s){var a;if(s&&typeof s==="function"){var u=0;a=function(f,l,p){if(f&&f.code==="EAGAIN"&&u<10){u++;return t.call(e,r,n,i,o,c,a)}s.apply(this,arguments)}}return t.call(e,r,n,i,o,c,a)}read.__proto__=t;return read}(e.read);e.readSync=function(t){return function(r,n,i,o,c){var s=0;while(true){try{return t.call(e,r,n,i,o,c)}catch(e){if(e.code==="EAGAIN"&&s<10){s++;continue}throw e}}}}(e.readSync);function patchLchmod(e){e.lchmod=function(t,r,i){e.open(t,n.O_WRONLY|n.O_SYMLINK,r,function(t,n){if(t){if(i)i(t);return}e.fchmod(n,r,function(t){e.close(n,function(e){if(i)i(t||e)})})})};e.lchmodSync=function(t,r){var i=e.openSync(t,n.O_WRONLY|n.O_SYMLINK,r);var o=true;var c;try{c=e.fchmodSync(i,r);o=false}finally{if(o){try{e.closeSync(i)}catch(e){}}else{e.closeSync(i)}}return c}}function patchLutimes(e){if(n.hasOwnProperty("O_SYMLINK")){e.lutimes=function(t,r,i,o){e.open(t,n.O_SYMLINK,function(t,n){if(t){if(o)o(t);return}e.futimes(n,r,i,function(t){e.close(n,function(e){if(o)o(t||e)})})})};e.lutimesSync=function(t,r,i){var o=e.openSync(t,n.O_SYMLINK);var c;var s=true;try{c=e.futimesSync(o,r,i);s=false}finally{if(s){try{e.closeSync(o)}catch(e){}}else{e.closeSync(o)}}return c}}else{e.lutimes=function(e,t,r,n){if(n)process.nextTick(n)};e.lutimesSync=function(){}}}function chmodFix(t){if(!t)return t;return function(r,n,i){return t.call(e,r,n,function(e){if(chownErOk(e))e=null;if(i)i.apply(this,arguments)})}}function chmodFixSync(t){if(!t)return t;return function(r,n){try{return t.call(e,r,n)}catch(e){if(!chownErOk(e))throw e}}}function chownFix(t){if(!t)return t;return function(r,n,i,o){return t.call(e,r,n,i,function(e){if(chownErOk(e))e=null;if(o)o.apply(this,arguments)})}}function chownFixSync(t){if(!t)return t;return function(r,n,i){try{return t.call(e,r,n,i)}catch(e){if(!chownErOk(e))throw e}}}function statFix(t){if(!t)return t;return function(r,n,i){if(typeof n==="function"){i=n;n=null}function callback(e,t){if(t){if(t.uid<0)t.uid+=4294967296;if(t.gid<0)t.gid+=4294967296}if(i)i.apply(this,arguments)}return n?t.call(e,r,n,callback):t.call(e,r,callback)}}function statFixSync(t){if(!t)return t;return function(r,n){var i=n?t.call(e,r,n):t.call(e,r);if(i.uid<0)i.uid+=4294967296;if(i.gid<0)i.gid+=4294967296;return i}}function chownErOk(e){if(!e)return true;if(e.code==="ENOSYS")return true;var t=!process.getuid||process.getuid()!==0;if(t){if(e.code==="EINVAL"||e.code==="EPERM")return true}return false}}},6160:(e,t,r)=>{let n;try{n=r(7758)}catch(e){n=r(5747)}const i=r(7133);const{stringify:o,stripBom:c}=r(5902);async function _readFile(e,t={}){if(typeof t==="string"){t={encoding:t}}const r=t.fs||n;const o="throws"in t?t.throws:true;let s=await i.fromCallback(r.readFile)(e,t);s=c(s);let a;try{a=JSON.parse(s,t?t.reviver:null)}catch(t){if(o){t.message=`${e}: ${t.message}`;throw t}else{return null}}return a}const s=i.fromPromise(_readFile);function readFileSync(e,t={}){if(typeof t==="string"){t={encoding:t}}const r=t.fs||n;const i="throws"in t?t.throws:true;try{let n=r.readFileSync(e,t);n=c(n);return JSON.parse(n,t.reviver)}catch(t){if(i){t.message=`${e}: ${t.message}`;throw t}else{return null}}}async function _writeFile(e,t,r={}){const c=r.fs||n;const s=o(t,r);await i.fromCallback(c.writeFile)(e,s,r)}const a=i.fromPromise(_writeFile);function writeFileSync(e,t,r={}){const i=r.fs||n;const c=o(t,r);return i.writeFileSync(e,c,r)}const u={readFile:s,readFileSync:readFileSync,writeFile:a,writeFileSync:writeFileSync};e.exports=u},7133:(e,t)=>{"use strict";t.fromCallback=function(e){return Object.defineProperty(function(...t){if(typeof t[t.length-1]==="function")e.apply(this,t);else{return new Promise((r,n)=>{e.call(this,...t,(e,t)=>e!=null?n(e):r(t))})}},"name",{value:e.name})};t.fromPromise=function(e){return Object.defineProperty(function(...t){const r=t[t.length-1];if(typeof r!=="function")return e.apply(this,t);else e.apply(this,t.slice(0,-1)).then(e=>r(null,e),r)},"name",{value:e.name})}},5902:e=>{function stringify(e,{EOL:t="\n",finalEOL:r=true,replacer:n=null,spaces:i}={}){const o=r?t:"";const c=JSON.stringify(e,n,i);return c.replace(/\n/g,t)+o}function stripBom(e){if(Buffer.isBuffer(e))e=e.toString("utf8");return e.replace(/^\uFEFF/,"")}e.exports={stringify:stringify,stripBom:stripBom}},5573:(e,t,r)=>{var n=r(5768);var i;try{i=r(7758)}catch(e){i=r(5747)}var o=["appendFile","chmod","chown","close","fchmod","fchown","fdatasync","fstat","fsync","ftruncate","futimes","lchown","link","lstat","mkdir","open","read","readFile","readdir","readlink","realpath","rename","rmdir","stat","symlink","truncate","unlink","utimes","write","writeFile"];typeof i.access==="function"&&o.push("access");typeof i.copyFile==="function"&&o.push("copyFile");typeof i.mkdtemp==="function"&&o.push("mkdtemp");r(8690).withCallback(i,t,o);t.exists=function(e,t){if(typeof t==="function"){return i.stat(e,function(e){t(null,!e)})}return new n(function(t){i.stat(e,function(e){t(!e)})})}},6605:(e,t,r)=>{"use strict";var n=r(5573);e.exports={read:function f(e,t,r){var i=["\n"];null==r&&(r="utf8");var o=function(e,t,r){return n.read(t,Buffer.alloc(1),0,1,e.size-1-r).then(function(e){return String.fromCharCode(e[1][0])})};return new Promise(function(c,s){var a={stat:null,file:null};n.exists(e).then(function(e){if(!e)throw new Error("file does not exist")}).then(function(){var t=[n.stat(e).then(function(e){return a.stat=e}),n.open(e,"r").then(function(e){return a.file=e})];return Promise.all(t)}).then(function(){var e=0,s=0,u="",f=function(){return u.length>a.stat.size&&(u=u.substring(u.length-a.stat.size)),u.length>=a.stat.size||s>=t?(i.includes(u.substring(0,1))&&(u=u.substring(1)),n.close(a.file),"buffer"===r?c(Buffer.from(u,"binary")):c(Buffer.from(u,"binary").toString(r))):o(a.stat,a.file,e).then(function(t){u=t+u,i.includes(t)&&1{var n=r(4115);e.exports=thenifyAll;thenifyAll.withCallback=withCallback;thenifyAll.thenify=n;function thenifyAll(e,t,r){return promisifyAll(e,t,r,n)}function withCallback(e,t,r){return promisifyAll(e,t,r,n.withCallback)}function promisifyAll(e,t,r,n){if(!t){t={};r=Object.keys(e)}if(Array.isArray(t)){r=t;t={}}if(!r){r=Object.keys(e)}if(typeof e==="function")t=n(e);r.forEach(function(r){if(typeof e[r]==="function")t[r]=n(e[r])});Object.keys(e).forEach(function(r){if(deprecated(e,r))return;if(t[r])return;t[r]=e[r]});return t}function deprecated(e,t){var r=Object.getOwnPropertyDescriptor(e,t);if(!r||!r.get)return false;if(r.get.name==="deprecated")return true;return false}},4115:(e,t,r)=>{var n=r(5768);var i=r(2357);e.exports=thenify;function thenify(e,t){i(typeof e==="function");return createWrapper(e,t)}thenify.withCallback=function(e,t){i(typeof e==="function");t=t||{};t.withCallback=true;return createWrapper(e,t)};function createCallback(e,t,r){if(r===undefined)r=true;return function(n,i){if(n)return t(n);var o=arguments.length;if(o<=2||!r)return e(i);if(Array.isArray(r)){var c={};for(var s=1;s{"use strict";t.E=function(e){return Object.defineProperty(function(...t){if(typeof t[t.length-1]==="function")e.apply(this,t);else{return new Promise((r,n)=>{e.apply(this,t.concat([(e,t)=>e?n(e):r(t)]))})}},"name",{value:e.name})};t.p=function(e){return Object.defineProperty(function(...t){const r=t[t.length-1];if(typeof r!=="function")return e.apply(this,t);else e.apply(this,t.slice(0,-1)).then(e=>r(null,e),r)},"name",{value:e.name})}},6144:function(e,t,r){"use strict";var n=this&&this.__createBinding||(Object.create?function(e,t,r,n){if(n===undefined)n=r;Object.defineProperty(e,n,{enumerable:true,get:function(){return t[r]}})}:function(e,t,r,n){if(n===undefined)n=r;e[n]=t[r]});var i=this&&this.__setModuleDefault||(Object.create?function(e,t){Object.defineProperty(e,"default",{enumerable:true,value:t})}:function(e,t){e["default"]=t});var o=this&&this.__importStar||function(e){if(e&&e.__esModule)return e;var t={};if(e!=null)for(var r in e)if(r!=="default"&&Object.prototype.hasOwnProperty.call(e,r))n(t,e,r);i(t,e);return t};Object.defineProperty(t,"__esModule",{value:true});const c=o(r(2186));const s=r(5622);const a=r(5630);const u=r(5747);const f=r(1314);const l=r(7888);const p=r(6605);const y=f.fixArgArr((c.getInput("versions")||"latest").split(","));const m=f.fixArgArr((c.getInput("target")||"Spigot").toUpperCase().split(","));const h=c.getInput("generateSrc")=="true";const d=c.getInput("generateDoc")=="true";const v=c.getInput("disableJavaCheck")=="true";const S=c.getInput("forceRun")=="true";const w=f.isNumeric(c.getInput("threads"))?parseInt(c.getInput("threads")):f.cpuCount;const g=f.resetWorkingDir();async function run(){return new Promise(async(e,t)=>{if(y.length==0)return e({code:0,msg:"No version(s) provided to build"});if(m.length==0)return e({code:0,msg:"No target(s) provided to build"});const r=s.join(g.logs,"SpraxDev_Actions-SpigotMC.log");console.log("Installed Java-Version:");await f.runCmd("java",["-version"],g.base,r);console.log(`Downloading BuildTools.jar from 'hub.spigotmc.org'...`);await f.downloadFile("https://hub.spigotmc.org/jenkins/job/BuildTools/lastSuccessfulBuild/artifact/target/BuildTools.jar",s.join(g.cache,"BuildTools.jar"));const n=y.length!=1;if(n){console.log("Prepare for future tasks by running BuildTools...");try{await c.group("Prepare BuildTools",async()=>{return f.runCmd("java",["-jar","BuildTools.jar","--compile","NONE"],g.cache,r)})}catch(e){console.error(e);console.error(`\nPrinting last 25 lines from '${s.resolve(r)}':`);for(const e of await p.read(r,25)){console.error(e)}return f.exit(1)}}const i=["-jar","BuildTools.jar","--compile",m.join(",")];if(h){i.push("--generate-source")}if(d){i.push("--generate-docs")}if(v){i.push("--disable-java-check")}const o=[];for(const e of y){o.push(t=>{try{const r=Date.now();const o=s.join(g.logs,`${e}.log`);console.log(`Building version '${e}'...`);const c=n?s.join(g.base,`${e}`):g.cache;if(n){a.copy(g.cache,c).then(()=>{f.runCmd("java",[...i,"--rev",e],c,o,true).then(()=>{u.rmdirSync(c,{recursive:true});const n=Date.now();console.log(`Finished building '${e}' in ${(n-r)/6e4} minutes`);t()})}).catch(r=>{console.log(`An error occurred while building '${e}'`);console.error(r);console.error(`\nPrinting last 25 lines from '${s.resolve(o)}':`);p.read(o,25).then(e=>{for(const t of e){console.error(t)}}).catch(console.error).finally(()=>t(r))})}}catch(e){t(e)}})}l.parallelLimit(o,w).then(()=>e({code:0})).catch(t)})}run().then(e=>f.exit(e.code,e.msg)).catch(e=>f.exit(1,e))},1314:(e,t,r)=>{"use strict";Object.defineProperty(t,"__esModule",{value:true});t.exit=t.resetWorkingDir=t.downloadFile=t.runCmd=t.isNumeric=t.fixArgArr=t.cpuCount=void 0;const n=r(3129);const i=r(5622);const o=r(5876);const c=r(7211);const s=r(2087);const a=r(5747);const u=JSON.parse(a.readFileSync(r.ab+"package.json","utf-8"));const f=`${u.name||"Action-SpigotMC"}/${u.version||"UNKNOWN_VERSION"} (+${u.homepage||"https://github.com/SpraxDev/"})`;t.cpuCount=s.cpus().length;function fixArgArr(e){const t=[];for(const r of e){const e=r.trim();if(e&&!t.includes(e)){t.push(e)}}return t}t.fixArgArr=fixArgArr;function isNumeric(e){return/^[0-9]+$/.test(e)}t.isNumeric=isNumeric;async function runCmd(e,t,r,i,o=false){return new Promise((c,s)=>{const u=a.createWriteStream(i,{encoding:"utf-8",flags:"a"});const f=n.spawn(e,t,{shell:true,cwd:r,env:process.env});f.stdout.on("data",e=>{u.write(e);if(!o){process.stdout.write(e)}});f.stderr.on("data",e=>{u.write(e);if(!o){process.stderr.write(e)}});f.on("close",t=>{u.close();if(t!=0){return s({err:new Error(`process exited with code ${t}`),cmd:e,workingDir:r})}c()})})}t.runCmd=runCmd;async function downloadFile(e,t){const r=e.toLowerCase().startsWith("http://")?o.get:c.get;return new Promise((n,i)=>{let o=null;const c=function(e){if(o){o.close();o=null;if(e){a.rmdirSync(t,{recursive:true})}}};r(e,{headers:{"User-Agent":f}},e=>{if(e.statusCode!=200){c(true);return i(new Error(`Server responded with ${e.statusCode}`))}o=a.createWriteStream(t,{encoding:"binary"}).on("finish",()=>{c(false);return n()}).on("error",e=>{c(true);return i(e)});e.pipe(o)}).on("error",e=>{c(true);return i(e)})})}t.downloadFile=downloadFile;function resetWorkingDir(){const e=i.join(s.tmpdir(),"SpraxDev-Action-SpigotMC");const t=i.join(e,"cache");const r=i.join(e,"logs");a.rmdirSync(e,{recursive:true});a.mkdirSync(t,{recursive:true});a.mkdirSync(r);return{base:e,cache:t,logs:r}}t.resetWorkingDir=resetWorkingDir;function exit(e,t){if(t){if(typeof t=="string"){console.log(t)}else{console.error(t)}}return process.exit(e)}t.exit=exit},2357:e=>{"use strict";e.exports=require("assert")},3129:e=>{"use strict";e.exports=require("child_process")},7619:e=>{"use strict";e.exports=require("constants")},5747:e=>{"use strict";e.exports=require("fs")},5876:e=>{"use strict";e.exports=require("http")},7211:e=>{"use strict";e.exports=require("https")},2087:e=>{"use strict";e.exports=require("os")},5622:e=>{"use strict";e.exports=require("path")},2413:e=>{"use strict";e.exports=require("stream")},1669:e=>{"use strict";e.exports=require("util")}};var t={};function __webpack_require__(r){if(t[r]){return t[r].exports}var n=t[r]={exports:{}};var i=true;try{e[r].call(n.exports,n,n.exports,__webpack_require__);i=false}finally{if(i)delete t[r]}return n.exports}__webpack_require__.ab=__dirname+"/";return __webpack_require__(6144)})(); +//# sourceMappingURL=index.js.map \ No newline at end of file diff --git a/dist/index.js.map b/dist/index.js.map new file mode 100644 index 0000000..7c4c4f6 --- /dev/null +++ b/dist/index.js.map @@ -0,0 +1 @@ +{"version":3,"sources":["../webpack:/action-spigotmc/node_modules/@actions/core/lib/command.js","../webpack:/action-spigotmc/node_modules/@actions/core/lib/core.js","../webpack:/action-spigotmc/node_modules/@actions/core/lib/file-command.js","../webpack:/action-spigotmc/node_modules/@actions/core/lib/utils.js","../webpack:/action-spigotmc/node_modules/any-promise/index.js","../webpack:/action-spigotmc/node_modules/any-promise/loader.js","../webpack:/action-spigotmc/node_modules/any-promise/register.js","../webpack:/action-spigotmc/node_modules/async/dist/async.js","../webpack:/action-spigotmc/node_modules/at-least-node/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/copy-sync/copy-sync.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/copy-sync/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/copy/copy.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/copy/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/empty/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/ensure/file.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/ensure/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/ensure/link.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/ensure/symlink-paths.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/ensure/symlink-type.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/ensure/symlink.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/fs/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/json/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/json/jsonfile.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/json/output-json-sync.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/json/output-json.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/mkdirs/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/mkdirs/make-dir.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/move-sync/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/move-sync/move-sync.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/move/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/move/move.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/output/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/path-exists/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/remove/index.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/remove/rimraf.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/util/stat.js","../webpack:/action-spigotmc/node_modules/fs-extra/lib/util/utimes.js","../webpack:/action-spigotmc/node_modules/graceful-fs/clone.js","../webpack:/action-spigotmc/node_modules/graceful-fs/graceful-fs.js","../webpack:/action-spigotmc/node_modules/graceful-fs/legacy-streams.js","../webpack:/action-spigotmc/node_modules/graceful-fs/polyfills.js","../webpack:/action-spigotmc/node_modules/jsonfile/index.js","../webpack:/action-spigotmc/node_modules/jsonfile/node_modules/universalify/index.js","../webpack:/action-spigotmc/node_modules/jsonfile/utils.js","../webpack:/action-spigotmc/node_modules/mz/fs.js","../webpack:/action-spigotmc/node_modules/read-last-lines/dist/index.js","../webpack:/action-spigotmc/node_modules/thenify-all/index.js","../webpack:/action-spigotmc/node_modules/thenify/index.js","../webpack:/action-spigotmc/node_modules/universalify/index.js","../webpack:/action-spigotmc/src/index.ts","../webpack:/action-spigotmc/src/utils.ts","../webpack:/action-spigotmc/external \"assert\"","../webpack:/action-spigotmc/external \"child_process\"","../webpack:/action-spigotmc/external \"constants\"","../webpack:/action-spigotmc/external \"fs\"","../webpack:/action-spigotmc/external \"http\"","../webpack:/action-spigotmc/external \"https\"","../webpack:/action-spigotmc/external \"os\"","../webpack:/action-spigotmc/external \"path\"","../webpack:/action-spigotmc/external \"stream\"","../webpack:/action-spigotmc/external \"util\"","../webpack:/action-spigotmc/webpack/bootstrap","../webpack:/action-spigotmc/webpack/runtime/compat","../webpack:/action-spigotmc/webpack/startup"],"names":["__importStar","this","mod","__esModule","result","k","Object","hasOwnProperty","call","defineProperty","exports","value","os","__webpack_require__","utils_1","issueCommand","command","properties","message","cmd","Command","process","stdout","write","toString","EOL","issue","name","CMD_STRING","[object Object]","cmdStr","keys","length","first","key","val","escapeProperty","escapeData","s","toCommandValue","replace","__awaiter","thisArg","_arguments","P","generator","adopt","resolve","Promise","reject","fulfilled","step","next","e","rejected","done","then","apply","command_1","file_command_1","path","ExitCode","exportVariable","convertedVal","env","filePath","delimiter","commandValue","setSecret","secret","addPath","inputPath","getInput","options","toUpperCase","required","Error","trim","setOutput","setCommandEcho","enabled","setFailed","exitCode","Failure","error","isDebug","debug","warning","info","startGroup","endGroup","group","fn","saveState","getState","fs","existsSync","appendFileSync","encoding","input","undefined","String","JSON","stringify","module","REGISTRATION_KEY","registered","root","loadImplementation","register","implementation","opts","registerGlobal","global","lib","require","factory","args","callArgs","initialParams","callback","pop","hasSetImmediate","setImmediate","hasNextTick","nextTick","fallback","setTimeout","wrap","defer","_defer","setImmediate$1","asyncify","func","isAsync","promise","handlePromise","invokeCallback","err","Symbol","toStringTag","isAsyncGenerator","isAsyncIterable","obj","asyncIterator","wrapAsync","asyncFn","awaitify","arity","awaitable","cbArgs","applyEach","eachfn","fns","go","that","cb","concat","_asyncMap","arr","iteratee","results","counter","_iteratee","_","iterCb","index","v","isArrayLike","breakLoop","once","wrapper","callFn","assign","getIterator","coll","iterator","createArrayIterator","i","len","createES2015Iterator","item","createObjectIterator","okeys","createIterator","onlyOnce","asyncEachOfLimit","limit","canceled","awaiting","running","idx","replenish","iterDone","iterateeCallback","catch","handleError","eachOfLimit","RangeError","nextElem","looping","elem","eachOfLimit$1","eachOfLimit$2","eachOfArrayLike","completed","iteratorCallback","eachOfGeneric","Infinity","eachOf","eachOfImplementation","eachOf$1","map","map$1","applyEach$1","eachOfSeries","eachOfSeries$1","mapSeries","mapSeries$1","applyEachSeries","PROMISE_SYMBOL","promiseCallback","res","rej","auto","tasks","concurrency","numTasks","runningTasks","hasError","listeners","create","readyTasks","readyToCheck","uncheckedDependencies","forEach","task","Array","isArray","enqueueTask","push","dependencies","slice","remainingDependencies","dependencyName","join","addListener","checkForDeadlocks","processQueue","runTask","run","shift","taskName","taskListeners","taskComplete","taskCallback","safeResults","rkey","taskFn","currentTask","getDependents","dependent","indexOf","FN_ARGS","ARROW_FN_ARGS","FN_ARG_SPLIT","FN_ARG","STRIP_COMMENTS","parseParams","src","match","split","arg","autoInject","newTasks","params","fnIsAsync","hasNoDeps","newTask","taskCb","newArgs","DLL","head","tail","node","prev","newNode","insertBefore","setInitial","insertAfter","removeLink","cur","data","testFn","curr","dll","queue","worker","payload","_worker","numRunning","workersList","events","drain","saturated","unsaturated","empty","on","event","handler","handleAndRemove","off","ev","filter","trigger","processingScheduled","_insert","insertAtFront","rejectOnError","q","started","_tasks","unshift","_createCB","l","splice","buffer","idle","_maybeDrain","eventMethod","isProcessing","paused","datum","remove","Math","min","defineProperties","writable","cargo","cargo$1","reduce","memo","x","reduce$1","seq","functions","_functions","newargs","nextargs","compose","reverse","mapLimit","mapLimit$1","concatLimit","mapResults","concatLimit$1","concat$1","concatSeries","concatSeries$1","constant","ignoredArgs","_createTester","check","getResult","testPassed","testResult","detect","bool","detect$1","detectLimit","detectLimit$1","detectSeries","detectSeries$1","consoleFunc","resultArgs","console","dir","doWhilst","test","_fn","_test","truth","doWhilst$1","doUntil","_withoutIndex","eachLimit","each","eachLimit$1","eachLimit$2","eachSeries","eachSeries$1","ensureAsync","sync","innerArgs","every","every$1","everyLimit","everyLimit$1","everySeries","everySeries$1","filterArray","truthValues","filterGeneric","sort","a","b","_filter","filter$1","filterLimit","filterLimit$1","filterSeries","filterSeries$1","forever","errback","forever$1","groupByLimit","prototype","groupByLimit$1","groupBy","groupBySeries","log","mapValuesLimit","newObj","mapValuesLimit$1","mapValues","mapValuesSeries","memoize","hasher","queues","memoized","unmemoized","_defer$1","parallel","parallel$1","parallelLimit","queue$1","items","Heap","heap","pushCount","Number","MIN_SAFE_INTEGER","p","smaller","parent","t","leftChi","percUp","top","percDown","j","y","priority","priorityQueue","race","TypeError","race$1","reduceRight","array","reversed","reflect","reflectOn","reflectCallback","retVal","reflectAll","reject$1","reject$2","rejectLimit","rejectLimit$1","rejectSeries","rejectSeries$1","constant$1","DEFAULT_TIMES","DEFAULT_INTERVAL","retry","times","intervalFunc","arguments","parseTimes","_task","attempt","retryAttempt","errorFilter","acc","interval","retryable","series","some","Boolean","some$1","someLimit","someLimit$1","someSeries","someSeries$1","sortBy","criteria","comparator","left","right","sortBy$1","timeout","milliseconds","timedOut","timer","timeoutCallback","code","clearTimeout","range","size","timesLimit","count","n","timesSeries","transform","accumulator","tryEach","tryEach$1","unmemoize","whilst","rest","whilst$1","until","waterfall","taskIndex","nextTask","waterfall$1","cargoQueue","all","allLimit","allSeries","any","anyLimit","anySeries","find","findLimit","findSeries","flatMap","flatMapLimit","flatMapSeries","forEachSeries","forEachLimit","forEachOf","forEachOfSeries","forEachOfLimit","inject","foldl","foldr","select","selectLimit","selectSeries","wrapSync","during","doDuring","default","r","versions","parseInt","mkdirsSync","utimesMillisSync","stat","copySync","dest","clobber","overwrite","preserveTimestamps","arch","warn","srcStat","destStat","checkPathsSync","checkParentPathsSync","handleFilterAndCopy","destParent","dirname","startCopy","getStats","statSync","dereference","lstatSync","isDirectory","onDir","isFile","isCharacterDevice","isBlockDevice","onFile","isSymbolicLink","onLink","copyFile","mayCopyFile","unlinkSync","errorOnExist","copyFileSync","handleTimestamps","mode","setDestMode","srcMode","fileIsNotWritable","makeFileWritable","setDestTimestamps","chmodSync","updatedSrcStat","atime","mtime","mkDirAndCopy","copyDir","mkdirSync","readdirSync","copyDirItem","srcItem","destItem","resolvedSrc","readlinkSync","cwd","symlinkSync","resolvedDest","isSrcSubdir","copyLink","mkdirs","pathExists","utimesMillis","copy","checkPaths","stats","checkParentPaths","handleFilter","checkParentDir","dirExists","onInclude","include","lstat","unlink","handleTimestampsAndMode","setDestTimestampsAndMode","chmod","mkdir","readdir","copyDirItems","readlink","symlink","u","E","emptyDir","deleteItem","emptyDirSync","removeSync","emptydirSync","emptydir","createFile","file","makeFile","writeFile","createFileSync","writeFileSync","link","ensureFile","ensureFileSync","createLink","createLinkSync","ensureLink","ensureLinkSync","createSymlink","createSymlinkSync","ensureSymlink","ensureSymlinkSync","srcpath","dstpath","makeLink","destinationExists","linkSync","symlinkPaths","isAbsolute","toCwd","toDst","dstdir","relativeToDst","exists","relative","symlinkPathsSync","symlinkType","type","symlinkTypeSync","_mkdirs","_symlinkPaths","_symlinkType","api","method","filename","read","fd","offset","position","bytesRead","bytesWritten","writev","buffers","realpath","native","getOwnPropertyDescriptor","promises","jsonFile","outputJson","outputJsonSync","outputJSON","outputJSONSync","writeJSON","writeJson","writeJSONSync","writeJsonSync","readJSON","readJson","readJSONSync","readJsonSync","readFile","readFileSync","outputFileSync","str","outputFile","async","makeDir","_makeDir","makeDirSync","mkdirp","mkdirpSync","ensureDir","ensureDirSync","atLeastNode","useNativeRecursiveOption","checkPath","pth","platform","pathHasInvalidWinCharacters","parse","processOptions","defaults","permissionError","errno","syscall","recursive","make","includes","moveSync","doRename","rename","renameSync","moveAcrossDevice","move","destExists","itDoes","access","pathExistsSync","rimraf","assert","isWindows","methods","m","maxBusyTries","busyTries","strictEqual","rimraf_","CB","er","time","st","fixWinEPERM","rmdir","er2","er3","fixWinEPERMSync","rmdirSync","originalEr","rmkids","files","errState","f","rimrafSync","rmkidsSync","startTime","Date","now","ret","util","nodeSupportsBigInt","bigint","getStatsSync","funcName","callbackify","areIdentical","errMsg","srcParent","ino","dev","MAX_SAFE_INTEGER","nlink","atimeMs","mtimeMs","ctimeMs","birthtimeMs","srcArr","sep","destArr","open","futimes","futimesErr","close","closeErr","openSync","futimesSync","closeSync","clone","__proto__","getOwnPropertyNames","polyfills","legacy","gracefulQueue","previousSymbol","for","noop","publishQueue","context","get","debuglog","NODE_DEBUG","format","fs$close","fs$closeSync","equal","patch","TEST_GRACEFUL_FS_GLOBAL_PATCH","__patched","gracefulify","createReadStream","createWriteStream","fs$readFile","go$readFile","enqueue","fs$writeFile","go$writeFile","fs$appendFile","appendFile","go$appendFile","fs$readdir","go$readdir$cb","go$readdir","version","substr","legStreams","ReadStream","WriteStream","fs$ReadStream","ReadStream$open","fs$WriteStream","WriteStream$open","set","enumerable","configurable","FileReadStream","FileWriteStream","flags","autoClose","destroy","emit","fs$open","go$open","Stream","self","readable","bufferSize","setEncoding","start","end","pos","_read","busy","_queue","_open","flush","constants","origCwd","GRACEFUL_FS_PLATFORM","chdir","d","patchLchmod","lutimes","patchLutimes","chown","chownFix","fchown","lchown","chmodFix","fchmod","lchmod","chownSync","chownFixSync","fchownSync","lchownSync","chmodFixSync","fchmodSync","lchmodSync","statFix","fstat","statFixSync","fstatSync","uid","gid","fs$rename","from","to","backoff","stater","fs$read","callback_","eagCounter","__","readSync","fs$readSync","O_WRONLY","O_SYMLINK","err2","threw","at","mt","lutimesSync","_a","_b","_c","orig","target","chownErOk","nonroot","getuid","_fs","universalify","stripBom","_readFile","shouldThrow","throws","fromCallback","reviver","fromPromise","content","_writeFile","jsonfile","finalEOL","replacer","spaces","EOF","Buffer","isBuffer","mkdtemp","withCallback","c","alloc","fromCharCode","g","h","substring","thenify","thenifyAll","source","destination","promisifyAll","promisify","deprecated","desc","createWrapper","createCallback","multiArgs","values","newFn","lastType","lastIndex","__createBinding","o","k2","__setModuleDefault","core","path_1","fs_extra_1","fs_1","async_1","rll","fixArgArr","generateSrc","generateDoc","disableJavaCheck","forceRun","threadCount","isNumeric","cpuCount","workingDir","resetWorkingDir","msg","appLogFile","logs","runCmd","base","downloadFile","cache","gotTemplateDirectory","line","exit","buildToolsArgs","ver","logFile","versionDir","lines","finally","packageJson","ab","__webpack_module_cache__","moduleId","__webpack_modules__","__dirname"],"mappings":"8DACA,IAAAA,EAAAC,MAAAA,KAAAD,cAAA,SAAAE,GACA,GAAAA,GAAAA,EAAAC,WAAA,OAAAD,EACA,IAAAE,EAAA,GACA,GAAAF,GAAA,KAAA,IAAA,IAAAG,KAAAH,EAAA,GAAAI,OAAAC,eAAAC,KAAAN,EAAAG,GAAAD,EAAAC,GAAAH,EAAAG,GACAD,EAAA,WAAAF,EACA,OAAAE,GAEAE,OAAAG,eAAAC,EAAA,aAAA,CAAAC,MAAA,OACA,MAAAC,EAAAZ,EAAAa,EAAA,OACA,MAAAC,EAAAD,EAAA,MAWA,SAAAE,aAAAC,EAAAC,EAAAC,GACA,MAAAC,EAAA,IAAAC,QAAAJ,EAAAC,EAAAC,GACAG,QAAAC,OAAAC,MAAAJ,EAAAK,WAAAZ,EAAAa,KAEAf,EAAAK,aAAAA,aACA,SAAAW,MAAAC,EAAAT,EAAA,IACAH,aAAAY,EAAA,GAAAT,GAEAR,EAAAgB,MAAAA,MACA,MAAAE,EAAA,KACA,MAAAR,QACAS,YAAAb,EAAAC,EAAAC,GACA,IAAAF,EAAA,CACAA,EAAA,kBAEAf,KAAAe,QAAAA,EACAf,KAAAgB,WAAAA,EACAhB,KAAAiB,QAAAA,EAEAW,WACA,IAAAC,EAAAF,EAAA3B,KAAAe,QACA,GAAAf,KAAAgB,YAAAX,OAAAyB,KAAA9B,KAAAgB,YAAAe,OAAA,EAAA,CACAF,GAAA,IACA,IAAAG,EAAA,KACA,IAAA,MAAAC,KAAAjC,KAAAgB,WAAA,CACA,GAAAhB,KAAAgB,WAAAV,eAAA2B,GAAA,CACA,MAAAC,EAAAlC,KAAAgB,WAAAiB,GACA,GAAAC,EAAA,CACA,GAAAF,EAAA,CACAA,EAAA,UAEA,CACAH,GAAA,IAEAA,MAAAI,KAAAE,eAAAD,QAKAL,MAAAF,IAAAS,WAAApC,KAAAiB,WACA,OAAAY,GAGA,SAAAO,WAAAC,GACA,OAAAxB,EAAAyB,eAAAD,GACAE,QAAA,KAAA,OACAA,QAAA,MAAA,OACAA,QAAA,MAAA,OAEA,SAAAJ,eAAAE,GACA,OAAAxB,EAAAyB,eAAAD,GACAE,QAAA,KAAA,OACAA,QAAA,MAAA,OACAA,QAAA,MAAA,OACAA,QAAA,KAAA,OACAA,QAAA,KAAA,2CC3EA,IAAAC,EAAAxC,MAAAA,KAAAwC,WAAA,SAAAC,EAAAC,EAAAC,EAAAC,GACA,SAAAC,MAAAnC,GAAA,OAAAA,aAAAiC,EAAAjC,EAAA,IAAAiC,EAAA,SAAAG,GAAAA,EAAApC,KACA,OAAA,IAAAiC,IAAAA,EAAAI,UAAA,SAAAD,EAAAE,GACA,SAAAC,UAAAvC,GAAA,IAAAwC,KAAAN,EAAAO,KAAAzC,IAAA,MAAA0C,GAAAJ,EAAAI,IACA,SAAAC,SAAA3C,GAAA,IAAAwC,KAAAN,EAAA,SAAAlC,IAAA,MAAA0C,GAAAJ,EAAAI,IACA,SAAAF,KAAA/C,GAAAA,EAAAmD,KAAAR,EAAA3C,EAAAO,OAAAmC,MAAA1C,EAAAO,OAAA6C,KAAAN,UAAAI,UACAH,MAAAN,EAAAA,EAAAY,MAAAf,EAAAC,GAAA,KAAAS,WAGA,IAAApD,EAAAC,MAAAA,KAAAD,cAAA,SAAAE,GACA,GAAAA,GAAAA,EAAAC,WAAA,OAAAD,EACA,IAAAE,EAAA,GACA,GAAAF,GAAA,KAAA,IAAA,IAAAG,KAAAH,EAAA,GAAAI,OAAAC,eAAAC,KAAAN,EAAAG,GAAAD,EAAAC,GAAAH,EAAAG,GACAD,EAAA,WAAAF,EACA,OAAAE,GAEAE,OAAAG,eAAAC,EAAA,aAAA,CAAAC,MAAA,OACA,MAAA+C,EAAA7C,EAAA,MACA,MAAA8C,EAAA9C,EAAA,KACA,MAAAC,EAAAD,EAAA,MACA,MAAAD,EAAAZ,EAAAa,EAAA,OACA,MAAA+C,EAAA5D,EAAAa,EAAA,OAIA,IAAAgD,GACA,SAAAA,GAIAA,EAAAA,EAAA,WAAA,GAAA,UAIAA,EAAAA,EAAA,WAAA,GAAA,WARA,CASAA,EAAAnD,EAAAmD,WAAAnD,EAAAmD,SAAA,KAUA,SAAAC,eAAAnC,EAAAQ,GACA,MAAA4B,EAAAjD,EAAAyB,eAAAJ,GACAd,QAAA2C,IAAArC,GAAAoC,EACA,MAAAE,EAAA5C,QAAA2C,IAAA,eAAA,GACA,GAAAC,EAAA,CACA,MAAAC,EAAA,sCACA,MAAAC,KAAAxC,MAAAuC,IAAAtD,EAAAa,MAAAsC,IAAAnD,EAAAa,MAAAyC,IACAP,EAAA5C,aAAA,MAAAoD,OAEA,CACAT,EAAA3C,aAAA,UAAA,CAAAY,KAAAA,GAAAoC,IAGArD,EAAAoD,eAAAA,eAKA,SAAAM,UAAAC,GACAX,EAAA3C,aAAA,WAAA,GAAAsD,GAEA3D,EAAA0D,UAAAA,UAKA,SAAAE,QAAAC,GACA,MAAAN,EAAA5C,QAAA2C,IAAA,gBAAA,GACA,GAAAC,EAAA,CACAN,EAAA5C,aAAA,OAAAwD,OAEA,CACAb,EAAA3C,aAAA,WAAA,GAAAwD,GAEAlD,QAAA2C,IAAA,WAAAO,IAAAX,EAAAM,YAAA7C,QAAA2C,IAAA,UAEAtD,EAAA4D,QAAAA,QAQA,SAAAE,SAAA7C,EAAA8C,GACA,MAAAtC,EAAAd,QAAA2C,aAAArC,EAAAa,QAAA,KAAA,KAAAkC,kBAAA,GACA,GAAAD,GAAAA,EAAAE,WAAAxC,EAAA,CACA,MAAA,IAAAyC,0CAAAjD,KAEA,OAAAQ,EAAA0C,OAEAnE,EAAA8D,SAAAA,SAQA,SAAAM,UAAAnD,EAAAhB,GACA+C,EAAA3C,aAAA,aAAA,CAAAY,KAAAA,GAAAhB,GAEAD,EAAAoE,UAAAA,UAMA,SAAAC,eAAAC,GACAtB,EAAAhC,MAAA,OAAAsD,EAAA,KAAA,OAEAtE,EAAAqE,eAAAA,eASA,SAAAE,UAAA/D,GACAG,QAAA6D,SAAArB,EAAAsB,QACAC,MAAAlE,GAEAR,EAAAuE,UAAAA,UAOA,SAAAI,UACA,OAAAhE,QAAA2C,IAAA,kBAAA,IAEAtD,EAAA2E,QAAAA,QAKA,SAAAC,MAAApE,GACAwC,EAAA3C,aAAA,QAAA,GAAAG,GAEAR,EAAA4E,MAAAA,MAKA,SAAAF,MAAAlE,GACAwC,EAAAhC,MAAA,QAAAR,aAAA0D,MAAA1D,EAAAM,WAAAN,GAEAR,EAAA0E,MAAAA,MAKA,SAAAG,QAAArE,GACAwC,EAAAhC,MAAA,UAAAR,aAAA0D,MAAA1D,EAAAM,WAAAN,GAEAR,EAAA6E,QAAAA,QAKA,SAAAC,KAAAtE,GACAG,QAAAC,OAAAC,MAAAL,EAAAN,EAAAa,KAEAf,EAAA8E,KAAAA,KAQA,SAAAC,WAAA9D,GACA+B,EAAAhC,MAAA,QAAAC,GAEAjB,EAAA+E,WAAAA,WAIA,SAAAC,WACAhC,EAAAhC,MAAA,YAEAhB,EAAAgF,SAAAA,SASA,SAAAC,MAAAhE,EAAAiE,GACA,OAAAnD,EAAAxC,UAAA,OAAA,EAAA,YACAwF,WAAA9D,GACA,IAAAvB,EACA,IACAA,QAAAwF,IAEA,QACAF,WAEA,OAAAtF,IAGAM,EAAAiF,MAAAA,MAWA,SAAAE,UAAAlE,EAAAhB,GACA+C,EAAA3C,aAAA,aAAA,CAAAY,KAAAA,GAAAhB,GAEAD,EAAAmF,UAAAA,UAOA,SAAAC,SAAAnE,GACA,OAAAN,QAAA2C,aAAArC,MAAA,GAEAjB,EAAAoF,SAAAA,2CC1OA,IAAA9F,EAAAC,MAAAA,KAAAD,cAAA,SAAAE,GACA,GAAAA,GAAAA,EAAAC,WAAA,OAAAD,EACA,IAAAE,EAAA,GACA,GAAAF,GAAA,KAAA,IAAA,IAAAG,KAAAH,EAAA,GAAAI,OAAAC,eAAAC,KAAAN,EAAAG,GAAAD,EAAAC,GAAAH,EAAAG,GACAD,EAAA,WAAAF,EACA,OAAAE,GAEAE,OAAAG,eAAAC,EAAA,aAAA,CAAAC,MAAA,OAGA,MAAAoF,EAAA/F,EAAAa,EAAA,OACA,MAAAD,EAAAZ,EAAAa,EAAA,OACA,MAAAC,EAAAD,EAAA,MACA,SAAAE,aAAAC,EAAAE,GACA,MAAA+C,EAAA5C,QAAA2C,cAAAhD,KACA,IAAAiD,EAAA,CACA,MAAA,IAAAW,8DAAA5D,KAEA,IAAA+E,EAAAC,WAAA/B,GAAA,CACA,MAAA,IAAAW,+BAAAX,KAEA8B,EAAAE,eAAAhC,KAAAnD,EAAAyB,eAAArB,KAAAN,EAAAa,MAAA,CACAyE,SAAA,SAGAxF,EAAAK,aAAAA,wCCxBAT,OAAAG,eAAAC,EAAA,aAAA,CAAAC,MAAA,OAKA,SAAA4B,eAAA4D,GACA,GAAAA,IAAA,MAAAA,IAAAC,UAAA,CACA,MAAA,QAEA,UAAAD,IAAA,UAAAA,aAAAE,OAAA,CACA,OAAAF,EAEA,OAAAG,KAAAC,UAAAJ,GAEAzF,EAAA6B,eAAAA,+BCjBAiE,EAAA9F,QAAAG,EAAA,KAAAA,GAAAmC,+BCEA,IAAAyD,EAAA,6BAEAC,EAAA,KAgCAF,EAAA9F,QAAA,SAAAiG,EAAAC,GACA,OAAA,SAAAC,SAAAC,EAAAC,GACAD,EAAAA,GAAA,KACAC,EAAAA,GAAA,GAEA,IAAAC,EAAAD,EAAAE,SAAA,MAGA,GAAAP,IAAA,MAAAM,EAAA,CACAN,EAAAC,EAAAF,IAAA,KAGA,GAAAC,IAAA,MACAI,IAAA,MACAJ,EAAAI,iBAAAA,EAAA,CAEA,MAAA,IAAAlC,MAAA,mCAAA8B,EAAAI,eACA,gEACA,2EAGA,GAAAJ,IAAA,KAAA,CAEA,GAAAI,IAAA,aAAAC,EAAA/D,UAAA,YAAA,CACA0D,EAAA,CACA1D,QAAA+D,EAAA/D,QACA8D,eAAAA,OAEA,CAEAJ,EAAAE,EAAAE,GAGA,GAAAE,EAAA,CAEAL,EAAAF,GAAAC,GAIA,OAAAA,+NCpDA,IAAAQ,EAAAC,QAAAL,w0BCvBA,SAAAG,EAAAG,GACA,KAAAA,EAAA1G,GACA,GAFA,CAIAT,KAAA,SAAAS,GAAA,aA+CA,SAAA+C,MAAAmC,KAAAyB,GACA,MAAA,IAAAC,IAAA1B,KAAAyB,KAAAC,GAGA,SAAAC,cAAA3B,GACA,OAAA,YAAAyB,GACA,IAAAG,EAAAH,EAAAI,MACA,OAAA7B,EAAApF,KAAAP,KAAAoH,EAAAG,IAMA,IAAAE,SAAAC,eAAA,YAAAA,aACA,IAAAC,SAAAvG,UAAA,iBAAAA,QAAAwG,WAAA,WAEA,SAAAC,SAAAlC,GACAmC,WAAAnC,EAAA,GAGA,SAAAoC,KAAAC,GACA,MAAA,CAAArC,KAAAyB,IAAAY,EAAA,IAAArC,KAAAyB,IAGA,IAAAa,EAEA,GAAAR,EAAA,CACAQ,EAAAP,kBACA,GAAAC,EAAA,CACAM,EAAA7G,QAAAwG,aACA,CACAK,EAAAJ,SAGA,IAAAK,EAAAH,KAAAE,GA0DA,SAAAE,SAAAC,GACA,GAAAC,QAAAD,GAAA,CACA,OAAA,YAAAhB,GACA,MAAAG,EAAAH,EAAAI,MACA,MAAAc,EAAAF,EAAA5E,MAAAxD,KAAAoH,GACA,OAAAmB,cAAAD,EAAAf,IAIA,OAAAD,cAAA,SAAAF,EAAAG,GACA,IAAApH,EACA,IACAA,EAAAiI,EAAA5E,MAAAxD,KAAAoH,GACA,MAAAhE,GACA,OAAAmE,EAAAnE,GAGA,GAAAjD,UAAAA,EAAAoD,OAAA,WAAA,CACA,OAAAgF,cAAApI,EAAAoH,OACA,CACAA,EAAA,KAAApH,MAKA,SAAAoI,cAAAD,EAAAf,GACA,OAAAe,EAAA/E,KAAA7C,IACA8H,eAAAjB,EAAA,KAAA7G,IACA+H,IACAD,eAAAjB,EAAAkB,GAAAA,EAAAxH,QAAAwH,EAAA,IAAA9D,MAAA8D,MAIA,SAAAD,eAAAjB,EAAApC,EAAAzE,GACA,IACA6G,EAAApC,EAAAzE,GACA,MAAA+H,GACAP,EAAA9E,IAAA,MAAAA,GAAAqF,IAIA,SAAAJ,QAAA1C,GACA,OAAAA,EAAA+C,OAAAC,eAAA,gBAGA,SAAAC,iBAAAjD,GACA,OAAAA,EAAA+C,OAAAC,eAAA,iBAGA,SAAAE,gBAAAC,GACA,cAAAA,EAAAJ,OAAAK,iBAAA,WAGA,SAAAC,UAAAC,GACA,UAAAA,IAAA,WAAA,MAAA,IAAAtE,MAAA,uBACA,OAAA0D,QAAAY,GAAAd,SAAAc,GAAAA,EAKA,SAAAC,SAAAD,EAAAE,EAAAF,EAAAlH,QACA,IAAAoH,EAAA,MAAA,IAAAxE,MAAA,sBACA,SAAAyE,aAAAhC,GACA,UAAAA,EAAA+B,EAAA,KAAA,WAAA,CACA,OAAAF,EAAAzF,MAAAxD,KAAAoH,GAGA,OAAA,IAAArE,QAAA,CAAAD,EAAAE,KACAoE,EAAA+B,EAAA,GAAA,EAAAV,KAAAY,KACA,GAAAZ,EAAA,OAAAzF,EAAAyF,GACA3F,EAAAuG,EAAAtH,OAAA,EAAAsH,EAAAA,EAAA,MAEAJ,EAAAzF,MAAAxD,KAAAoH,KAIA,OAAAgC,UAGA,SAAAE,UAAAC,GACA,OAAA,SAAAD,UAAAE,KAAAnC,GACA,MAAAoC,EAAAP,SAAA,SAAA3B,GACA,IAAAmC,EAAA1J,KACA,OAAAuJ,EAAAC,EAAA,CAAA7D,EAAAgE,KACAX,UAAArD,GAAAnC,MAAAkG,EAAArC,EAAAuC,OAAAD,KACApC,KAEA,OAAAkC,GAIA,SAAAI,UAAAN,EAAAO,EAAAC,EAAAxC,GACAuC,EAAAA,GAAA,GACA,IAAAE,EAAA,GACA,IAAAC,EAAA,EACA,IAAAC,EAAAlB,UAAAe,GAEA,OAAAR,EAAAO,EAAA,CAAApJ,EAAAyJ,EAAAC,KACA,IAAAC,EAAAJ,IACAC,EAAAxJ,EAAA,CAAA+H,EAAA6B,KACAN,EAAAK,GAAAC,EACAF,EAAA3B,MAEAA,IACAlB,EAAAkB,EAAAuB,KAIA,SAAAO,YAAA7J,GACA,OAAAA,UACAA,EAAAqB,SAAA,UACArB,EAAAqB,QAAA,GACArB,EAAAqB,OAAA,IAAA,EAKA,MAAAyI,EAAA,GAEA,SAAAC,KAAA9E,GACA,SAAA+E,WAAAtD,GACA,GAAAzB,IAAA,KAAA,OACA,IAAAgF,EAAAhF,EACAA,EAAA,KACAgF,EAAAnH,MAAAxD,KAAAoH,GAEA/G,OAAAuK,OAAAF,QAAA/E,GACA,OAAA+E,QAGA,SAAAG,YAAAC,GACA,OAAAA,EAAApC,OAAAqC,WAAAD,EAAApC,OAAAqC,YAGA,SAAAC,oBAAAF,GACA,IAAAG,GAAA,EACA,IAAAC,EAAAJ,EAAA/I,OACA,OAAA,SAAAoB,OACA,QAAA8H,EAAAC,EAAA,CAAAxK,MAAAoK,EAAAG,GAAAhJ,IAAAgJ,GAAA,MAIA,SAAAE,qBAAAJ,GACA,IAAAE,GAAA,EACA,OAAA,SAAA9H,OACA,IAAAiI,EAAAL,EAAA5H,OACA,GAAAiI,EAAA9H,KACA,OAAA,KACA2H,IACA,MAAA,CAAAvK,MAAA0K,EAAA1K,MAAAuB,IAAAgJ,IAIA,SAAAI,qBAAAvC,GACA,IAAAwC,EAAAxC,EAAAzI,OAAAyB,KAAAgH,GAAA,GACA,IAAAmC,GAAA,EACA,IAAAC,EAAAI,EAAAvJ,OACA,OAAA,SAAAoB,OACA,IAAAlB,EAAAqJ,IAAAL,GACA,OAAAA,EAAAC,EAAA,CAAAxK,MAAAoI,EAAA7G,GAAAA,IAAAA,GAAA,MAIA,SAAAsJ,eAAAT,GACA,GAAAP,YAAAO,GAAA,CACA,OAAAE,oBAAAF,GAGA,IAAAC,EAAAF,YAAAC,GACA,OAAAC,EAAAI,qBAAAJ,GAAAM,qBAAAP,GAGA,SAAAU,SAAA7F,GACA,OAAA,YAAAyB,GACA,GAAAzB,IAAA,KAAA,MAAA,IAAAhB,MAAA,gCACA,IAAAgG,EAAAhF,EACAA,EAAA,KACAgF,EAAAnH,MAAAxD,KAAAoH,IAKA,SAAAqE,iBAAA7I,EAAA8I,EAAA3B,EAAAxC,GACA,IAAAjE,EAAA,MACA,IAAAqI,EAAA,MACA,IAAAC,EAAA,MACA,IAAAC,EAAA,EACA,IAAAC,EAAA,EAEA,SAAAC,YAEA,GAAAF,GAAAH,GAAAE,GAAAtI,EAAA,OAEAsI,EAAA,KACAhJ,EAAAO,OAAAI,KAAA,EAAA7C,MAAAA,EAAA4C,KAAA0I,MAEA,GAAAL,GAAArI,EAAA,OACAsI,EAAA,MACA,GAAAI,EAAA,CACA1I,EAAA,KACA,GAAAuI,GAAA,EAAA,CAEAtE,EAAA,MAEA,OAEAsE,IACA9B,EAAArJ,EAAAoL,EAAAG,kBACAH,IACAC,cACAG,MAAAC,aAGA,SAAAF,iBAAAxD,EAAAtI,GAEA0L,GAAA,EACA,GAAAF,EAAA,OACA,GAAAlD,EAAA,OAAA0D,YAAA1D,GAEA,GAAAA,IAAA,MAAA,CACAnF,EAAA,KACAqI,EAAA,KACA,OAGA,GAAAxL,IAAAqK,GAAAlH,GAAAuI,GAAA,EAAA,CACAvI,EAAA,KAEA,OAAAiE,EAAA,MAEAwE,YAGA,SAAAI,YAAA1D,GACA,GAAAkD,EAAA,OACAC,EAAA,MACAtI,EAAA,KACAiE,EAAAkB,GAGAsD,YAGA,IAAAK,EAAAV,IACA,MAAA,CAAA5C,EAAAiB,EAAAxC,KACAA,EAAAkD,KAAAlD,GACA,GAAAmE,GAAA,EAAA,CACA,MAAA,IAAAW,WAAA,2CAEA,IAAAvD,EAAA,CACA,OAAAvB,EAAA,MAEA,GAAAqB,iBAAAE,GAAA,CACA,OAAA2C,iBAAA3C,EAAA4C,EAAA3B,EAAAxC,GAEA,GAAAsB,gBAAAC,GAAA,CACA,OAAA2C,iBAAA3C,EAAAJ,OAAAK,iBAAA2C,EAAA3B,EAAAxC,GAEA,IAAA+E,EAAAf,eAAAzC,GACA,IAAAxF,EAAA,MACA,IAAAqI,EAAA,MACA,IAAAE,EAAA,EACA,IAAAU,EAAA,MAEA,SAAAN,iBAAAxD,EAAA/H,GACA,GAAAiL,EAAA,OACAE,GAAA,EACA,GAAApD,EAAA,CACAnF,EAAA,KACAiE,EAAAkB,QAEA,GAAAA,IAAA,MAAA,CACAnF,EAAA,KACAqI,EAAA,UAEA,GAAAjL,IAAA8J,GAAAlH,GAAAuI,GAAA,EAAA,CACAvI,EAAA,KACA,OAAAiE,EAAA,WAEA,IAAAgF,EAAA,CACAR,aAIA,SAAAA,YACAQ,EAAA,KACA,MAAAV,EAAAH,IAAApI,EAAA,CACA,IAAAkJ,EAAAF,IACA,GAAAE,IAAA,KAAA,CACAlJ,EAAA,KACA,GAAAuI,GAAA,EAAA,CACAtE,EAAA,MAEA,OAEAsE,GAAA,EACA9B,EAAAyC,EAAA9L,MAAA8L,EAAAvK,IAAAuJ,SAAAS,mBAEAM,EAAA,MAGAR,cAyBA,SAAAU,cAAA3B,EAAAY,EAAA3B,EAAAxC,GACA,OAAA6E,EAAAV,EAAAU,CAAAtB,EAAA9B,UAAAe,GAAAxC,GAGA,IAAAmF,EAAAxD,SAAAuD,cAAA,GAGA,SAAAE,gBAAA7B,EAAAf,EAAAxC,GACAA,EAAAkD,KAAAlD,GACA,IAAA8C,EAAA,EACAuC,EAAA,GACA7K,OAAAA,GAAA+I,EACAa,EAAA,MACA,GAAA5J,IAAA,EAAA,CACAwF,EAAA,MAGA,SAAAsF,iBAAApE,EAAA/H,GACA,GAAA+H,IAAA,MAAA,CACAkD,EAAA,KAEA,GAAAA,IAAA,KAAA,OACA,GAAAlD,EAAA,CACAlB,EAAAkB,QACA,KAAAmE,IAAA7K,GAAArB,IAAA8J,EAAA,CACAjD,EAAA,OAIA,KAAA8C,EAAAtI,EAAAsI,IAAA,CACAN,EAAAe,EAAAT,GAAAA,EAAAmB,SAAAqB,oBAKA,SAAAC,cAAAhC,EAAAf,EAAAxC,GACA,OAAAmF,EAAA5B,EAAAiC,SAAAhD,EAAAxC,GA2CA,SAAAyF,OAAAlC,EAAAf,EAAAxC,GACA,IAAA0F,EAAA1C,YAAAO,GAAA6B,gBAAAG,cACA,OAAAG,EAAAnC,EAAA9B,UAAAe,GAAAxC,GAGA,IAAA2F,EAAAhE,SAAA8D,OAAA,GAuCA,SAAAG,IAAArC,EAAAf,EAAAxC,GACA,OAAAsC,UAAAqD,EAAApC,EAAAf,EAAAxC,GAEA,IAAA6F,EAAAlE,SAAAiE,IAAA,GAyCA,IAAAE,EAAA/D,UAAA8D,GAoBA,SAAAE,aAAAxC,EAAAf,EAAAxC,GACA,OAAAmF,EAAA5B,EAAA,EAAAf,EAAAxC,GAEA,IAAAgG,EAAArE,SAAAoE,aAAA,GAqBA,SAAAE,UAAA1C,EAAAf,EAAAxC,GACA,OAAAsC,UAAA0D,EAAAzC,EAAAf,EAAAxC,GAEA,IAAAkG,EAAAvE,SAAAsE,UAAA,GAqBA,IAAAE,EAAApE,UAAAmE,GAEA,MAAAE,EAAAjF,OAAA,mBAEA,SAAAkF,kBACA,IAAA9K,EAAAE,EACA,SAAAuE,SAAAkB,KAAArB,GACA,GAAAqB,EAAA,OAAAzF,EAAAyF,GACA3F,EAAAsE,EAAArF,OAAA,EAAAqF,EAAAA,EAAA,IAGAG,SAAAoG,GAAA,IAAA5K,QAAA,CAAA8K,EAAAC,KACAhL,EAAA+K,EACA7K,EAAA8K,IAGA,OAAAvG,SAkFA,SAAAwG,KAAAC,EAAAC,EAAA1G,GACA,UAAA0G,IAAA,SAAA,CAEA1G,EAAA0G,EACAA,EAAA,KAEA1G,EAAAkD,KAAAlD,GAAAqG,mBACA,IAAAM,EAAA7N,OAAAyB,KAAAkM,GAAAjM,OACA,IAAAmM,EAAA,CACA,OAAA3G,EAAA,MAEA,IAAA0G,EAAA,CACAA,EAAAC,EAGA,IAAAlE,EAAA,GACA,IAAAmE,EAAA,EACA,IAAAxC,EAAA,MACA,IAAAyC,EAAA,MAEA,IAAAC,EAAAhO,OAAAiO,OAAA,MAEA,IAAAC,EAAA,GAGA,IAAAC,EAAA,GAEA,IAAAC,EAAA,GAEApO,OAAAyB,KAAAkM,GAAAU,QAAAzM,IACA,IAAA0M,EAAAX,EAAA/L,GACA,IAAA2M,MAAAC,QAAAF,GAAA,CAEAG,YAAA7M,EAAA,CAAA0M,IACAH,EAAAO,KAAA9M,GACA,OAGA,IAAA+M,EAAAL,EAAAM,MAAA,EAAAN,EAAA5M,OAAA,GACA,IAAAmN,EAAAF,EAAAjN,OACA,GAAAmN,IAAA,EAAA,CACAJ,YAAA7M,EAAA0M,GACAH,EAAAO,KAAA9M,GACA,OAEAwM,EAAAxM,GAAAiN,EAEAF,EAAAN,QAAAS,IACA,IAAAnB,EAAAmB,GAAA,CACA,MAAA,IAAAxK,MAAA,oBAAA1C,EACA,oCACAkN,EAAA,QACAH,EAAAI,KAAA,OAEAC,YAAAF,EAAA,KACAD,IACA,GAAAA,IAAA,EAAA,CACAJ,YAAA7M,EAAA0M,UAMAW,oBACAC,eAEA,SAAAT,YAAA7M,EAAA0M,GACAJ,EAAAQ,KAAA,IAAAS,QAAAvN,EAAA0M,IAGA,SAAAY,eACA,GAAA5D,EAAA,OACA,GAAA4C,EAAAxM,SAAA,GAAAoM,IAAA,EAAA,CACA,OAAA5G,EAAA,KAAAyC,GAEA,MAAAuE,EAAAxM,QAAAoM,EAAAF,EAAA,CACA,IAAAwB,EAAAlB,EAAAmB,QACAD,KAKA,SAAAJ,YAAAM,EAAAhK,GACA,IAAAiK,EAAAvB,EAAAsB,GACA,IAAAC,EAAA,CACAA,EAAAvB,EAAAsB,GAAA,GAGAC,EAAAb,KAAApJ,GAGA,SAAAkK,aAAAF,GACA,IAAAC,EAAAvB,EAAAsB,IAAA,GACAC,EAAAlB,QAAA/I,GAAAA,KACA4J,eAIA,SAAAC,QAAAvN,EAAA0M,GACA,GAAAP,EAAA,OAEA,IAAA0B,EAAAtE,SAAA,CAAA/C,KAAAtI,KACAgO,IACA,GAAA1F,IAAA,MAAA,CACAkD,EAAA,KACA,OAEA,GAAAxL,EAAA4B,OAAA,EAAA,EACA5B,GAAAA,EAEA,GAAAsI,EAAA,CACA,IAAAsH,EAAA,GACA1P,OAAAyB,KAAAkI,GAAA0E,QAAAsB,IACAD,EAAAC,GAAAhG,EAAAgG,KAEAD,EAAA9N,GAAA9B,EACAiO,EAAA,KACAC,EAAAhO,OAAAiO,OAAA,MACA,GAAA3C,EAAA,OACApE,EAAAkB,EAAAsH,OACA,CACA/F,EAAA/H,GAAA9B,EACA0P,aAAA5N,MAIAkM,IACA,IAAA8B,EAAAjH,UAAA2F,EAAAA,EAAA5M,OAAA,IACA,GAAA4M,EAAA5M,OAAA,EAAA,CACAkO,EAAAjG,EAAA8F,OACA,CACAG,EAAAH,IAIA,SAAAR,oBAIA,IAAAY,EACA,IAAAjG,EAAA,EACA,MAAAuE,EAAAzM,OAAA,CACAmO,EAAA1B,EAAAhH,MACAyC,IACAkG,cAAAD,GAAAxB,QAAA0B,IACA,KAAA3B,EAAA2B,KAAA,EAAA,CACA5B,EAAAO,KAAAqB,MAKA,GAAAnG,IAAAiE,EAAA,CACA,MAAA,IAAAvJ,MACA,kEAKA,SAAAwL,cAAAR,GACA,IAAAxP,EAAA,GACAE,OAAAyB,KAAAkM,GAAAU,QAAAzM,IACA,MAAA0M,EAAAX,EAAA/L,GACA,GAAA2M,MAAAC,QAAAF,IAAAA,EAAA0B,QAAAV,IAAA,EAAA,CACAxP,EAAA4O,KAAA9M,MAGA,OAAA9B,EAGA,OAAAoH,EAAAoG,GAGA,IAAA2C,EAAA,gEACA,IAAAC,EAAA,8CACA,IAAAC,EAAA,IACA,IAAAC,EAAA,eACA,IAAAC,EAAA,mCAEA,SAAAC,YAAAvI,GACA,MAAAwI,EAAAxI,EAAA7G,WAAAgB,QAAAmO,EAAA,IACA,IAAAG,EAAAD,EAAAC,MAAAP,GACA,IAAAO,EAAA,CACAA,EAAAD,EAAAC,MAAAN,GAEA,IAAAM,EAAA,MAAA,IAAAlM,MAAA,gDAAAiM,GACA,IAAA,CAAAxJ,GAAAyJ,EACA,OAAAzJ,EACA7E,QAAA,MAAA,IACAuO,MAAAN,GACArD,IAAA4D,GAAAA,EAAAxO,QAAAkO,EAAA,IAAA7L,QAsFA,SAAAoM,WAAAhD,EAAAzG,GACA,IAAA0J,EAAA,GAEA5Q,OAAAyB,KAAAkM,GAAAU,QAAAzM,IACA,IAAAgO,EAAAjC,EAAA/L,GACA,IAAAiP,EACA,IAAAC,EAAA9I,QAAA4H,GACA,IAAAmB,GACAD,GAAAlB,EAAAlO,SAAA,GACAoP,GAAAlB,EAAAlO,SAAA,EAEA,GAAA6M,MAAAC,QAAAoB,GAAA,CACAiB,EAAA,IAAAjB,GACAA,EAAAiB,EAAA1J,MAEAyJ,EAAAhP,GAAAiP,EAAAtH,OAAAsH,EAAAnP,OAAA,EAAAsP,QAAApB,QACA,GAAAmB,EAAA,CAEAH,EAAAhP,GAAAgO,MACA,CACAiB,EAAAP,YAAAV,GACA,GAAAA,EAAAlO,SAAA,IAAAoP,GAAAD,EAAAnP,SAAA,EAAA,CACA,MAAA,IAAA4C,MAAA,0DAIA,IAAAwM,EAAAD,EAAA1J,MAEAyJ,EAAAhP,GAAAiP,EAAAtH,OAAAyH,SAGA,SAAAA,QAAArH,EAAAsH,GACA,IAAAC,EAAAL,EAAA/D,IAAAzL,GAAAsI,EAAAtI,IACA6P,EAAAxC,KAAAuC,GACAtI,UAAAiH,EAAAjH,IAAAuI,MAIA,OAAAxD,KAAAkD,EAAA1J,GAOA,MAAAiK,IACA5P,cACA5B,KAAAyR,KAAAzR,KAAA0R,KAAA,KACA1R,KAAA+B,OAAA,EAGAH,WAAA+P,GACA,GAAAA,EAAAC,KAAAD,EAAAC,KAAAzO,KAAAwO,EAAAxO,UACAnD,KAAAyR,KAAAE,EAAAxO,KACA,GAAAwO,EAAAxO,KAAAwO,EAAAxO,KAAAyO,KAAAD,EAAAC,UACA5R,KAAA0R,KAAAC,EAAAC,KAEAD,EAAAC,KAAAD,EAAAxO,KAAA,KACAnD,KAAA+B,QAAA,EACA,OAAA4P,EAGA/P,QACA,MAAA5B,KAAAyR,KAAAzR,KAAA0P,QACA,OAAA1P,KAGA4B,YAAA+P,EAAAE,GACAA,EAAAD,KAAAD,EACAE,EAAA1O,KAAAwO,EAAAxO,KACA,GAAAwO,EAAAxO,KAAAwO,EAAAxO,KAAAyO,KAAAC,OACA7R,KAAA0R,KAAAG,EACAF,EAAAxO,KAAA0O,EACA7R,KAAA+B,QAAA,EAGAH,aAAA+P,EAAAE,GACAA,EAAAD,KAAAD,EAAAC,KACAC,EAAA1O,KAAAwO,EACA,GAAAA,EAAAC,KAAAD,EAAAC,KAAAzO,KAAA0O,OACA7R,KAAAyR,KAAAI,EACAF,EAAAC,KAAAC,EACA7R,KAAA+B,QAAA,EAGAH,QAAA+P,GACA,GAAA3R,KAAAyR,KAAAzR,KAAA8R,aAAA9R,KAAAyR,KAAAE,QACAI,WAAA/R,KAAA2R,GAGA/P,KAAA+P,GACA,GAAA3R,KAAA0R,KAAA1R,KAAAgS,YAAAhS,KAAA0R,KAAAC,QACAI,WAAA/R,KAAA2R,GAGA/P,QACA,OAAA5B,KAAAyR,MAAAzR,KAAAiS,WAAAjS,KAAAyR,MAGA7P,MACA,OAAA5B,KAAA0R,MAAA1R,KAAAiS,WAAAjS,KAAA0R,MAGA9P,UACA,MAAA,IAAA5B,MAGA4B,EAAA8G,OAAAqC,YACA,IAAAmH,EAAAlS,KAAAyR,KACA,MAAAS,EAAA,OACAA,EAAAC,KACAD,EAAAA,EAAA/O,MAIAvB,OAAAwQ,GACA,IAAAC,EAAArS,KAAAyR,KACA,MAAAY,EAAA,CACA,IAAAlP,KAAAA,GAAAkP,EACA,GAAAD,EAAAC,GAAA,CACArS,KAAAiS,WAAAI,GAEAA,EAAAlP,EAEA,OAAAnD,MAIA,SAAA+R,WAAAO,EAAAX,GACAW,EAAAvQ,OAAA,EACAuQ,EAAAb,KAAAa,EAAAZ,KAAAC,EAGA,SAAAY,MAAAC,EAAAvE,EAAAwE,GACA,GAAAxE,GAAA,KAAA,CACAA,EAAA,OAEA,GAAAA,IAAA,EAAA,CACA,MAAA,IAAA5B,WAAA,gCAGA,IAAAqG,EAAA1J,UAAAwJ,GACA,IAAAG,EAAA,EACA,IAAAC,EAAA,GACA,MAAAC,EAAA,CACA1N,MAAA,GACA2N,MAAA,GACAC,UAAA,GACAC,YAAA,GACAC,MAAA,IAGA,SAAAC,GAAAC,EAAAC,GACAP,EAAAM,GAAApE,KAAAqE,GAGA,SAAA3I,KAAA0I,EAAAC,GACA,MAAAC,EAAA,IAAAjM,KACAkM,IAAAH,EAAAE,GACAD,KAAAhM,IAEAyL,EAAAM,GAAApE,KAAAsE,GAGA,SAAAC,IAAAH,EAAAC,GACA,IAAAD,EAAA,OAAA9S,OAAAyB,KAAA+Q,GAAAnE,QAAA6E,GAAAV,EAAAU,GAAA,IACA,IAAAH,EAAA,OAAAP,EAAAM,GAAA,GACAN,EAAAM,GAAAN,EAAAM,GAAAK,OAAAD,GAAAA,IAAAH,GAGA,SAAAK,QAAAN,KAAA/L,GACAyL,EAAAM,GAAAzE,QAAA0E,GAAAA,KAAAhM,IAGA,IAAAsM,EAAA,MACA,SAAAC,QAAAxB,EAAAyB,EAAAC,EAAAtM,GACA,GAAAA,GAAA,aAAAA,IAAA,WAAA,CACA,MAAA,IAAA5C,MAAA,oCAEAmP,EAAAC,QAAA,KAEA,IAAAlG,EAAAC,EACA,SAAAF,gBAAAnF,KAAArB,GAGA,GAAAqB,EAAA,OAAAoL,EAAA/F,EAAArF,GAAAoF,IACA,GAAAzG,EAAArF,QAAA,EAAA,OAAA8L,EAAAzG,EAAA,IACAyG,EAAAzG,GAGA,IAAAgE,EAAA,CACA+G,KAAAA,EACA5K,SAAAsM,EACAjG,gBACArG,GAAAqG,iBAGA,GAAAgG,EAAA,CACAE,EAAAE,OAAAC,QAAA7I,OACA,CACA0I,EAAAE,OAAAjF,KAAA3D,GAGA,IAAAsI,EAAA,CACAA,EAAA,KACAxL,EAAA,KACAwL,EAAA,MACAI,EAAA1S,YAIA,GAAAyS,IAAAtM,EAAA,CACA,OAAA,IAAAxE,QAAA,CAAAD,EAAAE,KACA6K,EAAA/K,EACAgL,EAAA9K,KAKA,SAAAkR,UAAAlG,GACA,OAAA,SAAAvF,KAAArB,GACAuL,GAAA,EAEA,IAAA,IAAA1H,EAAA,EAAAkJ,EAAAnG,EAAAjM,OAAAkJ,EAAAkJ,EAAAlJ,IAAA,CACA,IAAA0D,EAAAX,EAAA/C,GAEA,IAAAZ,EAAAuI,EAAAvC,QAAA1B,GACA,GAAAtE,IAAA,EAAA,CACAuI,EAAAlD,aACA,GAAArF,EAAA,EAAA,CACAuI,EAAAwB,OAAA/J,EAAA,GAGAsE,EAAApH,SAAAkB,KAAArB,GAEA,GAAAqB,GAAA,KAAA,CACAgL,QAAA,QAAAhL,EAAAkG,EAAAwD,OAIA,GAAAQ,GAAAmB,EAAA7F,YAAA6F,EAAAO,OAAA,CACAZ,QAAA,eAGA,GAAAK,EAAAQ,OAAA,CACAb,QAAA,SAEAK,EAAA1S,WAIA,SAAAmT,YAAApC,GACA,GAAAA,EAAApQ,SAAA,GAAA+R,EAAAQ,OAAA,CAEApM,EAAA,IAAAuL,QAAA,UACA,OAAA,KAEA,OAAA,MAGA,MAAAe,EAAA9S,GAAA0R,IACA,IAAAA,EAAA,CACA,OAAA,IAAArQ,QAAA,CAAAD,EAAAE,KACAyH,KAAA/I,EAAA,CAAA+G,EAAA0J,KACA,GAAA1J,EAAA,OAAAzF,EAAAyF,GACA3F,EAAAqP,OAIAmB,IAAA5R,GACAwR,GAAAxR,EAAA0R,IAIA,IAAAqB,EAAA,MACA,IAAAX,EAAA,CACAE,OAAA,IAAAxC,IACA5P,EAAA8G,OAAAqC,kBACA+I,EAAAE,OAAAtL,OAAAqC,aAEAkD,YAAAA,EACAwE,QAAAA,EACA4B,OAAApG,EAAA,EACA8F,QAAA,MACAW,OAAA,MACA9S,KAAAuQ,EAAA5K,GACA,GAAAqH,MAAAC,QAAAsD,GAAA,CACA,GAAAoC,YAAApC,GAAA,OACA,OAAAA,EAAAhF,IAAAwH,GAAAhB,QAAAgB,EAAA,MAAA,MAAApN,IAEA,OAAAoM,QAAAxB,EAAA,MAAA,MAAA5K,IAEA3F,UAAAuQ,EAAA5K,GACA,GAAAqH,MAAAC,QAAAsD,GAAA,CACA,GAAAoC,YAAApC,GAAA,OACA,OAAAA,EAAAhF,IAAAwH,GAAAhB,QAAAgB,EAAA,MAAA,KAAApN,IAEA,OAAAoM,QAAAxB,EAAA,MAAA,KAAA5K,IAEA3F,OACA0R,MACAQ,EAAAE,OAAAf,SAEArR,QAAAuQ,EAAA5K,GACA,GAAAqH,MAAAC,QAAAsD,GAAA,CACA,GAAAoC,YAAApC,GAAA,OACA,OAAAA,EAAAhF,IAAAwH,GAAAhB,QAAAgB,EAAA,KAAA,MAAApN,IAEA,OAAAoM,QAAAxB,EAAA,KAAA,MAAA5K,IAEA3F,aAAAuQ,EAAA5K,GACA,GAAAqH,MAAAC,QAAAsD,GAAA,CACA,GAAAoC,YAAApC,GAAA,OACA,OAAAA,EAAAhF,IAAAwH,GAAAhB,QAAAgB,EAAA,KAAA,KAAApN,IAEA,OAAAoM,QAAAxB,EAAA,KAAA,KAAA5K,IAEA3F,OAAAwQ,GACA0B,EAAAE,OAAAY,OAAAxC,IAEAxQ,UAGA,GAAA6S,EAAA,CACA,OAEAA,EAAA,KACA,OAAAX,EAAAY,QAAA/B,EAAAmB,EAAA7F,aAAA6F,EAAAE,OAAAjS,OAAA,CACA,IAAAiM,EAAA,GAAAmE,EAAA,GACA,IAAAgC,EAAAL,EAAAE,OAAAjS,OACA,GAAA+R,EAAArB,QAAA0B,EAAAU,KAAAC,IAAAX,EAAAL,EAAArB,SACA,IAAA,IAAAxH,EAAA,EAAAA,EAAAkJ,EAAAlJ,IAAA,CACA,IAAA0G,EAAAmC,EAAAE,OAAAtE,QACA1B,EAAAe,KAAA4C,GACAiB,EAAA7D,KAAA4C,GACAQ,EAAApD,KAAA4C,EAAAQ,MAGAQ,GAAA,EAEA,GAAAmB,EAAAE,OAAAjS,SAAA,EAAA,CACA0R,QAAA,SAGA,GAAAd,IAAAmB,EAAA7F,YAAA,CACAwF,QAAA,aAGA,IAAA9J,EAAA6B,SAAA0I,UAAAlG,IACA0E,EAAAP,EAAAxI,GAEA8K,EAAA,OAEA7S,SACA,OAAAkS,EAAAE,OAAAjS,QAEAH,UACA,OAAA+Q,GAEA/Q,cACA,OAAAgR,GAEAhR,OACA,OAAAkS,EAAAE,OAAAjS,OAAA4Q,IAAA,GAEA/Q,QACAkS,EAAAY,OAAA,MAEA9S,SACA,GAAAkS,EAAAY,SAAA,MAAA,CAAA,OACAZ,EAAAY,OAAA,MACAxM,EAAA4L,EAAA1S,WAIAf,OAAA0U,iBAAAjB,EAAA,CACAf,UAAA,CACAiC,SAAA,MACAtU,MAAA8T,EAAA,cAEAxB,YAAA,CACAgC,SAAA,MACAtU,MAAA8T,EAAA,gBAEAvB,MAAA,CACA+B,SAAA,MACAtU,MAAA8T,EAAA,UAEA1B,MAAA,CACAkC,SAAA,MACAtU,MAAA8T,EAAA,UAEArP,MAAA,CACA6P,SAAA,MACAtU,MAAA8T,EAAA,YAGA,OAAAV,EAiDA,SAAAmB,MAAAzC,EAAAC,GACA,OAAAF,MAAAC,EAAA,EAAAC,GAyDA,SAAAyC,QAAA1C,EAAAvE,EAAAwE,GACA,OAAAF,MAAAC,EAAAvE,EAAAwE,GA4CA,SAAA0C,OAAArK,EAAAsK,EAAArL,EAAAxC,GACAA,EAAAkD,KAAAlD,GACA,IAAA2C,EAAAlB,UAAAe,GACA,OAAAwD,EAAAzC,EAAA,CAAAuK,EAAApK,EAAAb,KACAF,EAAAkL,EAAAC,EAAA,CAAA5M,EAAA6B,KACA8K,EAAA9K,EACAF,EAAA3B,MAEAA,GAAAlB,EAAAkB,EAAA2M,IAEA,IAAAE,EAAApM,SAAAiM,OAAA,GAwCA,SAAAI,OAAAC,GACA,IAAAC,EAAAD,EAAArI,IAAAnE,WACA,OAAA,YAAA5B,GACA,IAAAsC,EAAA1J,KAEA,IAAA2J,EAAAvC,EAAAA,EAAArF,OAAA,GACA,UAAA4H,GAAA,WAAA,CACAvC,EAAAI,UACA,CACAmC,EAAAiE,kBAGA0H,EAAAG,EAAArO,EAAA,CAAAsO,EAAA/P,EAAAyE,KACAzE,EAAAnC,MAAAkG,EAAAgM,EAAA9L,OAAA,CAAAnB,KAAAkN,KACAvL,EAAA3B,EAAAkN,OAGA,CAAAlN,EAAAuB,IAAAL,EAAAlB,KAAAuB,IAEA,OAAAL,EAAAgE,IA0CA,SAAAiI,WAAAxO,GACA,OAAAmO,OAAAnO,EAAAyO,WAuBA,SAAAC,SAAAhL,EAAAY,EAAA3B,EAAAxC,GACA,OAAAsC,UAAAuC,EAAAV,GAAAZ,EAAAf,EAAAxC,GAEA,IAAAwO,EAAA7M,SAAA4M,SAAA,GAsBA,SAAAE,YAAAlL,EAAAY,EAAA3B,EAAAxC,GACA,IAAA2C,EAAAlB,UAAAe,GACA,OAAAgM,EAAAjL,EAAAY,EAAA,CAAAxJ,EAAAkI,KACAF,EAAAhI,EAAA,CAAAuG,KAAArB,KACA,GAAAqB,EAAA,OAAA2B,EAAA3B,GACA,OAAA2B,EAAA3B,EAAArB,MAEA,CAAAqB,EAAAwN,KACA,IAAA9V,EAAA,GACA,IAAA,IAAA8K,EAAA,EAAAA,EAAAgL,EAAAlU,OAAAkJ,IAAA,CACA,GAAAgL,EAAAhL,GAAA,CACA9K,EAAAA,EAAAyJ,UAAAqM,EAAAhL,KAIA,OAAA1D,EAAAkB,EAAAtI,KAGA,IAAA+V,EAAAhN,SAAA8M,YAAA,GA4BA,SAAApM,OAAAkB,EAAAf,EAAAxC,GACA,OAAA2O,EAAApL,EAAAiC,SAAAhD,EAAAxC,GAEA,IAAA4O,EAAAjN,SAAAU,OAAA,GAsBA,SAAAwM,aAAAtL,EAAAf,EAAAxC,GACA,OAAA2O,EAAApL,EAAA,EAAAf,EAAAxC,GAEA,IAAA8O,EAAAnN,SAAAkN,aAAA,GA4CA,SAAAE,YAAAlP,GACA,OAAA,YAAAmP,GACA,IAAAhP,EAAAgP,EAAA/O,MACA,OAAAD,EAAA,QAAAH,IAIA,SAAAoP,cAAAC,EAAAC,GACA,MAAA,CAAAnN,EAAAO,EAAAI,EAAAP,KACA,IAAAgN,EAAA,MACA,IAAAC,EACA,MAAA7M,EAAAf,UAAAkB,GACAX,EAAAO,EAAA,CAAApJ,EAAAyJ,EAAA5C,KACAwC,EAAArJ,EAAA,CAAA+H,EAAAtI,KACA,GAAAsI,GAAAA,IAAA,MAAA,OAAAlB,EAAAkB,GAEA,GAAAgO,EAAAtW,KAAAyW,EAAA,CACAD,EAAA,KACAC,EAAAF,EAAA,KAAAhW,GACA,OAAA6G,EAAA,KAAAiD,GAEAjD,OAEAkB,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACAkB,EAAA,KAAAgN,EAAAC,EAAAF,EAAA,WAyCA,SAAAG,OAAA/L,EAAAf,EAAAxC,GACA,OAAAiP,cAAAM,GAAAA,EAAA,CAAAjJ,EAAAzC,IAAAA,EAAAoL,CAAAtJ,EAAApC,EAAAf,EAAAxC,GAEA,IAAAwP,EAAA7N,SAAA2N,OAAA,GAyBA,SAAAG,YAAAlM,EAAAY,EAAA3B,EAAAxC,GACA,OAAAiP,cAAAM,GAAAA,EAAA,CAAAjJ,EAAAzC,IAAAA,EAAAoL,CAAApK,EAAAV,GAAAZ,EAAAf,EAAAxC,GAEA,IAAA0P,EAAA/N,SAAA8N,YAAA,GAuBA,SAAAE,aAAApM,EAAAf,EAAAxC,GACA,OAAAiP,cAAAM,GAAAA,EAAA,CAAAjJ,EAAAzC,IAAAA,EAAAoL,CAAApK,EAAA,GAAAtB,EAAAf,EAAAxC,GAGA,IAAA4P,EAAAjO,SAAAgO,aAAA,GAEA,SAAAE,YAAA1V,GACA,MAAA,CAAAiE,KAAAyB,IAAA4B,UAAArD,EAAAqD,IAAA5B,EAAA,CAAAqB,KAAA4O,KACA,UAAAC,UAAA,SAAA,CACA,GAAA7O,EAAA,CACA,GAAA6O,QAAAnS,MAAA,CACAmS,QAAAnS,MAAAsD,SAEA,GAAA6O,QAAA5V,GAAA,CACA2V,EAAA3I,QAAA2G,GAAAiC,QAAA5V,GAAA2T,QAmCA,IAAAkC,EAAAH,YAAA,OAyBA,SAAAI,SAAAzN,EAAA0N,EAAAlQ,GACAA,EAAAiE,SAAAjE,GACA,IAAAmQ,EAAA1O,UAAAe,GACA,IAAA4N,EAAA3O,UAAAyO,GACA,IAAAzN,EAEA,SAAA7G,KAAAsF,KAAArB,GACA,GAAAqB,EAAA,OAAAlB,EAAAkB,GACA,GAAAA,IAAA,MAAA,OACAuB,EAAA5C,EACAuQ,KAAAvQ,EAAAqP,OAGA,SAAAA,MAAAhO,EAAAmP,GACA,GAAAnP,EAAA,OAAAlB,EAAAkB,GACA,GAAAA,IAAA,MAAA,OACA,IAAAmP,EAAA,OAAArQ,EAAA,QAAAyC,GACA0N,EAAAvU,MAGA,OAAAsT,MAAA,KAAA,MAGA,IAAAoB,EAAA3O,SAAAsO,SAAA,GAuBA,SAAAM,QAAA/N,EAAA0N,EAAAlQ,GACA,MAAAoQ,EAAA3O,UAAAyO,GACA,OAAAI,EAAA9N,EAAA,IAAA3C,KACA,MAAAuC,EAAAvC,EAAAI,MACAmQ,KAAAvQ,EAAA,CAAAqB,EAAAmP,IAAAjO,EAAAlB,GAAAmP,KACArQ,GAGA,SAAAwQ,cAAAhO,GACA,MAAA,CAAArJ,EAAA2J,EAAA9C,IAAAwC,EAAArJ,EAAA6G,GA6DA,SAAAyQ,UAAAlN,EAAAf,EAAAxC,GACA,OAAA2F,EAAApC,EAAAiN,cAAA/O,UAAAe,IAAAxC,GAGA,IAAA0Q,EAAA/O,SAAA8O,UAAA,GAuBA,SAAAE,YAAApN,EAAAY,EAAA3B,EAAAxC,GACA,OAAA6E,EAAAV,EAAAU,CAAAtB,EAAAiN,cAAA/O,UAAAe,IAAAxC,GAEA,IAAA4Q,EAAAjP,SAAAgP,YAAA,GAyBA,SAAAE,WAAAtN,EAAAf,EAAAxC,GACA,OAAA4Q,EAAArN,EAAA,EAAAf,EAAAxC,GAEA,IAAA8Q,EAAAnP,SAAAkP,WAAA,GAqCA,SAAAE,YAAA3S,GACA,GAAA0C,QAAA1C,GAAA,OAAAA,EACA,OAAA,YAAAyB,GACA,IAAAG,EAAAH,EAAAI,MACA,IAAA+Q,EAAA,KACAnR,EAAA2H,KAAA,IAAAyJ,KACA,GAAAD,EAAA,CACArQ,EAAA,IAAAX,KAAAiR,QACA,CACAjR,KAAAiR,MAGA7S,EAAAnC,MAAAxD,KAAAoH,GACAmR,EAAA,OAiCA,SAAAE,MAAA3N,EAAAf,EAAAxC,GACA,OAAAiP,cAAAM,IAAAA,EAAAjJ,IAAAA,EAAA2I,CAAAtJ,EAAApC,EAAAf,EAAAxC,GAEA,IAAAmR,EAAAxP,SAAAuP,MAAA,GAuBA,SAAAE,WAAA7N,EAAAY,EAAA3B,EAAAxC,GACA,OAAAiP,cAAAM,IAAAA,EAAAjJ,IAAAA,EAAA2I,CAAApK,EAAAV,GAAAZ,EAAAf,EAAAxC,GAEA,IAAAqR,EAAA1P,SAAAyP,WAAA,GAsBA,SAAAE,YAAA/N,EAAAf,EAAAxC,GACA,OAAAiP,cAAAM,IAAAA,EAAAjJ,IAAAA,EAAA2I,CAAAjJ,EAAAzC,EAAAf,EAAAxC,GAEA,IAAAuR,EAAA5P,SAAA2P,YAAA,GAEA,SAAAE,YAAAxP,EAAAO,EAAAC,EAAAxC,GACA,IAAAyR,EAAA,IAAApK,MAAA9E,EAAA/H,QACAwH,EAAAO,EAAA,CAAAuL,EAAAhL,EAAAD,KACAL,EAAAsL,EAAA,CAAA5M,EAAA6B,KACA0O,EAAA3O,KAAAC,EACAF,EAAA3B,MAEAA,IACA,GAAAA,EAAA,OAAAlB,EAAAkB,GACA,IAAAuB,EAAA,GACA,IAAA,IAAAiB,EAAA,EAAAA,EAAAnB,EAAA/H,OAAAkJ,IAAA,CACA,GAAA+N,EAAA/N,GAAAjB,EAAA+E,KAAAjF,EAAAmB,IAEA1D,EAAA,KAAAyC,KAIA,SAAAiP,cAAA1P,EAAAuB,EAAAf,EAAAxC,GACA,IAAAyC,EAAA,GACAT,EAAAuB,EAAA,CAAAuK,EAAAhL,EAAAD,KACAL,EAAAsL,EAAA,CAAA5M,EAAA6B,KACA,GAAA7B,EAAA,OAAA2B,EAAA3B,GACA,GAAA6B,EAAA,CACAN,EAAA+E,KAAA,CAAA1E,MAAAA,EAAA3J,MAAA2U,IAEAjL,EAAA3B,MAEAA,IACA,GAAAA,EAAA,OAAAlB,EAAAkB,GACAlB,EAAA,KAAAyC,EACAkP,KAAA,CAAAC,EAAAC,IAAAD,EAAA9O,MAAA+O,EAAA/O,OACA8C,IAAA7C,GAAAA,EAAA5J,UAIA,SAAA2Y,QAAA9P,EAAAuB,EAAAf,EAAAxC,GACA,IAAAiM,EAAAjJ,YAAAO,GAAAiO,YAAAE,cACA,OAAAzF,EAAAjK,EAAAuB,EAAA9B,UAAAe,GAAAxC,GA+BA,SAAAiM,OAAA1I,EAAAf,EAAAxC,GACA,OAAA8R,QAAAnM,EAAApC,EAAAf,EAAAxC,GAEA,IAAA+R,EAAApQ,SAAAsK,OAAA,GAsBA,SAAA+F,YAAAzO,EAAAY,EAAA3B,EAAAxC,GACA,OAAA8R,QAAAjN,EAAAV,GAAAZ,EAAAf,EAAAxC,GAEA,IAAAiS,EAAAtQ,SAAAqQ,YAAA,GAoBA,SAAAE,aAAA3O,EAAAf,EAAAxC,GACA,OAAA8R,QAAA9L,EAAAzC,EAAAf,EAAAxC,GAEA,IAAAmS,EAAAxQ,SAAAuQ,aAAA,GAiCA,SAAAE,QAAAhU,EAAAiU,GACA,IAAAtW,EAAAkI,SAAAoO,GACA,IAAAjL,EAAA3F,UAAAsP,YAAA3S,IAEA,SAAAxC,KAAAsF,GACA,GAAAA,EAAA,OAAAnF,EAAAmF,GACA,GAAAA,IAAA,MAAA,OACAkG,EAAAxL,MAEA,OAAAA,OAEA,IAAA0W,EAAA3Q,SAAAyQ,QAAA,GAsBA,SAAAG,aAAAhP,EAAAY,EAAA3B,EAAAxC,GACA,IAAA2C,EAAAlB,UAAAe,GACA,OAAAgM,EAAAjL,EAAAY,EAAA,CAAAxJ,EAAAkI,KACAF,EAAAhI,EAAA,CAAAuG,EAAAxG,KACA,GAAAwG,EAAA,OAAA2B,EAAA3B,GACA,OAAA2B,EAAA3B,EAAA,CAAAxG,IAAAA,EAAAC,IAAAA,OAEA,CAAAuG,EAAAwN,KACA,IAAA9V,EAAA,GAEA,IAAAG,eAAAA,GAAAD,OAAA0Z,UAEA,IAAA,IAAA9O,EAAA,EAAAA,EAAAgL,EAAAlU,OAAAkJ,IAAA,CACA,GAAAgL,EAAAhL,GAAA,CACA,IAAAhJ,IAAAA,GAAAgU,EAAAhL,GACA,IAAA/I,IAAAA,GAAA+T,EAAAhL,GAEA,GAAA3K,EAAAC,KAAAJ,EAAA8B,GAAA,CACA9B,EAAA8B,GAAA8M,KAAA7M,OACA,CACA/B,EAAA8B,GAAA,CAAAC,KAKA,OAAAqF,EAAAkB,EAAAtI,KAIA,IAAA6Z,EAAA9Q,SAAA4Q,aAAA,GAuCA,SAAAG,QAAAnP,EAAAf,EAAAxC,GACA,OAAAyS,EAAAlP,EAAAiC,SAAAhD,EAAAxC,GAsBA,SAAA2S,cAAApP,EAAAf,EAAAxC,GACA,OAAAyS,EAAAlP,EAAA,EAAAf,EAAAxC,GA8BA,IAAA4S,EAAA/C,YAAA,OAwBA,SAAAgD,eAAAtR,EAAA4C,EAAA3B,EAAAxC,GACAA,EAAAkD,KAAAlD,GACA,IAAA8S,EAAA,GACA,IAAAnQ,EAAAlB,UAAAe,GACA,OAAAqC,EAAAV,EAAAU,CAAAtD,EAAA,CAAA5G,EAAAD,EAAAkB,KACA+G,EAAAhI,EAAAD,EAAA,CAAAwG,EAAAtI,KACA,GAAAsI,EAAA,OAAAtF,EAAAsF,GACA4R,EAAApY,GAAA9B,EACAgD,EAAAsF,MAEAA,GAAAlB,EAAAkB,EAAA4R,IAGA,IAAAC,EAAApR,SAAAkR,eAAA,GA+CA,SAAAG,UAAAzR,EAAAiB,EAAAxC,GACA,OAAA+S,EAAAxR,EAAAiE,SAAAhD,EAAAxC,GAuBA,SAAAiT,gBAAA1R,EAAAiB,EAAAxC,GACA,OAAA+S,EAAAxR,EAAA,EAAAiB,EAAAxC,GA2CA,SAAAkT,QAAA9U,EAAA+U,EAAApQ,CAAAA,GAAAA,IACA,IAAA8K,EAAA/U,OAAAiO,OAAA,MACA,IAAAqM,EAAAta,OAAAiO,OAAA,MACA,IAAAoJ,EAAA1O,UAAArD,GACA,IAAAiV,EAAAtT,cAAA,CAAAF,EAAAG,KACA,IAAAtF,EAAAyY,KAAAtT,GACA,GAAAnF,KAAAmT,EAAA,CACAlN,EAAA,IAAAX,EAAA,QAAA6N,EAAAnT,UACA,GAAAA,KAAA0Y,EAAA,CACAA,EAAA1Y,GAAA8M,KAAAxH,OACA,CACAoT,EAAA1Y,GAAA,CAAAsF,GACAmQ,KAAAtQ,EAAA,CAAAqB,KAAA4O,KAEA,IAAA5O,EAAA,CACA2M,EAAAnT,GAAAoV,EAEA,IAAAvD,EAAA6G,EAAA1Y,UACA0Y,EAAA1Y,GACA,IAAA,IAAAgJ,EAAA,EAAAkJ,EAAAL,EAAA/R,OAAAkJ,EAAAkJ,EAAAlJ,IAAA,CACA6I,EAAA7I,GAAAxC,KAAA4O,SAKAuD,EAAAxF,KAAAA,EACAwF,EAAAC,WAAAlV,EACA,OAAAiV,EAkCA,IAAAE,EAEA,GAAAnT,EAAA,CACAmT,EAAA1Z,QAAAwG,cACA,GAAAH,EAAA,CACAqT,EAAApT,iBACA,CACAoT,EAAAjT,SAGA,IAAAD,EAAAG,KAAA+S,GAEA,IAAAC,EAAA7R,SAAA,CAAAK,EAAAyE,EAAAzG,KACA,IAAAyC,EAAAO,YAAAyD,GAAA,GAAA,GAEAzE,EAAAyE,EAAA,CAAAW,EAAA1M,EAAAqP,KACAtI,UAAA2F,EAAA3F,CAAA,CAAAP,KAAAtI,KACA,GAAAA,EAAA4B,OAAA,EAAA,EACA5B,GAAAA,EAEA6J,EAAA/H,GAAA9B,EACAmR,EAAA7I,MAEAA,GAAAlB,EAAAkB,EAAAuB,KACA,GAwEA,SAAAgR,WAAAhN,EAAAzG,GACA,OAAAwT,EAAA7N,EAAAc,EAAAzG,GAuBA,SAAA0T,cAAAjN,EAAAtC,EAAAnE,GACA,OAAAwT,EAAA3O,EAAAV,GAAAsC,EAAAzG,GAiJA,SAAA2T,QAAA1I,EAAAvE,GACA,IAAAyE,EAAA1J,UAAAwJ,GACA,OAAAD,MAAA,CAAA4I,EAAAxR,KACA+I,EAAAyI,EAAA,GAAAxR,IACAsE,EAAA,GAKA,MAAAmN,KACAxZ,cACA5B,KAAAqb,KAAA,GACArb,KAAAsb,UAAAC,OAAAC,iBAGAzZ,aACA,OAAA/B,KAAAqb,KAAAtZ,OAGAH,QACA5B,KAAAqb,KAAA,GACA,OAAArb,KAGA4B,OAAAyI,GACA,IAAAoR,EAEA,MAAApR,EAAA,GAAAqR,QAAA1b,KAAAqb,KAAAhR,GAAArK,KAAAqb,KAAAI,EAAAE,OAAAtR,KAAA,CACA,IAAAuR,EAAA5b,KAAAqb,KAAAhR,GACArK,KAAAqb,KAAAhR,GAAArK,KAAAqb,KAAAI,GACAzb,KAAAqb,KAAAI,GAAAG,EAEAvR,EAAAoR,GAIA7Z,SAAAyI,GACA,IAAA8J,EAEA,OAAAA,EAAA0H,QAAAxR,IAAArK,KAAAqb,KAAAtZ,OAAA,CACA,GAAAoS,EAAA,EAAAnU,KAAAqb,KAAAtZ,QAAA2Z,QAAA1b,KAAAqb,KAAAlH,EAAA,GAAAnU,KAAAqb,KAAAlH,IAAA,CACAA,EAAAA,EAAA,EAGA,GAAAuH,QAAA1b,KAAAqb,KAAAhR,GAAArK,KAAAqb,KAAAlH,IAAA,CACA,MAGA,IAAAyH,EAAA5b,KAAAqb,KAAAhR,GACArK,KAAAqb,KAAAhR,GAAArK,KAAAqb,KAAAlH,GACAnU,KAAAqb,KAAAlH,GAAAyH,EAEAvR,EAAA8J,GAIAvS,KAAA+P,GACAA,EAAA2J,YAAAtb,KAAAsb,UACAtb,KAAAqb,KAAAtM,KAAA4C,GACA3R,KAAA8b,OAAA9b,KAAAqb,KAAAtZ,OAAA,GAGAH,QAAA+P,GACA,OAAA3R,KAAAqb,KAAAtM,KAAA4C,GAGA/P,QACA,IAAAma,GAAA/b,KAAAqb,KAEArb,KAAAqb,KAAA,GAAArb,KAAAqb,KAAArb,KAAAqb,KAAAtZ,OAAA,GACA/B,KAAAqb,KAAA7T,MACAxH,KAAAgc,SAAA,GAEA,OAAAD,EAGAna,UACA,MAAA,IAAA5B,MAGA4B,EAAA8G,OAAAqC,YACA,IAAA,IAAAE,EAAA,EAAAA,EAAAjL,KAAAqb,KAAAtZ,OAAAkJ,IAAA,OACAjL,KAAAqb,KAAApQ,GAAAkH,MAIAvQ,OAAAwQ,GACA,IAAA6J,EAAA,EACA,IAAA,IAAAhR,EAAA,EAAAA,EAAAjL,KAAAqb,KAAAtZ,OAAAkJ,IAAA,CACA,IAAAmH,EAAApS,KAAAqb,KAAApQ,IAAA,CACAjL,KAAAqb,KAAAY,GAAAjc,KAAAqb,KAAApQ,GACAgR,KAIAjc,KAAAqb,KAAAjH,OAAA6H,GAEA,IAAA,IAAAhR,EAAA0Q,OAAA3b,KAAAqb,KAAAtZ,OAAA,GAAAkJ,GAAA,EAAAA,IAAA,CACAjL,KAAAgc,SAAA/Q,GAGA,OAAAjL,MAIA,SAAA6b,QAAA5Q,GACA,OAAAA,GAAA,GAAA,EAGA,SAAA0Q,OAAA1Q,GACA,OAAAA,EAAA,GAAA,GAAA,EAGA,SAAAyQ,QAAArG,EAAA6G,GACA,GAAA7G,EAAA8G,WAAAD,EAAAC,SAAA,CACA,OAAA9G,EAAA8G,SAAAD,EAAAC,aAEA,CACA,OAAA9G,EAAAiG,UAAAY,EAAAZ,WA2BA,SAAAc,cAAA5J,EAAAvE,GAEA,IAAA6F,EAAAoH,QAAA1I,EAAAvE,GAEA6F,EAAAE,OAAA,IAAAoH,KAGAtH,EAAA/E,KAAA,SAAAoD,EAAAgK,EAAA,EAAA5U,EAAA,UACA,UAAAA,IAAA,WAAA,CACA,MAAA,IAAA5C,MAAA,oCAEAmP,EAAAC,QAAA,KACA,IAAAnF,MAAAC,QAAAsD,GAAA,CACAA,EAAA,CAAAA,GAEA,GAAAA,EAAApQ,SAAA,GAAA+R,EAAAQ,OAAA,CAEA,OAAApM,EAAA,IAAA4L,EAAAhB,SAGA,IAAA,IAAA7H,EAAA,EAAAkJ,EAAAhC,EAAApQ,OAAAkJ,EAAAkJ,EAAAlJ,IAAA,CACA,IAAAG,EAAA,CACA+G,KAAAA,EAAAlH,GACAkR,SAAAA,EACA5U,SAAAA,GAGAuM,EAAAE,OAAAjF,KAAA3D,GAGAlD,EAAA4L,EAAA1S,iBAIA0S,EAAAG,QAEA,OAAAH,EAuCA,SAAAuI,KAAArO,EAAAzG,GACAA,EAAAkD,KAAAlD,GACA,IAAAqH,MAAAC,QAAAb,GAAA,OAAAzG,EAAA,IAAA+U,UAAA,yDACA,IAAAtO,EAAAjM,OAAA,OAAAwF,IACA,IAAA,IAAA0D,EAAA,EAAAkJ,EAAAnG,EAAAjM,OAAAkJ,EAAAkJ,EAAAlJ,IAAA,CACAjC,UAAAgF,EAAA/C,GAAAjC,CAAAzB,IAIA,IAAAgV,EAAArT,SAAAmT,KAAA,GAyBA,SAAAG,YAAAC,EAAArH,EAAArL,EAAAxC,GACA,IAAAmV,EAAA,IAAAD,GAAA5G,UACA,OAAAP,EAAAoH,EAAAtH,EAAArL,EAAAxC,GA0CA,SAAAoV,QAAAhX,GACA,IAAA+R,EAAA1O,UAAArD,GACA,OAAA2B,cAAA,SAAAsV,UAAAxV,EAAAyV,GACAzV,EAAA2H,KAAA,CAAA5J,KAAAkE,KACA,IAAAyT,EAAA,GACA,GAAA3X,EAAA,CACA2X,EAAA3X,MAAAA,EAEA,GAAAkE,EAAAtH,OAAA,EAAA,CACA,IAAArB,EAAA2I,EACA,GAAAA,EAAAtH,QAAA,EAAA,EACArB,GAAA2I,EAEAyT,EAAApc,MAAAA,EAEAmc,EAAA,KAAAC,KAGA,OAAApF,EAAAlU,MAAAxD,KAAAoH,KAuEA,SAAA2V,WAAA/O,GACA,IAAAhE,EACA,GAAA4E,MAAAC,QAAAb,GAAA,CACAhE,EAAAgE,EAAAb,IAAAwP,aACA,CACA3S,EAAA,GACA3J,OAAAyB,KAAAkM,GAAAU,QAAAzM,IACA+H,EAAA/H,GAAA0a,QAAApc,KAAAP,KAAAgO,EAAA/L,MAGA,OAAA+H,EAGA,SAAAhH,OAAAuG,EAAAO,EAAAI,EAAA3C,GACA,MAAAwC,EAAAf,UAAAkB,GACA,OAAAmP,QAAA9P,EAAAO,EAAA,CAAApJ,EAAAiJ,KACAI,EAAArJ,EAAA,CAAA+H,EAAA6B,KACAX,EAAAlB,GAAA6B,MAEA/C,GA+BA,SAAAyV,SAAAlS,EAAAf,EAAAxC,GACA,OAAAvE,OAAAkK,EAAApC,EAAAf,EAAAxC,GAEA,IAAA0V,EAAA/T,SAAA8T,SAAA,GAsBA,SAAAE,YAAApS,EAAAY,EAAA3B,EAAAxC,GACA,OAAAvE,OAAAoJ,EAAAV,GAAAZ,EAAAf,EAAAxC,GAEA,IAAA4V,EAAAjU,SAAAgU,YAAA,GAoBA,SAAAE,aAAAtS,EAAAf,EAAAxC,GACA,OAAAvE,OAAAuK,EAAAzC,EAAAf,EAAAxC,GAEA,IAAA8V,EAAAnU,SAAAkU,aAAA,GAEA,SAAAE,WAAA5c,GACA,OAAA,WACA,OAAAA,GAyFA,MAAA6c,EAAA,EACA,MAAAC,EAAA,EAEA,SAAAC,MAAA3W,EAAA6H,EAAApH,GACA,IAAA/C,EAAA,CACAkZ,MAAAH,EACAI,aAAAL,WAAAE,IAGA,GAAAI,UAAA7b,OAAA,UAAA+E,IAAA,WAAA,CACAS,EAAAoH,GAAAf,kBACAe,EAAA7H,MACA,CACA+W,WAAArZ,EAAAsC,GACAS,EAAAA,GAAAqG,kBAGA,UAAAe,IAAA,WAAA,CACA,MAAA,IAAAhK,MAAA,qCAGA,IAAAmZ,EAAA9U,UAAA2F,GAEA,IAAAoP,EAAA,EACA,SAAAC,eACAF,EAAA,CAAArV,KAAArB,KACA,GAAAqB,IAAA,MAAA,OACA,GAAAA,GAAAsV,IAAAvZ,EAAAkZ,eACAlZ,EAAAyZ,aAAA,YACAzZ,EAAAyZ,YAAAxV,IAAA,CACAX,WAAAkW,aAAAxZ,EAAAmZ,aAAAI,EAAA,QACA,CACAxW,EAAAkB,KAAArB,MAKA4W,eACA,OAAAzW,EAAAoG,GAGA,SAAAkQ,WAAAK,EAAAtC,GACA,UAAAA,IAAA,SAAA,CACAsC,EAAAR,OAAA9B,EAAA8B,OAAAH,EAEAW,EAAAP,oBAAA/B,EAAAuC,WAAA,WACAvC,EAAAuC,SACAb,YAAA1B,EAAAuC,UAAAX,GAEAU,EAAAD,YAAArC,EAAAqC,iBACA,UAAArC,IAAA,iBAAAA,IAAA,SAAA,CACAsC,EAAAR,OAAA9B,GAAA2B,MACA,CACA,MAAA,IAAA5Y,MAAA,sCAiCA,SAAAyZ,UAAAtX,EAAA6H,GACA,IAAAA,EAAA,CACAA,EAAA7H,EACAA,EAAA,KAEA,IAAAqC,EAAArC,GAAAA,EAAAqC,OAAAwF,EAAA5M,OACA,GAAAsG,QAAAsG,GAAA,CACAxF,GAAA,EAEA,IAAA2U,EAAA9U,UAAA2F,GACA,OAAArH,cAAA,CAAAF,EAAAG,KACA,GAAAH,EAAArF,OAAAoH,EAAA,GAAA5B,GAAA,KAAA,CACAH,EAAA2H,KAAAxH,GACAA,EAAAqG,kBAEA,SAAAqC,OAAAtG,GACAmU,KAAA1W,EAAAuC,GAGA,GAAA7C,EAAA2W,MAAA3W,EAAAmJ,OAAA1I,QACAkW,MAAAxN,OAAA1I,GAEA,OAAAA,EAAAoG,KAqEA,SAAA0Q,OAAArQ,EAAAzG,GACA,OAAAwT,EAAAxN,EAAAS,EAAAzG,GAkCA,SAAA+W,KAAAxT,EAAAf,EAAAxC,GACA,OAAAiP,cAAA+H,QAAA1Q,GAAAA,EAAA2I,CAAAtJ,EAAApC,EAAAf,EAAAxC,GAEA,IAAAiX,EAAAtV,SAAAoV,KAAA,GAwBA,SAAAG,UAAA3T,EAAAY,EAAA3B,EAAAxC,GACA,OAAAiP,cAAA+H,QAAA1Q,GAAAA,EAAA2I,CAAApK,EAAAV,GAAAZ,EAAAf,EAAAxC,GAEA,IAAAmX,EAAAxV,SAAAuV,UAAA,GAuBA,SAAAE,WAAA7T,EAAAf,EAAAxC,GACA,OAAAiP,cAAA+H,QAAA1Q,GAAAA,EAAA2I,CAAAjJ,EAAAzC,EAAAf,EAAAxC,GAEA,IAAAqX,GAAA1V,SAAAyV,WAAA,GAkDA,SAAAE,OAAA/T,EAAAf,EAAAxC,GACA,IAAA2C,EAAAlB,UAAAe,GACA,OAAAqD,EAAAtC,EAAA,CAAAuK,EAAAjL,KACAF,EAAAmL,EAAA,CAAA5M,EAAAqW,KACA,GAAArW,EAAA,OAAA2B,EAAA3B,GACA2B,EAAA3B,EAAA,CAAA/H,MAAA2U,EAAAyJ,SAAAA,OAEA,CAAArW,EAAAuB,KACA,GAAAvB,EAAA,OAAAlB,EAAAkB,GACAlB,EAAA,KAAAyC,EAAAkP,KAAA6F,YAAA5R,IAAA7C,GAAAA,EAAA5J,UAGA,SAAAqe,WAAAC,EAAAC,GACA,IAAA9F,EAAA6F,EAAAF,SAAA1F,EAAA6F,EAAAH,SACA,OAAA3F,EAAAC,GAAA,EAAAD,EAAAC,EAAA,EAAA,GAGA,IAAA8F,GAAAhW,SAAA2V,OAAA,GA2CA,SAAAM,QAAAlW,EAAAmW,EAAA7Z,GACA,IAAAI,EAAAqD,UAAAC,GAEA,OAAA3B,cAAA,CAAAF,EAAAG,KACA,IAAA8X,EAAA,MACA,IAAAC,EAEA,SAAAC,kBACA,IAAA7d,EAAAuH,EAAAvH,MAAA,YACA,IAAAyD,EAAA,IAAAR,MAAA,sBAAAjD,EAAA,gBACAyD,EAAAqa,KAAA,YACA,GAAAja,EAAA,CACAJ,EAAAI,KAAAA,EAEA8Z,EAAA,KACA9X,EAAApC,GAGAiC,EAAA2H,KAAA,IAAA1F,KACA,IAAAgW,EAAA,CACA9X,KAAA8B,GACAoW,aAAAH,MAKAA,EAAAxX,WAAAyX,gBAAAH,GACAzZ,KAAAyB,KAIA,SAAAsY,MAAAC,GACA,IAAAxf,EAAAyO,MAAA+Q,GACA,MAAAA,IAAA,CACAxf,EAAAwf,GAAAA,EAEA,OAAAxf,EAoBA,SAAAyf,WAAAC,EAAAnU,EAAA3B,EAAAxC,GACA,IAAA2C,EAAAlB,UAAAe,GACA,OAAAgM,EAAA2J,MAAAG,GAAAnU,EAAAxB,EAAA3C,GAoCA,SAAAmW,MAAAoC,EAAA/V,EAAAxC,GACA,OAAAqY,WAAAE,EAAA/S,SAAAhD,EAAAxC,GAkBA,SAAAwY,YAAAD,EAAA/V,EAAAxC,GACA,OAAAqY,WAAAE,EAAA,EAAA/V,EAAAxC,GA8CA,SAAAyY,UAAAlV,EAAAmV,EAAAlW,EAAAxC,GACA,GAAAqW,UAAA7b,QAAA,UAAAke,IAAA,WAAA,CACA1Y,EAAAwC,EACAA,EAAAkW,EACAA,EAAArR,MAAAC,QAAA/D,GAAA,GAAA,GAEAvD,EAAAkD,KAAAlD,GAAAqG,mBACA,IAAA1D,EAAAlB,UAAAe,GAEAmD,EAAApC,EAAA,CAAAR,EAAAlK,EAAAuJ,KACAO,EAAA+V,EAAA3V,EAAAlK,EAAAuJ,IACAlB,GAAAlB,EAAAkB,EAAAwX,IACA,OAAA1Y,EAAAoG,GAyCA,SAAAuS,QAAAlS,EAAAzG,GACA,IAAApC,EAAA,KACA,IAAAhF,EACA,OAAAkY,EAAArK,EAAA,CAAAW,EAAA2C,KACAtI,UAAA2F,EAAA3F,CAAA,CAAAP,KAAArB,KACA,GAAAqB,IAAA,MAAA,OAAA6I,EAAA7I,GAEA,GAAArB,EAAArF,OAAA,EAAA,EACA5B,GAAAiH,MACA,CACAjH,EAAAiH,EAEAjC,EAAAsD,EACA6I,EAAA7I,EAAA,KAAA,OAEA,IAAAlB,EAAApC,EAAAhF,IAGA,IAAAggB,GAAAjX,SAAAgX,SAeA,SAAAE,UAAAza,GACA,MAAA,IAAAyB,KACA,OAAAzB,EAAAkV,YAAAlV,MAAAyB,IAsCA,SAAAiZ,OAAA5I,EAAA1N,EAAAxC,GACAA,EAAAiE,SAAAjE,GACA,IAAAmQ,EAAA1O,UAAAe,GACA,IAAA4N,EAAA3O,UAAAyO,GACA,IAAAzN,EAAA,GAEA,SAAA7G,KAAAsF,KAAA6X,GACA,GAAA7X,EAAA,OAAAlB,EAAAkB,GACAuB,EAAAsW,EACA,GAAA7X,IAAA,MAAA,OACAkP,EAAAlB,OAGA,SAAAA,MAAAhO,EAAAmP,GACA,GAAAnP,EAAA,OAAAlB,EAAAkB,GACA,GAAAA,IAAA,MAAA,OACA,IAAAmP,EAAA,OAAArQ,EAAA,QAAAyC,GACA0N,EAAAvU,MAGA,OAAAwU,EAAAlB,OAEA,IAAA8J,GAAArX,SAAAmX,OAAA,GAyCA,SAAAG,MAAA/I,EAAA1N,EAAAxC,GACA,MAAAoQ,EAAA3O,UAAAyO,GACA,OAAA8I,GAAA5W,GAAAgO,EAAA,CAAAlP,EAAAmP,IAAAjO,EAAAlB,GAAAmP,IAAA7N,EAAAxC,GA4DA,SAAAkZ,UAAAzS,EAAAzG,GACAA,EAAAkD,KAAAlD,GACA,IAAAqH,MAAAC,QAAAb,GAAA,OAAAzG,EAAA,IAAA5C,MAAA,8DACA,IAAAqJ,EAAAjM,OAAA,OAAAwF,IACA,IAAAmZ,EAAA,EAEA,SAAAC,SAAAvZ,GACA,IAAAuH,EAAA3F,UAAAgF,EAAA0S,MACA/R,KAAAvH,EAAAoE,SAAArI,OAGA,SAAAA,KAAAsF,KAAArB,GACA,GAAAqB,IAAA,MAAA,OACA,GAAAA,GAAAiY,IAAA1S,EAAAjM,OAAA,CACA,OAAAwF,EAAAkB,KAAArB,GAEAuZ,SAAAvZ,GAGAuZ,SAAA,IAGA,IAAAC,GAAA1X,SAAAuX,WAyCA,IAAApW,GAAA,CACA7G,MAAAA,MACA8F,UAAA+D,EACAK,gBAAAA,EACAvF,SAAAA,SACA4F,KAAAA,KACAiD,WAAAA,WACAiE,MAAAA,MACA4L,WAAA3L,QACAU,QAAAA,QACAhM,OAAAuM,EACAH,YAAAE,EACAE,aAAAC,EACAC,SAAAA,SACAO,OAAAE,EACAC,YAAAC,EACAC,aAAAC,EACAI,IAAAA,EACAO,QAAAA,QACAN,SAAAK,EACAI,KAAAA,EACAD,UAAAG,EACAnL,OAAAE,EACAd,YAAAM,EACAY,aAAAC,EACA6K,WAAAC,EACAC,YAAAA,YACAG,MAAAC,EACAC,WAAAC,EACAC,YAAAC,EACAtF,OAAA8F,EACAC,YAAAC,EACAC,aAAAC,EACAC,QAAAE,EACAI,QAAAA,QACAH,aAAAE,EACAE,cAAAA,cACAC,IAAAA,EACAhN,IAAAC,EACA0I,SAAAC,EACAvI,UAAAC,EACA8M,UAAAA,UACAH,eAAAE,EACAE,gBAAAA,gBACAC,QAAAA,QACA7S,SAAAA,EACAmT,SAAAC,WACAC,cAAAA,cACAmB,cAAAA,cACA7J,MAAA2I,QACAmB,KAAAE,EACApH,OAAAG,EACAkH,YAAAA,YACAG,QAAAA,QACAI,WAAAA,WACA/Z,OAAAia,EACAC,YAAAC,EACAC,aAAAC,EACAI,MAAAA,MACAW,UAAAA,UACA7I,IAAAA,IACA8I,OAAAA,OACA3W,aAAAQ,EACAoW,KAAAE,EACAC,UAAAC,EACAC,WAAAC,GACAC,OAAAK,GACAC,QAAAA,QACAzB,MAAAA,MACAkC,WAAAA,WACAG,YAAAA,YACAC,UAAAA,UACAE,QAAAC,GACAC,UAAAA,UACAI,MAAAA,MACAC,UAAAG,GACAP,OAAAE,GAGAO,IAAApI,EACAqI,SAAAnI,EACAoI,UAAAlI,EACAmI,IAAAzC,EACA0C,SAAAxC,EACAyC,UAAAvC,GACAwC,KAAArK,EACAsK,UAAApK,EACAqK,WAAAnK,EACAoK,QAAApL,EACAqL,aAAAtL,EACAuL,cAAApL,EACA3H,QAAAuJ,EACAyJ,cAAArJ,EACAsJ,aAAAxJ,EACAyJ,UAAA1U,EACA2U,gBAAAtU,EACAuU,eAAApV,EACAqV,OAAAzM,EACA0M,MAAA1M,EACA2M,MAAAzF,YACA0F,OAAA5I,EACA6I,YAAA3I,EACA4I,aAAA1I,EACA2I,SAAAla,SACAma,OAAA/B,GACAgC,SAAA1K,GAGApX,EAAA+hB,QAAAnY,GACA5J,EAAA+C,MAAAA,MACA/C,EAAA6I,UAAA+D,EACA5M,EAAAiN,gBAAAA,EACAjN,EAAA0H,SAAAA,SACA1H,EAAAsN,KAAAA,KACAtN,EAAAuQ,WAAAA,WACAvQ,EAAAwU,MAAAA,MACAxU,EAAAogB,WAAA3L,QACAzU,EAAAmV,QAAAA,QACAnV,EAAAmJ,OAAAuM,EACA1V,EAAAuV,YAAAE,EACAzV,EAAA2V,aAAAC,EACA5V,EAAA6V,SAAAA,SACA7V,EAAAoW,OAAAE,EACAtW,EAAAuW,YAAAC,EACAxW,EAAAyW,aAAAC,EACA1W,EAAA8W,IAAAA,EACA9W,EAAAqX,QAAAA,QACArX,EAAA+W,SAAAK,EACApX,EAAAwX,KAAAA,EACAxX,EAAAuX,UAAAG,EACA1X,EAAAuM,OAAAE,EACAzM,EAAA2L,YAAAM,EACAjM,EAAA6M,aAAAC,EACA9M,EAAA2X,WAAAC,EACA5X,EAAA6X,YAAAA,YACA7X,EAAAgY,MAAAC,EACAjY,EAAAkY,WAAAC,EACAnY,EAAAoY,YAAAC,EACArY,EAAA+S,OAAA8F,EACA7Y,EAAA8Y,YAAAC,EACA/Y,EAAAgZ,aAAAC,EACAjZ,EAAAkZ,QAAAE,EACApZ,EAAAwZ,QAAAA,QACAxZ,EAAAqZ,aAAAE,EACAvZ,EAAAyZ,cAAAA,cACAzZ,EAAA0Z,IAAAA,EACA1Z,EAAA0M,IAAAC,EACA3M,EAAAqV,SAAAC,EACAtV,EAAA+M,UAAAC,EACAhN,EAAA8Z,UAAAA,UACA9Z,EAAA2Z,eAAAE,EACA7Z,EAAA+Z,gBAAAA,gBACA/Z,EAAAga,QAAAA,QACAha,EAAAmH,SAAAA,EACAnH,EAAAsa,SAAAC,WACAva,EAAAwa,cAAAA,cACAxa,EAAA2b,cAAAA,cACA3b,EAAA8R,MAAA2I,QACAza,EAAA4b,KAAAE,EACA9b,EAAA0U,OAAAG,EACA7U,EAAA+b,YAAAA,YACA/b,EAAAkc,QAAAA,QACAlc,EAAAsc,WAAAA,WACAtc,EAAAuC,OAAAia,EACAxc,EAAAyc,YAAAC,EACA1c,EAAA2c,aAAAC,EACA5c,EAAAgd,MAAAA,MACAhd,EAAA2d,UAAAA,UACA3d,EAAA8U,IAAAA,IACA9U,EAAA4d,OAAAA,OACA5d,EAAAiH,aAAAQ,EACAzH,EAAA6d,KAAAE,EACA/d,EAAAge,UAAAC,EACAje,EAAAke,WAAAC,GACAne,EAAAoe,OAAAK,GACAze,EAAA0e,QAAAA,QACA1e,EAAAid,MAAAA,MACAjd,EAAAmf,WAAAA,WACAnf,EAAAsf,YAAAA,YACAtf,EAAAuf,UAAAA,UACAvf,EAAAyf,QAAAC,GACA1f,EAAA2f,UAAAA,UACA3f,EAAA+f,MAAAA,MACA/f,EAAAggB,UAAAG,GACAngB,EAAA4f,OAAAE,GACA9f,EAAAqgB,IAAApI,EACAjY,EAAAsgB,SAAAnI,EACAnY,EAAAugB,UAAAlI,EACArY,EAAAwgB,IAAAzC,EACA/d,EAAAygB,SAAAxC,EACAje,EAAA0gB,UAAAvC,GACAne,EAAA2gB,KAAArK,EACAtW,EAAA4gB,UAAApK,EACAxW,EAAA6gB,WAAAnK,EACA1W,EAAA8gB,QAAApL,EACA1V,EAAA+gB,aAAAtL,EACAzV,EAAAghB,cAAApL,EACA5V,EAAAiO,QAAAuJ,EACAxX,EAAAihB,cAAArJ,EACA5X,EAAAkhB,aAAAxJ,EACA1X,EAAAmhB,UAAA1U,EACAzM,EAAAohB,gBAAAtU,EACA9M,EAAAqhB,eAAApV,EACAjM,EAAAshB,OAAAzM,EACA7U,EAAAuhB,MAAA1M,EACA7U,EAAAwhB,MAAAzF,YACA/b,EAAAyhB,OAAA5I,EACA7Y,EAAA0hB,YAAA3I,EACA/Y,EAAA2hB,aAAA1I,EACAjZ,EAAA4hB,SAAAla,SACA1H,EAAA6hB,OAAA/B,GACA9f,EAAA8hB,SAAA1K,EAEAxX,OAAAG,eAAAC,EAAA,aAAA,CAAAC,MAAA,mBC3uJA6F,EAAA9F,QAAAgiB,CAAAA,IACA,MAAA3C,EAAA1e,QAAAshB,SAAA/Q,KAAAb,MAAA,KAAA3D,IAAAkI,GAAAsN,SAAAtN,EAAA,KACAoN,EAAAA,EAAA3R,MAAA,KAAA3D,IAAAkI,GAAAsN,SAAAtN,EAAA,KACA,OAAAyK,EAAA,GAAA2C,EAAA,IAAA3C,EAAA,KAAA2C,EAAA,KAAA3C,EAAA,GAAA2C,EAAA,IAAA3C,EAAA,KAAA2C,EAAA,IAAA3C,EAAA,IAAA2C,EAAA,mCCDA,MAAA3c,EAAAlF,EAAA,MACA,MAAA+C,EAAA/C,EAAA,MACA,MAAAgiB,EAAAhiB,EAAA,MAAAgiB,WACA,MAAAC,EAAAjiB,EAAA,MAAAiiB,iBACA,MAAAC,EAAAliB,EAAA,MAEA,SAAAmiB,SAAAnS,EAAAoS,EAAAlc,GACA,UAAAA,IAAA,WAAA,CACAA,EAAA,CAAA0M,OAAA1M,GAGAA,EAAAA,GAAA,GACAA,EAAAmc,QAAA,YAAAnc,IAAAA,EAAAmc,QAAA,KACAnc,EAAAoc,UAAA,cAAApc,IAAAA,EAAAoc,UAAApc,EAAAmc,QAGA,GAAAnc,EAAAqc,oBAAA/hB,QAAAgiB,OAAA,OAAA,CACA9L,QAAA+L,6JAIA,MAAAC,QAAAA,EAAAC,SAAAA,GAAAT,EAAAU,eAAA5S,EAAAoS,EAAA,QACAF,EAAAW,qBAAA7S,EAAA0S,EAAAN,EAAA,QACA,OAAAU,oBAAAH,EAAA3S,EAAAoS,EAAAlc,GAGA,SAAA4c,oBAAAH,EAAA3S,EAAAoS,EAAAlc,GACA,GAAAA,EAAA0M,SAAA1M,EAAA0M,OAAA5C,EAAAoS,GAAA,OACA,MAAAW,EAAAhgB,EAAAigB,QAAAZ,GACA,IAAAld,EAAAC,WAAA4d,GAAAf,EAAAe,GACA,OAAAE,UAAAN,EAAA3S,EAAAoS,EAAAlc,GAGA,SAAA+c,UAAAN,EAAA3S,EAAAoS,EAAAlc,GACA,GAAAA,EAAA0M,SAAA1M,EAAA0M,OAAA5C,EAAAoS,GAAA,OACA,OAAAc,SAAAP,EAAA3S,EAAAoS,EAAAlc,GAGA,SAAAgd,SAAAP,EAAA3S,EAAAoS,EAAAlc,GACA,MAAAid,EAAAjd,EAAAkd,YAAAle,EAAAie,SAAAje,EAAAme,UACA,MAAAX,EAAAS,EAAAnT,GAEA,GAAA0S,EAAAY,cAAA,OAAAC,MAAAb,EAAAC,EAAA3S,EAAAoS,EAAAlc,QACA,GAAAwc,EAAAc,UACAd,EAAAe,qBACAf,EAAAgB,gBAAA,OAAAC,OAAAjB,EAAAC,EAAA3S,EAAAoS,EAAAlc,QACA,GAAAwc,EAAAkB,iBAAA,OAAAC,OAAAlB,EAAA3S,EAAAoS,EAAAlc,GAGA,SAAAyd,OAAAjB,EAAAC,EAAA3S,EAAAoS,EAAAlc,GACA,IAAAyc,EAAA,OAAAmB,SAAApB,EAAA1S,EAAAoS,EAAAlc,GACA,OAAA6d,YAAArB,EAAA1S,EAAAoS,EAAAlc,GAGA,SAAA6d,YAAArB,EAAA1S,EAAAoS,EAAAlc,GACA,GAAAA,EAAAoc,UAAA,CACApd,EAAA8e,WAAA5B,GACA,OAAA0B,SAAApB,EAAA1S,EAAAoS,EAAAlc,QACA,GAAAA,EAAA+d,aAAA,CACA,MAAA,IAAAlgB,UAAAqe,sBAIA,SAAA0B,SAAApB,EAAA1S,EAAAoS,EAAAlc,GACAhB,EAAAgf,aAAAlU,EAAAoS,GACA,GAAAlc,EAAAqc,mBAAA4B,iBAAAzB,EAAA0B,KAAApU,EAAAoS,GACA,OAAAiC,YAAAjC,EAAAM,EAAA0B,MAGA,SAAAD,iBAAAG,EAAAtU,EAAAoS,GAIA,GAAAmC,kBAAAD,GAAAE,iBAAApC,EAAAkC,GACA,OAAAG,kBAAAzU,EAAAoS,GAGA,SAAAmC,kBAAAD,GACA,OAAAA,EAAA,OAAA,EAGA,SAAAE,iBAAApC,EAAAkC,GACA,OAAAD,YAAAjC,EAAAkC,EAAA,KAGA,SAAAD,YAAAjC,EAAAkC,GACA,OAAApf,EAAAwf,UAAAtC,EAAAkC,GAGA,SAAAG,kBAAAzU,EAAAoS,GAIA,MAAAuC,EAAAzf,EAAAie,SAAAnT,GACA,OAAAiS,EAAAG,EAAAuC,EAAAC,MAAAD,EAAAE,OAGA,SAAAtB,MAAAb,EAAAC,EAAA3S,EAAAoS,EAAAlc,GACA,IAAAyc,EAAA,OAAAmC,aAAApC,EAAA0B,KAAApU,EAAAoS,EAAAlc,GACA,GAAAyc,IAAAA,EAAAW,cAAA,CACA,MAAA,IAAAvf,yCAAAqe,sBAAApS,OAEA,OAAA+U,QAAA/U,EAAAoS,EAAAlc,GAGA,SAAA4e,aAAAR,EAAAtU,EAAAoS,EAAAlc,GACAhB,EAAA8f,UAAA5C,GACA2C,QAAA/U,EAAAoS,EAAAlc,GACA,OAAAme,YAAAjC,EAAAkC,GAGA,SAAAS,QAAA/U,EAAAoS,EAAAlc,GACAhB,EAAA+f,YAAAjV,GAAAlC,QAAAtD,GAAA0a,YAAA1a,EAAAwF,EAAAoS,EAAAlc,IAGA,SAAAgf,YAAA1a,EAAAwF,EAAAoS,EAAAlc,GACA,MAAAif,EAAApiB,EAAAyL,KAAAwB,EAAAxF,GACA,MAAA4a,EAAAriB,EAAAyL,KAAA4T,EAAA5X,GACA,MAAAmY,SAAAA,GAAAT,EAAAU,eAAAuC,EAAAC,EAAA,QACA,OAAAnC,UAAAN,EAAAwC,EAAAC,EAAAlf,GAGA,SAAA2d,OAAAlB,EAAA3S,EAAAoS,EAAAlc,GACA,IAAAmf,EAAAngB,EAAAogB,aAAAtV,GACA,GAAA9J,EAAAkd,YAAA,CACAiC,EAAAtiB,EAAAb,QAAA1B,QAAA+kB,MAAAF,GAGA,IAAA1C,EAAA,CACA,OAAAzd,EAAAsgB,YAAAH,EAAAjD,OACA,CACA,IAAAqD,EACA,IACAA,EAAAvgB,EAAAogB,aAAAlD,GACA,MAAAva,GAIA,GAAAA,EAAA+W,OAAA,UAAA/W,EAAA+W,OAAA,UAAA,OAAA1Z,EAAAsgB,YAAAH,EAAAjD,GACA,MAAAva,EAEA,GAAA3B,EAAAkd,YAAA,CACAqC,EAAA1iB,EAAAb,QAAA1B,QAAA+kB,MAAAE,GAEA,GAAAvD,EAAAwD,YAAAL,EAAAI,GAAA,CACA,MAAA,IAAA1hB,sBAAAshB,oCAAAI,OAMA,GAAAvgB,EAAAie,SAAAf,GAAAkB,eAAApB,EAAAwD,YAAAD,EAAAJ,GAAA,CACA,MAAA,IAAAthB,2BAAA0hB,YAAAJ,OAEA,OAAAM,SAAAN,EAAAjD,IAIA,SAAAuD,SAAAN,EAAAjD,GACAld,EAAA8e,WAAA5B,GACA,OAAAld,EAAAsgB,YAAAH,EAAAjD,GAGAzc,EAAA9F,QAAAsiB,sCCnKAxc,EAAA9F,QAAA,CACAsiB,SAAAniB,EAAA,oCCDA,MAAAkF,EAAAlF,EAAA,MACA,MAAA+C,EAAA/C,EAAA,MACA,MAAA4lB,EAAA5lB,EAAA,MAAA4lB,OACA,MAAAC,EAAA7lB,EAAA,MAAA6lB,WACA,MAAAC,EAAA9lB,EAAA,MAAA8lB,aACA,MAAA5D,EAAAliB,EAAA,MAEA,SAAA+lB,KAAA/V,EAAAoS,EAAAlc,EAAA6C,GACA,UAAA7C,IAAA,aAAA6C,EAAA,CACAA,EAAA7C,EACAA,EAAA,QACA,UAAAA,IAAA,WAAA,CACAA,EAAA,CAAA0M,OAAA1M,GAGA6C,EAAAA,GAAA,aACA7C,EAAAA,GAAA,GAEAA,EAAAmc,QAAA,YAAAnc,IAAAA,EAAAmc,QAAA,KACAnc,EAAAoc,UAAA,cAAApc,IAAAA,EAAAoc,UAAApc,EAAAmc,QAGA,GAAAnc,EAAAqc,oBAAA/hB,QAAAgiB,OAAA,OAAA,CACA9L,QAAA+L,6JAIAP,EAAA8D,WAAAhW,EAAAoS,EAAA,OAAA,CAAAva,EAAAoe,KACA,GAAApe,EAAA,OAAAkB,EAAAlB,GACA,MAAA6a,QAAAA,EAAAC,SAAAA,GAAAsD,EACA/D,EAAAgE,iBAAAlW,EAAA0S,EAAAN,EAAA,OAAAva,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,GAAA3B,EAAA0M,OAAA,OAAAuT,aAAAC,eAAAzD,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GACA,OAAAqd,eAAAzD,EAAA3S,EAAAoS,EAAAlc,EAAA6C,OAKA,SAAAqd,eAAAzD,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GACA,MAAAga,EAAAhgB,EAAAigB,QAAAZ,GACAyD,EAAA9C,EAAA,CAAAlb,EAAAwe,KACA,GAAAxe,EAAA,OAAAkB,EAAAlB,GACA,GAAAwe,EAAA,OAAApD,UAAAN,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GACA6c,EAAA7C,EAAAlb,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,OAAAob,UAAAN,EAAA3S,EAAAoS,EAAAlc,EAAA6C,OAKA,SAAAod,aAAAG,EAAA3D,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GACA5G,QAAAD,QAAAgE,EAAA0M,OAAA5C,EAAAoS,IAAAzf,KAAA4jB,IACA,GAAAA,EAAA,OAAAD,EAAA3D,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GACA,OAAAA,KACAxE,GAAAwE,EAAAxE,IAGA,SAAA0e,UAAAN,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GACA,GAAA7C,EAAA0M,OAAA,OAAAuT,aAAAjD,SAAAP,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GACA,OAAAma,SAAAP,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GAGA,SAAAma,SAAAP,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GACA,MAAAmZ,EAAAhc,EAAAkd,YAAAle,EAAAgd,KAAAhd,EAAAshB,MACAtE,EAAAlS,EAAA,CAAAnI,EAAA6a,KACA,GAAA7a,EAAA,OAAAkB,EAAAlB,GAEA,GAAA6a,EAAAY,cAAA,OAAAC,MAAAb,EAAAC,EAAA3S,EAAAoS,EAAAlc,EAAA6C,QACA,GAAA2Z,EAAAc,UACAd,EAAAe,qBACAf,EAAAgB,gBAAA,OAAAC,OAAAjB,EAAAC,EAAA3S,EAAAoS,EAAAlc,EAAA6C,QACA,GAAA2Z,EAAAkB,iBAAA,OAAAC,OAAAlB,EAAA3S,EAAAoS,EAAAlc,EAAA6C,KAIA,SAAA4a,OAAAjB,EAAAC,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GACA,IAAA4Z,EAAA,OAAAmB,SAAApB,EAAA1S,EAAAoS,EAAAlc,EAAA6C,GACA,OAAAgb,YAAArB,EAAA1S,EAAAoS,EAAAlc,EAAA6C,GAGA,SAAAgb,YAAArB,EAAA1S,EAAAoS,EAAAlc,EAAA6C,GACA,GAAA7C,EAAAoc,UAAA,CACApd,EAAAuhB,OAAArE,EAAAva,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,OAAAic,SAAApB,EAAA1S,EAAAoS,EAAAlc,EAAA6C,UAEA,GAAA7C,EAAA+d,aAAA,CACA,OAAAlb,EAAA,IAAAhF,UAAAqe,2BACA,OAAArZ,IAGA,SAAA+a,SAAApB,EAAA1S,EAAAoS,EAAAlc,EAAA6C,GACA7D,EAAA4e,SAAA9T,EAAAoS,EAAAva,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,GAAA3B,EAAAqc,mBAAA,OAAAmE,wBAAAhE,EAAA0B,KAAApU,EAAAoS,EAAArZ,GACA,OAAAsb,YAAAjC,EAAAM,EAAA0B,KAAArb,KAIA,SAAA2d,wBAAApC,EAAAtU,EAAAoS,EAAArZ,GAIA,GAAAwb,kBAAAD,GAAA,CACA,OAAAE,iBAAApC,EAAAkC,EAAAzc,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,OAAA8e,yBAAArC,EAAAtU,EAAAoS,EAAArZ,KAGA,OAAA4d,yBAAArC,EAAAtU,EAAAoS,EAAArZ,GAGA,SAAAwb,kBAAAD,GACA,OAAAA,EAAA,OAAA,EAGA,SAAAE,iBAAApC,EAAAkC,EAAAvb,GACA,OAAAsb,YAAAjC,EAAAkC,EAAA,IAAAvb,GAGA,SAAA4d,yBAAArC,EAAAtU,EAAAoS,EAAArZ,GACA0b,kBAAAzU,EAAAoS,EAAAva,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,OAAAwc,YAAAjC,EAAAkC,EAAAvb,KAIA,SAAAsb,YAAAjC,EAAAkC,EAAAvb,GACA,OAAA7D,EAAA0hB,MAAAxE,EAAAkC,EAAAvb,GAGA,SAAA0b,kBAAAzU,EAAAoS,EAAArZ,GAIA7D,EAAAgd,KAAAlS,EAAA,CAAAnI,EAAA8c,KACA,GAAA9c,EAAA,OAAAkB,EAAAlB,GACA,OAAAie,EAAA1D,EAAAuC,EAAAC,MAAAD,EAAAE,MAAA9b,KAIA,SAAAwa,MAAAb,EAAAC,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GACA,IAAA4Z,EAAA,OAAAmC,aAAApC,EAAA0B,KAAApU,EAAAoS,EAAAlc,EAAA6C,GACA,GAAA4Z,IAAAA,EAAAW,cAAA,CACA,OAAAva,EAAA,IAAAhF,yCAAAqe,sBAAApS,QAEA,OAAA+U,QAAA/U,EAAAoS,EAAAlc,EAAA6C,GAGA,SAAA+b,aAAAR,EAAAtU,EAAAoS,EAAAlc,EAAA6C,GACA7D,EAAA2hB,MAAAzE,EAAAva,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACAkd,QAAA/U,EAAAoS,EAAAlc,EAAA2B,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,OAAAwc,YAAAjC,EAAAkC,EAAAvb,OAKA,SAAAgc,QAAA/U,EAAAoS,EAAAlc,EAAA6C,GACA7D,EAAA4hB,QAAA9W,EAAA,CAAAnI,EAAA0S,KACA,GAAA1S,EAAA,OAAAkB,EAAAlB,GACA,OAAAkf,aAAAxM,EAAAvK,EAAAoS,EAAAlc,EAAA6C,KAIA,SAAAge,aAAAxM,EAAAvK,EAAAoS,EAAAlc,EAAA6C,GACA,MAAAyB,EAAA+P,EAAA3T,MACA,IAAA4D,EAAA,OAAAzB,IACA,OAAAmc,YAAA3K,EAAA/P,EAAAwF,EAAAoS,EAAAlc,EAAA6C,GAGA,SAAAmc,YAAA3K,EAAA/P,EAAAwF,EAAAoS,EAAAlc,EAAA6C,GACA,MAAAoc,EAAApiB,EAAAyL,KAAAwB,EAAAxF,GACA,MAAA4a,EAAAriB,EAAAyL,KAAA4T,EAAA5X,GACA0X,EAAA8D,WAAAb,EAAAC,EAAA,OAAA,CAAAvd,EAAAoe,KACA,GAAApe,EAAA,OAAAkB,EAAAlB,GACA,MAAA8a,SAAAA,GAAAsD,EACAhD,UAAAN,EAAAwC,EAAAC,EAAAlf,EAAA2B,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,OAAAkf,aAAAxM,EAAAvK,EAAAoS,EAAAlc,EAAA6C,OAKA,SAAA8a,OAAAlB,EAAA3S,EAAAoS,EAAAlc,EAAA6C,GACA7D,EAAA8hB,SAAAhX,EAAA,CAAAnI,EAAAwd,KACA,GAAAxd,EAAA,OAAAkB,EAAAlB,GACA,GAAA3B,EAAAkd,YAAA,CACAiC,EAAAtiB,EAAAb,QAAA1B,QAAA+kB,MAAAF,GAGA,IAAA1C,EAAA,CACA,OAAAzd,EAAA+hB,QAAA5B,EAAAjD,EAAArZ,OACA,CACA7D,EAAA8hB,SAAA5E,EAAA,CAAAva,EAAA4d,KACA,GAAA5d,EAAA,CAIA,GAAAA,EAAA+W,OAAA,UAAA/W,EAAA+W,OAAA,UAAA,OAAA1Z,EAAA+hB,QAAA5B,EAAAjD,EAAArZ,GACA,OAAAA,EAAAlB,GAEA,GAAA3B,EAAAkd,YAAA,CACAqC,EAAA1iB,EAAAb,QAAA1B,QAAA+kB,MAAAE,GAEA,GAAAvD,EAAAwD,YAAAL,EAAAI,GAAA,CACA,OAAA1c,EAAA,IAAAhF,sBAAAshB,oCAAAI,QAMA,GAAA9C,EAAAW,eAAApB,EAAAwD,YAAAD,EAAAJ,GAAA,CACA,OAAAtc,EAAA,IAAAhF,2BAAA0hB,YAAAJ,QAEA,OAAAM,SAAAN,EAAAjD,EAAArZ,QAMA,SAAA4c,SAAAN,EAAAjD,EAAArZ,GACA7D,EAAAuhB,OAAArE,EAAAva,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,OAAA3C,EAAA+hB,QAAA5B,EAAAjD,EAAArZ,KAIApD,EAAA9F,QAAAkmB,kCCrOA,MAAAmB,EAAAlnB,EAAA,MAAAmnB,EACAxhB,EAAA9F,QAAA,CACAkmB,KAAAmB,EAAAlnB,EAAA,qCCFA,MAAAknB,EAAAlnB,EAAA,MAAAmnB,EACA,MAAAjiB,EAAAlF,EAAA,MACA,MAAA+C,EAAA/C,EAAA,MACA,MAAA6mB,EAAA7mB,EAAA,MACA,MAAAgU,EAAAhU,EAAA,MAEA,MAAAonB,EAAAF,EAAA,SAAAE,SAAAzQ,EAAAhQ,GACAA,EAAAA,GAAA,aACAzB,EAAA4hB,QAAAnQ,EAAA,CAAA9O,EAAA0S,KACA,GAAA1S,EAAA,OAAAgf,EAAAjB,OAAAjP,EAAAhQ,GAEA4T,EAAAA,EAAAhO,IAAA/B,GAAAzH,EAAAyL,KAAAmI,EAAAnM,IAEA6c,aAEA,SAAAA,aACA,MAAA7c,EAAA+P,EAAA3T,MACA,IAAA4D,EAAA,OAAA7D,IACAqN,EAAAA,OAAAxJ,EAAA3C,IACA,GAAAA,EAAA,OAAAlB,EAAAkB,GACAwf,oBAMA,SAAAC,aAAA3Q,GACA,IAAA4D,EACA,IACAA,EAAArV,EAAA+f,YAAAtO,GACA,MACA,OAAAkQ,EAAA7E,WAAArL,GAGA4D,EAAAzM,QAAAtD,IACAA,EAAAzH,EAAAyL,KAAAmI,EAAAnM,GACAwJ,EAAAuT,WAAA/c,KAIA7E,EAAA9F,QAAA,CACAynB,aAAAA,aACAE,aAAAF,aACAF,SAAAA,EACAK,SAAAL,gCC5CA,MAAAF,EAAAlnB,EAAA,MAAAmnB,EACA,MAAApkB,EAAA/C,EAAA,MACA,MAAAkF,EAAAlF,EAAA,MACA,MAAA6mB,EAAA7mB,EAAA,MAEA,SAAA0nB,WAAAC,EAAAhhB,GACA,SAAAihB,WACA1iB,EAAA2iB,UAAAF,EAAA,GAAA9f,IACA,GAAAA,EAAA,OAAAlB,EAAAkB,GACAlB,MAIAzB,EAAAgd,KAAAyF,EAAA,CAAA9f,EAAAoe,KACA,IAAApe,GAAAoe,EAAAzC,SAAA,OAAA7c,IACA,MAAAgQ,EAAA5T,EAAAigB,QAAA2E,GACAziB,EAAAgd,KAAAvL,EAAA,CAAA9O,EAAAoe,KACA,GAAApe,EAAA,CAEA,GAAAA,EAAA+W,OAAA,SAAA,CACA,OAAAiI,EAAAjB,OAAAjP,EAAA9O,IACA,GAAAA,EAAA,OAAAlB,EAAAkB,GACA+f,aAGA,OAAAjhB,EAAAkB,GAGA,GAAAoe,EAAA3C,cAAAsE,eACA,CAGA1iB,EAAA4hB,QAAAnQ,EAAA9O,IACA,GAAAA,EAAA,OAAAlB,EAAAkB,UAOA,SAAAigB,eAAAH,GACA,IAAA1B,EACA,IACAA,EAAA/gB,EAAAie,SAAAwE,GACA,OACA,GAAA1B,GAAAA,EAAAzC,SAAA,OAEA,MAAA7M,EAAA5T,EAAAigB,QAAA2E,GACA,IACA,IAAAziB,EAAAie,SAAAxM,GAAA2M,cAAA,CAGApe,EAAA+f,YAAAtO,IAEA,MAAA9O,GAEA,GAAAA,GAAAA,EAAA+W,OAAA,SAAAiI,EAAA7E,WAAArL,QACA,MAAA9O,EAGA3C,EAAA6iB,cAAAJ,EAAA,IAGAhiB,EAAA9F,QAAA,CACA6nB,WAAAR,EAAAQ,YACAI,eAAAA,2CCjEA,MAAAH,EAAA3nB,EAAA,MACA,MAAAgoB,EAAAhoB,EAAA,MACA,MAAAinB,EAAAjnB,EAAA,MAEA2F,EAAA9F,QAAA,CAEA6nB,WAAAC,EAAAD,WACAI,eAAAH,EAAAG,eACAG,WAAAN,EAAAD,WACAQ,eAAAP,EAAAG,eAEAK,WAAAH,EAAAG,WACAC,eAAAJ,EAAAI,eACAC,WAAAL,EAAAG,WACAG,eAAAN,EAAAI,eAEAG,cAAAtB,EAAAsB,cACAC,kBAAAvB,EAAAuB,kBACAC,cAAAxB,EAAAsB,cACAG,kBAAAzB,EAAAuB,gDCnBA,MAAAtB,EAAAlnB,EAAA,MAAAmnB,EACA,MAAApkB,EAAA/C,EAAA,MACA,MAAAkF,EAAAlF,EAAA,MACA,MAAA6mB,EAAA7mB,EAAA,MACA,MAAA6lB,EAAA7lB,EAAA,MAAA6lB,WAEA,SAAAsC,WAAAQ,EAAAC,EAAAjiB,GACA,SAAAkiB,SAAAF,EAAAC,GACA1jB,EAAA8iB,KAAAW,EAAAC,EAAA/gB,IACA,GAAAA,EAAA,OAAAlB,EAAAkB,GACAlB,EAAA,QAIAkf,EAAA+C,EAAA,CAAA/gB,EAAAihB,KACA,GAAAjhB,EAAA,OAAAlB,EAAAkB,GACA,GAAAihB,EAAA,OAAAniB,EAAA,MACAzB,EAAAshB,MAAAmC,EAAA9gB,IACA,GAAAA,EAAA,CACAA,EAAAxH,QAAAwH,EAAAxH,QAAAsB,QAAA,QAAA,cACA,OAAAgF,EAAAkB,GAGA,MAAA8O,EAAA5T,EAAAigB,QAAA4F,GACA/C,EAAAlP,EAAA,CAAA9O,EAAAwe,KACA,GAAAxe,EAAA,OAAAlB,EAAAkB,GACA,GAAAwe,EAAA,OAAAwC,SAAAF,EAAAC,GACA/B,EAAAjB,OAAAjP,EAAA9O,IACA,GAAAA,EAAA,OAAAlB,EAAAkB,GACAghB,SAAAF,EAAAC,WAOA,SAAAR,eAAAO,EAAAC,GACA,MAAAE,EAAA5jB,EAAAC,WAAAyjB,GACA,GAAAE,EAAA,OAAAvjB,UAEA,IACAL,EAAAme,UAAAsF,GACA,MAAA9gB,GACAA,EAAAxH,QAAAwH,EAAAxH,QAAAsB,QAAA,QAAA,cACA,MAAAkG,EAGA,MAAA8O,EAAA5T,EAAAigB,QAAA4F,GACA,MAAAvC,EAAAnhB,EAAAC,WAAAwR,GACA,GAAA0P,EAAA,OAAAnhB,EAAA6jB,SAAAJ,EAAAC,GACA/B,EAAA7E,WAAArL,GAEA,OAAAzR,EAAA6jB,SAAAJ,EAAAC,GAGAjjB,EAAA9F,QAAA,CACAsoB,WAAAjB,EAAAiB,YACAC,eAAAA,6CCzDA,MAAArlB,EAAA/C,EAAA,MACA,MAAAkF,EAAAlF,EAAA,MACA,MAAA6lB,EAAA7lB,EAAA,MAAA6lB,WAwBA,SAAAmD,aAAAL,EAAAC,EAAAjiB,GACA,GAAA5D,EAAAkmB,WAAAN,GAAA,CACA,OAAAzjB,EAAAshB,MAAAmC,EAAA9gB,IACA,GAAAA,EAAA,CACAA,EAAAxH,QAAAwH,EAAAxH,QAAAsB,QAAA,QAAA,iBACA,OAAAgF,EAAAkB,GAEA,OAAAlB,EAAA,KAAA,CACAuiB,MAAAP,EACAQ,MAAAR,UAGA,CACA,MAAAS,EAAArmB,EAAAigB,QAAA4F,GACA,MAAAS,EAAAtmB,EAAAyL,KAAA4a,EAAAT,GACA,OAAA9C,EAAAwD,EAAA,CAAAxhB,EAAAyhB,KACA,GAAAzhB,EAAA,OAAAlB,EAAAkB,GACA,GAAAyhB,EAAA,CACA,OAAA3iB,EAAA,KAAA,CACAuiB,MAAAG,EACAF,MAAAR,QAEA,CACA,OAAAzjB,EAAAshB,MAAAmC,EAAA9gB,IACA,GAAAA,EAAA,CACAA,EAAAxH,QAAAwH,EAAAxH,QAAAsB,QAAA,QAAA,iBACA,OAAAgF,EAAAkB,GAEA,OAAAlB,EAAA,KAAA,CACAuiB,MAAAP,EACAQ,MAAApmB,EAAAwmB,SAAAH,EAAAT,WAQA,SAAAa,iBAAAb,EAAAC,GACA,IAAAU,EACA,GAAAvmB,EAAAkmB,WAAAN,GAAA,CACAW,EAAApkB,EAAAC,WAAAwjB,GACA,IAAAW,EAAA,MAAA,IAAAvlB,MAAA,mCACA,MAAA,CACAmlB,MAAAP,EACAQ,MAAAR,OAEA,CACA,MAAAS,EAAArmB,EAAAigB,QAAA4F,GACA,MAAAS,EAAAtmB,EAAAyL,KAAA4a,EAAAT,GACAW,EAAApkB,EAAAC,WAAAkkB,GACA,GAAAC,EAAA,CACA,MAAA,CACAJ,MAAAG,EACAF,MAAAR,OAEA,CACAW,EAAApkB,EAAAC,WAAAwjB,GACA,IAAAW,EAAA,MAAA,IAAAvlB,MAAA,mCACA,MAAA,CACAmlB,MAAAP,EACAQ,MAAApmB,EAAAwmB,SAAAH,EAAAT,MAMAhjB,EAAA9F,QAAA,CACAmpB,aAAAA,aACAQ,iBAAAA,+CC/FA,MAAAtkB,EAAAlF,EAAA,MAEA,SAAAypB,YAAAd,EAAAe,EAAA/iB,GACAA,SAAA+iB,IAAA,WAAAA,EAAA/iB,EACA+iB,SAAAA,IAAA,WAAA,MAAAA,EACA,GAAAA,EAAA,OAAA/iB,EAAA,KAAA+iB,GACAxkB,EAAAshB,MAAAmC,EAAA,CAAA9gB,EAAAoe,KACA,GAAApe,EAAA,OAAAlB,EAAA,KAAA,QACA+iB,EAAAzD,GAAAA,EAAA3C,cAAA,MAAA,OACA3c,EAAA,KAAA+iB,KAIA,SAAAC,gBAAAhB,EAAAe,GACA,IAAAzD,EAEA,GAAAyD,EAAA,OAAAA,EACA,IACAzD,EAAA/gB,EAAAme,UAAAsF,GACA,MACA,MAAA,OAEA,OAAA1C,GAAAA,EAAA3C,cAAA,MAAA,OAGA3d,EAAA9F,QAAA,CACA4pB,YAAAA,YACAE,gBAAAA,8CC3BA,MAAAzC,EAAAlnB,EAAA,MAAAmnB,EACA,MAAApkB,EAAA/C,EAAA,MACA,MAAAkF,EAAAlF,EAAA,MACA,MAAA4pB,EAAA5pB,EAAA,MACA,MAAA4lB,EAAAgE,EAAAhE,OACA,MAAA5D,EAAA4H,EAAA5H,WAEA,MAAA6H,EAAA7pB,EAAA,MACA,MAAAgpB,EAAAa,EAAAb,aACA,MAAAQ,EAAAK,EAAAL,iBAEA,MAAAM,EAAA9pB,EAAA,MACA,MAAAypB,EAAAK,EAAAL,YACA,MAAAE,EAAAG,EAAAH,gBAEA,MAAA9D,EAAA7lB,EAAA,MAAA6lB,WAEA,SAAA0C,cAAAI,EAAAC,EAAAc,EAAA/iB,GACAA,SAAA+iB,IAAA,WAAAA,EAAA/iB,EACA+iB,SAAAA,IAAA,WAAA,MAAAA,EAEA7D,EAAA+C,EAAA,CAAA/gB,EAAAihB,KACA,GAAAjhB,EAAA,OAAAlB,EAAAkB,GACA,GAAAihB,EAAA,OAAAniB,EAAA,MACAqiB,EAAAL,EAAAC,EAAA,CAAA/gB,EAAA0hB,KACA,GAAA1hB,EAAA,OAAAlB,EAAAkB,GACA8gB,EAAAY,EAAAJ,MACAM,EAAAF,EAAAL,MAAAQ,EAAA,CAAA7hB,EAAA6hB,KACA,GAAA7hB,EAAA,OAAAlB,EAAAkB,GACA,MAAA8O,EAAA5T,EAAAigB,QAAA4F,GACA/C,EAAAlP,EAAA,CAAA9O,EAAAwe,KACA,GAAAxe,EAAA,OAAAlB,EAAAkB,GACA,GAAAwe,EAAA,OAAAnhB,EAAA+hB,QAAA0B,EAAAC,EAAAc,EAAA/iB,GACAif,EAAAjP,EAAA9O,IACA,GAAAA,EAAA,OAAAlB,EAAAkB,GACA3C,EAAA+hB,QAAA0B,EAAAC,EAAAc,EAAA/iB,aAQA,SAAA6hB,kBAAAG,EAAAC,EAAAc,GACA,MAAAZ,EAAA5jB,EAAAC,WAAAyjB,GACA,GAAAE,EAAA,OAAAvjB,UAEA,MAAAgkB,EAAAC,EAAAb,EAAAC,GACAD,EAAAY,EAAAJ,MACAO,EAAAC,EAAAJ,EAAAL,MAAAQ,GACA,MAAA/S,EAAA5T,EAAAigB,QAAA4F,GACA,MAAAU,EAAApkB,EAAAC,WAAAwR,GACA,GAAA2S,EAAA,OAAApkB,EAAAsgB,YAAAmD,EAAAC,EAAAc,GACA1H,EAAArL,GACA,OAAAzR,EAAAsgB,YAAAmD,EAAAC,EAAAc,GAGA/jB,EAAA9F,QAAA,CACA0oB,cAAArB,EAAAqB,eACAC,kBAAAA,gDC1DA,MAAAtB,EAAAlnB,EAAA,MAAAmnB,EACA,MAAAjiB,EAAAlF,EAAA,MAEA,MAAA+pB,EAAA,CACA,SACA,aACA,QACA,QACA,QACA,WACA,SACA,SACA,YACA,QACA,QACA,YACA,UACA,SACA,SACA,OACA,QACA,QACA,UACA,OACA,UACA,UACA,WACA,WACA,WACA,SACA,QACA,OACA,UACA,WACA,SACA,SACA,aACAnX,OAAAvR,IAIA,cAAA6D,EAAA7D,KAAA,aAIA5B,OAAAyB,KAAAgE,GAAA4I,QAAAzM,IACA,GAAAA,IAAA,WAAA,CAGA,OAEAxB,EAAAwB,GAAA6D,EAAA7D,KAIA0oB,EAAAjc,QAAAkc,IACAnqB,EAAAmqB,GAAA9C,EAAAhiB,EAAA8kB,MAKAnqB,EAAAypB,OAAA,SAAAW,EAAAtjB,GACA,UAAAA,IAAA,WAAA,CACA,OAAAzB,EAAAokB,OAAAW,EAAAtjB,GAEA,OAAA,IAAAxE,QAAAD,IACA,OAAAgD,EAAAokB,OAAAW,EAAA/nB,MAMArC,EAAAqqB,KAAA,SAAAC,EAAA1W,EAAA2W,EAAAjpB,EAAAkpB,EAAA1jB,GACA,UAAAA,IAAA,WAAA,CACA,OAAAzB,EAAAglB,KAAAC,EAAA1W,EAAA2W,EAAAjpB,EAAAkpB,EAAA1jB,GAEA,OAAA,IAAAxE,QAAA,CAAAD,EAAAE,KACA8C,EAAAglB,KAAAC,EAAA1W,EAAA2W,EAAAjpB,EAAAkpB,EAAA,CAAAxiB,EAAAyiB,EAAA7W,KACA,GAAA5L,EAAA,OAAAzF,EAAAyF,GACA3F,EAAA,CAAAooB,UAAAA,EAAA7W,OAAAA,SAUA5T,EAAAa,MAAA,SAAAypB,EAAA1W,KAAAjN,GACA,UAAAA,EAAAA,EAAArF,OAAA,KAAA,WAAA,CACA,OAAA+D,EAAAxE,MAAAypB,EAAA1W,KAAAjN,GAGA,OAAA,IAAArE,QAAA,CAAAD,EAAAE,KACA8C,EAAAxE,MAAAypB,EAAA1W,KAAAjN,EAAA,CAAAqB,EAAA0iB,EAAA9W,KACA,GAAA5L,EAAA,OAAAzF,EAAAyF,GACA3F,EAAA,CAAAqoB,aAAAA,EAAA9W,OAAAA,SAMA,UAAAvO,EAAAslB,SAAA,WAAA,CAIA3qB,EAAA2qB,OAAA,SAAAL,EAAAM,KAAAjkB,GACA,UAAAA,EAAAA,EAAArF,OAAA,KAAA,WAAA,CACA,OAAA+D,EAAAslB,OAAAL,EAAAM,KAAAjkB,GAGA,OAAA,IAAArE,QAAA,CAAAD,EAAAE,KACA8C,EAAAslB,OAAAL,EAAAM,KAAAjkB,EAAA,CAAAqB,EAAA0iB,EAAAE,KACA,GAAA5iB,EAAA,OAAAzF,EAAAyF,GACA3F,EAAA,CAAAqoB,aAAAA,EAAAE,QAAAA,SAOA,UAAAvlB,EAAAwlB,SAAAC,SAAA,WAAA,CACA9qB,EAAA6qB,SAAAC,OAAAzD,EAAAhiB,EAAAwlB,SAAAC,sCC5HAhlB,EAAA9F,QAAA,IAEAG,EAAA,SAEAA,EAAA,SACAA,EAAA,SACAA,EAAA,SACAA,EAAA,OACAA,EAAA,QACAA,EAAA,SACAA,EAAA,SACAA,EAAA,SACAA,EAAA,SACAA,EAAA,SACAA,EAAA,OAKA,MAAAkF,EAAAlF,EAAA,MACA,GAAAP,OAAAmrB,yBAAA1lB,EAAA,YAAA,CACAzF,OAAAG,eAAA+F,EAAA9F,QAAA,WAAA,CACAmB,MAAA,OAAAkE,EAAA2lB,yCCtBA,MAAA3D,EAAAlnB,EAAA,MAAA6a,EACA,MAAAiQ,EAAA9qB,EAAA,MAEA8qB,EAAAC,WAAA7D,EAAAlnB,EAAA,MACA8qB,EAAAE,eAAAhrB,EAAA,MAEA8qB,EAAAG,WAAAH,EAAAC,WACAD,EAAAI,eAAAJ,EAAAE,eACAF,EAAAK,UAAAL,EAAAM,UACAN,EAAAO,cAAAP,EAAAQ,cACAR,EAAAS,SAAAT,EAAAU,SACAV,EAAAW,aAAAX,EAAAY,aAEA/lB,EAAA9F,QAAAirB,+BCbA,MAAAA,EAAA9qB,EAAA,MAEA2F,EAAA9F,QAAA,CAEA2rB,SAAAV,EAAAa,SACAD,aAAAZ,EAAAc,aACAR,UAAAN,EAAAjD,UACAyD,cAAAR,EAAA/C,4CCPA,MAAAriB,UAAAA,GAAA1F,EAAA,MACA,MAAA6rB,eAAAA,GAAA7rB,EAAA,MAEA,SAAAgrB,eAAArD,EAAApW,EAAA3N,GACA,MAAAkoB,EAAApmB,EAAA6L,EAAA3N,GAEAioB,EAAAlE,EAAAmE,EAAAloB,GAGA+B,EAAA9F,QAAAmrB,2CCTA,MAAAtlB,UAAAA,GAAA1F,EAAA,MACA,MAAA+rB,WAAAA,GAAA/rB,EAAA,MAEAgsB,eAAAjB,WAAApD,EAAApW,EAAA3N,EAAA,IACA,MAAAkoB,EAAApmB,EAAA6L,EAAA3N,SAEAmoB,EAAApE,EAAAmE,EAAAloB,GAGA+B,EAAA9F,QAAAkrB,wCCVA,MAAA7D,EAAAlnB,EAAA,MAAA6a,EACA,MAAAoR,QAAAC,EAAAC,YAAAA,GAAAnsB,EAAA,MACA,MAAAisB,EAAA/E,EAAAgF,GAEAvmB,EAAA9F,QAAA,CACA+lB,OAAAqG,EACAjK,WAAAmK,EAEAC,OAAAH,EACAI,WAAAF,EACAG,UAAAL,EACAM,cAAAJ,gCCNA,MAAAjnB,EAAAlF,EAAA,MACA,MAAA+C,EAAA/C,EAAA,MACA,MAAAwsB,EAAAxsB,EAAA,MAEA,MAAAysB,EAAAD,EAAA,WAIA,MAAAE,EAAAC,IACA,GAAAnsB,QAAAosB,WAAA,QAAA,CACA,MAAAC,EAAA,YAAAhW,KAAA8V,EAAAhrB,QAAAoB,EAAA+pB,MAAAH,GAAA7mB,KAAA,KAEA,GAAA+mB,EAAA,CACA,MAAAtoB,EAAA,IAAAR,2CAAA4oB,KACApoB,EAAAqa,KAAA,SACA,MAAAra,KAKA,MAAAwoB,EAAAnpB,IACA,MAAAopB,EAAA,CAAA5I,KAAA,KACA,UAAAxgB,IAAA,SAAAA,EAAA,CAAAwgB,KAAAxgB,GACA,MAAA,IAAAopB,KAAAppB,IAGA,MAAAqpB,EAAAN,IAGA,MAAApoB,EAAA,IAAAR,yCAAA4oB,MACApoB,EAAAqa,KAAA,QACAra,EAAA2oB,OAAA,KACA3oB,EAAAxB,KAAA4pB,EACApoB,EAAA4oB,QAAA,QACA,OAAA5oB,GAGAoB,EAAA9F,QAAAosB,QAAAD,OAAA1mB,EAAA1B,KACA8oB,EAAApnB,GACA1B,EAAAmpB,EAAAnpB,GAEA,GAAA6oB,EAAA,CACA,MAAAE,EAAA5pB,EAAAb,QAAAoD,GAEA,OAAAJ,EAAA2hB,MAAA8F,EAAA,CACAvI,KAAAxgB,EAAAwgB,KACAgJ,UAAA,OAIA,MAAAC,EAAArB,MAAAA,IACA,UACA9mB,EAAA2hB,MAAA8F,EAAA/oB,EAAAwgB,MACA,MAAA7f,GACA,GAAAA,EAAAqa,OAAA,QAAA,CACA,MAAAra,EAGA,GAAAA,EAAAqa,OAAA,SAAA,CACA,GAAA7b,EAAAigB,QAAA2J,KAAAA,EAAA,CACA,MAAAM,EAAAN,GAGA,GAAApoB,EAAAlE,QAAAitB,SAAA,cAAA,CACA,MAAA/oB,QAGA8oB,EAAAtqB,EAAAigB,QAAA2J,IACA,OAAAU,EAAAV,GAGA,IACA,MAAA1G,QAAA/gB,EAAAgd,KAAAyK,GACA,IAAA1G,EAAA3C,cAAA,CAGA,MAAA,IAAAvf,MAAA,gCAEA,MACA,MAAAQ,KAKA,OAAA8oB,EAAAtqB,EAAAb,QAAAoD,MAGAK,EAAA9F,QAAAssB,YAAA,EAAA7mB,EAAA1B,KACA8oB,EAAApnB,GACA1B,EAAAmpB,EAAAnpB,GAEA,GAAA6oB,EAAA,CACA,MAAAE,EAAA5pB,EAAAb,QAAAoD,GAEA,OAAAJ,EAAA8f,UAAA2H,EAAA,CACAvI,KAAAxgB,EAAAwgB,KACAgJ,UAAA,OAIA,MAAAC,EAAAV,IACA,IACAznB,EAAA8f,UAAA2H,EAAA/oB,EAAAwgB,MACA,MAAA7f,GACA,GAAAA,EAAAqa,OAAA,QAAA,CACA,MAAAra,EAGA,GAAAA,EAAAqa,OAAA,SAAA,CACA,GAAA7b,EAAAigB,QAAA2J,KAAAA,EAAA,CACA,MAAAM,EAAAN,GAGA,GAAApoB,EAAAlE,QAAAitB,SAAA,cAAA,CACA,MAAA/oB,EAGA8oB,EAAAtqB,EAAAigB,QAAA2J,IACA,OAAAU,EAAAV,GAGA,IACA,IAAAznB,EAAAie,SAAAwJ,GAAArJ,cAAA,CAGA,MAAA,IAAAvf,MAAA,gCAEA,MACA,MAAAQ,KAKA,OAAA8oB,EAAAtqB,EAAAb,QAAAoD,mCCzIAK,EAAA9F,QAAA,CACA0tB,SAAAvtB,EAAA,oCCDA,MAAAkF,EAAAlF,EAAA,MACA,MAAA+C,EAAA/C,EAAA,MACA,MAAAmiB,EAAAniB,EAAA,MAAAmiB,SACA,MAAAoF,EAAAvnB,EAAA,MAAAunB,WACA,MAAA8E,EAAArsB,EAAA,MAAAqsB,WACA,MAAAnK,EAAAliB,EAAA,MAEA,SAAAutB,SAAAvd,EAAAoS,EAAAlc,GACAA,EAAAA,GAAA,GACA,MAAAoc,EAAApc,EAAAoc,WAAApc,EAAAmc,SAAA,MAEA,MAAAK,QAAAA,GAAAR,EAAAU,eAAA5S,EAAAoS,EAAA,QACAF,EAAAW,qBAAA7S,EAAA0S,EAAAN,EAAA,QACAiK,EAAAtpB,EAAAigB,QAAAZ,IACA,OAAAoL,SAAAxd,EAAAoS,EAAAE,GAGA,SAAAkL,SAAAxd,EAAAoS,EAAAE,GACA,GAAAA,EAAA,CACAiF,EAAAnF,GACA,OAAAqL,OAAAzd,EAAAoS,EAAAE,GAEA,GAAApd,EAAAC,WAAAid,GAAA,MAAA,IAAAre,MAAA,wBACA,OAAA0pB,OAAAzd,EAAAoS,EAAAE,GAGA,SAAAmL,OAAAzd,EAAAoS,EAAAE,GACA,IACApd,EAAAwoB,WAAA1d,EAAAoS,GACA,MAAAva,GACA,GAAAA,EAAA+W,OAAA,QAAA,MAAA/W,EACA,OAAA8lB,iBAAA3d,EAAAoS,EAAAE,IAIA,SAAAqL,iBAAA3d,EAAAoS,EAAAE,GACA,MAAApc,EAAA,CACAoc,UAAAA,EACA2B,aAAA,MAEA9B,EAAAnS,EAAAoS,EAAAlc,GACA,OAAAqhB,EAAAvX,GAGArK,EAAA9F,QAAA0tB,sCC5CA,MAAArG,EAAAlnB,EAAA,MAAAmnB,EACAxhB,EAAA9F,QAAA,CACA+tB,KAAA1G,EAAAlnB,EAAA,qCCFA,MAAAkF,EAAAlF,EAAA,MACA,MAAA+C,EAAA/C,EAAA,MACA,MAAA+lB,EAAA/lB,EAAA,MAAA+lB,KACA,MAAA/R,EAAAhU,EAAA,MAAAgU,OACA,MAAAoY,EAAApsB,EAAA,MAAAosB,OACA,MAAAvG,EAAA7lB,EAAA,MAAA6lB,WACA,MAAA3D,EAAAliB,EAAA,MAEA,SAAA4tB,KAAA5d,EAAAoS,EAAAlc,EAAA6C,GACA,UAAA7C,IAAA,WAAA,CACA6C,EAAA7C,EACAA,EAAA,GAGA,MAAAoc,EAAApc,EAAAoc,WAAApc,EAAAmc,SAAA,MAEAH,EAAA8D,WAAAhW,EAAAoS,EAAA,OAAA,CAAAva,EAAAoe,KACA,GAAApe,EAAA,OAAAkB,EAAAlB,GACA,MAAA6a,QAAAA,GAAAuD,EACA/D,EAAAgE,iBAAAlW,EAAA0S,EAAAN,EAAA,OAAAva,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACAukB,EAAArpB,EAAAigB,QAAAZ,GAAAva,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,OAAA2lB,SAAAxd,EAAAoS,EAAAE,EAAAvZ,SAMA,SAAAykB,SAAAxd,EAAAoS,EAAAE,EAAAvZ,GACA,GAAAuZ,EAAA,CACA,OAAAtO,EAAAoO,EAAAva,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,OAAA4lB,OAAAzd,EAAAoS,EAAAE,EAAAvZ,KAGA8c,EAAAzD,EAAA,CAAAva,EAAAgmB,KACA,GAAAhmB,EAAA,OAAAkB,EAAAlB,GACA,GAAAgmB,EAAA,OAAA9kB,EAAA,IAAAhF,MAAA,yBACA,OAAA0pB,OAAAzd,EAAAoS,EAAAE,EAAAvZ,KAIA,SAAA0kB,OAAAzd,EAAAoS,EAAAE,EAAAvZ,GACA7D,EAAAuoB,OAAAzd,EAAAoS,EAAAva,IACA,IAAAA,EAAA,OAAAkB,IACA,GAAAlB,EAAA+W,OAAA,QAAA,OAAA7V,EAAAlB,GACA,OAAA8lB,iBAAA3d,EAAAoS,EAAAE,EAAAvZ,KAIA,SAAA4kB,iBAAA3d,EAAAoS,EAAAE,EAAAvZ,GACA,MAAA7C,EAAA,CACAoc,UAAAA,EACA2B,aAAA,MAEA8B,EAAA/V,EAAAoS,EAAAlc,EAAA2B,IACA,GAAAA,EAAA,OAAAkB,EAAAlB,GACA,OAAAmM,EAAAhE,EAAAjH,KAIApD,EAAA9F,QAAA+tB,kCC9DA,MAAA1G,EAAAlnB,EAAA,MAAAmnB,EACA,MAAAjiB,EAAAlF,EAAA,MACA,MAAA+C,EAAA/C,EAAA,MACA,MAAA6mB,EAAA7mB,EAAA,MACA,MAAA6lB,EAAA7lB,EAAA,MAAA6lB,WAEA,SAAAkG,WAAApE,EAAApW,EAAAlM,EAAAsB,GACA,UAAAtB,IAAA,WAAA,CACAsB,EAAAtB,EACAA,EAAA,OAGA,MAAAsR,EAAA5T,EAAAigB,QAAA2E,GACA9B,EAAAlP,EAAA,CAAA9O,EAAAimB,KACA,GAAAjmB,EAAA,OAAAlB,EAAAkB,GACA,GAAAimB,EAAA,OAAA5oB,EAAA2iB,UAAAF,EAAApW,EAAAlM,EAAAsB,GAEAkgB,EAAAjB,OAAAjP,EAAA9O,IACA,GAAAA,EAAA,OAAAlB,EAAAkB,GAEA3C,EAAA2iB,UAAAF,EAAApW,EAAAlM,EAAAsB,OAKA,SAAAklB,eAAAlE,KAAAnhB,GACA,MAAAmQ,EAAA5T,EAAAigB,QAAA2E,GACA,GAAAziB,EAAAC,WAAAwR,GAAA,CACA,OAAAzR,EAAA6iB,cAAAJ,KAAAnhB,GAEAqgB,EAAA7E,WAAArL,GACAzR,EAAA6iB,cAAAJ,KAAAnhB,GAGAb,EAAA9F,QAAA,CACAksB,WAAA7E,EAAA6E,YACAF,eAAAA,6CCrCA,MAAA3E,EAAAlnB,EAAA,MAAA6a,EACA,MAAA3V,EAAAlF,EAAA,MAEA,SAAA6lB,WAAA9iB,GACA,OAAAmC,EAAA6oB,OAAAhrB,GAAAJ,KAAA,IAAA,MAAA2I,MAAA,IAAA,OAGA3F,EAAA9F,QAAA,CACAgmB,WAAAqB,EAAArB,YACAmI,eAAA9oB,EAAAC,yCCRA,MAAA+hB,EAAAlnB,EAAA,MAAAmnB,EACA,MAAA8G,EAAAjuB,EAAA,MAEA2F,EAAA9F,QAAA,CACAmU,OAAAkT,EAAA+G,GACA1G,WAAA0G,EAAAtW,mCCLA,MAAAzS,EAAAlF,EAAA,MACA,MAAA+C,EAAA/C,EAAA,MACA,MAAAkuB,EAAAluB,EAAA,MAEA,MAAAmuB,EAAA3tB,QAAAosB,WAAA,QAEA,SAAAI,SAAAppB,GACA,MAAAwqB,EAAA,CACA,SACA,QACA,OACA,QACA,QACA,WAEAA,EAAAtgB,QAAAugB,IACAzqB,EAAAyqB,GAAAzqB,EAAAyqB,IAAAnpB,EAAAmpB,GACAA,EAAAA,EAAA,OACAzqB,EAAAyqB,GAAAzqB,EAAAyqB,IAAAnpB,EAAAmpB,KAGAzqB,EAAA0qB,aAAA1qB,EAAA0qB,cAAA,EAGA,SAAAL,OAAApT,EAAAjX,EAAAmF,GACA,IAAAwlB,EAAA,EAEA,UAAA3qB,IAAA,WAAA,CACAmF,EAAAnF,EACAA,EAAA,GAGAsqB,EAAArT,EAAA,wBACAqT,EAAAM,mBAAA3T,EAAA,SAAA,mCACAqT,EAAAM,mBAAAzlB,EAAA,WAAA,sCACAmlB,EAAAtqB,EAAA,6CACAsqB,EAAAM,mBAAA5qB,EAAA,SAAA,oCAEAopB,SAAAppB,GAEA6qB,QAAA5T,EAAAjX,EAAA,SAAA8qB,GAAAC,GACA,GAAAA,EAAA,CACA,IAAAA,EAAA/P,OAAA,SAAA+P,EAAA/P,OAAA,aAAA+P,EAAA/P,OAAA,UACA2P,EAAA3qB,EAAA0qB,aAAA,CACAC,IACA,MAAAK,EAAAL,EAAA,IAEA,OAAArnB,WAAA,IAAAunB,QAAA5T,EAAAjX,EAAA8qB,IAAAE,GAIA,GAAAD,EAAA/P,OAAA,SAAA+P,EAAA,KAGA5lB,EAAA4lB,KAeA,SAAAF,QAAA5T,EAAAjX,EAAAmF,GACAmlB,EAAArT,GACAqT,EAAAtqB,GACAsqB,SAAAnlB,IAAA,YAIAnF,EAAA4iB,MAAA3L,EAAA,CAAA8T,EAAAE,KACA,GAAAF,GAAAA,EAAA/P,OAAA,SAAA,CACA,OAAA7V,EAAA,MAIA,GAAA4lB,GAAAA,EAAA/P,OAAA,SAAAuP,EAAA,CACA,OAAAW,YAAAjU,EAAAjX,EAAA+qB,EAAA5lB,GAGA,GAAA8lB,GAAAA,EAAAvL,cAAA,CACA,OAAAyL,MAAAlU,EAAAjX,EAAA+qB,EAAA5lB,GAGAnF,EAAA6iB,OAAA5L,EAAA8T,IACA,GAAAA,EAAA,CACA,GAAAA,EAAA/P,OAAA,SAAA,CACA,OAAA7V,EAAA,MAEA,GAAA4lB,EAAA/P,OAAA,QAAA,CACA,OAAA,EACAkQ,YAAAjU,EAAAjX,EAAA+qB,EAAA5lB,GACAgmB,MAAAlU,EAAAjX,EAAA+qB,EAAA5lB,GAEA,GAAA4lB,EAAA/P,OAAA,SAAA,CACA,OAAAmQ,MAAAlU,EAAAjX,EAAA+qB,EAAA5lB,IAGA,OAAAA,EAAA4lB,OAKA,SAAAG,YAAAjU,EAAAjX,EAAA+qB,EAAA5lB,GACAmlB,EAAArT,GACAqT,EAAAtqB,GACAsqB,SAAAnlB,IAAA,YAEAnF,EAAAgjB,MAAA/L,EAAA,IAAAmU,IACA,GAAAA,EAAA,CACAjmB,EAAAimB,EAAApQ,OAAA,SAAA,KAAA+P,OACA,CACA/qB,EAAAse,KAAArH,EAAA,CAAAoU,EAAAhJ,KACA,GAAAgJ,EAAA,CACAlmB,EAAAkmB,EAAArQ,OAAA,SAAA,KAAA+P,QACA,GAAA1I,EAAA3C,cAAA,CACAyL,MAAAlU,EAAAjX,EAAA+qB,EAAA5lB,OACA,CACAnF,EAAA6iB,OAAA5L,EAAA9R,SAOA,SAAAmmB,gBAAArU,EAAAjX,EAAA+qB,GACA,IAAA1I,EAEAiI,EAAArT,GACAqT,EAAAtqB,GAEA,IACAA,EAAA8gB,UAAA7J,EAAA,KACA,MAAAmU,GACA,GAAAA,EAAApQ,OAAA,SAAA,CACA,WACA,CACA,MAAA+P,GAIA,IACA1I,EAAAriB,EAAAuf,SAAAtI,GACA,MAAAoU,GACA,GAAAA,EAAArQ,OAAA,SAAA,CACA,WACA,CACA,MAAA+P,GAIA,GAAA1I,EAAA3C,cAAA,CACA6L,UAAAtU,EAAAjX,EAAA+qB,OACA,CACA/qB,EAAAogB,WAAAnJ,IAIA,SAAAkU,MAAAlU,EAAAjX,EAAAwrB,EAAArmB,GACAmlB,EAAArT,GACAqT,EAAAtqB,GACAsqB,SAAAnlB,IAAA,YAKAnF,EAAAmrB,MAAAlU,EAAA8T,IACA,GAAAA,IAAAA,EAAA/P,OAAA,aAAA+P,EAAA/P,OAAA,UAAA+P,EAAA/P,OAAA,SAAA,CACAyQ,OAAAxU,EAAAjX,EAAAmF,QACA,GAAA4lB,GAAAA,EAAA/P,OAAA,UAAA,CACA7V,EAAAqmB,OACA,CACArmB,EAAA4lB,MAKA,SAAAU,OAAAxU,EAAAjX,EAAAmF,GACAmlB,EAAArT,GACAqT,EAAAtqB,GACAsqB,SAAAnlB,IAAA,YAEAnF,EAAAkjB,QAAAjM,EAAA,CAAA8T,EAAAW,KACA,GAAAX,EAAA,OAAA5lB,EAAA4lB,GAEA,IAAAzP,EAAAoQ,EAAAnuB,OACA,IAAAouB,EAEA,GAAArQ,IAAA,EAAA,OAAAtb,EAAAmrB,MAAAlU,EAAA9R,GAEAumB,EAAAxhB,QAAA0hB,IACAvB,OAAAlrB,EAAAyL,KAAAqM,EAAA2U,GAAA5rB,EAAA+qB,IACA,GAAAY,EAAA,CACA,OAEA,GAAAZ,EAAA,OAAA5lB,EAAAwmB,EAAAZ,GACA,KAAAzP,IAAA,EAAA,CACAtb,EAAAmrB,MAAAlU,EAAA9R,UAUA,SAAA0mB,WAAA5U,EAAAjX,GACA,IAAAirB,EAEAjrB,EAAAA,GAAA,GACAopB,SAAAppB,GAEAsqB,EAAArT,EAAA,wBACAqT,EAAAM,mBAAA3T,EAAA,SAAA,mCACAqT,EAAAtqB,EAAA,2BACAsqB,EAAAM,mBAAA5qB,EAAA,SAAA,oCAEA,IACAirB,EAAAjrB,EAAAyf,UAAAxI,GACA,MAAA8T,GACA,GAAAA,EAAA/P,OAAA,SAAA,CACA,OAIA,GAAA+P,EAAA/P,OAAA,SAAAuP,EAAA,CACAe,gBAAArU,EAAAjX,EAAA+qB,IAIA,IAEA,GAAAE,GAAAA,EAAAvL,cAAA,CACA6L,UAAAtU,EAAAjX,EAAA,UACA,CACAA,EAAAogB,WAAAnJ,IAEA,MAAA8T,GACA,GAAAA,EAAA/P,OAAA,SAAA,CACA,YACA,GAAA+P,EAAA/P,OAAA,QAAA,CACA,OAAAuP,EAAAe,gBAAArU,EAAAjX,EAAA+qB,GAAAQ,UAAAtU,EAAAjX,EAAA+qB,QACA,GAAAA,EAAA/P,OAAA,SAAA,CACA,MAAA+P,EAEAQ,UAAAtU,EAAAjX,EAAA+qB,IAIA,SAAAQ,UAAAtU,EAAAjX,EAAAwrB,GACAlB,EAAArT,GACAqT,EAAAtqB,GAEA,IACAA,EAAAurB,UAAAtU,GACA,MAAA8T,GACA,GAAAA,EAAA/P,OAAA,UAAA,CACA,MAAAwQ,OACA,GAAAT,EAAA/P,OAAA,aAAA+P,EAAA/P,OAAA,UAAA+P,EAAA/P,OAAA,QAAA,CACA8Q,WAAA7U,EAAAjX,QACA,GAAA+qB,EAAA/P,OAAA,SAAA,CACA,MAAA+P,IAKA,SAAAe,WAAA7U,EAAAjX,GACAsqB,EAAArT,GACAqT,EAAAtqB,GACAA,EAAAqhB,YAAApK,GAAA/M,QAAA0hB,GAAAC,WAAA1sB,EAAAyL,KAAAqM,EAAA2U,GAAA5rB,IAEA,GAAAuqB,EAAA,CAOA,MAAAwB,EAAAC,KAAAC,MACA,EAAA,CACA,IACA,MAAAC,EAAAlsB,EAAAurB,UAAAtU,EAAAjX,GACA,OAAAksB,EACA,cACAF,KAAAC,MAAAF,EAAA,SACA,CACA,MAAAG,EAAAlsB,EAAAurB,UAAAtU,EAAAjX,GACA,OAAAksB,GAIAnqB,EAAA9F,QAAAouB,OACAA,OAAAtW,KAAA8X,wCC3SA,MAAAvqB,EAAAlF,EAAA,MACA,MAAA+C,EAAA/C,EAAA,MACA,MAAA+vB,EAAA/vB,EAAA,MACA,MAAAwsB,EAAAxsB,EAAA,MAEA,MAAAgwB,EAAAxD,EAAA,UACA,MAAAtK,EAAAyF,GAAAqI,EAAA9qB,EAAAgd,KAAAyF,EAAA,CAAAsI,OAAA,OAAA/qB,EAAAgd,KAAAyF,GACA,MAAAxE,EAAAwE,GAAAqI,EAAA9qB,EAAAie,SAAAwE,EAAA,CAAAsI,OAAA,OAAA/qB,EAAAie,SAAAwE,GAEA,SAAAzE,SAAAlT,EAAAoS,GACA,OAAAjgB,QAAA+d,IAAA,CACAgC,EAAAlS,GACAkS,EAAAE,GAAA9W,MAAAzD,IACA,GAAAA,EAAA+W,OAAA,SAAA,OAAA,KACA,MAAA/W,MAEAlF,KAAA,EAAA+f,EAAAC,MAAA,CAAAD,QAAAA,EAAAC,SAAAA,KAGA,SAAAuN,aAAAlgB,EAAAoS,GACA,IAAAO,EACA,MAAAD,EAAAS,EAAAnT,GACA,IACA2S,EAAAQ,EAAAf,GACA,MAAAva,GACA,GAAAA,EAAA+W,OAAA,SAAA,MAAA,CAAA8D,QAAAA,EAAAC,SAAA,MACA,MAAA9a,EAEA,MAAA,CAAA6a,QAAAA,EAAAC,SAAAA,GAGA,SAAAqD,WAAAhW,EAAAoS,EAAA+N,EAAApnB,GACAgnB,EAAAK,YAAAlN,SAAA6M,CAAA/f,EAAAoS,EAAA,CAAAva,EAAAoe,KACA,GAAApe,EAAA,OAAAkB,EAAAlB,GACA,MAAA6a,QAAAA,EAAAC,SAAAA,GAAAsD,EACA,GAAAtD,GAAA0N,aAAA3N,EAAAC,GAAA,CACA,OAAA5Z,EAAA,IAAAhF,MAAA,iDAEA,GAAA2e,EAAAY,eAAAoC,YAAA1V,EAAAoS,GAAA,CACA,OAAArZ,EAAA,IAAAhF,MAAAusB,OAAAtgB,EAAAoS,EAAA+N,KAEA,OAAApnB,EAAA,KAAA,CAAA2Z,QAAAA,EAAAC,SAAAA,MAIA,SAAAC,eAAA5S,EAAAoS,EAAA+N,GACA,MAAAzN,QAAAA,EAAAC,SAAAA,GAAAuN,aAAAlgB,EAAAoS,GACA,GAAAO,GAAA0N,aAAA3N,EAAAC,GAAA,CACA,MAAA,IAAA5e,MAAA,gDAEA,GAAA2e,EAAAY,eAAAoC,YAAA1V,EAAAoS,GAAA,CACA,MAAA,IAAAre,MAAAusB,OAAAtgB,EAAAoS,EAAA+N,IAEA,MAAA,CAAAzN,QAAAA,EAAAC,SAAAA,GAOA,SAAAuD,iBAAAlW,EAAA0S,EAAAN,EAAA+N,EAAApnB,GACA,MAAAwnB,EAAAxtB,EAAAb,QAAAa,EAAAigB,QAAAhT,IACA,MAAA+S,EAAAhgB,EAAAb,QAAAa,EAAAigB,QAAAZ,IACA,GAAAW,IAAAwN,GAAAxN,IAAAhgB,EAAA+pB,MAAA/J,GAAAjd,KAAA,OAAAiD,IACA,MAAApC,EAAA,CAAAkB,EAAA8a,KACA,GAAA9a,EAAA,CACA,GAAAA,EAAA+W,OAAA,SAAA,OAAA7V,IACA,OAAAA,EAAAlB,GAEA,GAAAwoB,aAAA3N,EAAAC,GAAA,CACA,OAAA5Z,EAAA,IAAAhF,MAAAusB,OAAAtgB,EAAAoS,EAAA+N,KAEA,OAAAjK,iBAAAlW,EAAA0S,EAAAK,EAAAoN,EAAApnB,IAEA,GAAAinB,EAAA9qB,EAAAgd,KAAAa,EAAA,CAAAkN,OAAA,MAAAtpB,QACAzB,EAAAgd,KAAAa,EAAApc,GAGA,SAAAkc,qBAAA7S,EAAA0S,EAAAN,EAAA+N,GACA,MAAAI,EAAAxtB,EAAAb,QAAAa,EAAAigB,QAAAhT,IACA,MAAA+S,EAAAhgB,EAAAb,QAAAa,EAAAigB,QAAAZ,IACA,GAAAW,IAAAwN,GAAAxN,IAAAhgB,EAAA+pB,MAAA/J,GAAAjd,KAAA,OACA,IAAA6c,EACA,IACAA,EAAAQ,EAAAJ,GACA,MAAAlb,GACA,GAAAA,EAAA+W,OAAA,SAAA,OACA,MAAA/W,EAEA,GAAAwoB,aAAA3N,EAAAC,GAAA,CACA,MAAA,IAAA5e,MAAAusB,OAAAtgB,EAAAoS,EAAA+N,IAEA,OAAAtN,qBAAA7S,EAAA0S,EAAAK,EAAAoN,GAGA,SAAAE,aAAA3N,EAAAC,GACA,GAAAA,EAAA6N,KAAA7N,EAAA8N,KAAA9N,EAAA6N,MAAA9N,EAAA8N,KAAA7N,EAAA8N,MAAA/N,EAAA+N,IAAA,CACA,GAAAT,GAAArN,EAAA6N,IAAA7V,OAAA+V,iBAAA,CAEA,OAAA,KAKA,GAAA/N,EAAA5D,OAAA2D,EAAA3D,MACA4D,EAAAyB,OAAA1B,EAAA0B,MACAzB,EAAAgO,QAAAjO,EAAAiO,OACAhO,EAAAiO,UAAAlO,EAAAkO,SACAjO,EAAAkO,UAAAnO,EAAAmO,SACAlO,EAAAmO,UAAApO,EAAAoO,SACAnO,EAAAoO,cAAArO,EAAAqO,YAAA,CAEA,OAAA,MAGA,OAAA,MAKA,SAAArL,YAAA1V,EAAAoS,GACA,MAAA4O,EAAAjuB,EAAAb,QAAA8N,GAAAE,MAAAnN,EAAAkuB,KAAAre,OAAAvI,GAAAA,GACA,MAAA6mB,EAAAnuB,EAAAb,QAAAkgB,GAAAlS,MAAAnN,EAAAkuB,KAAAre,OAAAvI,GAAAA,GACA,OAAA2mB,EAAAzc,OAAA,CAAA+I,EAAAhM,EAAAjH,IAAAiT,GAAA4T,EAAA7mB,KAAAiH,EAAA,MAGA,SAAAgf,OAAAtgB,EAAAoS,EAAA+N,GACA,gBAAAA,MAAAngB,oCAAAoS,MAGAzc,EAAA9F,QAAA,CACAmmB,WAAAA,WACApD,eAAAA,eACAsD,iBAAAA,iBACArD,qBAAAA,qBACA6C,YAAAA,0CCvIA,MAAAxgB,EAAAlF,EAAA,MAEA,SAAA8lB,aAAA/iB,EAAA6hB,EAAAC,EAAAle,GAEAzB,EAAAisB,KAAApuB,EAAA,KAAA,CAAA8E,EAAAsiB,KACA,GAAAtiB,EAAA,OAAAlB,EAAAkB,GACA3C,EAAAksB,QAAAjH,EAAAvF,EAAAC,EAAAwM,IACAnsB,EAAAosB,MAAAnH,EAAAoH,IACA,GAAA5qB,EAAAA,EAAA0qB,GAAAE,SAMA,SAAAtP,iBAAAlf,EAAA6hB,EAAAC,GACA,MAAAsF,EAAAjlB,EAAAssB,SAAAzuB,EAAA,MACAmC,EAAAusB,YAAAtH,EAAAvF,EAAAC,GACA,OAAA3f,EAAAwsB,UAAAvH,GAGAxkB,EAAA9F,QAAA,CACAimB,aAAAA,aACA7D,iBAAAA,yCCtBAtc,EAAA9F,QAAA8xB,MAEA,SAAAA,MAAAzpB,GACA,GAAAA,IAAA,aAAAA,IAAA,SACA,OAAAA,EAEA,GAAAA,aAAAzI,OACA,IAAAsmB,EAAA,CAAA6L,UAAA1pB,EAAA0pB,gBAEA,IAAA7L,EAAAtmB,OAAAiO,OAAA,MAEAjO,OAAAoyB,oBAAA3pB,GAAA4F,QAAA,SAAAzM,GACA5B,OAAAG,eAAAmmB,EAAA1kB,EAAA5B,OAAAmrB,yBAAA1iB,EAAA7G,MAGA,OAAA0kB,mBCjBA,IAAA7gB,EAAAlF,EAAA,MACA,IAAA8xB,EAAA9xB,EAAA,KACA,IAAA+xB,EAAA/xB,EAAA,MACA,IAAA2xB,EAAA3xB,EAAA,MAEA,IAAA+vB,EAAA/vB,EAAA,MAGA,IAAAgyB,EACA,IAAAC,EAGA,UAAAnqB,SAAA,mBAAAA,OAAAoqB,MAAA,WAAA,CACAF,EAAAlqB,OAAAoqB,IAAA,qBAEAD,EAAAnqB,OAAAoqB,IAAA,4BACA,CACAF,EAAA,uBACAC,EAAA,0BAGA,SAAAE,QAEA,SAAAC,aAAAC,EAAA1gB,GACAlS,OAAAG,eAAAyyB,EAAAL,EAAA,CACAM,IAAA,WACA,OAAA3gB,KAKA,IAAAlN,EAAA0tB,KACA,GAAApC,EAAAwC,SACA9tB,EAAAsrB,EAAAwC,SAAA,aACA,GAAA,YAAA1b,KAAArW,QAAA2C,IAAAqvB,YAAA,IACA/tB,EAAA,WACA,IAAA4pB,EAAA0B,EAAA0C,OAAA7vB,MAAAmtB,EAAA/S,WACAqR,EAAA,SAAAA,EAAAne,MAAA,MAAA1B,KAAA,YACAkI,QAAAnS,MAAA8pB,IAIA,IAAAnpB,EAAA8sB,GAAA,CAEA,IAAArgB,EAAAvL,OAAA4rB,IAAA,GACAI,aAAAltB,EAAAyM,GAMAzM,EAAAosB,MAAA,SAAAoB,GACA,SAAApB,MAAAnH,EAAAphB,GACA,OAAA2pB,EAAA/yB,KAAAuF,EAAAilB,EAAA,SAAAtiB,GAEA,IAAAA,EAAA,CACAgV,QAGA,UAAA9T,IAAA,WACAA,EAAAnG,MAAAxD,KAAA4d,aAIAvd,OAAAG,eAAA0xB,MAAAW,EAAA,CACAnyB,MAAA4yB,IAEA,OAAApB,MAhBA,CAiBApsB,EAAAosB,OAEApsB,EAAAwsB,UAAA,SAAAiB,GACA,SAAAjB,UAAAvH,GAEAwI,EAAA/vB,MAAAsC,EAAA8X,WACAH,QAGApd,OAAAG,eAAA8xB,UAAAO,EAAA,CACAnyB,MAAA6yB,IAEA,OAAAjB,UAVA,CAWAxsB,EAAAwsB,WAEA,GAAA,YAAA7a,KAAArW,QAAA2C,IAAAqvB,YAAA,IAAA,CACAhyB,QAAA8R,GAAA,OAAA,WACA7N,EAAAS,EAAA8sB,IACAhyB,EAAA,MAAA4yB,MAAA1tB,EAAA8sB,GAAA7wB,OAAA,MAKA,IAAAiF,OAAA4rB,GAAA,CACAI,aAAAhsB,OAAAlB,EAAA8sB,IAGArsB,EAAA9F,QAAAgzB,MAAAlB,EAAAzsB,IACA,GAAA1E,QAAA2C,IAAA2vB,gCAAA5tB,EAAA6tB,UAAA,CACAptB,EAAA9F,QAAAgzB,MAAA3tB,GACAA,EAAA6tB,UAAA,KAGA,SAAAF,MAAA3tB,GAEA4sB,EAAA5sB,GACAA,EAAA8tB,YAAAH,MAEA3tB,EAAA+tB,iBAAAA,iBACA/tB,EAAAguB,kBAAAA,kBACA,IAAAC,EAAAjuB,EAAAymB,SACAzmB,EAAAymB,SAAAA,SACA,SAAAA,SAAA5oB,EAAAa,EAAAmF,GACA,UAAAnF,IAAA,WACAmF,EAAAnF,EAAAA,EAAA,KAEA,OAAAwvB,YAAArwB,EAAAa,EAAAmF,GAEA,SAAAqqB,YAAArwB,EAAAa,EAAAmF,GACA,OAAAoqB,EAAApwB,EAAAa,EAAA,SAAAiE,GACA,GAAAA,IAAAA,EAAA+W,OAAA,UAAA/W,EAAA+W,OAAA,UACAyU,QAAA,CAAAD,YAAA,CAAArwB,EAAAa,EAAAmF,SACA,CACA,UAAAA,IAAA,WACAA,EAAAnG,MAAAxD,KAAA4d,WACAH,YAMA,IAAAyW,EAAApuB,EAAA2iB,UACA3iB,EAAA2iB,UAAAA,UACA,SAAAA,UAAA9kB,EAAAwO,EAAA3N,EAAAmF,GACA,UAAAnF,IAAA,WACAmF,EAAAnF,EAAAA,EAAA,KAEA,OAAA2vB,aAAAxwB,EAAAwO,EAAA3N,EAAAmF,GAEA,SAAAwqB,aAAAxwB,EAAAwO,EAAA3N,EAAAmF,GACA,OAAAuqB,EAAAvwB,EAAAwO,EAAA3N,EAAA,SAAAiE,GACA,GAAAA,IAAAA,EAAA+W,OAAA,UAAA/W,EAAA+W,OAAA,UACAyU,QAAA,CAAAE,aAAA,CAAAxwB,EAAAwO,EAAA3N,EAAAmF,SACA,CACA,UAAAA,IAAA,WACAA,EAAAnG,MAAAxD,KAAA4d,WACAH,YAMA,IAAA2W,EAAAtuB,EAAAuuB,WACA,GAAAD,EACAtuB,EAAAuuB,WAAAA,WACA,SAAAA,WAAA1wB,EAAAwO,EAAA3N,EAAAmF,GACA,UAAAnF,IAAA,WACAmF,EAAAnF,EAAAA,EAAA,KAEA,OAAA8vB,cAAA3wB,EAAAwO,EAAA3N,EAAAmF,GAEA,SAAA2qB,cAAA3wB,EAAAwO,EAAA3N,EAAAmF,GACA,OAAAyqB,EAAAzwB,EAAAwO,EAAA3N,EAAA,SAAAiE,GACA,GAAAA,IAAAA,EAAA+W,OAAA,UAAA/W,EAAA+W,OAAA,UACAyU,QAAA,CAAAK,cAAA,CAAA3wB,EAAAwO,EAAA3N,EAAAmF,SACA,CACA,UAAAA,IAAA,WACAA,EAAAnG,MAAAxD,KAAA4d,WACAH,YAMA,IAAA8W,EAAAzuB,EAAA4hB,QACA5hB,EAAA4hB,QAAAA,QACA,SAAAA,QAAA/jB,EAAAa,EAAAmF,GACA,IAAAvC,EAAA,CAAAzD,GACA,UAAAa,IAAA,WAAA,CACA4C,EAAA2H,KAAAvK,OACA,CACAmF,EAAAnF,EAEA4C,EAAA2H,KAAAylB,eAEA,OAAAC,WAAArtB,GAEA,SAAAotB,cAAA/rB,EAAAynB,GACA,GAAAA,GAAAA,EAAAhX,KACAgX,EAAAhX,OAEA,GAAAzQ,IAAAA,EAAA+W,OAAA,UAAA/W,EAAA+W,OAAA,UACAyU,QAAA,CAAAQ,WAAA,CAAArtB,SAEA,CACA,UAAAuC,IAAA,WACAA,EAAAnG,MAAAxD,KAAA4d,WACAH,UAKA,SAAAgX,WAAArtB,GACA,OAAAmtB,EAAA/wB,MAAAsC,EAAAsB,GAGA,GAAAhG,QAAAszB,QAAAC,OAAA,EAAA,KAAA,OAAA,CACA,IAAAC,EAAAjC,EAAA7sB,GACA+uB,WAAAD,EAAAC,WACAC,YAAAF,EAAAE,YAGA,IAAAC,EAAAjvB,EAAA+uB,WACA,GAAAE,EAAA,CACAF,WAAA9a,UAAA1Z,OAAAiO,OAAAymB,EAAAhb,WACA8a,WAAA9a,UAAAgY,KAAAiD,gBAGA,IAAAC,EAAAnvB,EAAAgvB,YACA,GAAAG,EAAA,CACAH,YAAA/a,UAAA1Z,OAAAiO,OAAA2mB,EAAAlb,WACA+a,YAAA/a,UAAAgY,KAAAmD,iBAGA70B,OAAAG,eAAAsF,EAAA,aAAA,CACAotB,IAAA,WACA,OAAA2B,YAEAM,IAAA,SAAAjzB,GACA2yB,WAAA3yB,GAEAkzB,WAAA,KACAC,aAAA,OAEAh1B,OAAAG,eAAAsF,EAAA,cAAA,CACAotB,IAAA,WACA,OAAA4B,aAEAK,IAAA,SAAAjzB,GACA4yB,YAAA5yB,GAEAkzB,WAAA,KACAC,aAAA,OAIA,IAAAC,EAAAT,WACAx0B,OAAAG,eAAAsF,EAAA,iBAAA,CACAotB,IAAA,WACA,OAAAoC,GAEAH,IAAA,SAAAjzB,GACAozB,EAAApzB,GAEAkzB,WAAA,KACAC,aAAA,OAEA,IAAAE,EAAAT,YACAz0B,OAAAG,eAAAsF,EAAA,kBAAA,CACAotB,IAAA,WACA,OAAAqC,GAEAJ,IAAA,SAAAjzB,GACAqzB,EAAArzB,GAEAkzB,WAAA,KACAC,aAAA,OAGA,SAAAR,WAAAlxB,EAAAa,GACA,GAAAxE,gBAAA60B,WACA,OAAAE,EAAAvxB,MAAAxD,KAAA4d,WAAA5d,UAEA,OAAA60B,WAAArxB,MAAAnD,OAAAiO,OAAAumB,WAAA9a,WAAA6D,WAGA,SAAAoX,kBACA,IAAAtrB,EAAA1J,KACA+xB,KAAAroB,EAAA/F,KAAA+F,EAAA8rB,MAAA9rB,EAAAsb,KAAA,SAAAvc,EAAAsiB,GACA,GAAAtiB,EAAA,CACA,GAAAiB,EAAA+rB,UACA/rB,EAAAgsB,UAEAhsB,EAAAisB,KAAA,QAAAltB,OACA,CACAiB,EAAAqhB,GAAAA,EACArhB,EAAAisB,KAAA,OAAA5K,GACArhB,EAAAohB,UAKA,SAAAgK,YAAAnxB,EAAAa,GACA,GAAAxE,gBAAA80B,YACA,OAAAG,EAAAzxB,MAAAxD,KAAA4d,WAAA5d,UAEA,OAAA80B,YAAAtxB,MAAAnD,OAAAiO,OAAAwmB,YAAA/a,WAAA6D,WAGA,SAAAsX,mBACA,IAAAxrB,EAAA1J,KACA+xB,KAAAroB,EAAA/F,KAAA+F,EAAA8rB,MAAA9rB,EAAAsb,KAAA,SAAAvc,EAAAsiB,GACA,GAAAtiB,EAAA,CACAiB,EAAAgsB,UACAhsB,EAAAisB,KAAA,QAAAltB,OACA,CACAiB,EAAAqhB,GAAAA,EACArhB,EAAAisB,KAAA,OAAA5K,MAKA,SAAA8I,iBAAAlwB,EAAAa,GACA,OAAA,IAAAsB,EAAA+uB,WAAAlxB,EAAAa,GAGA,SAAAsvB,kBAAAnwB,EAAAa,GACA,OAAA,IAAAsB,EAAAgvB,YAAAnxB,EAAAa,GAGA,IAAAoxB,EAAA9vB,EAAAisB,KACAjsB,EAAAisB,KAAAA,KACA,SAAAA,KAAApuB,EAAA6xB,EAAAxQ,EAAArb,GACA,UAAAqb,IAAA,WACArb,EAAAqb,EAAAA,EAAA,KAEA,OAAA6Q,QAAAlyB,EAAA6xB,EAAAxQ,EAAArb,GAEA,SAAAksB,QAAAlyB,EAAA6xB,EAAAxQ,EAAArb,GACA,OAAAisB,EAAAjyB,EAAA6xB,EAAAxQ,EAAA,SAAAvc,EAAAsiB,GACA,GAAAtiB,IAAAA,EAAA+W,OAAA,UAAA/W,EAAA+W,OAAA,UACAyU,QAAA,CAAA4B,QAAA,CAAAlyB,EAAA6xB,EAAAxQ,EAAArb,SACA,CACA,UAAAA,IAAA,WACAA,EAAAnG,MAAAxD,KAAA4d,WACAH,YAMA,OAAA3X,EAGA,SAAAmuB,QAAAznB,GACAnH,EAAA,UAAAmH,EAAA,GAAA9K,KAAA8K,EAAA,IACA1G,EAAA8sB,GAAA7jB,KAAAvC,GAGA,SAAAiR,QACA,IAAAjR,EAAA1G,EAAA8sB,GAAAljB,QACA,GAAAlD,EAAA,CACAnH,EAAA,QAAAmH,EAAA,GAAA9K,KAAA8K,EAAA,IACAA,EAAA,GAAAhJ,MAAA,KAAAgJ,EAAA,sBC/VA,IAAAspB,EAAAl1B,EAAA,MAAAk1B,OAEAvvB,EAAA9F,QAAAkyB,OAEA,SAAAA,OAAA7sB,GACA,MAAA,CACA+uB,WAAAA,WACAC,YAAAA,aAGA,SAAAD,WAAAlxB,EAAAa,GACA,KAAAxE,gBAAA60B,YAAA,OAAA,IAAAA,WAAAlxB,EAAAa,GAEAsxB,EAAAv1B,KAAAP,MAEA,IAAA+1B,EAAA/1B,KAEAA,KAAA2D,KAAAA,EACA3D,KAAA+qB,GAAA,KACA/qB,KAAAg2B,SAAA,KACAh2B,KAAA0U,OAAA,MAEA1U,KAAAw1B,MAAA,IACAx1B,KAAAglB,KAAA,IACAhlB,KAAAi2B,WAAA,GAAA,KAEAzxB,EAAAA,GAAA,GAGA,IAAA1C,EAAAzB,OAAAyB,KAAA0C,GACA,IAAA,IAAA6F,EAAA,EAAAtI,EAAAD,EAAAC,OAAAsI,EAAAtI,EAAAsI,IAAA,CACA,IAAApI,EAAAH,EAAAuI,GACArK,KAAAiC,GAAAuC,EAAAvC,GAGA,GAAAjC,KAAAiG,SAAAjG,KAAAk2B,YAAAl2B,KAAAiG,UAEA,GAAAjG,KAAAm2B,QAAAhwB,UAAA,CACA,GAAA,kBAAAnG,KAAAm2B,MAAA,CACA,MAAA7Z,UAAA,0BAEA,GAAAtc,KAAAo2B,MAAAjwB,UAAA,CACAnG,KAAAo2B,IAAArpB,cACA,GAAA,kBAAA/M,KAAAo2B,IAAA,CACA,MAAA9Z,UAAA,wBAGA,GAAAtc,KAAAm2B,MAAAn2B,KAAAo2B,IAAA,CACA,MAAA,IAAAzxB,MAAA,wBAGA3E,KAAAq2B,IAAAr2B,KAAAm2B,MAGA,GAAAn2B,KAAA+qB,KAAA,KAAA,CACA3pB,QAAAwG,SAAA,WACAmuB,EAAAO,UAEA,OAGAxwB,EAAAisB,KAAA/xB,KAAA2D,KAAA3D,KAAAw1B,MAAAx1B,KAAAglB,KAAA,SAAAvc,EAAAsiB,GACA,GAAAtiB,EAAA,CACAstB,EAAAJ,KAAA,QAAAltB,GACAstB,EAAAC,SAAA,MACA,OAGAD,EAAAhL,GAAAA,EACAgL,EAAAJ,KAAA,OAAA5K,GACAgL,EAAAO,UAIA,SAAAxB,YAAAnxB,EAAAa,GACA,KAAAxE,gBAAA80B,aAAA,OAAA,IAAAA,YAAAnxB,EAAAa,GAEAsxB,EAAAv1B,KAAAP,MAEAA,KAAA2D,KAAAA,EACA3D,KAAA+qB,GAAA,KACA/qB,KAAAgV,SAAA,KAEAhV,KAAAw1B,MAAA,IACAx1B,KAAAiG,SAAA,SACAjG,KAAAglB,KAAA,IACAhlB,KAAAmrB,aAAA,EAEA3mB,EAAAA,GAAA,GAGA,IAAA1C,EAAAzB,OAAAyB,KAAA0C,GACA,IAAA,IAAA6F,EAAA,EAAAtI,EAAAD,EAAAC,OAAAsI,EAAAtI,EAAAsI,IAAA,CACA,IAAApI,EAAAH,EAAAuI,GACArK,KAAAiC,GAAAuC,EAAAvC,GAGA,GAAAjC,KAAAm2B,QAAAhwB,UAAA,CACA,GAAA,kBAAAnG,KAAAm2B,MAAA,CACA,MAAA7Z,UAAA,0BAEA,GAAAtc,KAAAm2B,MAAA,EAAA,CACA,MAAA,IAAAxxB,MAAA,yBAGA3E,KAAAq2B,IAAAr2B,KAAAm2B,MAGAn2B,KAAAu2B,KAAA,MACAv2B,KAAAw2B,OAAA,GAEA,GAAAx2B,KAAA+qB,KAAA,KAAA,CACA/qB,KAAAy2B,MAAA3wB,EAAAisB,KACA/xB,KAAAw2B,OAAAznB,KAAA,CAAA/O,KAAAy2B,MAAAz2B,KAAA2D,KAAA3D,KAAAw1B,MAAAx1B,KAAAglB,KAAA7e,YACAnG,KAAA02B,0BClHA,IAAAC,EAAA/1B,EAAA,MAEA,IAAAg2B,EAAAx1B,QAAA+kB,IACA,IAAAA,EAAA,KAEA,IAAAqH,EAAApsB,QAAA2C,IAAA8yB,sBAAAz1B,QAAAosB,SAEApsB,QAAA+kB,IAAA,WACA,IAAAA,EACAA,EAAAyQ,EAAAr2B,KAAAa,SACA,OAAA+kB,GAEA,IACA/kB,QAAA+kB,MACA,MAAAoJ,IAEA,IAAAuH,EAAA11B,QAAA01B,MACA11B,QAAA01B,MAAA,SAAAC,GACA5Q,EAAA,KACA2Q,EAAAv2B,KAAAa,QAAA21B,IAGAxwB,EAAA9F,QAAAgzB,MAEA,SAAAA,MAAA3tB,GAKA,GAAA6wB,EAAAr2B,eAAA,cACAc,QAAAszB,QAAA7jB,MAAA,0BAAA,CACAmmB,YAAAlxB,GAIA,IAAAA,EAAAmxB,QAAA,CACAC,aAAApxB,GAQAA,EAAAqxB,MAAAC,SAAAtxB,EAAAqxB,OACArxB,EAAAuxB,OAAAD,SAAAtxB,EAAAuxB,QACAvxB,EAAAwxB,OAAAF,SAAAtxB,EAAAwxB,QAEAxxB,EAAA0hB,MAAA+P,SAAAzxB,EAAA0hB,OACA1hB,EAAA0xB,OAAAD,SAAAzxB,EAAA0xB,QACA1xB,EAAA2xB,OAAAF,SAAAzxB,EAAA2xB,QAEA3xB,EAAA4xB,UAAAC,aAAA7xB,EAAA4xB,WACA5xB,EAAA8xB,WAAAD,aAAA7xB,EAAA8xB,YACA9xB,EAAA+xB,WAAAF,aAAA7xB,EAAA+xB,YAEA/xB,EAAAwf,UAAAwS,aAAAhyB,EAAAwf,WACAxf,EAAAiyB,WAAAD,aAAAhyB,EAAAiyB,YACAjyB,EAAAkyB,WAAAF,aAAAhyB,EAAAkyB,YAEAlyB,EAAAgd,KAAAmV,QAAAnyB,EAAAgd,MACAhd,EAAAoyB,MAAAD,QAAAnyB,EAAAoyB,OACApyB,EAAAshB,MAAA6Q,QAAAnyB,EAAAshB,OAEAthB,EAAAie,SAAAoU,YAAAryB,EAAAie,UACAje,EAAAsyB,UAAAD,YAAAryB,EAAAsyB,WACAtyB,EAAAme,UAAAkU,YAAAryB,EAAAme,WAGA,IAAAne,EAAA2xB,OAAA,CACA3xB,EAAA2xB,OAAA,SAAA9zB,EAAAqhB,EAAArb,GACA,GAAAA,EAAAvI,QAAAwG,SAAA+B,IAEA7D,EAAAkyB,WAAA,aAEA,IAAAlyB,EAAAwxB,OAAA,CACAxxB,EAAAwxB,OAAA,SAAA3zB,EAAA00B,EAAAC,EAAA3uB,GACA,GAAAA,EAAAvI,QAAAwG,SAAA+B,IAEA7D,EAAA+xB,WAAA,aAYA,GAAArK,IAAA,QAAA,CACA1nB,EAAAuoB,OAAA,SAAAkK,GAAA,OAAA,SAAAC,EAAAC,EAAA9uB,GACA,IAAAwsB,EAAA3F,KAAAC,MACA,IAAAiI,EAAA,EACAH,EAAAC,EAAAC,EAAA,SAAAnJ,GAAAC,GACA,GAAAA,IACAA,EAAA/P,OAAA,UAAA+P,EAAA/P,OAAA,UACAgR,KAAAC,MAAA0F,EAAA,IAAA,CACAruB,WAAA,WACAhC,EAAAgd,KAAA2V,EAAA,SAAAE,EAAAlJ,GACA,GAAAkJ,GAAAA,EAAAnZ,OAAA,SACA+Y,EAAAC,EAAAC,EAAAnJ,SAEA3lB,EAAA4lB,MAEAmJ,GACA,GAAAA,EAAA,IACAA,GAAA,GACA,OAEA,GAAA/uB,EAAAA,EAAA4lB,MAnBA,CAqBAzpB,EAAAuoB,QAIAvoB,EAAAglB,KAAA,SAAA8N,GACA,SAAA9N,KAAAC,EAAA1W,EAAA2W,EAAAjpB,EAAAkpB,EAAA4N,GACA,IAAAtxB,EACA,GAAAsxB,UAAAA,IAAA,WAAA,CACA,IAAAC,EAAA,EACAvxB,EAAA,SAAAgoB,EAAAplB,EAAA4uB,GACA,GAAAxJ,GAAAA,EAAA/P,OAAA,UAAAsZ,EAAA,GAAA,CACAA,IACA,OAAAF,EAAAr4B,KAAAuF,EAAAilB,EAAA1W,EAAA2W,EAAAjpB,EAAAkpB,EAAA1jB,GAEAsxB,EAAAr1B,MAAAxD,KAAA4d,YAGA,OAAAgb,EAAAr4B,KAAAuF,EAAAilB,EAAA1W,EAAA2W,EAAAjpB,EAAAkpB,EAAA1jB,GAIAujB,KAAA0H,UAAAoG,EACA,OAAA9N,KAlBA,CAmBAhlB,EAAAglB,MAEAhlB,EAAAkzB,SAAA,SAAAC,GAAA,OAAA,SAAAlO,EAAA1W,EAAA2W,EAAAjpB,EAAAkpB,GACA,IAAA6N,EAAA,EACA,MAAA,KAAA,CACA,IACA,OAAAG,EAAA14B,KAAAuF,EAAAilB,EAAA1W,EAAA2W,EAAAjpB,EAAAkpB,GACA,MAAAsE,GACA,GAAAA,EAAA/P,OAAA,UAAAsZ,EAAA,GAAA,CACAA,IACA,SAEA,MAAAvJ,KAVA,CAaAzpB,EAAAkzB,UAEA,SAAAhC,YAAAlxB,GACAA,EAAA2xB,OAAA,SAAA9zB,EAAAqhB,EAAAzd,GACAzB,EAAAisB,KAAApuB,EACAgzB,EAAAuC,SAAAvC,EAAAwC,UACAnU,EACA,SAAAvc,EAAAsiB,GACA,GAAAtiB,EAAA,CACA,GAAAlB,EAAAA,EAAAkB,GACA,OAIA3C,EAAA0xB,OAAAzM,EAAA/F,EAAA,SAAAvc,GACA3C,EAAAosB,MAAAnH,EAAA,SAAAqO,GACA,GAAA7xB,EAAAA,EAAAkB,GAAA2wB,UAMAtzB,EAAAkyB,WAAA,SAAAr0B,EAAAqhB,GACA,IAAA+F,EAAAjlB,EAAAssB,SAAAzuB,EAAAgzB,EAAAuC,SAAAvC,EAAAwC,UAAAnU,GAIA,IAAAqU,EAAA,KACA,IAAA3I,EACA,IACAA,EAAA5qB,EAAAiyB,WAAAhN,EAAA/F,GACAqU,EAAA,MACA,QACA,GAAAA,EAAA,CACA,IACAvzB,EAAAwsB,UAAAvH,GACA,MAAAwE,SACA,CACAzpB,EAAAwsB,UAAAvH,IAGA,OAAA2F,GAIA,SAAAwG,aAAApxB,GACA,GAAA6wB,EAAAr2B,eAAA,aAAA,CACAwF,EAAAmxB,QAAA,SAAAtzB,EAAA21B,EAAAC,EAAA5vB,GACA7D,EAAAisB,KAAApuB,EAAAgzB,EAAAwC,UAAA,SAAA5J,EAAAxE,GACA,GAAAwE,EAAA,CACA,GAAA5lB,EAAAA,EAAA4lB,GACA,OAEAzpB,EAAAksB,QAAAjH,EAAAuO,EAAAC,EAAA,SAAAhK,GACAzpB,EAAAosB,MAAAnH,EAAA,SAAA6E,GACA,GAAAjmB,EAAAA,EAAA4lB,GAAAK,UAMA9pB,EAAA0zB,YAAA,SAAA71B,EAAA21B,EAAAC,GACA,IAAAxO,EAAAjlB,EAAAssB,SAAAzuB,EAAAgzB,EAAAwC,WACA,IAAAzI,EACA,IAAA2I,EAAA,KACA,IACA3I,EAAA5qB,EAAAusB,YAAAtH,EAAAuO,EAAAC,GACAF,EAAA,MACA,QACA,GAAAA,EAAA,CACA,IACAvzB,EAAAwsB,UAAAvH,GACA,MAAAwE,SACA,CACAzpB,EAAAwsB,UAAAvH,IAGA,OAAA2F,OAGA,CACA5qB,EAAAmxB,QAAA,SAAAwC,EAAAC,EAAAC,EAAAhwB,GAAA,GAAAA,EAAAvI,QAAAwG,SAAA+B,IACA7D,EAAA0zB,YAAA,cAIA,SAAAjC,SAAAqC,GACA,IAAAA,EAAA,OAAAA,EACA,OAAA,SAAAC,EAAA7U,EAAArb,GACA,OAAAiwB,EAAAr5B,KAAAuF,EAAA+zB,EAAA7U,EAAA,SAAAuK,GACA,GAAAuK,UAAAvK,GAAAA,EAAA,KACA,GAAA5lB,EAAAA,EAAAnG,MAAAxD,KAAA4d,cAKA,SAAAka,aAAA8B,GACA,IAAAA,EAAA,OAAAA,EACA,OAAA,SAAAC,EAAA7U,GACA,IACA,OAAA4U,EAAAr5B,KAAAuF,EAAA+zB,EAAA7U,GACA,MAAAuK,GACA,IAAAuK,UAAAvK,GAAA,MAAAA,IAMA,SAAA6H,SAAAwC,GACA,IAAAA,EAAA,OAAAA,EACA,OAAA,SAAAC,EAAAxB,EAAAC,EAAA3uB,GACA,OAAAiwB,EAAAr5B,KAAAuF,EAAA+zB,EAAAxB,EAAAC,EAAA,SAAA/I,GACA,GAAAuK,UAAAvK,GAAAA,EAAA,KACA,GAAA5lB,EAAAA,EAAAnG,MAAAxD,KAAA4d,cAKA,SAAA+Z,aAAAiC,GACA,IAAAA,EAAA,OAAAA,EACA,OAAA,SAAAC,EAAAxB,EAAAC,GACA,IACA,OAAAsB,EAAAr5B,KAAAuF,EAAA+zB,EAAAxB,EAAAC,GACA,MAAA/I,GACA,IAAAuK,UAAAvK,GAAA,MAAAA,IAKA,SAAA0I,QAAA2B,GACA,IAAAA,EAAA,OAAAA,EAGA,OAAA,SAAAC,EAAAr1B,EAAAmF,GACA,UAAAnF,IAAA,WAAA,CACAmF,EAAAnF,EACAA,EAAA,KAEA,SAAA+C,SAAAgoB,EAAA1I,GACA,GAAAA,EAAA,CACA,GAAAA,EAAAwR,IAAA,EAAAxR,EAAAwR,KAAA,WACA,GAAAxR,EAAAyR,IAAA,EAAAzR,EAAAyR,KAAA,WAEA,GAAA3uB,EAAAA,EAAAnG,MAAAxD,KAAA4d,WAEA,OAAApZ,EAAAo1B,EAAAr5B,KAAAuF,EAAA+zB,EAAAr1B,EAAA+C,UACAqyB,EAAAr5B,KAAAuF,EAAA+zB,EAAAtyB,WAIA,SAAA4wB,YAAAyB,GACA,IAAAA,EAAA,OAAAA,EAGA,OAAA,SAAAC,EAAAr1B,GACA,IAAAqiB,EAAAriB,EAAAo1B,EAAAr5B,KAAAuF,EAAA+zB,EAAAr1B,GACAo1B,EAAAr5B,KAAAuF,EAAA+zB,GACA,GAAAhT,EAAAwR,IAAA,EAAAxR,EAAAwR,KAAA,WACA,GAAAxR,EAAAyR,IAAA,EAAAzR,EAAAyR,KAAA,WACA,OAAAzR,GAgBA,SAAAiT,UAAAvK,GACA,IAAAA,EACA,OAAA,KAEA,GAAAA,EAAA/P,OAAA,SACA,OAAA,KAEA,IAAAua,GAAA34B,QAAA44B,QAAA54B,QAAA44B,WAAA,EACA,GAAAD,EAAA,CACA,GAAAxK,EAAA/P,OAAA,UAAA+P,EAAA/P,OAAA,QACA,OAAA,KAGA,OAAA,wBCnVA,IAAAya,EACA,IACAA,EAAAr5B,EAAA,MACA,MAAAuJ,GACA8vB,EAAAr5B,EAAA,MAEA,MAAAs5B,EAAAt5B,EAAA,MACA,MAAA0F,UAAAA,EAAA6zB,SAAAA,GAAAv5B,EAAA,MAEAgsB,eAAAwN,UAAA7R,EAAA/jB,EAAA,IACA,UAAAA,IAAA,SAAA,CACAA,EAAA,CAAAyB,SAAAzB,GAGA,MAAAsB,EAAAtB,EAAAsB,IAAAm0B,EAEA,MAAAI,EAAA,WAAA71B,EAAAA,EAAA81B,OAAA,KAEA,IAAAnoB,QAAA+nB,EAAAK,aAAAz0B,EAAAymB,SAAA2N,CAAA3R,EAAA/jB,GAEA2N,EAAAgoB,EAAAhoB,GAEA,IAAArJ,EACA,IACAA,EAAAzC,KAAAqnB,MAAAvb,EAAA3N,EAAAA,EAAAg2B,QAAA,MACA,MAAA/xB,GACA,GAAA4xB,EAAA,CACA5xB,EAAAxH,WAAAsnB,MAAA9f,EAAAxH,UACA,MAAAwH,MACA,CACA,OAAA,MAIA,OAAAK,EAGA,MAAAyjB,EAAA2N,EAAAO,YAAAL,WAEA,SAAA5N,aAAAjE,EAAA/jB,EAAA,IACA,UAAAA,IAAA,SAAA,CACAA,EAAA,CAAAyB,SAAAzB,GAGA,MAAAsB,EAAAtB,EAAAsB,IAAAm0B,EAEA,MAAAI,EAAA,WAAA71B,EAAAA,EAAA81B,OAAA,KAEA,IACA,IAAAI,EAAA50B,EAAA0mB,aAAAjE,EAAA/jB,GACAk2B,EAAAP,EAAAO,GACA,OAAAr0B,KAAAqnB,MAAAgN,EAAAl2B,EAAAg2B,SACA,MAAA/xB,GACA,GAAA4xB,EAAA,CACA5xB,EAAAxH,WAAAsnB,MAAA9f,EAAAxH,UACA,MAAAwH,MACA,CACA,OAAA,OAKAmkB,eAAA+N,WAAApS,EAAAzf,EAAAtE,EAAA,IACA,MAAAsB,EAAAtB,EAAAsB,IAAAm0B,EAEA,MAAAvN,EAAApmB,EAAAwC,EAAAtE,SAEA01B,EAAAK,aAAAz0B,EAAA2iB,UAAAyR,CAAA3R,EAAAmE,EAAAloB,GAGA,MAAAikB,EAAAyR,EAAAO,YAAAE,YAEA,SAAAhS,cAAAJ,EAAAzf,EAAAtE,EAAA,IACA,MAAAsB,EAAAtB,EAAAsB,IAAAm0B,EAEA,MAAAvN,EAAApmB,EAAAwC,EAAAtE,GAEA,OAAAsB,EAAA6iB,cAAAJ,EAAAmE,EAAAloB,GAGA,MAAAo2B,EAAA,CACArO,SAAAA,EACAC,aAAAA,aACA/D,UAAAA,EACAE,cAAAA,eAGApiB,EAAA9F,QAAAm6B,6BCrFAn6B,EAAA85B,aAAA,SAAA50B,GACA,OAAAtF,OAAAG,eAAA,YAAA4G,GACA,UAAAA,EAAAA,EAAArF,OAAA,KAAA,WAAA4D,EAAAnC,MAAAxD,KAAAoH,OACA,CACA,OAAA,IAAArE,QAAA,CAAAD,EAAAE,KACA2C,EAAApF,KACAP,QACAoH,EACA,CAAAqB,EAAAoF,IAAApF,GAAA,KAAAzF,EAAAyF,GAAA3F,EAAA+K,QAIA,OAAA,CAAAnN,MAAAiF,EAAAjE,QAGAjB,EAAAg6B,YAAA,SAAA90B,GACA,OAAAtF,OAAAG,eAAA,YAAA4G,GACA,MAAAuC,EAAAvC,EAAAA,EAAArF,OAAA,GACA,UAAA4H,IAAA,WAAA,OAAAhE,EAAAnC,MAAAxD,KAAAoH,QACAzB,EAAAnC,MAAAxD,KAAAoH,EAAA6H,MAAA,GAAA,IAAA1L,KAAAkf,GAAA9Y,EAAA,KAAA8Y,GAAA9Y,IACA,OAAA,CAAAjJ,MAAAiF,EAAAjE,kBCtBA,SAAA4E,UAAAwC,GAAAtH,IAAAA,EAAA,KAAAq5B,SAAAA,EAAA,KAAAC,SAAAA,EAAA,KAAAC,OAAAA,GAAA,IACA,MAAAC,EAAAH,EAAAr5B,EAAA,GACA,MAAAkrB,EAAArmB,KAAAC,UAAAwC,EAAAgyB,EAAAC,GAEA,OAAArO,EAAAnqB,QAAA,MAAAf,GAAAw5B,EAGA,SAAAb,SAAAO,GAEA,GAAAO,OAAAC,SAAAR,GAAAA,EAAAA,EAAAn5B,SAAA,QACA,OAAAm5B,EAAAn4B,QAAA,UAAA,IAGAgE,EAAA9F,QAAA,CAAA6F,UAAAA,UAAA6zB,SAAAA,0BCZA,IAAAp3B,EAAAnC,EAAA,MACA,IAAAkF,EACA,IACAA,EAAAlF,EAAA,MACA,MAAA6H,GACA3C,EAAAlF,EAAA,MAGA,IAAA+pB,EAAA,CACA,aACA,QACA,QACA,QACA,SACA,SACA,YACA,QACA,QACA,YACA,UACA,SACA,OACA,QACA,QACA,OACA,OACA,WACA,UACA,WACA,WACA,SACA,QACA,OACA,UACA,WACA,SACA,SACA,QACA,oBAGA7kB,EAAA6oB,SAAA,YAAAhE,EAAA5b,KAAA,iBACAjJ,EAAA4e,WAAA,YAAAiG,EAAA5b,KAAA,mBACAjJ,EAAAq1B,UAAA,YAAAxQ,EAAA5b,KAAA,WAEAnO,EAAA,MAAAw6B,aAAAt1B,EAAArF,EAAAkqB,GAEAlqB,EAAAypB,OAAA,SAAAW,EAAAtjB,GAEA,UAAAA,IAAA,WAAA,CACA,OAAAzB,EAAAgd,KAAA+H,EAAA,SAAApiB,GACAlB,EAAA,MAAAkB,KAIA,OAAA,IAAA1F,EAAA,SAAAD,GACAgD,EAAAgd,KAAA+H,EAAA,SAAApiB,GACA3F,GAAA2F,qCC1DA,IAAA3C,EAAAlF,EAAA,MAAA2F,EAAA9F,QAAA,CAOAqqB,KAAA,SAAAsF,EAAAjX,EAAAC,EAAAiiB,GAAA,IAAAtE,EAAA,CAAA,MAAA,MAAAsE,IAAAA,EAAA,QAAA,IAAAj4B,EAAA,SAAA+V,EAAAC,EAAAiiB,GAAA,OAAAv1B,EAAAglB,KAAA1R,EAAA6hB,OAAAK,MAAA,GAAA,EAAA,EAAAniB,EAAAwG,KAAA,EAAA0b,GAAA93B,KAAA,SAAA4V,GAAA,OAAA/S,OAAAm1B,aAAApiB,EAAA,GAAA,OAAA,OAAA,IAAApW,QAAA,SAAAqtB,EAAAoL,GAAA,IAAAC,EAAA,CAAA3Y,KAAA,KAAAyF,KAAA,MAAAziB,EAAAokB,OAAA/Q,GAAA5V,KAAA,SAAA4V,GAAA,IAAAA,EAAA,MAAA,IAAAxU,MAAA,yBAAApB,KAAA,WAAA,IAAA6V,EAAA,CAAAtT,EAAAgd,KAAA3J,GAAA5V,KAAA,SAAA4V,GAAA,OAAAsiB,EAAA3Y,KAAA3J,IAAArT,EAAAisB,KAAA5Y,EAAA,KAAA5V,KAAA,SAAA4V,GAAA,OAAAsiB,EAAAlT,KAAApP,KACA,OAAApW,QAAA+d,IAAA1H,KAAA7V,KAAA,WAAA,IAAA4V,EAAA,EAAAqiB,EAAA,EAAAvwB,EAAA,GAAAgR,EAAA,WAAA,OAAAhR,EAAAlJ,OAAA05B,EAAA3Y,KAAAnD,OAAA1U,EAAAA,EAAAywB,UAAAzwB,EAAAlJ,OAAA05B,EAAA3Y,KAAAnD,OAAA1U,EAAAlJ,QAAA05B,EAAA3Y,KAAAnD,MAAA6b,GAAApiB,GAAA2d,EAAA7I,SAAAjjB,EAAAywB,UAAA,EAAA,MAAAzwB,EAAAA,EAAAywB,UAAA,IAAA51B,EAAAosB,MAAAuJ,EAAAlT,MAAA,WAAA8S,EAAAjL,EAAA6K,OAAAzC,KAAAvtB,EAAA,WAAAmlB,EAAA6K,OAAAzC,KAAAvtB,EAAA,UAAA1J,SAAA85B,KAAAj4B,EAAAq4B,EAAA3Y,KAAA2Y,EAAAlT,KAAApP,GAAA5V,KAAA,SAAA6V,GAAAnO,EAAAmO,EAAAnO,EAAA8rB,EAAA7I,SAAA9U,IAAA,EAAAnO,EAAAlJ,QAAAy5B,IAAAriB,MAAA5V,KAAA0Y,IAAA,OAAAA,MAAA/P,MAAA,SAAAiN,GAAA,OAAA,OAAAsiB,EAAAlT,MAAAziB,EAAAosB,MAAAuJ,EAAAlT,MAAArc,MAAA,cAEAsvB,EAAAriB,yBCTA,IAAAwiB,EAAA/6B,EAAA,MAEA2F,EAAA9F,QAAAm7B,WACAA,WAAAR,aAAAA,aACAQ,WAAAD,QAAAA,EAYA,SAAAC,WAAAC,EAAAC,EAAA9M,GACA,OAAA+M,aAAAF,EAAAC,EAAA9M,EAAA2M,GAaA,SAAAP,aAAAS,EAAAC,EAAA9M,GACA,OAAA+M,aAAAF,EAAAC,EAAA9M,EAAA2M,EAAAP,cAGA,SAAAW,aAAAF,EAAAC,EAAA9M,EAAAgN,GACA,IAAAF,EAAA,CACAA,EAAA,GACA9M,EAAA3uB,OAAAyB,KAAA+5B,GAGA,GAAAjtB,MAAAC,QAAAitB,GAAA,CACA9M,EAAA8M,EACAA,EAAA,GAGA,IAAA9M,EAAA,CACAA,EAAA3uB,OAAAyB,KAAA+5B,GAGA,UAAAA,IAAA,WAAAC,EAAAE,EAAAH,GAEA7M,EAAAtgB,QAAA,SAAAhN,GAEA,UAAAm6B,EAAAn6B,KAAA,WAAAo6B,EAAAp6B,GAAAs6B,EAAAH,EAAAn6B,MAIArB,OAAAyB,KAAA+5B,GAAAntB,QAAA,SAAAhN,GACA,GAAAu6B,WAAAJ,EAAAn6B,GAAA,OACA,GAAAo6B,EAAAp6B,GAAA,OACAo6B,EAAAp6B,GAAAm6B,EAAAn6B,KAGA,OAAAo6B,EAGA,SAAAG,WAAAJ,EAAAn6B,GACA,IAAAw6B,EAAA77B,OAAAmrB,yBAAAqQ,EAAAn6B,GACA,IAAAw6B,IAAAA,EAAAhJ,IAAA,OAAA,MACA,GAAAgJ,EAAAhJ,IAAAxxB,OAAA,aAAA,OAAA,KACA,OAAA,uBCtEA,IAAAqB,EAAAnC,EAAA,MACA,IAAAkuB,EAAAluB,EAAA,MAEA2F,EAAA9F,QAAAk7B,QAUA,SAAAA,QAAAh2B,EAAAnB,GACAsqB,SAAAnpB,IAAA,YACA,OAAAw2B,cAAAx2B,EAAAnB,GAWAm3B,QAAAP,aAAA,SAAAz1B,EAAAnB,GACAsqB,SAAAnpB,IAAA,YACAnB,EAAAA,GAAA,GACAA,EAAA42B,aAAA,KACA,OAAAe,cAAAx2B,EAAAnB,IAGA,SAAA43B,eAAAt5B,EAAAE,EAAAq5B,GAEA,GAAAA,IAAAl2B,UAAAk2B,EAAA,KACA,OAAA,SAAA5zB,EAAA/H,GACA,GAAA+H,EAAA,OAAAzF,EAAAyF,GACA,IAAA1G,EAAA6b,UAAA7b,OAEA,GAAAA,GAAA,IAAAs6B,EAAA,OAAAv5B,EAAApC,GAEA,GAAAkO,MAAAC,QAAAwtB,GAAA,CACA,IAAAC,EAAA,GACA,IAAA,IAAArxB,EAAA,EAAAA,EAAAlJ,EAAAkJ,IAAAqxB,EAAAD,EAAApxB,EAAA,IAAA2S,UAAA3S,GACA,OAAAnI,EAAAw5B,GAGA,IAAAA,EAAA,IAAA1tB,MAAA7M,EAAA,GACA,IAAA,IAAAkJ,EAAA,EAAAA,EAAAlJ,IAAAkJ,EAAAqxB,EAAArxB,EAAA,GAAA2S,UAAA3S,GACAnI,EAAAw5B,IAIA,SAAAH,cAAAx2B,EAAAnB,GACAA,EAAAA,GAAA,GACA,IAAA9C,EAAAiE,EAAAjE,KACAA,GAAAA,GAAA,IAAAa,QAAA,iBAAA,IACA,IAAAg6B,EAAA,WACA,IAAAxG,EAAA/1B,KACA,IAAAkL,EAAA0S,UAAA7b,OACA,GAAAyC,EAAA42B,aAAA,CACA,IAAAoB,SAAA5e,UAAA1S,EAAA,GACA,GAAAsxB,IAAA,WAAA,OAAA72B,EAAAnC,MAAAuyB,EAAAnY,WAEA,IAAAxW,EAAA,IAAAwH,MAAA1D,EAAA,GACA,IAAA,IAAAD,EAAA,EAAAA,EAAAC,IAAAD,EAAA7D,EAAA6D,GAAA2S,UAAA3S,GACA,IAAAwxB,EAAAxxB,EACA,OAAA,IAAAlI,EAAA,SAAAD,EAAAE,GACAoE,EAAAq1B,GAAAL,eAAAt5B,EAAAE,EAAAwB,EAAA63B,WACA12B,EAAAnC,MAAAuyB,EAAA3uB,MAGA/G,OAAAG,eAAA+7B,EAAA,OAAA,CAAA77B,MAAAgB,IACA,OAAA66B,8BCzEA97B,EAAAsnB,EAAA,SAAApiB,GACA,OAAAtF,OAAAG,eAAA,YAAA4G,GACA,UAAAA,EAAAA,EAAArF,OAAA,KAAA,WAAA4D,EAAAnC,MAAAxD,KAAAoH,OACA,CACA,OAAA,IAAArE,QAAA,CAAAD,EAAAE,KACA2C,EAAAnC,MACAxD,KACAoH,EAAAwC,OAAA,CAAA,CAAAnB,EAAAoF,IAAApF,EAAAzF,EAAAyF,GAAA3F,EAAA+K,UAIA,OAAA,CAAAnN,MAAAiF,EAAAjE,QAGAjB,EAAAgb,EAAA,SAAA9V,GACA,OAAAtF,OAAAG,eAAA,YAAA4G,GACA,MAAAuC,EAAAvC,EAAAA,EAAArF,OAAA,GACA,UAAA4H,IAAA,WAAA,OAAAhE,EAAAnC,MAAAxD,KAAAoH,QACAzB,EAAAnC,MAAAxD,KAAAoH,EAAA6H,MAAA,GAAA,IAAA1L,KAAAkf,GAAA9Y,EAAA,KAAA8Y,GAAA9Y,IACA,OAAA,CAAAjJ,MAAAiF,EAAAjE,2CCpBA,IAAAg7B,EAAA18B,MAAAA,KAAA08B,kBAAAr8B,OAAAiO,OAAA,SAAAquB,EAAA1N,EAAA7uB,EAAAw8B,GACA,GAAAA,IAAAz2B,UAAAy2B,EAAAx8B,EACAC,OAAAG,eAAAm8B,EAAAC,EAAA,CAAAxH,WAAA,KAAAlC,IAAA,WAAA,OAAAjE,EAAA7uB,OACA,SAAAu8B,EAAA1N,EAAA7uB,EAAAw8B,GACA,GAAAA,IAAAz2B,UAAAy2B,EAAAx8B,EACAu8B,EAAAC,GAAA3N,EAAA7uB,KAEA,IAAAy8B,EAAA78B,MAAAA,KAAA68B,qBAAAx8B,OAAAiO,OAAA,SAAAquB,EAAAryB,GACAjK,OAAAG,eAAAm8B,EAAA,UAAA,CAAAvH,WAAA,KAAA10B,MAAA4J,KACA,SAAAqyB,EAAAryB,GACAqyB,EAAA,WAAAryB,IAEA,IAAAvK,EAAAC,MAAAA,KAAAD,cAAA,SAAAE,GACA,GAAAA,GAAAA,EAAAC,WAAA,OAAAD,EACA,IAAAE,EAAA,GACA,GAAAF,GAAA,KAAA,IAAA,IAAAG,KAAAH,EAAA,GAAAG,IAAA,WAAAC,OAAA0Z,UAAAzZ,eAAAC,KAAAN,EAAAG,GAAAs8B,EAAAv8B,EAAAF,EAAAG,GACAy8B,EAAA18B,EAAAF,GACA,OAAAE,GAEAE,OAAAG,eAAAC,EAAA,aAAA,CAAAC,MAAA,OACA,MAAAo8B,EAAA/8B,EAAAa,EAAA,OACA,MAAAm8B,EAAAn8B,EAAA,MACA,MAAAo8B,EAAAp8B,EAAA,MACA,MAAAq8B,EAAAr8B,EAAA,MACA,MAAAC,EAAAD,EAAA,MACA,MAAAs8B,EAAAt8B,EAAA,MACA,MAAAu8B,EAAAv8B,EAAA,MAEA,MAAA8hB,EAAA7hB,EAAAu8B,WAAAN,EAAAv4B,SAAA,aAAA,UAAAuM,MAAA,MACA,MAAA+oB,EAAAh5B,EAAAu8B,WAAAN,EAAAv4B,SAAA,WAAA,UAAAE,cAAAqM,MAAA,MACA,MAAAusB,EAAAP,EAAAv4B,SAAA,gBAAA,OACA,MAAA+4B,EAAAR,EAAAv4B,SAAA,gBAAA,OACA,MAAAg5B,EAAAT,EAAAv4B,SAAA,qBAAA,OACA,MAAAi5B,EAAAV,EAAAv4B,SAAA,aAAA,OACA,MAAAk5B,EAAA58B,EAAA68B,UAAAZ,EAAAv4B,SAAA,YAAAoe,SAAAma,EAAAv4B,SAAA,YAAA1D,EAAA88B,SACA,MAAAC,EAAA/8B,EAAAg9B,kBACAjR,eAAAnd,MACA,OAAA,IAAA1M,QAAA6pB,MAAA9pB,EAAAE,KACA,GAAA0f,EAAA3gB,QAAA,EACA,OAAAe,EAAA,CAAA0c,KAAA,EAAAse,IAAA,oCACA,GAAAjE,EAAA93B,QAAA,EACA,OAAAe,EAAA,CAAA0c,KAAA,EAAAse,IAAA,mCACA,MAAAC,EAAAhB,EAAA3tB,KAAAwuB,EAAAI,KAAA,iCACA1mB,QAAA6C,IAAA,iCACAtZ,EAAAo9B,OAAA,OAAA,CAAA,YAAAL,EAAAM,KAAAH,GACAzmB,QAAA6C,mEACAtZ,EAAAs9B,aAAA,qGAAApB,EAAA3tB,KAAAwuB,EAAAQ,MAAA,mBACA,MAAAC,EAAA3b,EAAA3gB,QAAA,EAEA,GAAAs8B,EAAA,CACA/mB,QAAA6C,IAAA,qDACA,UACA2iB,EAAAp3B,MAAA,qBAAAknB,UACA,OAAA/rB,EAAAo9B,OAAA,OAAA,CAAA,OAAA,iBAAA,YAAA,QAAAL,EAAAQ,MAAAL,KAGA,MAAAt1B,GACA6O,QAAAnS,MAAAsD,GACA6O,QAAAnS,wCAAA43B,EAAAj6B,QAAAi7B,QACA,IAAA,MAAAO,WAAAnB,EAAArS,KAAAiT,EAAA,IAAA,CACAzmB,QAAAnS,MAAAm5B,GAEA,OAAAz9B,EAAA09B,KAAA,IAGA,MAAAC,EAAA,CAAA,OAAA,iBAAA,YAAA3E,EAAAzqB,KAAA,MACA,GAAAiuB,EAAA,CACAmB,EAAAzvB,KAAA,qBAEA,GAAAuuB,EAAA,CACAkB,EAAAzvB,KAAA,mBAEA,GAAAwuB,EAAA,CACAiB,EAAAzvB,KAAA,wBAEA,MAAAf,EAAA,GACA,IAAA,MAAAywB,KAAA/b,EAAA,CACA1U,EAAAe,KAAAxH,IACA,IACA,MAAA4uB,EAAA3F,KAAAC,MACA,MAAAiO,EAAA3B,EAAA3tB,KAAAwuB,EAAAI,QAAAS,SACAnnB,QAAA6C,yBAAAskB,SAEA,MAAAE,EAAAN,EAAAtB,EAAA3tB,KAAAwuB,EAAAM,QAAAO,KAAAb,EAAAQ,MACA,GAAAC,EAAA,CACArB,EAAArW,KAAAiX,EAAAQ,MAAAO,GACAp7B,KAAA,KACA1C,EAAAo9B,OAAA,OAAA,IAAAO,EAAA,QAAAC,GAAAE,EAAAD,EAAA,MACAn7B,KAAA,KACA05B,EAAAlN,UAAA4O,EAAA,CAAA3Q,UAAA,OACA,MAAAoI,EAAA5F,KAAAC,MACAnZ,QAAA6C,0BAAAskB,UAAArI,EAAAD,GAAA,eACA5uB,QAGA2E,MAAAzD,IACA6O,QAAA6C,yCAAAskB,MACAnnB,QAAAnS,MAAAsD,GACA6O,QAAAnS,wCAAA43B,EAAAj6B,QAAA47B,QACAvB,EAAArS,KAAA4T,EAAA,IACAn7B,KAAAq7B,IACA,IAAA,MAAAN,KAAAM,EAAA,CACAtnB,QAAAnS,MAAAm5B,MAGApyB,MAAAoL,QAAAnS,OACA05B,QAAA,IAAAt3B,EAAAkB,OAIA,MAAAA,GACAlB,EAAAkB,MAIAy0B,EAAAjiB,cAAAjN,EAAAyvB,GACAl6B,KAAA,IAAAT,EAAA,CAAA0c,KAAA,KACAtT,MAAAlJ,KAGAyM,MACAlM,KAAApD,GAAAU,EAAA09B,KAAAp+B,EAAAqf,KAAArf,EAAA29B,MACA5xB,MAAAzD,GAAA5H,EAAA09B,KAAA,EAAA91B,+QClHA,MAAAq2B,EAAAz4B,KAAAqnB,MAAAuP,EAAAzQ,aAAA5rB,EAAAm+B,GAAA,eAAA,4uDCTAx4B,EAAA9F,QAAAyG,QAAA,iCCAAX,EAAA9F,QAAAyG,QAAA,wCCAAX,EAAA9F,QAAAyG,QAAA,oCCAAX,EAAA9F,QAAAyG,QAAA,6BCAAX,EAAA9F,QAAAyG,QAAA,+BCAAX,EAAA9F,QAAAyG,QAAA,gCCAAX,EAAA9F,QAAAyG,QAAA,6BCAAX,EAAA9F,QAAAyG,QAAA,+BCAAX,EAAA9F,QAAAyG,QAAA,iCCAAX,EAAA9F,QAAAyG,QAAA,UCCA,IAAA83B,EAAA,GAGA,SAAAp+B,oBAAAq+B,GAEA,GAAAD,EAAAC,GAAA,CACA,OAAAD,EAAAC,GAAAx+B,QAGA,IAAA8F,EAAAy4B,EAAAC,GAAA,CAGAx+B,QAAA,IAIA,IAAA44B,EAAA,KACA,IACA6F,EAAAD,GAAA1+B,KAAAgG,EAAA9F,QAAA8F,EAAAA,EAAA9F,QAAAG,qBACAy4B,EAAA,MACA,QACA,GAAAA,SAAA2F,EAAAC,GAIA,OAAA14B,EAAA9F,QCzBAG,oBAAAm+B,GAAAI,UAAA,ICEA,OAAAv+B,oBAAA","file":"index.js","sourcesContent":["\"use strict\";\nvar __importStar = (this && this.__importStar) || function (mod) {\n if (mod && mod.__esModule) return mod;\n var result = {};\n if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\n result[\"default\"] = mod;\n return result;\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst os = __importStar(require(\"os\"));\nconst utils_1 = require(\"./utils\");\n/**\n * Commands\n *\n * Command Format:\n * ::name key=value,key=value::message\n *\n * Examples:\n * ::warning::This is the message\n * ::set-env name=MY_VAR::some value\n */\nfunction issueCommand(command, properties, message) {\n const cmd = new Command(command, properties, message);\n process.stdout.write(cmd.toString() + os.EOL);\n}\nexports.issueCommand = issueCommand;\nfunction issue(name, message = '') {\n issueCommand(name, {}, message);\n}\nexports.issue = issue;\nconst CMD_STRING = '::';\nclass Command {\n constructor(command, properties, message) {\n if (!command) {\n command = 'missing.command';\n }\n this.command = command;\n this.properties = properties;\n this.message = message;\n }\n toString() {\n let cmdStr = CMD_STRING + this.command;\n if (this.properties && Object.keys(this.properties).length > 0) {\n cmdStr += ' ';\n let first = true;\n for (const key in this.properties) {\n if (this.properties.hasOwnProperty(key)) {\n const val = this.properties[key];\n if (val) {\n if (first) {\n first = false;\n }\n else {\n cmdStr += ',';\n }\n cmdStr += `${key}=${escapeProperty(val)}`;\n }\n }\n }\n }\n cmdStr += `${CMD_STRING}${escapeData(this.message)}`;\n return cmdStr;\n }\n}\nfunction escapeData(s) {\n return utils_1.toCommandValue(s)\n .replace(/%/g, '%25')\n .replace(/\\r/g, '%0D')\n .replace(/\\n/g, '%0A');\n}\nfunction escapeProperty(s) {\n return utils_1.toCommandValue(s)\n .replace(/%/g, '%25')\n .replace(/\\r/g, '%0D')\n .replace(/\\n/g, '%0A')\n .replace(/:/g, '%3A')\n .replace(/,/g, '%2C');\n}\n//# sourceMappingURL=command.js.map","\"use strict\";\nvar __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) {\n function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\n return new (P || (P = Promise))(function (resolve, reject) {\n function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\n function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\n function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\n step((generator = generator.apply(thisArg, _arguments || [])).next());\n });\n};\nvar __importStar = (this && this.__importStar) || function (mod) {\n if (mod && mod.__esModule) return mod;\n var result = {};\n if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\n result[\"default\"] = mod;\n return result;\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst command_1 = require(\"./command\");\nconst file_command_1 = require(\"./file-command\");\nconst utils_1 = require(\"./utils\");\nconst os = __importStar(require(\"os\"));\nconst path = __importStar(require(\"path\"));\n/**\n * The code to exit an action\n */\nvar ExitCode;\n(function (ExitCode) {\n /**\n * A code indicating that the action was successful\n */\n ExitCode[ExitCode[\"Success\"] = 0] = \"Success\";\n /**\n * A code indicating that the action was a failure\n */\n ExitCode[ExitCode[\"Failure\"] = 1] = \"Failure\";\n})(ExitCode = exports.ExitCode || (exports.ExitCode = {}));\n//-----------------------------------------------------------------------\n// Variables\n//-----------------------------------------------------------------------\n/**\n * Sets env variable for this action and future actions in the job\n * @param name the name of the variable to set\n * @param val the value of the variable. Non-string values will be converted to a string via JSON.stringify\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction exportVariable(name, val) {\n const convertedVal = utils_1.toCommandValue(val);\n process.env[name] = convertedVal;\n const filePath = process.env['GITHUB_ENV'] || '';\n if (filePath) {\n const delimiter = '_GitHubActionsFileCommandDelimeter_';\n const commandValue = `${name}<<${delimiter}${os.EOL}${convertedVal}${os.EOL}${delimiter}`;\n file_command_1.issueCommand('ENV', commandValue);\n }\n else {\n command_1.issueCommand('set-env', { name }, convertedVal);\n }\n}\nexports.exportVariable = exportVariable;\n/**\n * Registers a secret which will get masked from logs\n * @param secret value of the secret\n */\nfunction setSecret(secret) {\n command_1.issueCommand('add-mask', {}, secret);\n}\nexports.setSecret = setSecret;\n/**\n * Prepends inputPath to the PATH (for this action and future actions)\n * @param inputPath\n */\nfunction addPath(inputPath) {\n const filePath = process.env['GITHUB_PATH'] || '';\n if (filePath) {\n file_command_1.issueCommand('PATH', inputPath);\n }\n else {\n command_1.issueCommand('add-path', {}, inputPath);\n }\n process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`;\n}\nexports.addPath = addPath;\n/**\n * Gets the value of an input. The value is also trimmed.\n *\n * @param name name of the input to get\n * @param options optional. See InputOptions.\n * @returns string\n */\nfunction getInput(name, options) {\n const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || '';\n if (options && options.required && !val) {\n throw new Error(`Input required and not supplied: ${name}`);\n }\n return val.trim();\n}\nexports.getInput = getInput;\n/**\n * Sets the value of an output.\n *\n * @param name name of the output to set\n * @param value value to store. Non-string values will be converted to a string via JSON.stringify\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction setOutput(name, value) {\n command_1.issueCommand('set-output', { name }, value);\n}\nexports.setOutput = setOutput;\n/**\n * Enables or disables the echoing of commands into stdout for the rest of the step.\n * Echoing is disabled by default if ACTIONS_STEP_DEBUG is not set.\n *\n */\nfunction setCommandEcho(enabled) {\n command_1.issue('echo', enabled ? 'on' : 'off');\n}\nexports.setCommandEcho = setCommandEcho;\n//-----------------------------------------------------------------------\n// Results\n//-----------------------------------------------------------------------\n/**\n * Sets the action status to failed.\n * When the action exits it will be with an exit code of 1\n * @param message add error issue message\n */\nfunction setFailed(message) {\n process.exitCode = ExitCode.Failure;\n error(message);\n}\nexports.setFailed = setFailed;\n//-----------------------------------------------------------------------\n// Logging Commands\n//-----------------------------------------------------------------------\n/**\n * Gets whether Actions Step Debug is on or not\n */\nfunction isDebug() {\n return process.env['RUNNER_DEBUG'] === '1';\n}\nexports.isDebug = isDebug;\n/**\n * Writes debug message to user log\n * @param message debug message\n */\nfunction debug(message) {\n command_1.issueCommand('debug', {}, message);\n}\nexports.debug = debug;\n/**\n * Adds an error issue\n * @param message error issue message. Errors will be converted to string via toString()\n */\nfunction error(message) {\n command_1.issue('error', message instanceof Error ? message.toString() : message);\n}\nexports.error = error;\n/**\n * Adds an warning issue\n * @param message warning issue message. Errors will be converted to string via toString()\n */\nfunction warning(message) {\n command_1.issue('warning', message instanceof Error ? message.toString() : message);\n}\nexports.warning = warning;\n/**\n * Writes info to log with console.log.\n * @param message info message\n */\nfunction info(message) {\n process.stdout.write(message + os.EOL);\n}\nexports.info = info;\n/**\n * Begin an output group.\n *\n * Output until the next `groupEnd` will be foldable in this group\n *\n * @param name The name of the output group\n */\nfunction startGroup(name) {\n command_1.issue('group', name);\n}\nexports.startGroup = startGroup;\n/**\n * End an output group.\n */\nfunction endGroup() {\n command_1.issue('endgroup');\n}\nexports.endGroup = endGroup;\n/**\n * Wrap an asynchronous function call in a group.\n *\n * Returns the same type as the function itself.\n *\n * @param name The name of the group\n * @param fn The function to wrap in the group\n */\nfunction group(name, fn) {\n return __awaiter(this, void 0, void 0, function* () {\n startGroup(name);\n let result;\n try {\n result = yield fn();\n }\n finally {\n endGroup();\n }\n return result;\n });\n}\nexports.group = group;\n//-----------------------------------------------------------------------\n// Wrapper action state\n//-----------------------------------------------------------------------\n/**\n * Saves state for current action, the state can only be retrieved by this action's post job execution.\n *\n * @param name name of the state to store\n * @param value value to store. Non-string values will be converted to a string via JSON.stringify\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction saveState(name, value) {\n command_1.issueCommand('save-state', { name }, value);\n}\nexports.saveState = saveState;\n/**\n * Gets the value of an state set by this action's main execution.\n *\n * @param name name of the state to get\n * @returns string\n */\nfunction getState(name) {\n return process.env[`STATE_${name}`] || '';\n}\nexports.getState = getState;\n//# sourceMappingURL=core.js.map","\"use strict\";\n// For internal use, subject to change.\nvar __importStar = (this && this.__importStar) || function (mod) {\n if (mod && mod.__esModule) return mod;\n var result = {};\n if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\n result[\"default\"] = mod;\n return result;\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\n// We use any as a valid input type\n/* eslint-disable @typescript-eslint/no-explicit-any */\nconst fs = __importStar(require(\"fs\"));\nconst os = __importStar(require(\"os\"));\nconst utils_1 = require(\"./utils\");\nfunction issueCommand(command, message) {\n const filePath = process.env[`GITHUB_${command}`];\n if (!filePath) {\n throw new Error(`Unable to find environment variable for file command ${command}`);\n }\n if (!fs.existsSync(filePath)) {\n throw new Error(`Missing file at path: ${filePath}`);\n }\n fs.appendFileSync(filePath, `${utils_1.toCommandValue(message)}${os.EOL}`, {\n encoding: 'utf8'\n });\n}\nexports.issueCommand = issueCommand;\n//# sourceMappingURL=file-command.js.map","\"use strict\";\n// We use any as a valid input type\n/* eslint-disable @typescript-eslint/no-explicit-any */\nObject.defineProperty(exports, \"__esModule\", { value: true });\n/**\n * Sanitizes an input into a string so it can be passed into issueCommand safely\n * @param input input to sanitize into a string\n */\nfunction toCommandValue(input) {\n if (input === null || input === undefined) {\n return '';\n }\n else if (typeof input === 'string' || input instanceof String) {\n return input;\n }\n return JSON.stringify(input);\n}\nexports.toCommandValue = toCommandValue;\n//# sourceMappingURL=utils.js.map","module.exports = require('./register')().Promise\n","\"use strict\"\n // global key for user preferred registration\nvar REGISTRATION_KEY = '@@any-promise/REGISTRATION',\n // Prior registration (preferred or detected)\n registered = null\n\n/**\n * Registers the given implementation. An implementation must\n * be registered prior to any call to `require(\"any-promise\")`,\n * typically on application load.\n *\n * If called with no arguments, will return registration in\n * following priority:\n *\n * For Node.js:\n *\n * 1. Previous registration\n * 2. global.Promise if node.js version >= 0.12\n * 3. Auto detected promise based on first sucessful require of\n * known promise libraries. Note this is a last resort, as the\n * loaded library is non-deterministic. node.js >= 0.12 will\n * always use global.Promise over this priority list.\n * 4. Throws error.\n *\n * For Browser:\n *\n * 1. Previous registration\n * 2. window.Promise\n * 3. Throws error.\n *\n * Options:\n *\n * Promise: Desired Promise constructor\n * global: Boolean - Should the registration be cached in a global variable to\n * allow cross dependency/bundle registration? (default true)\n */\nmodule.exports = function(root, loadImplementation){\n return function register(implementation, opts){\n implementation = implementation || null\n opts = opts || {}\n // global registration unless explicitly {global: false} in options (default true)\n var registerGlobal = opts.global !== false;\n\n // load any previous global registration\n if(registered === null && registerGlobal){\n registered = root[REGISTRATION_KEY] || null\n }\n\n if(registered !== null\n && implementation !== null\n && registered.implementation !== implementation){\n // Throw error if attempting to redefine implementation\n throw new Error('any-promise already defined as \"'+registered.implementation+\n '\". You can only register an implementation before the first '+\n ' call to require(\"any-promise\") and an implementation cannot be changed')\n }\n\n if(registered === null){\n // use provided implementation\n if(implementation !== null && typeof opts.Promise !== 'undefined'){\n registered = {\n Promise: opts.Promise,\n implementation: implementation\n }\n } else {\n // require implementation if implementation is specified but not provided\n registered = loadImplementation(implementation)\n }\n\n if(registerGlobal){\n // register preference globally in case multiple installations\n root[REGISTRATION_KEY] = registered\n }\n }\n\n return registered\n }\n}\n",null,"(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) :\n typeof define === 'function' && define.amd ? define(['exports'], factory) :\n (factory((global.async = {})));\n}(this, (function (exports) { 'use strict';\n\n /**\n * Creates a continuation function with some arguments already applied.\n *\n * Useful as a shorthand when combined with other control flow functions. Any\n * arguments passed to the returned function are added to the arguments\n * originally passed to apply.\n *\n * @name apply\n * @static\n * @memberOf module:Utils\n * @method\n * @category Util\n * @param {Function} fn - The function you want to eventually apply all\n * arguments to. Invokes with (arguments...).\n * @param {...*} arguments... - Any number of arguments to automatically apply\n * when the continuation is called.\n * @returns {Function} the partially-applied function\n * @example\n *\n * // using apply\n * async.parallel([\n * async.apply(fs.writeFile, 'testfile1', 'test1'),\n * async.apply(fs.writeFile, 'testfile2', 'test2')\n * ]);\n *\n *\n * // the same process without using apply\n * async.parallel([\n * function(callback) {\n * fs.writeFile('testfile1', 'test1', callback);\n * },\n * function(callback) {\n * fs.writeFile('testfile2', 'test2', callback);\n * }\n * ]);\n *\n * // It's possible to pass any number of additional arguments when calling the\n * // continuation:\n *\n * node> var fn = async.apply(sys.puts, 'one');\n * node> fn('two', 'three');\n * one\n * two\n * three\n */\n function apply(fn, ...args) {\n return (...callArgs) => fn(...args,...callArgs);\n }\n\n function initialParams (fn) {\n return function (...args/*, callback*/) {\n var callback = args.pop();\n return fn.call(this, args, callback);\n };\n }\n\n /* istanbul ignore file */\n\n var hasSetImmediate = typeof setImmediate === 'function' && setImmediate;\n var hasNextTick = typeof process === 'object' && typeof process.nextTick === 'function';\n\n function fallback(fn) {\n setTimeout(fn, 0);\n }\n\n function wrap(defer) {\n return (fn, ...args) => defer(() => fn(...args));\n }\n\n var _defer;\n\n if (hasSetImmediate) {\n _defer = setImmediate;\n } else if (hasNextTick) {\n _defer = process.nextTick;\n } else {\n _defer = fallback;\n }\n\n var setImmediate$1 = wrap(_defer);\n\n /**\n * Take a sync function and make it async, passing its return value to a\n * callback. This is useful for plugging sync functions into a waterfall,\n * series, or other async functions. Any arguments passed to the generated\n * function will be passed to the wrapped function (except for the final\n * callback argument). Errors thrown will be passed to the callback.\n *\n * If the function passed to `asyncify` returns a Promise, that promises's\n * resolved/rejected state will be used to call the callback, rather than simply\n * the synchronous return value.\n *\n * This also means you can asyncify ES2017 `async` functions.\n *\n * @name asyncify\n * @static\n * @memberOf module:Utils\n * @method\n * @alias wrapSync\n * @category Util\n * @param {Function} func - The synchronous function, or Promise-returning\n * function to convert to an {@link AsyncFunction}.\n * @returns {AsyncFunction} An asynchronous wrapper of the `func`. To be\n * invoked with `(args..., callback)`.\n * @example\n *\n * // passing a regular synchronous function\n * async.waterfall([\n * async.apply(fs.readFile, filename, \"utf8\"),\n * async.asyncify(JSON.parse),\n * function (data, next) {\n * // data is the result of parsing the text.\n * // If there was a parsing error, it would have been caught.\n * }\n * ], callback);\n *\n * // passing a function returning a promise\n * async.waterfall([\n * async.apply(fs.readFile, filename, \"utf8\"),\n * async.asyncify(function (contents) {\n * return db.model.create(contents);\n * }),\n * function (model, next) {\n * // `model` is the instantiated model object.\n * // If there was an error, this function would be skipped.\n * }\n * ], callback);\n *\n * // es2017 example, though `asyncify` is not needed if your JS environment\n * // supports async functions out of the box\n * var q = async.queue(async.asyncify(async function(file) {\n * var intermediateStep = await processFile(file);\n * return await somePromise(intermediateStep)\n * }));\n *\n * q.push(files);\n */\n function asyncify(func) {\n if (isAsync(func)) {\n return function (...args/*, callback*/) {\n const callback = args.pop();\n const promise = func.apply(this, args);\n return handlePromise(promise, callback)\n }\n }\n\n return initialParams(function (args, callback) {\n var result;\n try {\n result = func.apply(this, args);\n } catch (e) {\n return callback(e);\n }\n // if result is Promise object\n if (result && typeof result.then === 'function') {\n return handlePromise(result, callback)\n } else {\n callback(null, result);\n }\n });\n }\n\n function handlePromise(promise, callback) {\n return promise.then(value => {\n invokeCallback(callback, null, value);\n }, err => {\n invokeCallback(callback, err && err.message ? err : new Error(err));\n });\n }\n\n function invokeCallback(callback, error, value) {\n try {\n callback(error, value);\n } catch (err) {\n setImmediate$1(e => { throw e }, err);\n }\n }\n\n function isAsync(fn) {\n return fn[Symbol.toStringTag] === 'AsyncFunction';\n }\n\n function isAsyncGenerator(fn) {\n return fn[Symbol.toStringTag] === 'AsyncGenerator';\n }\n\n function isAsyncIterable(obj) {\n return typeof obj[Symbol.asyncIterator] === 'function';\n }\n\n function wrapAsync(asyncFn) {\n if (typeof asyncFn !== 'function') throw new Error('expected a function')\n return isAsync(asyncFn) ? asyncify(asyncFn) : asyncFn;\n }\n\n // conditionally promisify a function.\n // only return a promise if a callback is omitted\n function awaitify (asyncFn, arity = asyncFn.length) {\n if (!arity) throw new Error('arity is undefined')\n function awaitable (...args) {\n if (typeof args[arity - 1] === 'function') {\n return asyncFn.apply(this, args)\n }\n\n return new Promise((resolve, reject) => {\n args[arity - 1] = (err, ...cbArgs) => {\n if (err) return reject(err)\n resolve(cbArgs.length > 1 ? cbArgs : cbArgs[0]);\n };\n asyncFn.apply(this, args);\n })\n }\n\n return awaitable\n }\n\n function applyEach (eachfn) {\n return function applyEach(fns, ...callArgs) {\n const go = awaitify(function (callback) {\n var that = this;\n return eachfn(fns, (fn, cb) => {\n wrapAsync(fn).apply(that, callArgs.concat(cb));\n }, callback);\n });\n return go;\n };\n }\n\n function _asyncMap(eachfn, arr, iteratee, callback) {\n arr = arr || [];\n var results = [];\n var counter = 0;\n var _iteratee = wrapAsync(iteratee);\n\n return eachfn(arr, (value, _, iterCb) => {\n var index = counter++;\n _iteratee(value, (err, v) => {\n results[index] = v;\n iterCb(err);\n });\n }, err => {\n callback(err, results);\n });\n }\n\n function isArrayLike(value) {\n return value &&\n typeof value.length === 'number' &&\n value.length >= 0 &&\n value.length % 1 === 0;\n }\n\n // A temporary value used to identify if the loop should be broken.\n // See #1064, #1293\n const breakLoop = {};\n\n function once(fn) {\n function wrapper (...args) {\n if (fn === null) return;\n var callFn = fn;\n fn = null;\n callFn.apply(this, args);\n }\n Object.assign(wrapper, fn);\n return wrapper\n }\n\n function getIterator (coll) {\n return coll[Symbol.iterator] && coll[Symbol.iterator]();\n }\n\n function createArrayIterator(coll) {\n var i = -1;\n var len = coll.length;\n return function next() {\n return ++i < len ? {value: coll[i], key: i} : null;\n }\n }\n\n function createES2015Iterator(iterator) {\n var i = -1;\n return function next() {\n var item = iterator.next();\n if (item.done)\n return null;\n i++;\n return {value: item.value, key: i};\n }\n }\n\n function createObjectIterator(obj) {\n var okeys = obj ? Object.keys(obj) : [];\n var i = -1;\n var len = okeys.length;\n return function next() {\n var key = okeys[++i];\n return i < len ? {value: obj[key], key} : null;\n };\n }\n\n function createIterator(coll) {\n if (isArrayLike(coll)) {\n return createArrayIterator(coll);\n }\n\n var iterator = getIterator(coll);\n return iterator ? createES2015Iterator(iterator) : createObjectIterator(coll);\n }\n\n function onlyOnce(fn) {\n return function (...args) {\n if (fn === null) throw new Error(\"Callback was already called.\");\n var callFn = fn;\n fn = null;\n callFn.apply(this, args);\n };\n }\n\n // for async generators\n function asyncEachOfLimit(generator, limit, iteratee, callback) {\n let done = false;\n let canceled = false;\n let awaiting = false;\n let running = 0;\n let idx = 0;\n\n function replenish() {\n //console.log('replenish')\n if (running >= limit || awaiting || done) return\n //console.log('replenish awaiting')\n awaiting = true;\n generator.next().then(({value, done: iterDone}) => {\n //console.log('got value', value)\n if (canceled || done) return\n awaiting = false;\n if (iterDone) {\n done = true;\n if (running <= 0) {\n //console.log('done nextCb')\n callback(null);\n }\n return;\n }\n running++;\n iteratee(value, idx, iterateeCallback);\n idx++;\n replenish();\n }).catch(handleError);\n }\n\n function iterateeCallback(err, result) {\n //console.log('iterateeCallback')\n running -= 1;\n if (canceled) return\n if (err) return handleError(err)\n\n if (err === false) {\n done = true;\n canceled = true;\n return\n }\n\n if (result === breakLoop || (done && running <= 0)) {\n done = true;\n //console.log('done iterCb')\n return callback(null);\n }\n replenish();\n }\n\n function handleError(err) {\n if (canceled) return\n awaiting = false;\n done = true;\n callback(err);\n }\n\n replenish();\n }\n\n var eachOfLimit = (limit) => {\n return (obj, iteratee, callback) => {\n callback = once(callback);\n if (limit <= 0) {\n throw new RangeError('concurrency limit cannot be less than 1')\n }\n if (!obj) {\n return callback(null);\n }\n if (isAsyncGenerator(obj)) {\n return asyncEachOfLimit(obj, limit, iteratee, callback)\n }\n if (isAsyncIterable(obj)) {\n return asyncEachOfLimit(obj[Symbol.asyncIterator](), limit, iteratee, callback)\n }\n var nextElem = createIterator(obj);\n var done = false;\n var canceled = false;\n var running = 0;\n var looping = false;\n\n function iterateeCallback(err, value) {\n if (canceled) return\n running -= 1;\n if (err) {\n done = true;\n callback(err);\n }\n else if (err === false) {\n done = true;\n canceled = true;\n }\n else if (value === breakLoop || (done && running <= 0)) {\n done = true;\n return callback(null);\n }\n else if (!looping) {\n replenish();\n }\n }\n\n function replenish () {\n looping = true;\n while (running < limit && !done) {\n var elem = nextElem();\n if (elem === null) {\n done = true;\n if (running <= 0) {\n callback(null);\n }\n return;\n }\n running += 1;\n iteratee(elem.value, elem.key, onlyOnce(iterateeCallback));\n }\n looping = false;\n }\n\n replenish();\n };\n };\n\n /**\n * The same as [`eachOf`]{@link module:Collections.eachOf} but runs a maximum of `limit` async operations at a\n * time.\n *\n * @name eachOfLimit\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.eachOf]{@link module:Collections.eachOf}\n * @alias forEachOfLimit\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {AsyncFunction} iteratee - An async function to apply to each\n * item in `coll`. The `key` is the item's key, or index in the case of an\n * array.\n * Invoked with (item, key, callback).\n * @param {Function} [callback] - A callback which is called when all\n * `iteratee` functions have finished, or an error occurs. Invoked with (err).\n * @returns {Promise} a promise, if a callback is omitted\n */\n function eachOfLimit$1(coll, limit, iteratee, callback) {\n return eachOfLimit(limit)(coll, wrapAsync(iteratee), callback);\n }\n\n var eachOfLimit$2 = awaitify(eachOfLimit$1, 4);\n\n // eachOf implementation optimized for array-likes\n function eachOfArrayLike(coll, iteratee, callback) {\n callback = once(callback);\n var index = 0,\n completed = 0,\n {length} = coll,\n canceled = false;\n if (length === 0) {\n callback(null);\n }\n\n function iteratorCallback(err, value) {\n if (err === false) {\n canceled = true;\n }\n if (canceled === true) return\n if (err) {\n callback(err);\n } else if ((++completed === length) || value === breakLoop) {\n callback(null);\n }\n }\n\n for (; index < length; index++) {\n iteratee(coll[index], index, onlyOnce(iteratorCallback));\n }\n }\n\n // a generic version of eachOf which can handle array, object, and iterator cases.\n function eachOfGeneric (coll, iteratee, callback) {\n return eachOfLimit$2(coll, Infinity, iteratee, callback);\n }\n\n /**\n * Like [`each`]{@link module:Collections.each}, except that it passes the key (or index) as the second argument\n * to the iteratee.\n *\n * @name eachOf\n * @static\n * @memberOf module:Collections\n * @method\n * @alias forEachOf\n * @category Collection\n * @see [async.each]{@link module:Collections.each}\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - A function to apply to each\n * item in `coll`.\n * The `key` is the item's key, or index in the case of an array.\n * Invoked with (item, key, callback).\n * @param {Function} [callback] - A callback which is called when all\n * `iteratee` functions have finished, or an error occurs. Invoked with (err).\n * @returns {Promise} a promise, if a callback is omitted\n * @example\n *\n * var obj = {dev: \"/dev.json\", test: \"/test.json\", prod: \"/prod.json\"};\n * var configs = {};\n *\n * async.forEachOf(obj, function (value, key, callback) {\n * fs.readFile(__dirname + value, \"utf8\", function (err, data) {\n * if (err) return callback(err);\n * try {\n * configs[key] = JSON.parse(data);\n * } catch (e) {\n * return callback(e);\n * }\n * callback();\n * });\n * }, function (err) {\n * if (err) console.error(err.message);\n * // configs is now a map of JSON data\n * doSomethingWith(configs);\n * });\n */\n function eachOf(coll, iteratee, callback) {\n var eachOfImplementation = isArrayLike(coll) ? eachOfArrayLike : eachOfGeneric;\n return eachOfImplementation(coll, wrapAsync(iteratee), callback);\n }\n\n var eachOf$1 = awaitify(eachOf, 3);\n\n /**\n * Produces a new collection of values by mapping each value in `coll` through\n * the `iteratee` function. The `iteratee` is called with an item from `coll`\n * and a callback for when it has finished processing. Each of these callback\n * takes 2 arguments: an `error`, and the transformed item from `coll`. If\n * `iteratee` passes an error to its callback, the main `callback` (for the\n * `map` function) is immediately called with the error.\n *\n * Note, that since this function applies the `iteratee` to each item in\n * parallel, there is no guarantee that the `iteratee` functions will complete\n * in order. However, the results array will be in the same order as the\n * original `coll`.\n *\n * If `map` is passed an Object, the results will be an Array. The results\n * will roughly be in the order of the original Objects' keys (but this can\n * vary across JavaScript engines).\n *\n * @name map\n * @static\n * @memberOf module:Collections\n * @method\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async function to apply to each item in\n * `coll`.\n * The iteratee should complete with the transformed item.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called when all `iteratee`\n * functions have finished, or an error occurs. Results is an Array of the\n * transformed items from the `coll`. Invoked with (err, results).\n * @returns {Promise} a promise, if no callback is passed\n * @example\n *\n * async.map(['file1','file2','file3'], fs.stat, function(err, results) {\n * // results is now an array of stats for each file\n * });\n */\n function map (coll, iteratee, callback) {\n return _asyncMap(eachOf$1, coll, iteratee, callback)\n }\n var map$1 = awaitify(map, 3);\n\n /**\n * Applies the provided arguments to each function in the array, calling\n * `callback` after all functions have completed. If you only provide the first\n * argument, `fns`, then it will return a function which lets you pass in the\n * arguments as if it were a single function call. If more arguments are\n * provided, `callback` is required while `args` is still optional. The results\n * for each of the applied async functions are passed to the final callback\n * as an array.\n *\n * @name applyEach\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @param {Array|Iterable|AsyncIterable|Object} fns - A collection of {@link AsyncFunction}s\n * to all call with the same arguments\n * @param {...*} [args] - any number of separate arguments to pass to the\n * function.\n * @param {Function} [callback] - the final argument should be the callback,\n * called when all functions have completed processing.\n * @returns {AsyncFunction} - Returns a function that takes no args other than\n * an optional callback, that is the result of applying the `args` to each\n * of the functions.\n * @example\n *\n * const appliedFn = async.applyEach([enableSearch, updateSchema], 'bucket')\n *\n * appliedFn((err, results) => {\n * // results[0] is the results for `enableSearch`\n * // results[1] is the results for `updateSchema`\n * });\n *\n * // partial application example:\n * async.each(\n * buckets,\n * async (bucket) => async.applyEach([enableSearch, updateSchema], bucket)(),\n * callback\n * );\n */\n var applyEach$1 = applyEach(map$1);\n\n /**\n * The same as [`eachOf`]{@link module:Collections.eachOf} but runs only a single async operation at a time.\n *\n * @name eachOfSeries\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.eachOf]{@link module:Collections.eachOf}\n * @alias forEachOfSeries\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async function to apply to each item in\n * `coll`.\n * Invoked with (item, key, callback).\n * @param {Function} [callback] - A callback which is called when all `iteratee`\n * functions have finished, or an error occurs. Invoked with (err).\n * @returns {Promise} a promise, if a callback is omitted\n */\n function eachOfSeries(coll, iteratee, callback) {\n return eachOfLimit$2(coll, 1, iteratee, callback)\n }\n var eachOfSeries$1 = awaitify(eachOfSeries, 3);\n\n /**\n * The same as [`map`]{@link module:Collections.map} but runs only a single async operation at a time.\n *\n * @name mapSeries\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.map]{@link module:Collections.map}\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async function to apply to each item in\n * `coll`.\n * The iteratee should complete with the transformed item.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called when all `iteratee`\n * functions have finished, or an error occurs. Results is an array of the\n * transformed items from the `coll`. Invoked with (err, results).\n * @returns {Promise} a promise, if no callback is passed\n */\n function mapSeries (coll, iteratee, callback) {\n return _asyncMap(eachOfSeries$1, coll, iteratee, callback)\n }\n var mapSeries$1 = awaitify(mapSeries, 3);\n\n /**\n * The same as [`applyEach`]{@link module:ControlFlow.applyEach} but runs only a single async operation at a time.\n *\n * @name applyEachSeries\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.applyEach]{@link module:ControlFlow.applyEach}\n * @category Control Flow\n * @param {Array|Iterable|AsyncIterable|Object} fns - A collection of {@link AsyncFunction}s to all\n * call with the same arguments\n * @param {...*} [args] - any number of separate arguments to pass to the\n * function.\n * @param {Function} [callback] - the final argument should be the callback,\n * called when all functions have completed processing.\n * @returns {AsyncFunction} - A function, that when called, is the result of\n * appling the `args` to the list of functions. It takes no args, other than\n * a callback.\n */\n var applyEachSeries = applyEach(mapSeries$1);\n\n const PROMISE_SYMBOL = Symbol('promiseCallback');\n\n function promiseCallback () {\n let resolve, reject;\n function callback (err, ...args) {\n if (err) return reject(err)\n resolve(args.length > 1 ? args : args[0]);\n }\n\n callback[PROMISE_SYMBOL] = new Promise((res, rej) => {\n resolve = res,\n reject = rej;\n });\n\n return callback\n }\n\n /**\n * Determines the best order for running the {@link AsyncFunction}s in `tasks`, based on\n * their requirements. Each function can optionally depend on other functions\n * being completed first, and each function is run as soon as its requirements\n * are satisfied.\n *\n * If any of the {@link AsyncFunction}s pass an error to their callback, the `auto` sequence\n * will stop. Further tasks will not execute (so any other functions depending\n * on it will not run), and the main `callback` is immediately called with the\n * error.\n *\n * {@link AsyncFunction}s also receive an object containing the results of functions which\n * have completed so far as the first argument, if they have dependencies. If a\n * task function has no dependencies, it will only be passed a callback.\n *\n * @name auto\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @param {Object} tasks - An object. Each of its properties is either a\n * function or an array of requirements, with the {@link AsyncFunction} itself the last item\n * in the array. The object's key of a property serves as the name of the task\n * defined by that property, i.e. can be used when specifying requirements for\n * other tasks. The function receives one or two arguments:\n * * a `results` object, containing the results of the previously executed\n * functions, only passed if the task has any dependencies,\n * * a `callback(err, result)` function, which must be called when finished,\n * passing an `error` (which can be `null`) and the result of the function's\n * execution.\n * @param {number} [concurrency=Infinity] - An optional `integer` for\n * determining the maximum number of tasks that can be run in parallel. By\n * default, as many as possible.\n * @param {Function} [callback] - An optional callback which is called when all\n * the tasks have been completed. It receives the `err` argument if any `tasks`\n * pass an error to their callback. Results are always returned; however, if an\n * error occurs, no further `tasks` will be performed, and the results object\n * will only contain partial results. Invoked with (err, results).\n * @returns {Promise} a promise, if a callback is not passed\n * @example\n *\n * async.auto({\n * // this function will just be passed a callback\n * readData: async.apply(fs.readFile, 'data.txt', 'utf-8'),\n * showData: ['readData', function(results, cb) {\n * // results.readData is the file's contents\n * // ...\n * }]\n * }, callback);\n *\n * async.auto({\n * get_data: function(callback) {\n * console.log('in get_data');\n * // async code to get some data\n * callback(null, 'data', 'converted to array');\n * },\n * make_folder: function(callback) {\n * console.log('in make_folder');\n * // async code to create a directory to store a file in\n * // this is run at the same time as getting the data\n * callback(null, 'folder');\n * },\n * write_file: ['get_data', 'make_folder', function(results, callback) {\n * console.log('in write_file', JSON.stringify(results));\n * // once there is some data and the directory exists,\n * // write the data to a file in the directory\n * callback(null, 'filename');\n * }],\n * email_link: ['write_file', function(results, callback) {\n * console.log('in email_link', JSON.stringify(results));\n * // once the file is written let's email a link to it...\n * // results.write_file contains the filename returned by write_file.\n * callback(null, {'file':results.write_file, 'email':'user@example.com'});\n * }]\n * }, function(err, results) {\n * console.log('err = ', err);\n * console.log('results = ', results);\n * });\n */\n function auto(tasks, concurrency, callback) {\n if (typeof concurrency !== 'number') {\n // concurrency is optional, shift the args.\n callback = concurrency;\n concurrency = null;\n }\n callback = once(callback || promiseCallback());\n var numTasks = Object.keys(tasks).length;\n if (!numTasks) {\n return callback(null);\n }\n if (!concurrency) {\n concurrency = numTasks;\n }\n\n var results = {};\n var runningTasks = 0;\n var canceled = false;\n var hasError = false;\n\n var listeners = Object.create(null);\n\n var readyTasks = [];\n\n // for cycle detection:\n var readyToCheck = []; // tasks that have been identified as reachable\n // without the possibility of returning to an ancestor task\n var uncheckedDependencies = {};\n\n Object.keys(tasks).forEach(key => {\n var task = tasks[key];\n if (!Array.isArray(task)) {\n // no dependencies\n enqueueTask(key, [task]);\n readyToCheck.push(key);\n return;\n }\n\n var dependencies = task.slice(0, task.length - 1);\n var remainingDependencies = dependencies.length;\n if (remainingDependencies === 0) {\n enqueueTask(key, task);\n readyToCheck.push(key);\n return;\n }\n uncheckedDependencies[key] = remainingDependencies;\n\n dependencies.forEach(dependencyName => {\n if (!tasks[dependencyName]) {\n throw new Error('async.auto task `' + key +\n '` has a non-existent dependency `' +\n dependencyName + '` in ' +\n dependencies.join(', '));\n }\n addListener(dependencyName, () => {\n remainingDependencies--;\n if (remainingDependencies === 0) {\n enqueueTask(key, task);\n }\n });\n });\n });\n\n checkForDeadlocks();\n processQueue();\n\n function enqueueTask(key, task) {\n readyTasks.push(() => runTask(key, task));\n }\n\n function processQueue() {\n if (canceled) return\n if (readyTasks.length === 0 && runningTasks === 0) {\n return callback(null, results);\n }\n while(readyTasks.length && runningTasks < concurrency) {\n var run = readyTasks.shift();\n run();\n }\n\n }\n\n function addListener(taskName, fn) {\n var taskListeners = listeners[taskName];\n if (!taskListeners) {\n taskListeners = listeners[taskName] = [];\n }\n\n taskListeners.push(fn);\n }\n\n function taskComplete(taskName) {\n var taskListeners = listeners[taskName] || [];\n taskListeners.forEach(fn => fn());\n processQueue();\n }\n\n\n function runTask(key, task) {\n if (hasError) return;\n\n var taskCallback = onlyOnce((err, ...result) => {\n runningTasks--;\n if (err === false) {\n canceled = true;\n return\n }\n if (result.length < 2) {\n [result] = result;\n }\n if (err) {\n var safeResults = {};\n Object.keys(results).forEach(rkey => {\n safeResults[rkey] = results[rkey];\n });\n safeResults[key] = result;\n hasError = true;\n listeners = Object.create(null);\n if (canceled) return\n callback(err, safeResults);\n } else {\n results[key] = result;\n taskComplete(key);\n }\n });\n\n runningTasks++;\n var taskFn = wrapAsync(task[task.length - 1]);\n if (task.length > 1) {\n taskFn(results, taskCallback);\n } else {\n taskFn(taskCallback);\n }\n }\n\n function checkForDeadlocks() {\n // Kahn's algorithm\n // https://en.wikipedia.org/wiki/Topological_sorting#Kahn.27s_algorithm\n // http://connalle.blogspot.com/2013/10/topological-sortingkahn-algorithm.html\n var currentTask;\n var counter = 0;\n while (readyToCheck.length) {\n currentTask = readyToCheck.pop();\n counter++;\n getDependents(currentTask).forEach(dependent => {\n if (--uncheckedDependencies[dependent] === 0) {\n readyToCheck.push(dependent);\n }\n });\n }\n\n if (counter !== numTasks) {\n throw new Error(\n 'async.auto cannot execute tasks due to a recursive dependency'\n );\n }\n }\n\n function getDependents(taskName) {\n var result = [];\n Object.keys(tasks).forEach(key => {\n const task = tasks[key];\n if (Array.isArray(task) && task.indexOf(taskName) >= 0) {\n result.push(key);\n }\n });\n return result;\n }\n\n return callback[PROMISE_SYMBOL]\n }\n\n var FN_ARGS = /^(?:async\\s+)?(?:function)?\\s*\\w*\\s*\\(\\s*([^)]+)\\s*\\)(?:\\s*{)/;\n var ARROW_FN_ARGS = /^(?:async\\s+)?\\(?\\s*([^)=]+)\\s*\\)?(?:\\s*=>)/;\n var FN_ARG_SPLIT = /,/;\n var FN_ARG = /(=.+)?(\\s*)$/;\n var STRIP_COMMENTS = /((\\/\\/.*$)|(\\/\\*[\\s\\S]*?\\*\\/))/mg;\n\n function parseParams(func) {\n const src = func.toString().replace(STRIP_COMMENTS, '');\n let match = src.match(FN_ARGS);\n if (!match) {\n match = src.match(ARROW_FN_ARGS);\n }\n if (!match) throw new Error('could not parse args in autoInject\\nSource:\\n' + src)\n let [, args] = match;\n return args\n .replace(/\\s/g, '')\n .split(FN_ARG_SPLIT)\n .map((arg) => arg.replace(FN_ARG, '').trim());\n }\n\n /**\n * A dependency-injected version of the [async.auto]{@link module:ControlFlow.auto} function. Dependent\n * tasks are specified as parameters to the function, after the usual callback\n * parameter, with the parameter names matching the names of the tasks it\n * depends on. This can provide even more readable task graphs which can be\n * easier to maintain.\n *\n * If a final callback is specified, the task results are similarly injected,\n * specified as named parameters after the initial error parameter.\n *\n * The autoInject function is purely syntactic sugar and its semantics are\n * otherwise equivalent to [async.auto]{@link module:ControlFlow.auto}.\n *\n * @name autoInject\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.auto]{@link module:ControlFlow.auto}\n * @category Control Flow\n * @param {Object} tasks - An object, each of whose properties is an {@link AsyncFunction} of\n * the form 'func([dependencies...], callback). The object's key of a property\n * serves as the name of the task defined by that property, i.e. can be used\n * when specifying requirements for other tasks.\n * * The `callback` parameter is a `callback(err, result)` which must be called\n * when finished, passing an `error` (which can be `null`) and the result of\n * the function's execution. The remaining parameters name other tasks on\n * which the task is dependent, and the results from those tasks are the\n * arguments of those parameters.\n * @param {Function} [callback] - An optional callback which is called when all\n * the tasks have been completed. It receives the `err` argument if any `tasks`\n * pass an error to their callback, and a `results` object with any completed\n * task results, similar to `auto`.\n * @returns {Promise} a promise, if no callback is passed\n * @example\n *\n * // The example from `auto` can be rewritten as follows:\n * async.autoInject({\n * get_data: function(callback) {\n * // async code to get some data\n * callback(null, 'data', 'converted to array');\n * },\n * make_folder: function(callback) {\n * // async code to create a directory to store a file in\n * // this is run at the same time as getting the data\n * callback(null, 'folder');\n * },\n * write_file: function(get_data, make_folder, callback) {\n * // once there is some data and the directory exists,\n * // write the data to a file in the directory\n * callback(null, 'filename');\n * },\n * email_link: function(write_file, callback) {\n * // once the file is written let's email a link to it...\n * // write_file contains the filename returned by write_file.\n * callback(null, {'file':write_file, 'email':'user@example.com'});\n * }\n * }, function(err, results) {\n * console.log('err = ', err);\n * console.log('email_link = ', results.email_link);\n * });\n *\n * // If you are using a JS minifier that mangles parameter names, `autoInject`\n * // will not work with plain functions, since the parameter names will be\n * // collapsed to a single letter identifier. To work around this, you can\n * // explicitly specify the names of the parameters your task function needs\n * // in an array, similar to Angular.js dependency injection.\n *\n * // This still has an advantage over plain `auto`, since the results a task\n * // depends on are still spread into arguments.\n * async.autoInject({\n * //...\n * write_file: ['get_data', 'make_folder', function(get_data, make_folder, callback) {\n * callback(null, 'filename');\n * }],\n * email_link: ['write_file', function(write_file, callback) {\n * callback(null, {'file':write_file, 'email':'user@example.com'});\n * }]\n * //...\n * }, function(err, results) {\n * console.log('err = ', err);\n * console.log('email_link = ', results.email_link);\n * });\n */\n function autoInject(tasks, callback) {\n var newTasks = {};\n\n Object.keys(tasks).forEach(key => {\n var taskFn = tasks[key];\n var params;\n var fnIsAsync = isAsync(taskFn);\n var hasNoDeps =\n (!fnIsAsync && taskFn.length === 1) ||\n (fnIsAsync && taskFn.length === 0);\n\n if (Array.isArray(taskFn)) {\n params = [...taskFn];\n taskFn = params.pop();\n\n newTasks[key] = params.concat(params.length > 0 ? newTask : taskFn);\n } else if (hasNoDeps) {\n // no dependencies, use the function as-is\n newTasks[key] = taskFn;\n } else {\n params = parseParams(taskFn);\n if ((taskFn.length === 0 && !fnIsAsync) && params.length === 0) {\n throw new Error(\"autoInject task functions require explicit parameters.\");\n }\n\n // remove callback param\n if (!fnIsAsync) params.pop();\n\n newTasks[key] = params.concat(newTask);\n }\n\n function newTask(results, taskCb) {\n var newArgs = params.map(name => results[name]);\n newArgs.push(taskCb);\n wrapAsync(taskFn)(...newArgs);\n }\n });\n\n return auto(newTasks, callback);\n }\n\n // Simple doubly linked list (https://en.wikipedia.org/wiki/Doubly_linked_list) implementation\n // used for queues. This implementation assumes that the node provided by the user can be modified\n // to adjust the next and last properties. We implement only the minimal functionality\n // for queue support.\n class DLL {\n constructor() {\n this.head = this.tail = null;\n this.length = 0;\n }\n\n removeLink(node) {\n if (node.prev) node.prev.next = node.next;\n else this.head = node.next;\n if (node.next) node.next.prev = node.prev;\n else this.tail = node.prev;\n\n node.prev = node.next = null;\n this.length -= 1;\n return node;\n }\n\n empty () {\n while(this.head) this.shift();\n return this;\n }\n\n insertAfter(node, newNode) {\n newNode.prev = node;\n newNode.next = node.next;\n if (node.next) node.next.prev = newNode;\n else this.tail = newNode;\n node.next = newNode;\n this.length += 1;\n }\n\n insertBefore(node, newNode) {\n newNode.prev = node.prev;\n newNode.next = node;\n if (node.prev) node.prev.next = newNode;\n else this.head = newNode;\n node.prev = newNode;\n this.length += 1;\n }\n\n unshift(node) {\n if (this.head) this.insertBefore(this.head, node);\n else setInitial(this, node);\n }\n\n push(node) {\n if (this.tail) this.insertAfter(this.tail, node);\n else setInitial(this, node);\n }\n\n shift() {\n return this.head && this.removeLink(this.head);\n }\n\n pop() {\n return this.tail && this.removeLink(this.tail);\n }\n\n toArray() {\n return [...this]\n }\n\n *[Symbol.iterator] () {\n var cur = this.head;\n while (cur) {\n yield cur.data;\n cur = cur.next;\n }\n }\n\n remove (testFn) {\n var curr = this.head;\n while(curr) {\n var {next} = curr;\n if (testFn(curr)) {\n this.removeLink(curr);\n }\n curr = next;\n }\n return this;\n }\n }\n\n function setInitial(dll, node) {\n dll.length = 1;\n dll.head = dll.tail = node;\n }\n\n function queue(worker, concurrency, payload) {\n if (concurrency == null) {\n concurrency = 1;\n }\n else if(concurrency === 0) {\n throw new RangeError('Concurrency must not be zero');\n }\n\n var _worker = wrapAsync(worker);\n var numRunning = 0;\n var workersList = [];\n const events = {\n error: [],\n drain: [],\n saturated: [],\n unsaturated: [],\n empty: []\n };\n\n function on (event, handler) {\n events[event].push(handler);\n }\n\n function once (event, handler) {\n const handleAndRemove = (...args) => {\n off(event, handleAndRemove);\n handler(...args);\n };\n events[event].push(handleAndRemove);\n }\n\n function off (event, handler) {\n if (!event) return Object.keys(events).forEach(ev => events[ev] = [])\n if (!handler) return events[event] = []\n events[event] = events[event].filter(ev => ev !== handler);\n }\n\n function trigger (event, ...args) {\n events[event].forEach(handler => handler(...args));\n }\n\n var processingScheduled = false;\n function _insert(data, insertAtFront, rejectOnError, callback) {\n if (callback != null && typeof callback !== 'function') {\n throw new Error('task callback must be a function');\n }\n q.started = true;\n\n var res, rej;\n function promiseCallback (err, ...args) {\n // we don't care about the error, let the global error handler\n // deal with it\n if (err) return rejectOnError ? rej(err) : res()\n if (args.length <= 1) return res(args[0])\n res(args);\n }\n\n var item = {\n data,\n callback: rejectOnError ?\n promiseCallback :\n (callback || promiseCallback)\n };\n\n if (insertAtFront) {\n q._tasks.unshift(item);\n } else {\n q._tasks.push(item);\n }\n\n if (!processingScheduled) {\n processingScheduled = true;\n setImmediate$1(() => {\n processingScheduled = false;\n q.process();\n });\n }\n\n if (rejectOnError || !callback) {\n return new Promise((resolve, reject) => {\n res = resolve;\n rej = reject;\n })\n }\n }\n\n function _createCB(tasks) {\n return function (err, ...args) {\n numRunning -= 1;\n\n for (var i = 0, l = tasks.length; i < l; i++) {\n var task = tasks[i];\n\n var index = workersList.indexOf(task);\n if (index === 0) {\n workersList.shift();\n } else if (index > 0) {\n workersList.splice(index, 1);\n }\n\n task.callback(err, ...args);\n\n if (err != null) {\n trigger('error', err, task.data);\n }\n }\n\n if (numRunning <= (q.concurrency - q.buffer) ) {\n trigger('unsaturated');\n }\n\n if (q.idle()) {\n trigger('drain');\n }\n q.process();\n };\n }\n\n function _maybeDrain(data) {\n if (data.length === 0 && q.idle()) {\n // call drain immediately if there are no tasks\n setImmediate$1(() => trigger('drain'));\n return true\n }\n return false\n }\n\n const eventMethod = (name) => (handler) => {\n if (!handler) {\n return new Promise((resolve, reject) => {\n once(name, (err, data) => {\n if (err) return reject(err)\n resolve(data);\n });\n })\n }\n off(name);\n on(name, handler);\n\n };\n\n var isProcessing = false;\n var q = {\n _tasks: new DLL(),\n *[Symbol.iterator] () {\n yield* q._tasks[Symbol.iterator]();\n },\n concurrency,\n payload,\n buffer: concurrency / 4,\n started: false,\n paused: false,\n push (data, callback) {\n if (Array.isArray(data)) {\n if (_maybeDrain(data)) return\n return data.map(datum => _insert(datum, false, false, callback))\n }\n return _insert(data, false, false, callback);\n },\n pushAsync (data, callback) {\n if (Array.isArray(data)) {\n if (_maybeDrain(data)) return\n return data.map(datum => _insert(datum, false, true, callback))\n }\n return _insert(data, false, true, callback);\n },\n kill () {\n off();\n q._tasks.empty();\n },\n unshift (data, callback) {\n if (Array.isArray(data)) {\n if (_maybeDrain(data)) return\n return data.map(datum => _insert(datum, true, false, callback))\n }\n return _insert(data, true, false, callback);\n },\n unshiftAsync (data, callback) {\n if (Array.isArray(data)) {\n if (_maybeDrain(data)) return\n return data.map(datum => _insert(datum, true, true, callback))\n }\n return _insert(data, true, true, callback);\n },\n remove (testFn) {\n q._tasks.remove(testFn);\n },\n process () {\n // Avoid trying to start too many processing operations. This can occur\n // when callbacks resolve synchronously (#1267).\n if (isProcessing) {\n return;\n }\n isProcessing = true;\n while(!q.paused && numRunning < q.concurrency && q._tasks.length){\n var tasks = [], data = [];\n var l = q._tasks.length;\n if (q.payload) l = Math.min(l, q.payload);\n for (var i = 0; i < l; i++) {\n var node = q._tasks.shift();\n tasks.push(node);\n workersList.push(node);\n data.push(node.data);\n }\n\n numRunning += 1;\n\n if (q._tasks.length === 0) {\n trigger('empty');\n }\n\n if (numRunning === q.concurrency) {\n trigger('saturated');\n }\n\n var cb = onlyOnce(_createCB(tasks));\n _worker(data, cb);\n }\n isProcessing = false;\n },\n length () {\n return q._tasks.length;\n },\n running () {\n return numRunning;\n },\n workersList () {\n return workersList;\n },\n idle() {\n return q._tasks.length + numRunning === 0;\n },\n pause () {\n q.paused = true;\n },\n resume () {\n if (q.paused === false) { return; }\n q.paused = false;\n setImmediate$1(q.process);\n }\n };\n // define these as fixed properties, so people get useful errors when updating\n Object.defineProperties(q, {\n saturated: {\n writable: false,\n value: eventMethod('saturated')\n },\n unsaturated: {\n writable: false,\n value: eventMethod('unsaturated')\n },\n empty: {\n writable: false,\n value: eventMethod('empty')\n },\n drain: {\n writable: false,\n value: eventMethod('drain')\n },\n error: {\n writable: false,\n value: eventMethod('error')\n },\n });\n return q;\n }\n\n /**\n * Creates a `cargo` object with the specified payload. Tasks added to the\n * cargo will be processed altogether (up to the `payload` limit). If the\n * `worker` is in progress, the task is queued until it becomes available. Once\n * the `worker` has completed some tasks, each callback of those tasks is\n * called. Check out [these](https://camo.githubusercontent.com/6bbd36f4cf5b35a0f11a96dcd2e97711ffc2fb37/68747470733a2f2f662e636c6f75642e6769746875622e636f6d2f6173736574732f313637363837312f36383130382f62626330636662302d356632392d313165322d393734662d3333393763363464633835382e676966) [animations](https://camo.githubusercontent.com/f4810e00e1c5f5f8addbe3e9f49064fd5d102699/68747470733a2f2f662e636c6f75642e6769746875622e636f6d2f6173736574732f313637363837312f36383130312f38346339323036362d356632392d313165322d383134662d3964336430323431336266642e676966)\n * for how `cargo` and `queue` work.\n *\n * While [`queue`]{@link module:ControlFlow.queue} passes only one task to one of a group of workers\n * at a time, cargo passes an array of tasks to a single worker, repeating\n * when the worker is finished.\n *\n * @name cargo\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.queue]{@link module:ControlFlow.queue}\n * @category Control Flow\n * @param {AsyncFunction} worker - An asynchronous function for processing an array\n * of queued tasks. Invoked with `(tasks, callback)`.\n * @param {number} [payload=Infinity] - An optional `integer` for determining\n * how many tasks should be processed per round; if omitted, the default is\n * unlimited.\n * @returns {module:ControlFlow.QueueObject} A cargo object to manage the tasks. Callbacks can\n * attached as certain properties to listen for specific events during the\n * lifecycle of the cargo and inner queue.\n * @example\n *\n * // create a cargo object with payload 2\n * var cargo = async.cargo(function(tasks, callback) {\n * for (var i=0; i {\n _iteratee(memo, x, (err, v) => {\n memo = v;\n iterCb(err);\n });\n }, err => callback(err, memo));\n }\n var reduce$1 = awaitify(reduce, 4);\n\n /**\n * Version of the compose function that is more natural to read. Each function\n * consumes the return value of the previous function. It is the equivalent of\n * [compose]{@link module:ControlFlow.compose} with the arguments reversed.\n *\n * Each function is executed with the `this` binding of the composed function.\n *\n * @name seq\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.compose]{@link module:ControlFlow.compose}\n * @category Control Flow\n * @param {...AsyncFunction} functions - the asynchronous functions to compose\n * @returns {Function} a function that composes the `functions` in order\n * @example\n *\n * // Requires lodash (or underscore), express3 and dresende's orm2.\n * // Part of an app, that fetches cats of the logged user.\n * // This example uses `seq` function to avoid overnesting and error\n * // handling clutter.\n * app.get('/cats', function(request, response) {\n * var User = request.models.User;\n * async.seq(\n * _.bind(User.get, User), // 'User.get' has signature (id, callback(err, data))\n * function(user, fn) {\n * user.getCats(fn); // 'getCats' has signature (callback(err, data))\n * }\n * )(req.session.user_id, function (err, cats) {\n * if (err) {\n * console.error(err);\n * response.json({ status: 'error', message: err.message });\n * } else {\n * response.json({ status: 'ok', message: 'Cats found', data: cats });\n * }\n * });\n * });\n */\n function seq(...functions) {\n var _functions = functions.map(wrapAsync);\n return function (...args) {\n var that = this;\n\n var cb = args[args.length - 1];\n if (typeof cb == 'function') {\n args.pop();\n } else {\n cb = promiseCallback();\n }\n\n reduce$1(_functions, args, (newargs, fn, iterCb) => {\n fn.apply(that, newargs.concat((err, ...nextargs) => {\n iterCb(err, nextargs);\n }));\n },\n (err, results) => cb(err, ...results));\n\n return cb[PROMISE_SYMBOL]\n };\n }\n\n /**\n * Creates a function which is a composition of the passed asynchronous\n * functions. Each function consumes the return value of the function that\n * follows. Composing functions `f()`, `g()`, and `h()` would produce the result\n * of `f(g(h()))`, only this version uses callbacks to obtain the return values.\n *\n * If the last argument to the composed function is not a function, a promise\n * is returned when you call it.\n *\n * Each function is executed with the `this` binding of the composed function.\n *\n * @name compose\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @param {...AsyncFunction} functions - the asynchronous functions to compose\n * @returns {Function} an asynchronous function that is the composed\n * asynchronous `functions`\n * @example\n *\n * function add1(n, callback) {\n * setTimeout(function () {\n * callback(null, n + 1);\n * }, 10);\n * }\n *\n * function mul3(n, callback) {\n * setTimeout(function () {\n * callback(null, n * 3);\n * }, 10);\n * }\n *\n * var add1mul3 = async.compose(mul3, add1);\n * add1mul3(4, function (err, result) {\n * // result now equals 15\n * });\n */\n function compose(...args) {\n return seq(...args.reverse());\n }\n\n /**\n * The same as [`map`]{@link module:Collections.map} but runs a maximum of `limit` async operations at a time.\n *\n * @name mapLimit\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.map]{@link module:Collections.map}\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {AsyncFunction} iteratee - An async function to apply to each item in\n * `coll`.\n * The iteratee should complete with the transformed item.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called when all `iteratee`\n * functions have finished, or an error occurs. Results is an array of the\n * transformed items from the `coll`. Invoked with (err, results).\n * @returns {Promise} a promise, if no callback is passed\n */\n function mapLimit (coll, limit, iteratee, callback) {\n return _asyncMap(eachOfLimit(limit), coll, iteratee, callback)\n }\n var mapLimit$1 = awaitify(mapLimit, 4);\n\n /**\n * The same as [`concat`]{@link module:Collections.concat} but runs a maximum of `limit` async operations at a time.\n *\n * @name concatLimit\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.concat]{@link module:Collections.concat}\n * @category Collection\n * @alias flatMapLimit\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {AsyncFunction} iteratee - A function to apply to each item in `coll`,\n * which should use an array as its result. Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished, or an error occurs. Results is an array\n * containing the concatenated results of the `iteratee` function. Invoked with\n * (err, results).\n * @returns A Promise, if no callback is passed\n */\n function concatLimit(coll, limit, iteratee, callback) {\n var _iteratee = wrapAsync(iteratee);\n return mapLimit$1(coll, limit, (val, iterCb) => {\n _iteratee(val, (err, ...args) => {\n if (err) return iterCb(err);\n return iterCb(err, args);\n });\n }, (err, mapResults) => {\n var result = [];\n for (var i = 0; i < mapResults.length; i++) {\n if (mapResults[i]) {\n result = result.concat(...mapResults[i]);\n }\n }\n\n return callback(err, result);\n });\n }\n var concatLimit$1 = awaitify(concatLimit, 4);\n\n /**\n * Applies `iteratee` to each item in `coll`, concatenating the results. Returns\n * the concatenated list. The `iteratee`s are called in parallel, and the\n * results are concatenated as they return. The results array will be returned in\n * the original order of `coll` passed to the `iteratee` function.\n *\n * @name concat\n * @static\n * @memberOf module:Collections\n * @method\n * @category Collection\n * @alias flatMap\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - A function to apply to each item in `coll`,\n * which should use an array as its result. Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished, or an error occurs. Results is an array\n * containing the concatenated results of the `iteratee` function. Invoked with\n * (err, results).\n * @returns A Promise, if no callback is passed\n * @example\n *\n * async.concat(['dir1','dir2','dir3'], fs.readdir, function(err, files) {\n * // files is now a list of filenames that exist in the 3 directories\n * });\n */\n function concat(coll, iteratee, callback) {\n return concatLimit$1(coll, Infinity, iteratee, callback)\n }\n var concat$1 = awaitify(concat, 3);\n\n /**\n * The same as [`concat`]{@link module:Collections.concat} but runs only a single async operation at a time.\n *\n * @name concatSeries\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.concat]{@link module:Collections.concat}\n * @category Collection\n * @alias flatMapSeries\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - A function to apply to each item in `coll`.\n * The iteratee should complete with an array an array of results.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished, or an error occurs. Results is an array\n * containing the concatenated results of the `iteratee` function. Invoked with\n * (err, results).\n * @returns A Promise, if no callback is passed\n */\n function concatSeries(coll, iteratee, callback) {\n return concatLimit$1(coll, 1, iteratee, callback)\n }\n var concatSeries$1 = awaitify(concatSeries, 3);\n\n /**\n * Returns a function that when called, calls-back with the values provided.\n * Useful as the first function in a [`waterfall`]{@link module:ControlFlow.waterfall}, or for plugging values in to\n * [`auto`]{@link module:ControlFlow.auto}.\n *\n * @name constant\n * @static\n * @memberOf module:Utils\n * @method\n * @category Util\n * @param {...*} arguments... - Any number of arguments to automatically invoke\n * callback with.\n * @returns {AsyncFunction} Returns a function that when invoked, automatically\n * invokes the callback with the previous given arguments.\n * @example\n *\n * async.waterfall([\n * async.constant(42),\n * function (value, next) {\n * // value === 42\n * },\n * //...\n * ], callback);\n *\n * async.waterfall([\n * async.constant(filename, \"utf8\"),\n * fs.readFile,\n * function (fileData, next) {\n * //...\n * }\n * //...\n * ], callback);\n *\n * async.auto({\n * hostname: async.constant(\"https://server.net/\"),\n * port: findFreePort,\n * launchServer: [\"hostname\", \"port\", function (options, cb) {\n * startServer(options, cb);\n * }],\n * //...\n * }, callback);\n */\n function constant(...args) {\n return function (...ignoredArgs/*, callback*/) {\n var callback = ignoredArgs.pop();\n return callback(null, ...args);\n };\n }\n\n function _createTester(check, getResult) {\n return (eachfn, arr, _iteratee, cb) => {\n var testPassed = false;\n var testResult;\n const iteratee = wrapAsync(_iteratee);\n eachfn(arr, (value, _, callback) => {\n iteratee(value, (err, result) => {\n if (err || err === false) return callback(err);\n\n if (check(result) && !testResult) {\n testPassed = true;\n testResult = getResult(true, value);\n return callback(null, breakLoop);\n }\n callback();\n });\n }, err => {\n if (err) return cb(err);\n cb(null, testPassed ? testResult : getResult(false));\n });\n };\n }\n\n /**\n * Returns the first value in `coll` that passes an async truth test. The\n * `iteratee` is applied in parallel, meaning the first iteratee to return\n * `true` will fire the detect `callback` with that result. That means the\n * result might not be the first item in the original `coll` (in terms of order)\n * that passes the test.\n\n * If order within the original `coll` is important, then look at\n * [`detectSeries`]{@link module:Collections.detectSeries}.\n *\n * @name detect\n * @static\n * @memberOf module:Collections\n * @method\n * @alias find\n * @category Collections\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - A truth test to apply to each item in `coll`.\n * The iteratee must complete with a boolean value as its result.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called as soon as any\n * iteratee returns `true`, or after all the `iteratee` functions have finished.\n * Result will be the first item in the array that passes the truth test\n * (iteratee) or the value `undefined` if none passed. Invoked with\n * (err, result).\n * @returns A Promise, if no callback is passed\n * @example\n *\n * async.detect(['file1','file2','file3'], function(filePath, callback) {\n * fs.access(filePath, function(err) {\n * callback(null, !err)\n * });\n * }, function(err, result) {\n * // result now equals the first file in the list that exists\n * });\n */\n function detect(coll, iteratee, callback) {\n return _createTester(bool => bool, (res, item) => item)(eachOf$1, coll, iteratee, callback)\n }\n var detect$1 = awaitify(detect, 3);\n\n /**\n * The same as [`detect`]{@link module:Collections.detect} but runs a maximum of `limit` async operations at a\n * time.\n *\n * @name detectLimit\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.detect]{@link module:Collections.detect}\n * @alias findLimit\n * @category Collections\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {AsyncFunction} iteratee - A truth test to apply to each item in `coll`.\n * The iteratee must complete with a boolean value as its result.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called as soon as any\n * iteratee returns `true`, or after all the `iteratee` functions have finished.\n * Result will be the first item in the array that passes the truth test\n * (iteratee) or the value `undefined` if none passed. Invoked with\n * (err, result).\n * @returns a Promise if no callback is passed\n */\n function detectLimit(coll, limit, iteratee, callback) {\n return _createTester(bool => bool, (res, item) => item)(eachOfLimit(limit), coll, iteratee, callback)\n }\n var detectLimit$1 = awaitify(detectLimit, 4);\n\n /**\n * The same as [`detect`]{@link module:Collections.detect} but runs only a single async operation at a time.\n *\n * @name detectSeries\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.detect]{@link module:Collections.detect}\n * @alias findSeries\n * @category Collections\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - A truth test to apply to each item in `coll`.\n * The iteratee must complete with a boolean value as its result.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called as soon as any\n * iteratee returns `true`, or after all the `iteratee` functions have finished.\n * Result will be the first item in the array that passes the truth test\n * (iteratee) or the value `undefined` if none passed. Invoked with\n * (err, result).\n * @returns a Promise if no callback is passed\n */\n function detectSeries(coll, iteratee, callback) {\n return _createTester(bool => bool, (res, item) => item)(eachOfLimit(1), coll, iteratee, callback)\n }\n\n var detectSeries$1 = awaitify(detectSeries, 3);\n\n function consoleFunc(name) {\n return (fn, ...args) => wrapAsync(fn)(...args, (err, ...resultArgs) => {\n if (typeof console === 'object') {\n if (err) {\n if (console.error) {\n console.error(err);\n }\n } else if (console[name]) {\n resultArgs.forEach(x => console[name](x));\n }\n }\n })\n }\n\n /**\n * Logs the result of an [`async` function]{@link AsyncFunction} to the\n * `console` using `console.dir` to display the properties of the resulting object.\n * Only works in Node.js or in browsers that support `console.dir` and\n * `console.error` (such as FF and Chrome).\n * If multiple arguments are returned from the async function,\n * `console.dir` is called on each argument in order.\n *\n * @name dir\n * @static\n * @memberOf module:Utils\n * @method\n * @category Util\n * @param {AsyncFunction} function - The function you want to eventually apply\n * all arguments to.\n * @param {...*} arguments... - Any number of arguments to apply to the function.\n * @example\n *\n * // in a module\n * var hello = function(name, callback) {\n * setTimeout(function() {\n * callback(null, {hello: name});\n * }, 1000);\n * };\n *\n * // in the node repl\n * node> async.dir(hello, 'world');\n * {hello: 'world'}\n */\n var dir = consoleFunc('dir');\n\n /**\n * The post-check version of [`whilst`]{@link module:ControlFlow.whilst}. To reflect the difference in\n * the order of operations, the arguments `test` and `iteratee` are switched.\n *\n * `doWhilst` is to `whilst` as `do while` is to `while` in plain JavaScript.\n *\n * @name doWhilst\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.whilst]{@link module:ControlFlow.whilst}\n * @category Control Flow\n * @param {AsyncFunction} iteratee - A function which is called each time `test`\n * passes. Invoked with (callback).\n * @param {AsyncFunction} test - asynchronous truth test to perform after each\n * execution of `iteratee`. Invoked with (...args, callback), where `...args` are the\n * non-error args from the previous callback of `iteratee`.\n * @param {Function} [callback] - A callback which is called after the test\n * function has failed and repeated execution of `iteratee` has stopped.\n * `callback` will be passed an error and any arguments passed to the final\n * `iteratee`'s callback. Invoked with (err, [results]);\n * @returns {Promise} a promise, if no callback is passed\n */\n function doWhilst(iteratee, test, callback) {\n callback = onlyOnce(callback);\n var _fn = wrapAsync(iteratee);\n var _test = wrapAsync(test);\n var results;\n\n function next(err, ...args) {\n if (err) return callback(err);\n if (err === false) return;\n results = args;\n _test(...args, check);\n }\n\n function check(err, truth) {\n if (err) return callback(err);\n if (err === false) return;\n if (!truth) return callback(null, ...results);\n _fn(next);\n }\n\n return check(null, true);\n }\n\n var doWhilst$1 = awaitify(doWhilst, 3);\n\n /**\n * Like ['doWhilst']{@link module:ControlFlow.doWhilst}, except the `test` is inverted. Note the\n * argument ordering differs from `until`.\n *\n * @name doUntil\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.doWhilst]{@link module:ControlFlow.doWhilst}\n * @category Control Flow\n * @param {AsyncFunction} iteratee - An async function which is called each time\n * `test` fails. Invoked with (callback).\n * @param {AsyncFunction} test - asynchronous truth test to perform after each\n * execution of `iteratee`. Invoked with (...args, callback), where `...args` are the\n * non-error args from the previous callback of `iteratee`\n * @param {Function} [callback] - A callback which is called after the test\n * function has passed and repeated execution of `iteratee` has stopped. `callback`\n * will be passed an error and any arguments passed to the final `iteratee`'s\n * callback. Invoked with (err, [results]);\n * @returns {Promise} a promise, if no callback is passed\n */\n function doUntil(iteratee, test, callback) {\n const _test = wrapAsync(test);\n return doWhilst$1(iteratee, (...args) => {\n const cb = args.pop();\n _test(...args, (err, truth) => cb (err, !truth));\n }, callback);\n }\n\n function _withoutIndex(iteratee) {\n return (value, index, callback) => iteratee(value, callback);\n }\n\n /**\n * Applies the function `iteratee` to each item in `coll`, in parallel.\n * The `iteratee` is called with an item from the list, and a callback for when\n * it has finished. If the `iteratee` passes an error to its `callback`, the\n * main `callback` (for the `each` function) is immediately called with the\n * error.\n *\n * Note, that since this function applies `iteratee` to each item in parallel,\n * there is no guarantee that the iteratee functions will complete in order.\n *\n * @name each\n * @static\n * @memberOf module:Collections\n * @method\n * @alias forEach\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async function to apply to\n * each item in `coll`. Invoked with (item, callback).\n * The array index is not passed to the iteratee.\n * If you need the index, use `eachOf`.\n * @param {Function} [callback] - A callback which is called when all\n * `iteratee` functions have finished, or an error occurs. Invoked with (err).\n * @returns {Promise} a promise, if a callback is omitted\n * @example\n *\n * // assuming openFiles is an array of file names and saveFile is a function\n * // to save the modified contents of that file:\n *\n * async.each(openFiles, saveFile, function(err){\n * // if any of the saves produced an error, err would equal that error\n * });\n *\n * // assuming openFiles is an array of file names\n * async.each(openFiles, function(file, callback) {\n *\n * // Perform operation on file here.\n * console.log('Processing file ' + file);\n *\n * if( file.length > 32 ) {\n * console.log('This file name is too long');\n * callback('File name too long');\n * } else {\n * // Do work to process file here\n * console.log('File processed');\n * callback();\n * }\n * }, function(err) {\n * // if any of the file processing produced an error, err would equal that error\n * if( err ) {\n * // One of the iterations produced an error.\n * // All processing will now stop.\n * console.log('A file failed to process');\n * } else {\n * console.log('All files have been processed successfully');\n * }\n * });\n */\n function eachLimit(coll, iteratee, callback) {\n return eachOf$1(coll, _withoutIndex(wrapAsync(iteratee)), callback);\n }\n\n var each = awaitify(eachLimit, 3);\n\n /**\n * The same as [`each`]{@link module:Collections.each} but runs a maximum of `limit` async operations at a time.\n *\n * @name eachLimit\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.each]{@link module:Collections.each}\n * @alias forEachLimit\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {AsyncFunction} iteratee - An async function to apply to each item in\n * `coll`.\n * The array index is not passed to the iteratee.\n * If you need the index, use `eachOfLimit`.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called when all\n * `iteratee` functions have finished, or an error occurs. Invoked with (err).\n * @returns {Promise} a promise, if a callback is omitted\n */\n function eachLimit$1(coll, limit, iteratee, callback) {\n return eachOfLimit(limit)(coll, _withoutIndex(wrapAsync(iteratee)), callback);\n }\n var eachLimit$2 = awaitify(eachLimit$1, 4);\n\n /**\n * The same as [`each`]{@link module:Collections.each} but runs only a single async operation at a time.\n *\n * Note, that unlike [`each`]{@link module:Collections.each}, this function applies iteratee to each item\n * in series and therefore the iteratee functions will complete in order.\n\n * @name eachSeries\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.each]{@link module:Collections.each}\n * @alias forEachSeries\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async function to apply to each\n * item in `coll`.\n * The array index is not passed to the iteratee.\n * If you need the index, use `eachOfSeries`.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called when all\n * `iteratee` functions have finished, or an error occurs. Invoked with (err).\n * @returns {Promise} a promise, if a callback is omitted\n */\n function eachSeries(coll, iteratee, callback) {\n return eachLimit$2(coll, 1, iteratee, callback)\n }\n var eachSeries$1 = awaitify(eachSeries, 3);\n\n /**\n * Wrap an async function and ensure it calls its callback on a later tick of\n * the event loop. If the function already calls its callback on a next tick,\n * no extra deferral is added. This is useful for preventing stack overflows\n * (`RangeError: Maximum call stack size exceeded`) and generally keeping\n * [Zalgo](http://blog.izs.me/post/59142742143/designing-apis-for-asynchrony)\n * contained. ES2017 `async` functions are returned as-is -- they are immune\n * to Zalgo's corrupting influences, as they always resolve on a later tick.\n *\n * @name ensureAsync\n * @static\n * @memberOf module:Utils\n * @method\n * @category Util\n * @param {AsyncFunction} fn - an async function, one that expects a node-style\n * callback as its last argument.\n * @returns {AsyncFunction} Returns a wrapped function with the exact same call\n * signature as the function passed in.\n * @example\n *\n * function sometimesAsync(arg, callback) {\n * if (cache[arg]) {\n * return callback(null, cache[arg]); // this would be synchronous!!\n * } else {\n * doSomeIO(arg, callback); // this IO would be asynchronous\n * }\n * }\n *\n * // this has a risk of stack overflows if many results are cached in a row\n * async.mapSeries(args, sometimesAsync, done);\n *\n * // this will defer sometimesAsync's callback if necessary,\n * // preventing stack overflows\n * async.mapSeries(args, async.ensureAsync(sometimesAsync), done);\n */\n function ensureAsync(fn) {\n if (isAsync(fn)) return fn;\n return function (...args/*, callback*/) {\n var callback = args.pop();\n var sync = true;\n args.push((...innerArgs) => {\n if (sync) {\n setImmediate$1(() => callback(...innerArgs));\n } else {\n callback(...innerArgs);\n }\n });\n fn.apply(this, args);\n sync = false;\n };\n }\n\n /**\n * Returns `true` if every element in `coll` satisfies an async test. If any\n * iteratee call returns `false`, the main `callback` is immediately called.\n *\n * @name every\n * @static\n * @memberOf module:Collections\n * @method\n * @alias all\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async truth test to apply to each item\n * in the collection in parallel.\n * The iteratee must complete with a boolean result value.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished. Result will be either `true` or `false`\n * depending on the values of the async tests. Invoked with (err, result).\n * @returns {Promise} a promise, if no callback provided\n * @example\n *\n * async.every(['file1','file2','file3'], function(filePath, callback) {\n * fs.access(filePath, function(err) {\n * callback(null, !err)\n * });\n * }, function(err, result) {\n * // if result is true then every file exists\n * });\n */\n function every(coll, iteratee, callback) {\n return _createTester(bool => !bool, res => !res)(eachOf$1, coll, iteratee, callback)\n }\n var every$1 = awaitify(every, 3);\n\n /**\n * The same as [`every`]{@link module:Collections.every} but runs a maximum of `limit` async operations at a time.\n *\n * @name everyLimit\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.every]{@link module:Collections.every}\n * @alias allLimit\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {AsyncFunction} iteratee - An async truth test to apply to each item\n * in the collection in parallel.\n * The iteratee must complete with a boolean result value.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished. Result will be either `true` or `false`\n * depending on the values of the async tests. Invoked with (err, result).\n * @returns {Promise} a promise, if no callback provided\n */\n function everyLimit(coll, limit, iteratee, callback) {\n return _createTester(bool => !bool, res => !res)(eachOfLimit(limit), coll, iteratee, callback)\n }\n var everyLimit$1 = awaitify(everyLimit, 4);\n\n /**\n * The same as [`every`]{@link module:Collections.every} but runs only a single async operation at a time.\n *\n * @name everySeries\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.every]{@link module:Collections.every}\n * @alias allSeries\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async truth test to apply to each item\n * in the collection in series.\n * The iteratee must complete with a boolean result value.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished. Result will be either `true` or `false`\n * depending on the values of the async tests. Invoked with (err, result).\n * @returns {Promise} a promise, if no callback provided\n */\n function everySeries(coll, iteratee, callback) {\n return _createTester(bool => !bool, res => !res)(eachOfSeries$1, coll, iteratee, callback)\n }\n var everySeries$1 = awaitify(everySeries, 3);\n\n function filterArray(eachfn, arr, iteratee, callback) {\n var truthValues = new Array(arr.length);\n eachfn(arr, (x, index, iterCb) => {\n iteratee(x, (err, v) => {\n truthValues[index] = !!v;\n iterCb(err);\n });\n }, err => {\n if (err) return callback(err);\n var results = [];\n for (var i = 0; i < arr.length; i++) {\n if (truthValues[i]) results.push(arr[i]);\n }\n callback(null, results);\n });\n }\n\n function filterGeneric(eachfn, coll, iteratee, callback) {\n var results = [];\n eachfn(coll, (x, index, iterCb) => {\n iteratee(x, (err, v) => {\n if (err) return iterCb(err);\n if (v) {\n results.push({index, value: x});\n }\n iterCb(err);\n });\n }, err => {\n if (err) return callback(err);\n callback(null, results\n .sort((a, b) => a.index - b.index)\n .map(v => v.value));\n });\n }\n\n function _filter(eachfn, coll, iteratee, callback) {\n var filter = isArrayLike(coll) ? filterArray : filterGeneric;\n return filter(eachfn, coll, wrapAsync(iteratee), callback);\n }\n\n /**\n * Returns a new array of all the values in `coll` which pass an async truth\n * test. This operation is performed in parallel, but the results array will be\n * in the same order as the original.\n *\n * @name filter\n * @static\n * @memberOf module:Collections\n * @method\n * @alias select\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {Function} iteratee - A truth test to apply to each item in `coll`.\n * The `iteratee` is passed a `callback(err, truthValue)`, which must be called\n * with a boolean argument once it has completed. Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished. Invoked with (err, results).\n * @returns {Promise} a promise, if no callback provided\n * @example\n *\n * async.filter(['file1','file2','file3'], function(filePath, callback) {\n * fs.access(filePath, function(err) {\n * callback(null, !err)\n * });\n * }, function(err, results) {\n * // results now equals an array of the existing files\n * });\n */\n function filter (coll, iteratee, callback) {\n return _filter(eachOf$1, coll, iteratee, callback)\n }\n var filter$1 = awaitify(filter, 3);\n\n /**\n * The same as [`filter`]{@link module:Collections.filter} but runs a maximum of `limit` async operations at a\n * time.\n *\n * @name filterLimit\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.filter]{@link module:Collections.filter}\n * @alias selectLimit\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {Function} iteratee - A truth test to apply to each item in `coll`.\n * The `iteratee` is passed a `callback(err, truthValue)`, which must be called\n * with a boolean argument once it has completed. Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished. Invoked with (err, results).\n * @returns {Promise} a promise, if no callback provided\n */\n function filterLimit (coll, limit, iteratee, callback) {\n return _filter(eachOfLimit(limit), coll, iteratee, callback)\n }\n var filterLimit$1 = awaitify(filterLimit, 4);\n\n /**\n * The same as [`filter`]{@link module:Collections.filter} but runs only a single async operation at a time.\n *\n * @name filterSeries\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.filter]{@link module:Collections.filter}\n * @alias selectSeries\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {Function} iteratee - A truth test to apply to each item in `coll`.\n * The `iteratee` is passed a `callback(err, truthValue)`, which must be called\n * with a boolean argument once it has completed. Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished. Invoked with (err, results)\n * @returns {Promise} a promise, if no callback provided\n */\n function filterSeries (coll, iteratee, callback) {\n return _filter(eachOfSeries$1, coll, iteratee, callback)\n }\n var filterSeries$1 = awaitify(filterSeries, 3);\n\n /**\n * Calls the asynchronous function `fn` with a callback parameter that allows it\n * to call itself again, in series, indefinitely.\n\n * If an error is passed to the callback then `errback` is called with the\n * error, and execution stops, otherwise it will never be called.\n *\n * @name forever\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @param {AsyncFunction} fn - an async function to call repeatedly.\n * Invoked with (next).\n * @param {Function} [errback] - when `fn` passes an error to it's callback,\n * this function will be called, and execution stops. Invoked with (err).\n * @returns {Promise} a promise that rejects if an error occurs and an errback\n * is not passed\n * @example\n *\n * async.forever(\n * function(next) {\n * // next is suitable for passing to things that need a callback(err [, whatever]);\n * // it will result in this function being called again.\n * },\n * function(err) {\n * // if next is called with a value in its first parameter, it will appear\n * // in here as 'err', and execution will stop.\n * }\n * );\n */\n function forever(fn, errback) {\n var done = onlyOnce(errback);\n var task = wrapAsync(ensureAsync(fn));\n\n function next(err) {\n if (err) return done(err);\n if (err === false) return;\n task(next);\n }\n return next();\n }\n var forever$1 = awaitify(forever, 2);\n\n /**\n * The same as [`groupBy`]{@link module:Collections.groupBy} but runs a maximum of `limit` async operations at a time.\n *\n * @name groupByLimit\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.groupBy]{@link module:Collections.groupBy}\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {AsyncFunction} iteratee - An async function to apply to each item in\n * `coll`.\n * The iteratee should complete with a `key` to group the value under.\n * Invoked with (value, callback).\n * @param {Function} [callback] - A callback which is called when all `iteratee`\n * functions have finished, or an error occurs. Result is an `Object` whoses\n * properties are arrays of values which returned the corresponding key.\n * @returns {Promise} a promise, if no callback is passed\n */\n function groupByLimit(coll, limit, iteratee, callback) {\n var _iteratee = wrapAsync(iteratee);\n return mapLimit$1(coll, limit, (val, iterCb) => {\n _iteratee(val, (err, key) => {\n if (err) return iterCb(err);\n return iterCb(err, {key, val});\n });\n }, (err, mapResults) => {\n var result = {};\n // from MDN, handle object having an `hasOwnProperty` prop\n var {hasOwnProperty} = Object.prototype;\n\n for (var i = 0; i < mapResults.length; i++) {\n if (mapResults[i]) {\n var {key} = mapResults[i];\n var {val} = mapResults[i];\n\n if (hasOwnProperty.call(result, key)) {\n result[key].push(val);\n } else {\n result[key] = [val];\n }\n }\n }\n\n return callback(err, result);\n });\n }\n\n var groupByLimit$1 = awaitify(groupByLimit, 4);\n\n /**\n * Returns a new object, where each value corresponds to an array of items, from\n * `coll`, that returned the corresponding key. That is, the keys of the object\n * correspond to the values passed to the `iteratee` callback.\n *\n * Note: Since this function applies the `iteratee` to each item in parallel,\n * there is no guarantee that the `iteratee` functions will complete in order.\n * However, the values for each key in the `result` will be in the same order as\n * the original `coll`. For Objects, the values will roughly be in the order of\n * the original Objects' keys (but this can vary across JavaScript engines).\n *\n * @name groupBy\n * @static\n * @memberOf module:Collections\n * @method\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async function to apply to each item in\n * `coll`.\n * The iteratee should complete with a `key` to group the value under.\n * Invoked with (value, callback).\n * @param {Function} [callback] - A callback which is called when all `iteratee`\n * functions have finished, or an error occurs. Result is an `Object` whoses\n * properties are arrays of values which returned the corresponding key.\n * @returns {Promise} a promise, if no callback is passed\n * @example\n *\n * async.groupBy(['userId1', 'userId2', 'userId3'], function(userId, callback) {\n * db.findById(userId, function(err, user) {\n * if (err) return callback(err);\n * return callback(null, user.age);\n * });\n * }, function(err, result) {\n * // result is object containing the userIds grouped by age\n * // e.g. { 30: ['userId1', 'userId3'], 42: ['userId2']};\n * });\n */\n function groupBy (coll, iteratee, callback) {\n return groupByLimit$1(coll, Infinity, iteratee, callback)\n }\n\n /**\n * The same as [`groupBy`]{@link module:Collections.groupBy} but runs only a single async operation at a time.\n *\n * @name groupBySeries\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.groupBy]{@link module:Collections.groupBy}\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async function to apply to each item in\n * `coll`.\n * The iteratee should complete with a `key` to group the value under.\n * Invoked with (value, callback).\n * @param {Function} [callback] - A callback which is called when all `iteratee`\n * functions have finished, or an error occurs. Result is an `Object` whoses\n * properties are arrays of values which returned the corresponding key.\n * @returns {Promise} a promise, if no callback is passed\n */\n function groupBySeries (coll, iteratee, callback) {\n return groupByLimit$1(coll, 1, iteratee, callback)\n }\n\n /**\n * Logs the result of an `async` function to the `console`. Only works in\n * Node.js or in browsers that support `console.log` and `console.error` (such\n * as FF and Chrome). If multiple arguments are returned from the async\n * function, `console.log` is called on each argument in order.\n *\n * @name log\n * @static\n * @memberOf module:Utils\n * @method\n * @category Util\n * @param {AsyncFunction} function - The function you want to eventually apply\n * all arguments to.\n * @param {...*} arguments... - Any number of arguments to apply to the function.\n * @example\n *\n * // in a module\n * var hello = function(name, callback) {\n * setTimeout(function() {\n * callback(null, 'hello ' + name);\n * }, 1000);\n * };\n *\n * // in the node repl\n * node> async.log(hello, 'world');\n * 'hello world'\n */\n var log = consoleFunc('log');\n\n /**\n * The same as [`mapValues`]{@link module:Collections.mapValues} but runs a maximum of `limit` async operations at a\n * time.\n *\n * @name mapValuesLimit\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.mapValues]{@link module:Collections.mapValues}\n * @category Collection\n * @param {Object} obj - A collection to iterate over.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {AsyncFunction} iteratee - A function to apply to each value and key\n * in `coll`.\n * The iteratee should complete with the transformed value as its result.\n * Invoked with (value, key, callback).\n * @param {Function} [callback] - A callback which is called when all `iteratee`\n * functions have finished, or an error occurs. `result` is a new object consisting\n * of each key from `obj`, with each transformed value on the right-hand side.\n * Invoked with (err, result).\n * @returns {Promise} a promise, if no callback is passed\n */\n function mapValuesLimit(obj, limit, iteratee, callback) {\n callback = once(callback);\n var newObj = {};\n var _iteratee = wrapAsync(iteratee);\n return eachOfLimit(limit)(obj, (val, key, next) => {\n _iteratee(val, key, (err, result) => {\n if (err) return next(err);\n newObj[key] = result;\n next(err);\n });\n }, err => callback(err, newObj));\n }\n\n var mapValuesLimit$1 = awaitify(mapValuesLimit, 4);\n\n /**\n * A relative of [`map`]{@link module:Collections.map}, designed for use with objects.\n *\n * Produces a new Object by mapping each value of `obj` through the `iteratee`\n * function. The `iteratee` is called each `value` and `key` from `obj` and a\n * callback for when it has finished processing. Each of these callbacks takes\n * two arguments: an `error`, and the transformed item from `obj`. If `iteratee`\n * passes an error to its callback, the main `callback` (for the `mapValues`\n * function) is immediately called with the error.\n *\n * Note, the order of the keys in the result is not guaranteed. The keys will\n * be roughly in the order they complete, (but this is very engine-specific)\n *\n * @name mapValues\n * @static\n * @memberOf module:Collections\n * @method\n * @category Collection\n * @param {Object} obj - A collection to iterate over.\n * @param {AsyncFunction} iteratee - A function to apply to each value and key\n * in `coll`.\n * The iteratee should complete with the transformed value as its result.\n * Invoked with (value, key, callback).\n * @param {Function} [callback] - A callback which is called when all `iteratee`\n * functions have finished, or an error occurs. `result` is a new object consisting\n * of each key from `obj`, with each transformed value on the right-hand side.\n * Invoked with (err, result).\n * @returns {Promise} a promise, if no callback is passed\n * @example\n *\n * async.mapValues({\n * f1: 'file1',\n * f2: 'file2',\n * f3: 'file3'\n * }, function (file, key, callback) {\n * fs.stat(file, callback);\n * }, function(err, result) {\n * // result is now a map of stats for each file, e.g.\n * // {\n * // f1: [stats for file1],\n * // f2: [stats for file2],\n * // f3: [stats for file3]\n * // }\n * });\n */\n function mapValues(obj, iteratee, callback) {\n return mapValuesLimit$1(obj, Infinity, iteratee, callback)\n }\n\n /**\n * The same as [`mapValues`]{@link module:Collections.mapValues} but runs only a single async operation at a time.\n *\n * @name mapValuesSeries\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.mapValues]{@link module:Collections.mapValues}\n * @category Collection\n * @param {Object} obj - A collection to iterate over.\n * @param {AsyncFunction} iteratee - A function to apply to each value and key\n * in `coll`.\n * The iteratee should complete with the transformed value as its result.\n * Invoked with (value, key, callback).\n * @param {Function} [callback] - A callback which is called when all `iteratee`\n * functions have finished, or an error occurs. `result` is a new object consisting\n * of each key from `obj`, with each transformed value on the right-hand side.\n * Invoked with (err, result).\n * @returns {Promise} a promise, if no callback is passed\n */\n function mapValuesSeries(obj, iteratee, callback) {\n return mapValuesLimit$1(obj, 1, iteratee, callback)\n }\n\n /**\n * Caches the results of an async function. When creating a hash to store\n * function results against, the callback is omitted from the hash and an\n * optional hash function can be used.\n *\n * **Note: if the async function errs, the result will not be cached and\n * subsequent calls will call the wrapped function.**\n *\n * If no hash function is specified, the first argument is used as a hash key,\n * which may work reasonably if it is a string or a data type that converts to a\n * distinct string. Note that objects and arrays will not behave reasonably.\n * Neither will cases where the other arguments are significant. In such cases,\n * specify your own hash function.\n *\n * The cache of results is exposed as the `memo` property of the function\n * returned by `memoize`.\n *\n * @name memoize\n * @static\n * @memberOf module:Utils\n * @method\n * @category Util\n * @param {AsyncFunction} fn - The async function to proxy and cache results from.\n * @param {Function} hasher - An optional function for generating a custom hash\n * for storing results. It has all the arguments applied to it apart from the\n * callback, and must be synchronous.\n * @returns {AsyncFunction} a memoized version of `fn`\n * @example\n *\n * var slow_fn = function(name, callback) {\n * // do something\n * callback(null, result);\n * };\n * var fn = async.memoize(slow_fn);\n *\n * // fn can now be used as if it were slow_fn\n * fn('some name', function() {\n * // callback\n * });\n */\n function memoize(fn, hasher = v => v) {\n var memo = Object.create(null);\n var queues = Object.create(null);\n var _fn = wrapAsync(fn);\n var memoized = initialParams((args, callback) => {\n var key = hasher(...args);\n if (key in memo) {\n setImmediate$1(() => callback(null, ...memo[key]));\n } else if (key in queues) {\n queues[key].push(callback);\n } else {\n queues[key] = [callback];\n _fn(...args, (err, ...resultArgs) => {\n // #1465 don't memoize if an error occurred\n if (!err) {\n memo[key] = resultArgs;\n }\n var q = queues[key];\n delete queues[key];\n for (var i = 0, l = q.length; i < l; i++) {\n q[i](err, ...resultArgs);\n }\n });\n }\n });\n memoized.memo = memo;\n memoized.unmemoized = fn;\n return memoized;\n }\n\n /**\n * Calls `callback` on a later loop around the event loop. In Node.js this just\n * calls `process.nextTick`. In the browser it will use `setImmediate` if\n * available, otherwise `setTimeout(callback, 0)`, which means other higher\n * priority events may precede the execution of `callback`.\n *\n * This is used internally for browser-compatibility purposes.\n *\n * @name nextTick\n * @static\n * @memberOf module:Utils\n * @method\n * @see [async.setImmediate]{@link module:Utils.setImmediate}\n * @category Util\n * @param {Function} callback - The function to call on a later loop around\n * the event loop. Invoked with (args...).\n * @param {...*} args... - any number of additional arguments to pass to the\n * callback on the next tick.\n * @example\n *\n * var call_order = [];\n * async.nextTick(function() {\n * call_order.push('two');\n * // call_order now equals ['one','two']\n * });\n * call_order.push('one');\n *\n * async.setImmediate(function (a, b, c) {\n * // a, b, and c equal 1, 2, and 3\n * }, 1, 2, 3);\n */\n var _defer$1;\n\n if (hasNextTick) {\n _defer$1 = process.nextTick;\n } else if (hasSetImmediate) {\n _defer$1 = setImmediate;\n } else {\n _defer$1 = fallback;\n }\n\n var nextTick = wrap(_defer$1);\n\n var parallel = awaitify((eachfn, tasks, callback) => {\n var results = isArrayLike(tasks) ? [] : {};\n\n eachfn(tasks, (task, key, taskCb) => {\n wrapAsync(task)((err, ...result) => {\n if (result.length < 2) {\n [result] = result;\n }\n results[key] = result;\n taskCb(err);\n });\n }, err => callback(err, results));\n }, 3);\n\n /**\n * Run the `tasks` collection of functions in parallel, without waiting until\n * the previous function has completed. If any of the functions pass an error to\n * its callback, the main `callback` is immediately called with the value of the\n * error. Once the `tasks` have completed, the results are passed to the final\n * `callback` as an array.\n *\n * **Note:** `parallel` is about kicking-off I/O tasks in parallel, not about\n * parallel execution of code. If your tasks do not use any timers or perform\n * any I/O, they will actually be executed in series. Any synchronous setup\n * sections for each task will happen one after the other. JavaScript remains\n * single-threaded.\n *\n * **Hint:** Use [`reflect`]{@link module:Utils.reflect} to continue the\n * execution of other tasks when a task fails.\n *\n * It is also possible to use an object instead of an array. Each property will\n * be run as a function and the results will be passed to the final `callback`\n * as an object instead of an array. This can be a more readable way of handling\n * results from {@link async.parallel}.\n *\n * @name parallel\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @param {Array|Iterable|AsyncIterable|Object} tasks - A collection of\n * [async functions]{@link AsyncFunction} to run.\n * Each async function can complete with any number of optional `result` values.\n * @param {Function} [callback] - An optional callback to run once all the\n * functions have completed successfully. This function gets a results array\n * (or object) containing all the result arguments passed to the task callbacks.\n * Invoked with (err, results).\n * @returns {Promise} a promise, if a callback is not passed\n *\n * @example\n * async.parallel([\n * function(callback) {\n * setTimeout(function() {\n * callback(null, 'one');\n * }, 200);\n * },\n * function(callback) {\n * setTimeout(function() {\n * callback(null, 'two');\n * }, 100);\n * }\n * ],\n * // optional callback\n * function(err, results) {\n * // the results array will equal ['one','two'] even though\n * // the second function had a shorter timeout.\n * });\n *\n * // an example using an object instead of an array\n * async.parallel({\n * one: function(callback) {\n * setTimeout(function() {\n * callback(null, 1);\n * }, 200);\n * },\n * two: function(callback) {\n * setTimeout(function() {\n * callback(null, 2);\n * }, 100);\n * }\n * }, function(err, results) {\n * // results is now equals to: {one: 1, two: 2}\n * });\n */\n function parallel$1(tasks, callback) {\n return parallel(eachOf$1, tasks, callback);\n }\n\n /**\n * The same as [`parallel`]{@link module:ControlFlow.parallel} but runs a maximum of `limit` async operations at a\n * time.\n *\n * @name parallelLimit\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.parallel]{@link module:ControlFlow.parallel}\n * @category Control Flow\n * @param {Array|Iterable|AsyncIterable|Object} tasks - A collection of\n * [async functions]{@link AsyncFunction} to run.\n * Each async function can complete with any number of optional `result` values.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {Function} [callback] - An optional callback to run once all the\n * functions have completed successfully. This function gets a results array\n * (or object) containing all the result arguments passed to the task callbacks.\n * Invoked with (err, results).\n * @returns {Promise} a promise, if a callback is not passed\n */\n function parallelLimit(tasks, limit, callback) {\n return parallel(eachOfLimit(limit), tasks, callback);\n }\n\n /**\n * A queue of tasks for the worker function to complete.\n * @typedef {Iterable} QueueObject\n * @memberOf module:ControlFlow\n * @property {Function} length - a function returning the number of items\n * waiting to be processed. Invoke with `queue.length()`.\n * @property {boolean} started - a boolean indicating whether or not any\n * items have been pushed and processed by the queue.\n * @property {Function} running - a function returning the number of items\n * currently being processed. Invoke with `queue.running()`.\n * @property {Function} workersList - a function returning the array of items\n * currently being processed. Invoke with `queue.workersList()`.\n * @property {Function} idle - a function returning false if there are items\n * waiting or being processed, or true if not. Invoke with `queue.idle()`.\n * @property {number} concurrency - an integer for determining how many `worker`\n * functions should be run in parallel. This property can be changed after a\n * `queue` is created to alter the concurrency on-the-fly.\n * @property {number} payload - an integer that specifies how many items are\n * passed to the worker function at a time. only applies if this is a\n * [cargo]{@link module:ControlFlow.cargo} object\n * @property {AsyncFunction} push - add a new task to the `queue`. Calls `callback`\n * once the `worker` has finished processing the task. Instead of a single task,\n * a `tasks` array can be submitted. The respective callback is used for every\n * task in the list. Invoke with `queue.push(task, [callback])`,\n * @property {AsyncFunction} unshift - add a new task to the front of the `queue`.\n * Invoke with `queue.unshift(task, [callback])`.\n * @property {AsyncFunction} pushAsync - the same as `q.push`, except this returns\n * a promise that rejects if an error occurs.\n * @property {AsyncFunction} unshirtAsync - the same as `q.unshift`, except this returns\n * a promise that rejects if an error occurs.\n * @property {Function} remove - remove items from the queue that match a test\n * function. The test function will be passed an object with a `data` property,\n * and a `priority` property, if this is a\n * [priorityQueue]{@link module:ControlFlow.priorityQueue} object.\n * Invoked with `queue.remove(testFn)`, where `testFn` is of the form\n * `function ({data, priority}) {}` and returns a Boolean.\n * @property {Function} saturated - a function that sets a callback that is\n * called when the number of running workers hits the `concurrency` limit, and\n * further tasks will be queued. If the callback is omitted, `q.saturated()`\n * returns a promise for the next occurrence.\n * @property {Function} unsaturated - a function that sets a callback that is\n * called when the number of running workers is less than the `concurrency` &\n * `buffer` limits, and further tasks will not be queued. If the callback is\n * omitted, `q.unsaturated()` returns a promise for the next occurrence.\n * @property {number} buffer - A minimum threshold buffer in order to say that\n * the `queue` is `unsaturated`.\n * @property {Function} empty - a function that sets a callback that is called\n * when the last item from the `queue` is given to a `worker`. If the callback\n * is omitted, `q.empty()` returns a promise for the next occurrence.\n * @property {Function} drain - a function that sets a callback that is called\n * when the last item from the `queue` has returned from the `worker`. If the\n * callback is omitted, `q.drain()` returns a promise for the next occurrence.\n * @property {Function} error - a function that sets a callback that is called\n * when a task errors. Has the signature `function(error, task)`. If the\n * callback is omitted, `error()` returns a promise that rejects on the next\n * error.\n * @property {boolean} paused - a boolean for determining whether the queue is\n * in a paused state.\n * @property {Function} pause - a function that pauses the processing of tasks\n * until `resume()` is called. Invoke with `queue.pause()`.\n * @property {Function} resume - a function that resumes the processing of\n * queued tasks when the queue is paused. Invoke with `queue.resume()`.\n * @property {Function} kill - a function that removes the `drain` callback and\n * empties remaining tasks from the queue forcing it to go idle. No more tasks\n * should be pushed to the queue after calling this function. Invoke with `queue.kill()`.\n *\n * @example\n * const q = aync.queue(worker, 2)\n * q.push(item1)\n * q.push(item2)\n * q.push(item3)\n * // queues are iterable, spread into an array to inspect\n * const items = [...q] // [item1, item2, item3]\n * // or use for of\n * for (let item of q) {\n * console.log(item)\n * }\n *\n * q.drain(() => {\n * console.log('all done')\n * })\n * // or\n * await q.drain()\n */\n\n /**\n * Creates a `queue` object with the specified `concurrency`. Tasks added to the\n * `queue` are processed in parallel (up to the `concurrency` limit). If all\n * `worker`s are in progress, the task is queued until one becomes available.\n * Once a `worker` completes a `task`, that `task`'s callback is called.\n *\n * @name queue\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @param {AsyncFunction} worker - An async function for processing a queued task.\n * If you want to handle errors from an individual task, pass a callback to\n * `q.push()`. Invoked with (task, callback).\n * @param {number} [concurrency=1] - An `integer` for determining how many\n * `worker` functions should be run in parallel. If omitted, the concurrency\n * defaults to `1`. If the concurrency is `0`, an error is thrown.\n * @returns {module:ControlFlow.QueueObject} A queue object to manage the tasks. Callbacks can be\n * attached as certain properties to listen for specific events during the\n * lifecycle of the queue.\n * @example\n *\n * // create a queue object with concurrency 2\n * var q = async.queue(function(task, callback) {\n * console.log('hello ' + task.name);\n * callback();\n * }, 2);\n *\n * // assign a callback\n * q.drain(function() {\n * console.log('all items have been processed');\n * });\n * // or await the end\n * await q.drain()\n *\n * // assign an error callback\n * q.error(function(err, task) {\n * console.error('task experienced an error');\n * });\n *\n * // add some items to the queue\n * q.push({name: 'foo'}, function(err) {\n * console.log('finished processing foo');\n * });\n * // callback is optional\n * q.push({name: 'bar'});\n *\n * // add some items to the queue (batch-wise)\n * q.push([{name: 'baz'},{name: 'bay'},{name: 'bax'}], function(err) {\n * console.log('finished processing item');\n * });\n *\n * // add some items to the front of the queue\n * q.unshift({name: 'bar'}, function (err) {\n * console.log('finished processing bar');\n * });\n */\n function queue$1 (worker, concurrency) {\n var _worker = wrapAsync(worker);\n return queue((items, cb) => {\n _worker(items[0], cb);\n }, concurrency, 1);\n }\n\n // Binary min-heap implementation used for priority queue.\n // Implementation is stable, i.e. push time is considered for equal priorities\n class Heap {\n constructor() {\n this.heap = [];\n this.pushCount = Number.MIN_SAFE_INTEGER;\n }\n\n get length() {\n return this.heap.length;\n }\n\n empty () {\n this.heap = [];\n return this;\n }\n\n percUp(index) {\n let p;\n\n while (index > 0 && smaller(this.heap[index], this.heap[p=parent(index)])) {\n let t = this.heap[index];\n this.heap[index] = this.heap[p];\n this.heap[p] = t;\n\n index = p;\n }\n }\n\n percDown(index) {\n let l;\n\n while ((l=leftChi(index)) < this.heap.length) {\n if (l+1 < this.heap.length && smaller(this.heap[l+1], this.heap[l])) {\n l = l+1;\n }\n\n if (smaller(this.heap[index], this.heap[l])) {\n break;\n }\n\n let t = this.heap[index];\n this.heap[index] = this.heap[l];\n this.heap[l] = t;\n\n index = l;\n }\n }\n\n push(node) {\n node.pushCount = ++this.pushCount;\n this.heap.push(node);\n this.percUp(this.heap.length-1);\n }\n\n unshift(node) {\n return this.heap.push(node);\n }\n\n shift() {\n let [top] = this.heap;\n\n this.heap[0] = this.heap[this.heap.length-1];\n this.heap.pop();\n this.percDown(0);\n\n return top;\n }\n\n toArray() {\n return [...this];\n }\n\n *[Symbol.iterator] () {\n for (let i = 0; i < this.heap.length; i++) {\n yield this.heap[i].data;\n }\n }\n\n remove (testFn) {\n let j = 0;\n for (let i = 0; i < this.heap.length; i++) {\n if (!testFn(this.heap[i])) {\n this.heap[j] = this.heap[i];\n j++;\n }\n }\n\n this.heap.splice(j);\n\n for (let i = parent(this.heap.length-1); i >= 0; i--) {\n this.percDown(i);\n }\n\n return this;\n }\n }\n\n function leftChi(i) {\n return (i<<1)+1;\n }\n\n function parent(i) {\n return ((i+1)>>1)-1;\n }\n\n function smaller(x, y) {\n if (x.priority !== y.priority) {\n return x.priority < y.priority;\n }\n else {\n return x.pushCount < y.pushCount;\n }\n }\n\n /**\n * The same as [async.queue]{@link module:ControlFlow.queue} only tasks are assigned a priority and\n * completed in ascending priority order.\n *\n * @name priorityQueue\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.queue]{@link module:ControlFlow.queue}\n * @category Control Flow\n * @param {AsyncFunction} worker - An async function for processing a queued task.\n * If you want to handle errors from an individual task, pass a callback to\n * `q.push()`.\n * Invoked with (task, callback).\n * @param {number} concurrency - An `integer` for determining how many `worker`\n * functions should be run in parallel. If omitted, the concurrency defaults to\n * `1`. If the concurrency is `0`, an error is thrown.\n * @returns {module:ControlFlow.QueueObject} A priorityQueue object to manage the tasks. There are two\n * differences between `queue` and `priorityQueue` objects:\n * * `push(task, priority, [callback])` - `priority` should be a number. If an\n * array of `tasks` is given, all tasks will be assigned the same priority.\n * * The `unshift` method was removed.\n */\n function priorityQueue(worker, concurrency) {\n // Start with a normal queue\n var q = queue$1(worker, concurrency);\n\n q._tasks = new Heap();\n\n // Override push to accept second parameter representing priority\n q.push = function(data, priority = 0, callback = () => {}) {\n if (typeof callback !== 'function') {\n throw new Error('task callback must be a function');\n }\n q.started = true;\n if (!Array.isArray(data)) {\n data = [data];\n }\n if (data.length === 0 && q.idle()) {\n // call drain immediately if there are no tasks\n return setImmediate$1(() => q.drain());\n }\n\n for (var i = 0, l = data.length; i < l; i++) {\n var item = {\n data: data[i],\n priority,\n callback\n };\n\n q._tasks.push(item);\n }\n\n setImmediate$1(q.process);\n };\n\n // Remove unshift function\n delete q.unshift;\n\n return q;\n }\n\n /**\n * Runs the `tasks` array of functions in parallel, without waiting until the\n * previous function has completed. Once any of the `tasks` complete or pass an\n * error to its callback, the main `callback` is immediately called. It's\n * equivalent to `Promise.race()`.\n *\n * @name race\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @param {Array} tasks - An array containing [async functions]{@link AsyncFunction}\n * to run. Each function can complete with an optional `result` value.\n * @param {Function} callback - A callback to run once any of the functions have\n * completed. This function gets an error or result from the first function that\n * completed. Invoked with (err, result).\n * @returns undefined\n * @example\n *\n * async.race([\n * function(callback) {\n * setTimeout(function() {\n * callback(null, 'one');\n * }, 200);\n * },\n * function(callback) {\n * setTimeout(function() {\n * callback(null, 'two');\n * }, 100);\n * }\n * ],\n * // main callback\n * function(err, result) {\n * // the result will be equal to 'two' as it finishes earlier\n * });\n */\n function race(tasks, callback) {\n callback = once(callback);\n if (!Array.isArray(tasks)) return callback(new TypeError('First argument to race must be an array of functions'));\n if (!tasks.length) return callback();\n for (var i = 0, l = tasks.length; i < l; i++) {\n wrapAsync(tasks[i])(callback);\n }\n }\n\n var race$1 = awaitify(race, 2);\n\n /**\n * Same as [`reduce`]{@link module:Collections.reduce}, only operates on `array` in reverse order.\n *\n * @name reduceRight\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.reduce]{@link module:Collections.reduce}\n * @alias foldr\n * @category Collection\n * @param {Array} array - A collection to iterate over.\n * @param {*} memo - The initial state of the reduction.\n * @param {AsyncFunction} iteratee - A function applied to each item in the\n * array to produce the next step in the reduction.\n * The `iteratee` should complete with the next state of the reduction.\n * If the iteratee complete with an error, the reduction is stopped and the\n * main `callback` is immediately called with the error.\n * Invoked with (memo, item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished. Result is the reduced value. Invoked with\n * (err, result).\n * @returns {Promise} a promise, if no callback is passed\n */\n function reduceRight (array, memo, iteratee, callback) {\n var reversed = [...array].reverse();\n return reduce$1(reversed, memo, iteratee, callback);\n }\n\n /**\n * Wraps the async function in another function that always completes with a\n * result object, even when it errors.\n *\n * The result object has either the property `error` or `value`.\n *\n * @name reflect\n * @static\n * @memberOf module:Utils\n * @method\n * @category Util\n * @param {AsyncFunction} fn - The async function you want to wrap\n * @returns {Function} - A function that always passes null to it's callback as\n * the error. The second argument to the callback will be an `object` with\n * either an `error` or a `value` property.\n * @example\n *\n * async.parallel([\n * async.reflect(function(callback) {\n * // do some stuff ...\n * callback(null, 'one');\n * }),\n * async.reflect(function(callback) {\n * // do some more stuff but error ...\n * callback('bad stuff happened');\n * }),\n * async.reflect(function(callback) {\n * // do some more stuff ...\n * callback(null, 'two');\n * })\n * ],\n * // optional callback\n * function(err, results) {\n * // values\n * // results[0].value = 'one'\n * // results[1].error = 'bad stuff happened'\n * // results[2].value = 'two'\n * });\n */\n function reflect(fn) {\n var _fn = wrapAsync(fn);\n return initialParams(function reflectOn(args, reflectCallback) {\n args.push((error, ...cbArgs) => {\n let retVal = {};\n if (error) {\n retVal.error = error;\n }\n if (cbArgs.length > 0){\n var value = cbArgs;\n if (cbArgs.length <= 1) {\n [value] = cbArgs;\n }\n retVal.value = value;\n }\n reflectCallback(null, retVal);\n });\n\n return _fn.apply(this, args);\n });\n }\n\n /**\n * A helper function that wraps an array or an object of functions with `reflect`.\n *\n * @name reflectAll\n * @static\n * @memberOf module:Utils\n * @method\n * @see [async.reflect]{@link module:Utils.reflect}\n * @category Util\n * @param {Array|Object|Iterable} tasks - The collection of\n * [async functions]{@link AsyncFunction} to wrap in `async.reflect`.\n * @returns {Array} Returns an array of async functions, each wrapped in\n * `async.reflect`\n * @example\n *\n * let tasks = [\n * function(callback) {\n * setTimeout(function() {\n * callback(null, 'one');\n * }, 200);\n * },\n * function(callback) {\n * // do some more stuff but error ...\n * callback(new Error('bad stuff happened'));\n * },\n * function(callback) {\n * setTimeout(function() {\n * callback(null, 'two');\n * }, 100);\n * }\n * ];\n *\n * async.parallel(async.reflectAll(tasks),\n * // optional callback\n * function(err, results) {\n * // values\n * // results[0].value = 'one'\n * // results[1].error = Error('bad stuff happened')\n * // results[2].value = 'two'\n * });\n *\n * // an example using an object instead of an array\n * let tasks = {\n * one: function(callback) {\n * setTimeout(function() {\n * callback(null, 'one');\n * }, 200);\n * },\n * two: function(callback) {\n * callback('two');\n * },\n * three: function(callback) {\n * setTimeout(function() {\n * callback(null, 'three');\n * }, 100);\n * }\n * };\n *\n * async.parallel(async.reflectAll(tasks),\n * // optional callback\n * function(err, results) {\n * // values\n * // results.one.value = 'one'\n * // results.two.error = 'two'\n * // results.three.value = 'three'\n * });\n */\n function reflectAll(tasks) {\n var results;\n if (Array.isArray(tasks)) {\n results = tasks.map(reflect);\n } else {\n results = {};\n Object.keys(tasks).forEach(key => {\n results[key] = reflect.call(this, tasks[key]);\n });\n }\n return results;\n }\n\n function reject(eachfn, arr, _iteratee, callback) {\n const iteratee = wrapAsync(_iteratee);\n return _filter(eachfn, arr, (value, cb) => {\n iteratee(value, (err, v) => {\n cb(err, !v);\n });\n }, callback);\n }\n\n /**\n * The opposite of [`filter`]{@link module:Collections.filter}. Removes values that pass an `async` truth test.\n *\n * @name reject\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.filter]{@link module:Collections.filter}\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {Function} iteratee - An async truth test to apply to each item in\n * `coll`.\n * The should complete with a boolean value as its `result`.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished. Invoked with (err, results).\n * @returns {Promise} a promise, if no callback is passed\n * @example\n *\n * async.reject(['file1','file2','file3'], function(filePath, callback) {\n * fs.access(filePath, function(err) {\n * callback(null, !err)\n * });\n * }, function(err, results) {\n * // results now equals an array of missing files\n * createFiles(results);\n * });\n */\n function reject$1 (coll, iteratee, callback) {\n return reject(eachOf$1, coll, iteratee, callback)\n }\n var reject$2 = awaitify(reject$1, 3);\n\n /**\n * The same as [`reject`]{@link module:Collections.reject} but runs a maximum of `limit` async operations at a\n * time.\n *\n * @name rejectLimit\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.reject]{@link module:Collections.reject}\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {Function} iteratee - An async truth test to apply to each item in\n * `coll`.\n * The should complete with a boolean value as its `result`.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished. Invoked with (err, results).\n * @returns {Promise} a promise, if no callback is passed\n */\n function rejectLimit (coll, limit, iteratee, callback) {\n return reject(eachOfLimit(limit), coll, iteratee, callback)\n }\n var rejectLimit$1 = awaitify(rejectLimit, 4);\n\n /**\n * The same as [`reject`]{@link module:Collections.reject} but runs only a single async operation at a time.\n *\n * @name rejectSeries\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.reject]{@link module:Collections.reject}\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {Function} iteratee - An async truth test to apply to each item in\n * `coll`.\n * The should complete with a boolean value as its `result`.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished. Invoked with (err, results).\n * @returns {Promise} a promise, if no callback is passed\n */\n function rejectSeries (coll, iteratee, callback) {\n return reject(eachOfSeries$1, coll, iteratee, callback)\n }\n var rejectSeries$1 = awaitify(rejectSeries, 3);\n\n function constant$1(value) {\n return function () {\n return value;\n }\n }\n\n /**\n * Attempts to get a successful response from `task` no more than `times` times\n * before returning an error. If the task is successful, the `callback` will be\n * passed the result of the successful task. If all attempts fail, the callback\n * will be passed the error and result (if any) of the final attempt.\n *\n * @name retry\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @see [async.retryable]{@link module:ControlFlow.retryable}\n * @param {Object|number} [opts = {times: 5, interval: 0}| 5] - Can be either an\n * object with `times` and `interval` or a number.\n * * `times` - The number of attempts to make before giving up. The default\n * is `5`.\n * * `interval` - The time to wait between retries, in milliseconds. The\n * default is `0`. The interval may also be specified as a function of the\n * retry count (see example).\n * * `errorFilter` - An optional synchronous function that is invoked on\n * erroneous result. If it returns `true` the retry attempts will continue;\n * if the function returns `false` the retry flow is aborted with the current\n * attempt's error and result being returned to the final callback.\n * Invoked with (err).\n * * If `opts` is a number, the number specifies the number of times to retry,\n * with the default interval of `0`.\n * @param {AsyncFunction} task - An async function to retry.\n * Invoked with (callback).\n * @param {Function} [callback] - An optional callback which is called when the\n * task has succeeded, or after the final failed attempt. It receives the `err`\n * and `result` arguments of the last attempt at completing the `task`. Invoked\n * with (err, results).\n * @returns {Promise} a promise if no callback provided\n *\n * @example\n *\n * // The `retry` function can be used as a stand-alone control flow by passing\n * // a callback, as shown below:\n *\n * // try calling apiMethod 3 times\n * async.retry(3, apiMethod, function(err, result) {\n * // do something with the result\n * });\n *\n * // try calling apiMethod 3 times, waiting 200 ms between each retry\n * async.retry({times: 3, interval: 200}, apiMethod, function(err, result) {\n * // do something with the result\n * });\n *\n * // try calling apiMethod 10 times with exponential backoff\n * // (i.e. intervals of 100, 200, 400, 800, 1600, ... milliseconds)\n * async.retry({\n * times: 10,\n * interval: function(retryCount) {\n * return 50 * Math.pow(2, retryCount);\n * }\n * }, apiMethod, function(err, result) {\n * // do something with the result\n * });\n *\n * // try calling apiMethod the default 5 times no delay between each retry\n * async.retry(apiMethod, function(err, result) {\n * // do something with the result\n * });\n *\n * // try calling apiMethod only when error condition satisfies, all other\n * // errors will abort the retry control flow and return to final callback\n * async.retry({\n * errorFilter: function(err) {\n * return err.message === 'Temporary error'; // only retry on a specific error\n * }\n * }, apiMethod, function(err, result) {\n * // do something with the result\n * });\n *\n * // to retry individual methods that are not as reliable within other\n * // control flow functions, use the `retryable` wrapper:\n * async.auto({\n * users: api.getUsers.bind(api),\n * payments: async.retryable(3, api.getPayments.bind(api))\n * }, function(err, results) {\n * // do something with the results\n * });\n *\n */\n const DEFAULT_TIMES = 5;\n const DEFAULT_INTERVAL = 0;\n\n function retry(opts, task, callback) {\n var options = {\n times: DEFAULT_TIMES,\n intervalFunc: constant$1(DEFAULT_INTERVAL)\n };\n\n if (arguments.length < 3 && typeof opts === 'function') {\n callback = task || promiseCallback();\n task = opts;\n } else {\n parseTimes(options, opts);\n callback = callback || promiseCallback();\n }\n\n if (typeof task !== 'function') {\n throw new Error(\"Invalid arguments for async.retry\");\n }\n\n var _task = wrapAsync(task);\n\n var attempt = 1;\n function retryAttempt() {\n _task((err, ...args) => {\n if (err === false) return\n if (err && attempt++ < options.times &&\n (typeof options.errorFilter != 'function' ||\n options.errorFilter(err))) {\n setTimeout(retryAttempt, options.intervalFunc(attempt - 1));\n } else {\n callback(err, ...args);\n }\n });\n }\n\n retryAttempt();\n return callback[PROMISE_SYMBOL]\n }\n\n function parseTimes(acc, t) {\n if (typeof t === 'object') {\n acc.times = +t.times || DEFAULT_TIMES;\n\n acc.intervalFunc = typeof t.interval === 'function' ?\n t.interval :\n constant$1(+t.interval || DEFAULT_INTERVAL);\n\n acc.errorFilter = t.errorFilter;\n } else if (typeof t === 'number' || typeof t === 'string') {\n acc.times = +t || DEFAULT_TIMES;\n } else {\n throw new Error(\"Invalid arguments for async.retry\");\n }\n }\n\n /**\n * A close relative of [`retry`]{@link module:ControlFlow.retry}. This method\n * wraps a task and makes it retryable, rather than immediately calling it\n * with retries.\n *\n * @name retryable\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.retry]{@link module:ControlFlow.retry}\n * @category Control Flow\n * @param {Object|number} [opts = {times: 5, interval: 0}| 5] - optional\n * options, exactly the same as from `retry`, except for a `opts.arity` that\n * is the arity of the `task` function, defaulting to `task.length`\n * @param {AsyncFunction} task - the asynchronous function to wrap.\n * This function will be passed any arguments passed to the returned wrapper.\n * Invoked with (...args, callback).\n * @returns {AsyncFunction} The wrapped function, which when invoked, will\n * retry on an error, based on the parameters specified in `opts`.\n * This function will accept the same parameters as `task`.\n * @example\n *\n * async.auto({\n * dep1: async.retryable(3, getFromFlakyService),\n * process: [\"dep1\", async.retryable(3, function (results, cb) {\n * maybeProcessData(results.dep1, cb);\n * })]\n * }, callback);\n */\n function retryable (opts, task) {\n if (!task) {\n task = opts;\n opts = null;\n }\n let arity = (opts && opts.arity) || task.length;\n if (isAsync(task)) {\n arity += 1;\n }\n var _task = wrapAsync(task);\n return initialParams((args, callback) => {\n if (args.length < arity - 1 || callback == null) {\n args.push(callback);\n callback = promiseCallback();\n }\n function taskFn(cb) {\n _task(...args, cb);\n }\n\n if (opts) retry(opts, taskFn, callback);\n else retry(taskFn, callback);\n\n return callback[PROMISE_SYMBOL]\n });\n }\n\n /**\n * Run the functions in the `tasks` collection in series, each one running once\n * the previous function has completed. If any functions in the series pass an\n * error to its callback, no more functions are run, and `callback` is\n * immediately called with the value of the error. Otherwise, `callback`\n * receives an array of results when `tasks` have completed.\n *\n * It is also possible to use an object instead of an array. Each property will\n * be run as a function, and the results will be passed to the final `callback`\n * as an object instead of an array. This can be a more readable way of handling\n * results from {@link async.series}.\n *\n * **Note** that while many implementations preserve the order of object\n * properties, the [ECMAScript Language Specification](http://www.ecma-international.org/ecma-262/5.1/#sec-8.6)\n * explicitly states that\n *\n * > The mechanics and order of enumerating the properties is not specified.\n *\n * So if you rely on the order in which your series of functions are executed,\n * and want this to work on all platforms, consider using an array.\n *\n * @name series\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @param {Array|Iterable|AsyncIterable|Object} tasks - A collection containing\n * [async functions]{@link AsyncFunction} to run in series.\n * Each function can complete with any number of optional `result` values.\n * @param {Function} [callback] - An optional callback to run once all the\n * functions have completed. This function gets a results array (or object)\n * containing all the result arguments passed to the `task` callbacks. Invoked\n * with (err, result).\n * @return {Promise} a promise, if no callback is passed\n * @example\n * async.series([\n * function(callback) {\n * // do some stuff ...\n * callback(null, 'one');\n * },\n * function(callback) {\n * // do some more stuff ...\n * callback(null, 'two');\n * }\n * ],\n * // optional callback\n * function(err, results) {\n * // results is now equal to ['one', 'two']\n * });\n *\n * async.series({\n * one: function(callback) {\n * setTimeout(function() {\n * callback(null, 1);\n * }, 200);\n * },\n * two: function(callback){\n * setTimeout(function() {\n * callback(null, 2);\n * }, 100);\n * }\n * }, function(err, results) {\n * // results is now equal to: {one: 1, two: 2}\n * });\n */\n function series(tasks, callback) {\n return parallel(eachOfSeries$1, tasks, callback);\n }\n\n /**\n * Returns `true` if at least one element in the `coll` satisfies an async test.\n * If any iteratee call returns `true`, the main `callback` is immediately\n * called.\n *\n * @name some\n * @static\n * @memberOf module:Collections\n * @method\n * @alias any\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async truth test to apply to each item\n * in the collections in parallel.\n * The iteratee should complete with a boolean `result` value.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called as soon as any\n * iteratee returns `true`, or after all the iteratee functions have finished.\n * Result will be either `true` or `false` depending on the values of the async\n * tests. Invoked with (err, result).\n * @returns {Promise} a promise, if no callback provided\n * @example\n *\n * async.some(['file1','file2','file3'], function(filePath, callback) {\n * fs.access(filePath, function(err) {\n * callback(null, !err)\n * });\n * }, function(err, result) {\n * // if result is true then at least one of the files exists\n * });\n */\n function some(coll, iteratee, callback) {\n return _createTester(Boolean, res => res)(eachOf$1, coll, iteratee, callback)\n }\n var some$1 = awaitify(some, 3);\n\n /**\n * The same as [`some`]{@link module:Collections.some} but runs a maximum of `limit` async operations at a time.\n *\n * @name someLimit\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.some]{@link module:Collections.some}\n * @alias anyLimit\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {AsyncFunction} iteratee - An async truth test to apply to each item\n * in the collections in parallel.\n * The iteratee should complete with a boolean `result` value.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called as soon as any\n * iteratee returns `true`, or after all the iteratee functions have finished.\n * Result will be either `true` or `false` depending on the values of the async\n * tests. Invoked with (err, result).\n * @returns {Promise} a promise, if no callback provided\n */\n function someLimit(coll, limit, iteratee, callback) {\n return _createTester(Boolean, res => res)(eachOfLimit(limit), coll, iteratee, callback)\n }\n var someLimit$1 = awaitify(someLimit, 4);\n\n /**\n * The same as [`some`]{@link module:Collections.some} but runs only a single async operation at a time.\n *\n * @name someSeries\n * @static\n * @memberOf module:Collections\n * @method\n * @see [async.some]{@link module:Collections.some}\n * @alias anySeries\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async truth test to apply to each item\n * in the collections in series.\n * The iteratee should complete with a boolean `result` value.\n * Invoked with (item, callback).\n * @param {Function} [callback] - A callback which is called as soon as any\n * iteratee returns `true`, or after all the iteratee functions have finished.\n * Result will be either `true` or `false` depending on the values of the async\n * tests. Invoked with (err, result).\n * @returns {Promise} a promise, if no callback provided\n */\n function someSeries(coll, iteratee, callback) {\n return _createTester(Boolean, res => res)(eachOfSeries$1, coll, iteratee, callback)\n }\n var someSeries$1 = awaitify(someSeries, 3);\n\n /**\n * Sorts a list by the results of running each `coll` value through an async\n * `iteratee`.\n *\n * @name sortBy\n * @static\n * @memberOf module:Collections\n * @method\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {AsyncFunction} iteratee - An async function to apply to each item in\n * `coll`.\n * The iteratee should complete with a value to use as the sort criteria as\n * its `result`.\n * Invoked with (item, callback).\n * @param {Function} callback - A callback which is called after all the\n * `iteratee` functions have finished, or an error occurs. Results is the items\n * from the original `coll` sorted by the values returned by the `iteratee`\n * calls. Invoked with (err, results).\n * @returns {Promise} a promise, if no callback passed\n * @example\n *\n * async.sortBy(['file1','file2','file3'], function(file, callback) {\n * fs.stat(file, function(err, stats) {\n * callback(err, stats.mtime);\n * });\n * }, function(err, results) {\n * // results is now the original array of files sorted by\n * // modified date\n * });\n *\n * // By modifying the callback parameter the\n * // sorting order can be influenced:\n *\n * // ascending order\n * async.sortBy([1,9,3,5], function(x, callback) {\n * callback(null, x);\n * }, function(err,result) {\n * // result callback\n * });\n *\n * // descending order\n * async.sortBy([1,9,3,5], function(x, callback) {\n * callback(null, x*-1); //<- x*-1 instead of x, turns the order around\n * }, function(err,result) {\n * // result callback\n * });\n */\n function sortBy (coll, iteratee, callback) {\n var _iteratee = wrapAsync(iteratee);\n return map$1(coll, (x, iterCb) => {\n _iteratee(x, (err, criteria) => {\n if (err) return iterCb(err);\n iterCb(err, {value: x, criteria});\n });\n }, (err, results) => {\n if (err) return callback(err);\n callback(null, results.sort(comparator).map(v => v.value));\n });\n\n function comparator(left, right) {\n var a = left.criteria, b = right.criteria;\n return a < b ? -1 : a > b ? 1 : 0;\n }\n }\n var sortBy$1 = awaitify(sortBy, 3);\n\n /**\n * Sets a time limit on an asynchronous function. If the function does not call\n * its callback within the specified milliseconds, it will be called with a\n * timeout error. The code property for the error object will be `'ETIMEDOUT'`.\n *\n * @name timeout\n * @static\n * @memberOf module:Utils\n * @method\n * @category Util\n * @param {AsyncFunction} asyncFn - The async function to limit in time.\n * @param {number} milliseconds - The specified time limit.\n * @param {*} [info] - Any variable you want attached (`string`, `object`, etc)\n * to timeout Error for more information..\n * @returns {AsyncFunction} Returns a wrapped function that can be used with any\n * of the control flow functions.\n * Invoke this function with the same parameters as you would `asyncFunc`.\n * @example\n *\n * function myFunction(foo, callback) {\n * doAsyncTask(foo, function(err, data) {\n * // handle errors\n * if (err) return callback(err);\n *\n * // do some stuff ...\n *\n * // return processed data\n * return callback(null, data);\n * });\n * }\n *\n * var wrapped = async.timeout(myFunction, 1000);\n *\n * // call `wrapped` as you would `myFunction`\n * wrapped({ bar: 'bar' }, function(err, data) {\n * // if `myFunction` takes < 1000 ms to execute, `err`\n * // and `data` will have their expected values\n *\n * // else `err` will be an Error with the code 'ETIMEDOUT'\n * });\n */\n function timeout(asyncFn, milliseconds, info) {\n var fn = wrapAsync(asyncFn);\n\n return initialParams((args, callback) => {\n var timedOut = false;\n var timer;\n\n function timeoutCallback() {\n var name = asyncFn.name || 'anonymous';\n var error = new Error('Callback function \"' + name + '\" timed out.');\n error.code = 'ETIMEDOUT';\n if (info) {\n error.info = info;\n }\n timedOut = true;\n callback(error);\n }\n\n args.push((...cbArgs) => {\n if (!timedOut) {\n callback(...cbArgs);\n clearTimeout(timer);\n }\n });\n\n // setup timer and call original function\n timer = setTimeout(timeoutCallback, milliseconds);\n fn(...args);\n });\n }\n\n function range(size) {\n var result = Array(size);\n while (size--) {\n result[size] = size;\n }\n return result;\n }\n\n /**\n * The same as [times]{@link module:ControlFlow.times} but runs a maximum of `limit` async operations at a\n * time.\n *\n * @name timesLimit\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.times]{@link module:ControlFlow.times}\n * @category Control Flow\n * @param {number} count - The number of times to run the function.\n * @param {number} limit - The maximum number of async operations at a time.\n * @param {AsyncFunction} iteratee - The async function to call `n` times.\n * Invoked with the iteration index and a callback: (n, next).\n * @param {Function} callback - see [async.map]{@link module:Collections.map}.\n * @returns {Promise} a promise, if no callback is provided\n */\n function timesLimit(count, limit, iteratee, callback) {\n var _iteratee = wrapAsync(iteratee);\n return mapLimit$1(range(count), limit, _iteratee, callback);\n }\n\n /**\n * Calls the `iteratee` function `n` times, and accumulates results in the same\n * manner you would use with [map]{@link module:Collections.map}.\n *\n * @name times\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.map]{@link module:Collections.map}\n * @category Control Flow\n * @param {number} n - The number of times to run the function.\n * @param {AsyncFunction} iteratee - The async function to call `n` times.\n * Invoked with the iteration index and a callback: (n, next).\n * @param {Function} callback - see {@link module:Collections.map}.\n * @returns {Promise} a promise, if no callback is provided\n * @example\n *\n * // Pretend this is some complicated async factory\n * var createUser = function(id, callback) {\n * callback(null, {\n * id: 'user' + id\n * });\n * };\n *\n * // generate 5 users\n * async.times(5, function(n, next) {\n * createUser(n, function(err, user) {\n * next(err, user);\n * });\n * }, function(err, users) {\n * // we should now have 5 users\n * });\n */\n function times (n, iteratee, callback) {\n return timesLimit(n, Infinity, iteratee, callback)\n }\n\n /**\n * The same as [times]{@link module:ControlFlow.times} but runs only a single async operation at a time.\n *\n * @name timesSeries\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.times]{@link module:ControlFlow.times}\n * @category Control Flow\n * @param {number} n - The number of times to run the function.\n * @param {AsyncFunction} iteratee - The async function to call `n` times.\n * Invoked with the iteration index and a callback: (n, next).\n * @param {Function} callback - see {@link module:Collections.map}.\n * @returns {Promise} a promise, if no callback is provided\n */\n function timesSeries (n, iteratee, callback) {\n return timesLimit(n, 1, iteratee, callback)\n }\n\n /**\n * A relative of `reduce`. Takes an Object or Array, and iterates over each\n * element in parallel, each step potentially mutating an `accumulator` value.\n * The type of the accumulator defaults to the type of collection passed in.\n *\n * @name transform\n * @static\n * @memberOf module:Collections\n * @method\n * @category Collection\n * @param {Array|Iterable|AsyncIterable|Object} coll - A collection to iterate over.\n * @param {*} [accumulator] - The initial state of the transform. If omitted,\n * it will default to an empty Object or Array, depending on the type of `coll`\n * @param {AsyncFunction} iteratee - A function applied to each item in the\n * collection that potentially modifies the accumulator.\n * Invoked with (accumulator, item, key, callback).\n * @param {Function} [callback] - A callback which is called after all the\n * `iteratee` functions have finished. Result is the transformed accumulator.\n * Invoked with (err, result).\n * @returns {Promise} a promise, if no callback provided\n * @example\n *\n * async.transform([1,2,3], function(acc, item, index, callback) {\n * // pointless async:\n * process.nextTick(function() {\n * acc[index] = item * 2\n * callback(null)\n * });\n * }, function(err, result) {\n * // result is now equal to [2, 4, 6]\n * });\n *\n * @example\n *\n * async.transform({a: 1, b: 2, c: 3}, function (obj, val, key, callback) {\n * setImmediate(function () {\n * obj[key] = val * 2;\n * callback();\n * })\n * }, function (err, result) {\n * // result is equal to {a: 2, b: 4, c: 6}\n * })\n */\n function transform (coll, accumulator, iteratee, callback) {\n if (arguments.length <= 3 && typeof accumulator === 'function') {\n callback = iteratee;\n iteratee = accumulator;\n accumulator = Array.isArray(coll) ? [] : {};\n }\n callback = once(callback || promiseCallback());\n var _iteratee = wrapAsync(iteratee);\n\n eachOf$1(coll, (v, k, cb) => {\n _iteratee(accumulator, v, k, cb);\n }, err => callback(err, accumulator));\n return callback[PROMISE_SYMBOL]\n }\n\n /**\n * It runs each task in series but stops whenever any of the functions were\n * successful. If one of the tasks were successful, the `callback` will be\n * passed the result of the successful task. If all tasks fail, the callback\n * will be passed the error and result (if any) of the final attempt.\n *\n * @name tryEach\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @param {Array|Iterable|AsyncIterable|Object} tasks - A collection containing functions to\n * run, each function is passed a `callback(err, result)` it must call on\n * completion with an error `err` (which can be `null`) and an optional `result`\n * value.\n * @param {Function} [callback] - An optional callback which is called when one\n * of the tasks has succeeded, or all have failed. It receives the `err` and\n * `result` arguments of the last attempt at completing the `task`. Invoked with\n * (err, results).\n * @returns {Promise} a promise, if no callback is passed\n * @example\n * async.tryEach([\n * function getDataFromFirstWebsite(callback) {\n * // Try getting the data from the first website\n * callback(err, data);\n * },\n * function getDataFromSecondWebsite(callback) {\n * // First website failed,\n * // Try getting the data from the backup website\n * callback(err, data);\n * }\n * ],\n * // optional callback\n * function(err, results) {\n * Now do something with the data.\n * });\n *\n */\n function tryEach(tasks, callback) {\n var error = null;\n var result;\n return eachSeries$1(tasks, (task, taskCb) => {\n wrapAsync(task)((err, ...args) => {\n if (err === false) return taskCb(err);\n\n if (args.length < 2) {\n [result] = args;\n } else {\n result = args;\n }\n error = err;\n taskCb(err ? null : {});\n });\n }, () => callback(error, result));\n }\n\n var tryEach$1 = awaitify(tryEach);\n\n /**\n * Undoes a [memoize]{@link module:Utils.memoize}d function, reverting it to the original,\n * unmemoized form. Handy for testing.\n *\n * @name unmemoize\n * @static\n * @memberOf module:Utils\n * @method\n * @see [async.memoize]{@link module:Utils.memoize}\n * @category Util\n * @param {AsyncFunction} fn - the memoized function\n * @returns {AsyncFunction} a function that calls the original unmemoized function\n */\n function unmemoize(fn) {\n return (...args) => {\n return (fn.unmemoized || fn)(...args);\n };\n }\n\n /**\n * Repeatedly call `iteratee`, while `test` returns `true`. Calls `callback` when\n * stopped, or an error occurs.\n *\n * @name whilst\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @param {AsyncFunction} test - asynchronous truth test to perform before each\n * execution of `iteratee`. Invoked with ().\n * @param {AsyncFunction} iteratee - An async function which is called each time\n * `test` passes. Invoked with (callback).\n * @param {Function} [callback] - A callback which is called after the test\n * function has failed and repeated execution of `iteratee` has stopped. `callback`\n * will be passed an error and any arguments passed to the final `iteratee`'s\n * callback. Invoked with (err, [results]);\n * @returns {Promise} a promise, if no callback is passed\n * @example\n *\n * var count = 0;\n * async.whilst(\n * function test(cb) { cb(null, count < 5); },\n * function iter(callback) {\n * count++;\n * setTimeout(function() {\n * callback(null, count);\n * }, 1000);\n * },\n * function (err, n) {\n * // 5 seconds have passed, n = 5\n * }\n * );\n */\n function whilst(test, iteratee, callback) {\n callback = onlyOnce(callback);\n var _fn = wrapAsync(iteratee);\n var _test = wrapAsync(test);\n var results = [];\n\n function next(err, ...rest) {\n if (err) return callback(err);\n results = rest;\n if (err === false) return;\n _test(check);\n }\n\n function check(err, truth) {\n if (err) return callback(err);\n if (err === false) return;\n if (!truth) return callback(null, ...results);\n _fn(next);\n }\n\n return _test(check);\n }\n var whilst$1 = awaitify(whilst, 3);\n\n /**\n * Repeatedly call `iteratee` until `test` returns `true`. Calls `callback` when\n * stopped, or an error occurs. `callback` will be passed an error and any\n * arguments passed to the final `iteratee`'s callback.\n *\n * The inverse of [whilst]{@link module:ControlFlow.whilst}.\n *\n * @name until\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @see [async.whilst]{@link module:ControlFlow.whilst}\n * @category Control Flow\n * @param {AsyncFunction} test - asynchronous truth test to perform before each\n * execution of `iteratee`. Invoked with (callback).\n * @param {AsyncFunction} iteratee - An async function which is called each time\n * `test` fails. Invoked with (callback).\n * @param {Function} [callback] - A callback which is called after the test\n * function has passed and repeated execution of `iteratee` has stopped. `callback`\n * will be passed an error and any arguments passed to the final `iteratee`'s\n * callback. Invoked with (err, [results]);\n * @returns {Promise} a promise, if a callback is not passed\n *\n * @example\n * const results = []\n * let finished = false\n * async.until(function test(page, cb) {\n * cb(null, finished)\n * }, function iter(next) {\n * fetchPage(url, (err, body) => {\n * if (err) return next(err)\n * results = results.concat(body.objects)\n * finished = !!body.next\n * next(err)\n * })\n * }, function done (err) {\n * // all pages have been fetched\n * })\n */\n function until(test, iteratee, callback) {\n const _test = wrapAsync(test);\n return whilst$1((cb) => _test((err, truth) => cb (err, !truth)), iteratee, callback);\n }\n\n /**\n * Runs the `tasks` array of functions in series, each passing their results to\n * the next in the array. However, if any of the `tasks` pass an error to their\n * own callback, the next function is not executed, and the main `callback` is\n * immediately called with the error.\n *\n * @name waterfall\n * @static\n * @memberOf module:ControlFlow\n * @method\n * @category Control Flow\n * @param {Array} tasks - An array of [async functions]{@link AsyncFunction}\n * to run.\n * Each function should complete with any number of `result` values.\n * The `result` values will be passed as arguments, in order, to the next task.\n * @param {Function} [callback] - An optional callback to run once all the\n * functions have completed. This will be passed the results of the last task's\n * callback. Invoked with (err, [results]).\n * @returns undefined\n * @example\n *\n * async.waterfall([\n * function(callback) {\n * callback(null, 'one', 'two');\n * },\n * function(arg1, arg2, callback) {\n * // arg1 now equals 'one' and arg2 now equals 'two'\n * callback(null, 'three');\n * },\n * function(arg1, callback) {\n * // arg1 now equals 'three'\n * callback(null, 'done');\n * }\n * ], function (err, result) {\n * // result now equals 'done'\n * });\n *\n * // Or, with named functions:\n * async.waterfall([\n * myFirstFunction,\n * mySecondFunction,\n * myLastFunction,\n * ], function (err, result) {\n * // result now equals 'done'\n * });\n * function myFirstFunction(callback) {\n * callback(null, 'one', 'two');\n * }\n * function mySecondFunction(arg1, arg2, callback) {\n * // arg1 now equals 'one' and arg2 now equals 'two'\n * callback(null, 'three');\n * }\n * function myLastFunction(arg1, callback) {\n * // arg1 now equals 'three'\n * callback(null, 'done');\n * }\n */\n function waterfall (tasks, callback) {\n callback = once(callback);\n if (!Array.isArray(tasks)) return callback(new Error('First argument to waterfall must be an array of functions'));\n if (!tasks.length) return callback();\n var taskIndex = 0;\n\n function nextTask(args) {\n var task = wrapAsync(tasks[taskIndex++]);\n task(...args, onlyOnce(next));\n }\n\n function next(err, ...args) {\n if (err === false) return\n if (err || taskIndex === tasks.length) {\n return callback(err, ...args);\n }\n nextTask(args);\n }\n\n nextTask([]);\n }\n\n var waterfall$1 = awaitify(waterfall);\n\n /**\n * An \"async function\" in the context of Async is an asynchronous function with\n * a variable number of parameters, with the final parameter being a callback.\n * (`function (arg1, arg2, ..., callback) {}`)\n * The final callback is of the form `callback(err, results...)`, which must be\n * called once the function is completed. The callback should be called with a\n * Error as its first argument to signal that an error occurred.\n * Otherwise, if no error occurred, it should be called with `null` as the first\n * argument, and any additional `result` arguments that may apply, to signal\n * successful completion.\n * The callback must be called exactly once, ideally on a later tick of the\n * JavaScript event loop.\n *\n * This type of function is also referred to as a \"Node-style async function\",\n * or a \"continuation passing-style function\" (CPS). Most of the methods of this\n * library are themselves CPS/Node-style async functions, or functions that\n * return CPS/Node-style async functions.\n *\n * Wherever we accept a Node-style async function, we also directly accept an\n * [ES2017 `async` function]{@link https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Statements/async_function}.\n * In this case, the `async` function will not be passed a final callback\n * argument, and any thrown error will be used as the `err` argument of the\n * implicit callback, and the return value will be used as the `result` value.\n * (i.e. a `rejected` of the returned Promise becomes the `err` callback\n * argument, and a `resolved` value becomes the `result`.)\n *\n * Note, due to JavaScript limitations, we can only detect native `async`\n * functions and not transpilied implementations.\n * Your environment must have `async`/`await` support for this to work.\n * (e.g. Node > v7.6, or a recent version of a modern browser).\n * If you are using `async` functions through a transpiler (e.g. Babel), you\n * must still wrap the function with [asyncify]{@link module:Utils.asyncify},\n * because the `async function` will be compiled to an ordinary function that\n * returns a promise.\n *\n * @typedef {Function} AsyncFunction\n * @static\n */\n\n var index = {\n apply,\n applyEach: applyEach$1,\n applyEachSeries,\n asyncify,\n auto,\n autoInject,\n cargo,\n cargoQueue: cargo$1,\n compose,\n concat: concat$1,\n concatLimit: concatLimit$1,\n concatSeries: concatSeries$1,\n constant,\n detect: detect$1,\n detectLimit: detectLimit$1,\n detectSeries: detectSeries$1,\n dir,\n doUntil,\n doWhilst: doWhilst$1,\n each,\n eachLimit: eachLimit$2,\n eachOf: eachOf$1,\n eachOfLimit: eachOfLimit$2,\n eachOfSeries: eachOfSeries$1,\n eachSeries: eachSeries$1,\n ensureAsync,\n every: every$1,\n everyLimit: everyLimit$1,\n everySeries: everySeries$1,\n filter: filter$1,\n filterLimit: filterLimit$1,\n filterSeries: filterSeries$1,\n forever: forever$1,\n groupBy,\n groupByLimit: groupByLimit$1,\n groupBySeries,\n log,\n map: map$1,\n mapLimit: mapLimit$1,\n mapSeries: mapSeries$1,\n mapValues,\n mapValuesLimit: mapValuesLimit$1,\n mapValuesSeries,\n memoize,\n nextTick,\n parallel: parallel$1,\n parallelLimit,\n priorityQueue,\n queue: queue$1,\n race: race$1,\n reduce: reduce$1,\n reduceRight,\n reflect,\n reflectAll,\n reject: reject$2,\n rejectLimit: rejectLimit$1,\n rejectSeries: rejectSeries$1,\n retry,\n retryable,\n seq,\n series,\n setImmediate: setImmediate$1,\n some: some$1,\n someLimit: someLimit$1,\n someSeries: someSeries$1,\n sortBy: sortBy$1,\n timeout,\n times,\n timesLimit,\n timesSeries,\n transform,\n tryEach: tryEach$1,\n unmemoize,\n until,\n waterfall: waterfall$1,\n whilst: whilst$1,\n\n // aliases\n all: every$1,\n allLimit: everyLimit$1,\n allSeries: everySeries$1,\n any: some$1,\n anyLimit: someLimit$1,\n anySeries: someSeries$1,\n find: detect$1,\n findLimit: detectLimit$1,\n findSeries: detectSeries$1,\n flatMap: concat$1,\n flatMapLimit: concatLimit$1,\n flatMapSeries: concatSeries$1,\n forEach: each,\n forEachSeries: eachSeries$1,\n forEachLimit: eachLimit$2,\n forEachOf: eachOf$1,\n forEachOfSeries: eachOfSeries$1,\n forEachOfLimit: eachOfLimit$2,\n inject: reduce$1,\n foldl: reduce$1,\n foldr: reduceRight,\n select: filter$1,\n selectLimit: filterLimit$1,\n selectSeries: filterSeries$1,\n wrapSync: asyncify,\n during: whilst$1,\n doDuring: doWhilst$1\n };\n\n exports.default = index;\n exports.apply = apply;\n exports.applyEach = applyEach$1;\n exports.applyEachSeries = applyEachSeries;\n exports.asyncify = asyncify;\n exports.auto = auto;\n exports.autoInject = autoInject;\n exports.cargo = cargo;\n exports.cargoQueue = cargo$1;\n exports.compose = compose;\n exports.concat = concat$1;\n exports.concatLimit = concatLimit$1;\n exports.concatSeries = concatSeries$1;\n exports.constant = constant;\n exports.detect = detect$1;\n exports.detectLimit = detectLimit$1;\n exports.detectSeries = detectSeries$1;\n exports.dir = dir;\n exports.doUntil = doUntil;\n exports.doWhilst = doWhilst$1;\n exports.each = each;\n exports.eachLimit = eachLimit$2;\n exports.eachOf = eachOf$1;\n exports.eachOfLimit = eachOfLimit$2;\n exports.eachOfSeries = eachOfSeries$1;\n exports.eachSeries = eachSeries$1;\n exports.ensureAsync = ensureAsync;\n exports.every = every$1;\n exports.everyLimit = everyLimit$1;\n exports.everySeries = everySeries$1;\n exports.filter = filter$1;\n exports.filterLimit = filterLimit$1;\n exports.filterSeries = filterSeries$1;\n exports.forever = forever$1;\n exports.groupBy = groupBy;\n exports.groupByLimit = groupByLimit$1;\n exports.groupBySeries = groupBySeries;\n exports.log = log;\n exports.map = map$1;\n exports.mapLimit = mapLimit$1;\n exports.mapSeries = mapSeries$1;\n exports.mapValues = mapValues;\n exports.mapValuesLimit = mapValuesLimit$1;\n exports.mapValuesSeries = mapValuesSeries;\n exports.memoize = memoize;\n exports.nextTick = nextTick;\n exports.parallel = parallel$1;\n exports.parallelLimit = parallelLimit;\n exports.priorityQueue = priorityQueue;\n exports.queue = queue$1;\n exports.race = race$1;\n exports.reduce = reduce$1;\n exports.reduceRight = reduceRight;\n exports.reflect = reflect;\n exports.reflectAll = reflectAll;\n exports.reject = reject$2;\n exports.rejectLimit = rejectLimit$1;\n exports.rejectSeries = rejectSeries$1;\n exports.retry = retry;\n exports.retryable = retryable;\n exports.seq = seq;\n exports.series = series;\n exports.setImmediate = setImmediate$1;\n exports.some = some$1;\n exports.someLimit = someLimit$1;\n exports.someSeries = someSeries$1;\n exports.sortBy = sortBy$1;\n exports.timeout = timeout;\n exports.times = times;\n exports.timesLimit = timesLimit;\n exports.timesSeries = timesSeries;\n exports.transform = transform;\n exports.tryEach = tryEach$1;\n exports.unmemoize = unmemoize;\n exports.until = until;\n exports.waterfall = waterfall$1;\n exports.whilst = whilst$1;\n exports.all = every$1;\n exports.allLimit = everyLimit$1;\n exports.allSeries = everySeries$1;\n exports.any = some$1;\n exports.anyLimit = someLimit$1;\n exports.anySeries = someSeries$1;\n exports.find = detect$1;\n exports.findLimit = detectLimit$1;\n exports.findSeries = detectSeries$1;\n exports.flatMap = concat$1;\n exports.flatMapLimit = concatLimit$1;\n exports.flatMapSeries = concatSeries$1;\n exports.forEach = each;\n exports.forEachSeries = eachSeries$1;\n exports.forEachLimit = eachLimit$2;\n exports.forEachOf = eachOf$1;\n exports.forEachOfSeries = eachOfSeries$1;\n exports.forEachOfLimit = eachOfLimit$2;\n exports.inject = reduce$1;\n exports.foldl = reduce$1;\n exports.foldr = reduceRight;\n exports.select = filter$1;\n exports.selectLimit = filterLimit$1;\n exports.selectSeries = filterSeries$1;\n exports.wrapSync = asyncify;\n exports.during = whilst$1;\n exports.doDuring = doWhilst$1;\n\n Object.defineProperty(exports, '__esModule', { value: true });\n\n})));\n","module.exports = r => {\n const n = process.versions.node.split('.').map(x => parseInt(x, 10))\n r = r.split('.').map(x => parseInt(x, 10))\n return n[0] > r[0] || (n[0] === r[0] && (n[1] > r[1] || (n[1] === r[1] && n[2] >= r[2])))\n}\n","'use strict'\n\nconst fs = require('graceful-fs')\nconst path = require('path')\nconst mkdirsSync = require('../mkdirs').mkdirsSync\nconst utimesMillisSync = require('../util/utimes').utimesMillisSync\nconst stat = require('../util/stat')\n\nfunction copySync (src, dest, opts) {\n if (typeof opts === 'function') {\n opts = { filter: opts }\n }\n\n opts = opts || {}\n opts.clobber = 'clobber' in opts ? !!opts.clobber : true // default to true for now\n opts.overwrite = 'overwrite' in opts ? !!opts.overwrite : opts.clobber // overwrite falls back to clobber\n\n // Warn about using preserveTimestamps on 32-bit node\n if (opts.preserveTimestamps && process.arch === 'ia32') {\n console.warn(`fs-extra: Using the preserveTimestamps option in 32-bit node is not recommended;\\n\n see https://github.com/jprichardson/node-fs-extra/issues/269`)\n }\n\n const { srcStat, destStat } = stat.checkPathsSync(src, dest, 'copy')\n stat.checkParentPathsSync(src, srcStat, dest, 'copy')\n return handleFilterAndCopy(destStat, src, dest, opts)\n}\n\nfunction handleFilterAndCopy (destStat, src, dest, opts) {\n if (opts.filter && !opts.filter(src, dest)) return\n const destParent = path.dirname(dest)\n if (!fs.existsSync(destParent)) mkdirsSync(destParent)\n return startCopy(destStat, src, dest, opts)\n}\n\nfunction startCopy (destStat, src, dest, opts) {\n if (opts.filter && !opts.filter(src, dest)) return\n return getStats(destStat, src, dest, opts)\n}\n\nfunction getStats (destStat, src, dest, opts) {\n const statSync = opts.dereference ? fs.statSync : fs.lstatSync\n const srcStat = statSync(src)\n\n if (srcStat.isDirectory()) return onDir(srcStat, destStat, src, dest, opts)\n else if (srcStat.isFile() ||\n srcStat.isCharacterDevice() ||\n srcStat.isBlockDevice()) return onFile(srcStat, destStat, src, dest, opts)\n else if (srcStat.isSymbolicLink()) return onLink(destStat, src, dest, opts)\n}\n\nfunction onFile (srcStat, destStat, src, dest, opts) {\n if (!destStat) return copyFile(srcStat, src, dest, opts)\n return mayCopyFile(srcStat, src, dest, opts)\n}\n\nfunction mayCopyFile (srcStat, src, dest, opts) {\n if (opts.overwrite) {\n fs.unlinkSync(dest)\n return copyFile(srcStat, src, dest, opts)\n } else if (opts.errorOnExist) {\n throw new Error(`'${dest}' already exists`)\n }\n}\n\nfunction copyFile (srcStat, src, dest, opts) {\n fs.copyFileSync(src, dest)\n if (opts.preserveTimestamps) handleTimestamps(srcStat.mode, src, dest)\n return setDestMode(dest, srcStat.mode)\n}\n\nfunction handleTimestamps (srcMode, src, dest) {\n // Make sure the file is writable before setting the timestamp\n // otherwise open fails with EPERM when invoked with 'r+'\n // (through utimes call)\n if (fileIsNotWritable(srcMode)) makeFileWritable(dest, srcMode)\n return setDestTimestamps(src, dest)\n}\n\nfunction fileIsNotWritable (srcMode) {\n return (srcMode & 0o200) === 0\n}\n\nfunction makeFileWritable (dest, srcMode) {\n return setDestMode(dest, srcMode | 0o200)\n}\n\nfunction setDestMode (dest, srcMode) {\n return fs.chmodSync(dest, srcMode)\n}\n\nfunction setDestTimestamps (src, dest) {\n // The initial srcStat.atime cannot be trusted\n // because it is modified by the read(2) system call\n // (See https://nodejs.org/api/fs.html#fs_stat_time_values)\n const updatedSrcStat = fs.statSync(src)\n return utimesMillisSync(dest, updatedSrcStat.atime, updatedSrcStat.mtime)\n}\n\nfunction onDir (srcStat, destStat, src, dest, opts) {\n if (!destStat) return mkDirAndCopy(srcStat.mode, src, dest, opts)\n if (destStat && !destStat.isDirectory()) {\n throw new Error(`Cannot overwrite non-directory '${dest}' with directory '${src}'.`)\n }\n return copyDir(src, dest, opts)\n}\n\nfunction mkDirAndCopy (srcMode, src, dest, opts) {\n fs.mkdirSync(dest)\n copyDir(src, dest, opts)\n return setDestMode(dest, srcMode)\n}\n\nfunction copyDir (src, dest, opts) {\n fs.readdirSync(src).forEach(item => copyDirItem(item, src, dest, opts))\n}\n\nfunction copyDirItem (item, src, dest, opts) {\n const srcItem = path.join(src, item)\n const destItem = path.join(dest, item)\n const { destStat } = stat.checkPathsSync(srcItem, destItem, 'copy')\n return startCopy(destStat, srcItem, destItem, opts)\n}\n\nfunction onLink (destStat, src, dest, opts) {\n let resolvedSrc = fs.readlinkSync(src)\n if (opts.dereference) {\n resolvedSrc = path.resolve(process.cwd(), resolvedSrc)\n }\n\n if (!destStat) {\n return fs.symlinkSync(resolvedSrc, dest)\n } else {\n let resolvedDest\n try {\n resolvedDest = fs.readlinkSync(dest)\n } catch (err) {\n // dest exists and is a regular file or directory,\n // Windows may throw UNKNOWN error. If dest already exists,\n // fs throws error anyway, so no need to guard against it here.\n if (err.code === 'EINVAL' || err.code === 'UNKNOWN') return fs.symlinkSync(resolvedSrc, dest)\n throw err\n }\n if (opts.dereference) {\n resolvedDest = path.resolve(process.cwd(), resolvedDest)\n }\n if (stat.isSrcSubdir(resolvedSrc, resolvedDest)) {\n throw new Error(`Cannot copy '${resolvedSrc}' to a subdirectory of itself, '${resolvedDest}'.`)\n }\n\n // prevent copy if src is a subdir of dest since unlinking\n // dest in this case would result in removing src contents\n // and therefore a broken symlink would be created.\n if (fs.statSync(dest).isDirectory() && stat.isSrcSubdir(resolvedDest, resolvedSrc)) {\n throw new Error(`Cannot overwrite '${resolvedDest}' with '${resolvedSrc}'.`)\n }\n return copyLink(resolvedSrc, dest)\n }\n}\n\nfunction copyLink (resolvedSrc, dest) {\n fs.unlinkSync(dest)\n return fs.symlinkSync(resolvedSrc, dest)\n}\n\nmodule.exports = copySync\n","'use strict'\n\nmodule.exports = {\n copySync: require('./copy-sync')\n}\n","'use strict'\n\nconst fs = require('graceful-fs')\nconst path = require('path')\nconst mkdirs = require('../mkdirs').mkdirs\nconst pathExists = require('../path-exists').pathExists\nconst utimesMillis = require('../util/utimes').utimesMillis\nconst stat = require('../util/stat')\n\nfunction copy (src, dest, opts, cb) {\n if (typeof opts === 'function' && !cb) {\n cb = opts\n opts = {}\n } else if (typeof opts === 'function') {\n opts = { filter: opts }\n }\n\n cb = cb || function () {}\n opts = opts || {}\n\n opts.clobber = 'clobber' in opts ? !!opts.clobber : true // default to true for now\n opts.overwrite = 'overwrite' in opts ? !!opts.overwrite : opts.clobber // overwrite falls back to clobber\n\n // Warn about using preserveTimestamps on 32-bit node\n if (opts.preserveTimestamps && process.arch === 'ia32') {\n console.warn(`fs-extra: Using the preserveTimestamps option in 32-bit node is not recommended;\\n\n see https://github.com/jprichardson/node-fs-extra/issues/269`)\n }\n\n stat.checkPaths(src, dest, 'copy', (err, stats) => {\n if (err) return cb(err)\n const { srcStat, destStat } = stats\n stat.checkParentPaths(src, srcStat, dest, 'copy', err => {\n if (err) return cb(err)\n if (opts.filter) return handleFilter(checkParentDir, destStat, src, dest, opts, cb)\n return checkParentDir(destStat, src, dest, opts, cb)\n })\n })\n}\n\nfunction checkParentDir (destStat, src, dest, opts, cb) {\n const destParent = path.dirname(dest)\n pathExists(destParent, (err, dirExists) => {\n if (err) return cb(err)\n if (dirExists) return startCopy(destStat, src, dest, opts, cb)\n mkdirs(destParent, err => {\n if (err) return cb(err)\n return startCopy(destStat, src, dest, opts, cb)\n })\n })\n}\n\nfunction handleFilter (onInclude, destStat, src, dest, opts, cb) {\n Promise.resolve(opts.filter(src, dest)).then(include => {\n if (include) return onInclude(destStat, src, dest, opts, cb)\n return cb()\n }, error => cb(error))\n}\n\nfunction startCopy (destStat, src, dest, opts, cb) {\n if (opts.filter) return handleFilter(getStats, destStat, src, dest, opts, cb)\n return getStats(destStat, src, dest, opts, cb)\n}\n\nfunction getStats (destStat, src, dest, opts, cb) {\n const stat = opts.dereference ? fs.stat : fs.lstat\n stat(src, (err, srcStat) => {\n if (err) return cb(err)\n\n if (srcStat.isDirectory()) return onDir(srcStat, destStat, src, dest, opts, cb)\n else if (srcStat.isFile() ||\n srcStat.isCharacterDevice() ||\n srcStat.isBlockDevice()) return onFile(srcStat, destStat, src, dest, opts, cb)\n else if (srcStat.isSymbolicLink()) return onLink(destStat, src, dest, opts, cb)\n })\n}\n\nfunction onFile (srcStat, destStat, src, dest, opts, cb) {\n if (!destStat) return copyFile(srcStat, src, dest, opts, cb)\n return mayCopyFile(srcStat, src, dest, opts, cb)\n}\n\nfunction mayCopyFile (srcStat, src, dest, opts, cb) {\n if (opts.overwrite) {\n fs.unlink(dest, err => {\n if (err) return cb(err)\n return copyFile(srcStat, src, dest, opts, cb)\n })\n } else if (opts.errorOnExist) {\n return cb(new Error(`'${dest}' already exists`))\n } else return cb()\n}\n\nfunction copyFile (srcStat, src, dest, opts, cb) {\n fs.copyFile(src, dest, err => {\n if (err) return cb(err)\n if (opts.preserveTimestamps) return handleTimestampsAndMode(srcStat.mode, src, dest, cb)\n return setDestMode(dest, srcStat.mode, cb)\n })\n}\n\nfunction handleTimestampsAndMode (srcMode, src, dest, cb) {\n // Make sure the file is writable before setting the timestamp\n // otherwise open fails with EPERM when invoked with 'r+'\n // (through utimes call)\n if (fileIsNotWritable(srcMode)) {\n return makeFileWritable(dest, srcMode, err => {\n if (err) return cb(err)\n return setDestTimestampsAndMode(srcMode, src, dest, cb)\n })\n }\n return setDestTimestampsAndMode(srcMode, src, dest, cb)\n}\n\nfunction fileIsNotWritable (srcMode) {\n return (srcMode & 0o200) === 0\n}\n\nfunction makeFileWritable (dest, srcMode, cb) {\n return setDestMode(dest, srcMode | 0o200, cb)\n}\n\nfunction setDestTimestampsAndMode (srcMode, src, dest, cb) {\n setDestTimestamps(src, dest, err => {\n if (err) return cb(err)\n return setDestMode(dest, srcMode, cb)\n })\n}\n\nfunction setDestMode (dest, srcMode, cb) {\n return fs.chmod(dest, srcMode, cb)\n}\n\nfunction setDestTimestamps (src, dest, cb) {\n // The initial srcStat.atime cannot be trusted\n // because it is modified by the read(2) system call\n // (See https://nodejs.org/api/fs.html#fs_stat_time_values)\n fs.stat(src, (err, updatedSrcStat) => {\n if (err) return cb(err)\n return utimesMillis(dest, updatedSrcStat.atime, updatedSrcStat.mtime, cb)\n })\n}\n\nfunction onDir (srcStat, destStat, src, dest, opts, cb) {\n if (!destStat) return mkDirAndCopy(srcStat.mode, src, dest, opts, cb)\n if (destStat && !destStat.isDirectory()) {\n return cb(new Error(`Cannot overwrite non-directory '${dest}' with directory '${src}'.`))\n }\n return copyDir(src, dest, opts, cb)\n}\n\nfunction mkDirAndCopy (srcMode, src, dest, opts, cb) {\n fs.mkdir(dest, err => {\n if (err) return cb(err)\n copyDir(src, dest, opts, err => {\n if (err) return cb(err)\n return setDestMode(dest, srcMode, cb)\n })\n })\n}\n\nfunction copyDir (src, dest, opts, cb) {\n fs.readdir(src, (err, items) => {\n if (err) return cb(err)\n return copyDirItems(items, src, dest, opts, cb)\n })\n}\n\nfunction copyDirItems (items, src, dest, opts, cb) {\n const item = items.pop()\n if (!item) return cb()\n return copyDirItem(items, item, src, dest, opts, cb)\n}\n\nfunction copyDirItem (items, item, src, dest, opts, cb) {\n const srcItem = path.join(src, item)\n const destItem = path.join(dest, item)\n stat.checkPaths(srcItem, destItem, 'copy', (err, stats) => {\n if (err) return cb(err)\n const { destStat } = stats\n startCopy(destStat, srcItem, destItem, opts, err => {\n if (err) return cb(err)\n return copyDirItems(items, src, dest, opts, cb)\n })\n })\n}\n\nfunction onLink (destStat, src, dest, opts, cb) {\n fs.readlink(src, (err, resolvedSrc) => {\n if (err) return cb(err)\n if (opts.dereference) {\n resolvedSrc = path.resolve(process.cwd(), resolvedSrc)\n }\n\n if (!destStat) {\n return fs.symlink(resolvedSrc, dest, cb)\n } else {\n fs.readlink(dest, (err, resolvedDest) => {\n if (err) {\n // dest exists and is a regular file or directory,\n // Windows may throw UNKNOWN error. If dest already exists,\n // fs throws error anyway, so no need to guard against it here.\n if (err.code === 'EINVAL' || err.code === 'UNKNOWN') return fs.symlink(resolvedSrc, dest, cb)\n return cb(err)\n }\n if (opts.dereference) {\n resolvedDest = path.resolve(process.cwd(), resolvedDest)\n }\n if (stat.isSrcSubdir(resolvedSrc, resolvedDest)) {\n return cb(new Error(`Cannot copy '${resolvedSrc}' to a subdirectory of itself, '${resolvedDest}'.`))\n }\n\n // do not copy if src is a subdir of dest since unlinking\n // dest in this case would result in removing src contents\n // and therefore a broken symlink would be created.\n if (destStat.isDirectory() && stat.isSrcSubdir(resolvedDest, resolvedSrc)) {\n return cb(new Error(`Cannot overwrite '${resolvedDest}' with '${resolvedSrc}'.`))\n }\n return copyLink(resolvedSrc, dest, cb)\n })\n }\n })\n}\n\nfunction copyLink (resolvedSrc, dest, cb) {\n fs.unlink(dest, err => {\n if (err) return cb(err)\n return fs.symlink(resolvedSrc, dest, cb)\n })\n}\n\nmodule.exports = copy\n","'use strict'\n\nconst u = require('universalify').fromCallback\nmodule.exports = {\n copy: u(require('./copy'))\n}\n","'use strict'\n\nconst u = require('universalify').fromCallback\nconst fs = require('graceful-fs')\nconst path = require('path')\nconst mkdir = require('../mkdirs')\nconst remove = require('../remove')\n\nconst emptyDir = u(function emptyDir (dir, callback) {\n callback = callback || function () {}\n fs.readdir(dir, (err, items) => {\n if (err) return mkdir.mkdirs(dir, callback)\n\n items = items.map(item => path.join(dir, item))\n\n deleteItem()\n\n function deleteItem () {\n const item = items.pop()\n if (!item) return callback()\n remove.remove(item, err => {\n if (err) return callback(err)\n deleteItem()\n })\n }\n })\n})\n\nfunction emptyDirSync (dir) {\n let items\n try {\n items = fs.readdirSync(dir)\n } catch {\n return mkdir.mkdirsSync(dir)\n }\n\n items.forEach(item => {\n item = path.join(dir, item)\n remove.removeSync(item)\n })\n}\n\nmodule.exports = {\n emptyDirSync,\n emptydirSync: emptyDirSync,\n emptyDir,\n emptydir: emptyDir\n}\n","'use strict'\n\nconst u = require('universalify').fromCallback\nconst path = require('path')\nconst fs = require('graceful-fs')\nconst mkdir = require('../mkdirs')\n\nfunction createFile (file, callback) {\n function makeFile () {\n fs.writeFile(file, '', err => {\n if (err) return callback(err)\n callback()\n })\n }\n\n fs.stat(file, (err, stats) => { // eslint-disable-line handle-callback-err\n if (!err && stats.isFile()) return callback()\n const dir = path.dirname(file)\n fs.stat(dir, (err, stats) => {\n if (err) {\n // if the directory doesn't exist, make it\n if (err.code === 'ENOENT') {\n return mkdir.mkdirs(dir, err => {\n if (err) return callback(err)\n makeFile()\n })\n }\n return callback(err)\n }\n\n if (stats.isDirectory()) makeFile()\n else {\n // parent is not a directory\n // This is just to cause an internal ENOTDIR error to be thrown\n fs.readdir(dir, err => {\n if (err) return callback(err)\n })\n }\n })\n })\n}\n\nfunction createFileSync (file) {\n let stats\n try {\n stats = fs.statSync(file)\n } catch {}\n if (stats && stats.isFile()) return\n\n const dir = path.dirname(file)\n try {\n if (!fs.statSync(dir).isDirectory()) {\n // parent is not a directory\n // This is just to cause an internal ENOTDIR error to be thrown\n fs.readdirSync(dir)\n }\n } catch (err) {\n // If the stat call above failed because the directory doesn't exist, create it\n if (err && err.code === 'ENOENT') mkdir.mkdirsSync(dir)\n else throw err\n }\n\n fs.writeFileSync(file, '')\n}\n\nmodule.exports = {\n createFile: u(createFile),\n createFileSync\n}\n","'use strict'\n\nconst file = require('./file')\nconst link = require('./link')\nconst symlink = require('./symlink')\n\nmodule.exports = {\n // file\n createFile: file.createFile,\n createFileSync: file.createFileSync,\n ensureFile: file.createFile,\n ensureFileSync: file.createFileSync,\n // link\n createLink: link.createLink,\n createLinkSync: link.createLinkSync,\n ensureLink: link.createLink,\n ensureLinkSync: link.createLinkSync,\n // symlink\n createSymlink: symlink.createSymlink,\n createSymlinkSync: symlink.createSymlinkSync,\n ensureSymlink: symlink.createSymlink,\n ensureSymlinkSync: symlink.createSymlinkSync\n}\n","'use strict'\n\nconst u = require('universalify').fromCallback\nconst path = require('path')\nconst fs = require('graceful-fs')\nconst mkdir = require('../mkdirs')\nconst pathExists = require('../path-exists').pathExists\n\nfunction createLink (srcpath, dstpath, callback) {\n function makeLink (srcpath, dstpath) {\n fs.link(srcpath, dstpath, err => {\n if (err) return callback(err)\n callback(null)\n })\n }\n\n pathExists(dstpath, (err, destinationExists) => {\n if (err) return callback(err)\n if (destinationExists) return callback(null)\n fs.lstat(srcpath, (err) => {\n if (err) {\n err.message = err.message.replace('lstat', 'ensureLink')\n return callback(err)\n }\n\n const dir = path.dirname(dstpath)\n pathExists(dir, (err, dirExists) => {\n if (err) return callback(err)\n if (dirExists) return makeLink(srcpath, dstpath)\n mkdir.mkdirs(dir, err => {\n if (err) return callback(err)\n makeLink(srcpath, dstpath)\n })\n })\n })\n })\n}\n\nfunction createLinkSync (srcpath, dstpath) {\n const destinationExists = fs.existsSync(dstpath)\n if (destinationExists) return undefined\n\n try {\n fs.lstatSync(srcpath)\n } catch (err) {\n err.message = err.message.replace('lstat', 'ensureLink')\n throw err\n }\n\n const dir = path.dirname(dstpath)\n const dirExists = fs.existsSync(dir)\n if (dirExists) return fs.linkSync(srcpath, dstpath)\n mkdir.mkdirsSync(dir)\n\n return fs.linkSync(srcpath, dstpath)\n}\n\nmodule.exports = {\n createLink: u(createLink),\n createLinkSync\n}\n","'use strict'\n\nconst path = require('path')\nconst fs = require('graceful-fs')\nconst pathExists = require('../path-exists').pathExists\n\n/**\n * Function that returns two types of paths, one relative to symlink, and one\n * relative to the current working directory. Checks if path is absolute or\n * relative. If the path is relative, this function checks if the path is\n * relative to symlink or relative to current working directory. This is an\n * initiative to find a smarter `srcpath` to supply when building symlinks.\n * This allows you to determine which path to use out of one of three possible\n * types of source paths. The first is an absolute path. This is detected by\n * `path.isAbsolute()`. When an absolute path is provided, it is checked to\n * see if it exists. If it does it's used, if not an error is returned\n * (callback)/ thrown (sync). The other two options for `srcpath` are a\n * relative url. By default Node's `fs.symlink` works by creating a symlink\n * using `dstpath` and expects the `srcpath` to be relative to the newly\n * created symlink. If you provide a `srcpath` that does not exist on the file\n * system it results in a broken symlink. To minimize this, the function\n * checks to see if the 'relative to symlink' source file exists, and if it\n * does it will use it. If it does not, it checks if there's a file that\n * exists that is relative to the current working directory, if does its used.\n * This preserves the expectations of the original fs.symlink spec and adds\n * the ability to pass in `relative to current working direcotry` paths.\n */\n\nfunction symlinkPaths (srcpath, dstpath, callback) {\n if (path.isAbsolute(srcpath)) {\n return fs.lstat(srcpath, (err) => {\n if (err) {\n err.message = err.message.replace('lstat', 'ensureSymlink')\n return callback(err)\n }\n return callback(null, {\n toCwd: srcpath,\n toDst: srcpath\n })\n })\n } else {\n const dstdir = path.dirname(dstpath)\n const relativeToDst = path.join(dstdir, srcpath)\n return pathExists(relativeToDst, (err, exists) => {\n if (err) return callback(err)\n if (exists) {\n return callback(null, {\n toCwd: relativeToDst,\n toDst: srcpath\n })\n } else {\n return fs.lstat(srcpath, (err) => {\n if (err) {\n err.message = err.message.replace('lstat', 'ensureSymlink')\n return callback(err)\n }\n return callback(null, {\n toCwd: srcpath,\n toDst: path.relative(dstdir, srcpath)\n })\n })\n }\n })\n }\n}\n\nfunction symlinkPathsSync (srcpath, dstpath) {\n let exists\n if (path.isAbsolute(srcpath)) {\n exists = fs.existsSync(srcpath)\n if (!exists) throw new Error('absolute srcpath does not exist')\n return {\n toCwd: srcpath,\n toDst: srcpath\n }\n } else {\n const dstdir = path.dirname(dstpath)\n const relativeToDst = path.join(dstdir, srcpath)\n exists = fs.existsSync(relativeToDst)\n if (exists) {\n return {\n toCwd: relativeToDst,\n toDst: srcpath\n }\n } else {\n exists = fs.existsSync(srcpath)\n if (!exists) throw new Error('relative srcpath does not exist')\n return {\n toCwd: srcpath,\n toDst: path.relative(dstdir, srcpath)\n }\n }\n }\n}\n\nmodule.exports = {\n symlinkPaths,\n symlinkPathsSync\n}\n","'use strict'\n\nconst fs = require('graceful-fs')\n\nfunction symlinkType (srcpath, type, callback) {\n callback = (typeof type === 'function') ? type : callback\n type = (typeof type === 'function') ? false : type\n if (type) return callback(null, type)\n fs.lstat(srcpath, (err, stats) => {\n if (err) return callback(null, 'file')\n type = (stats && stats.isDirectory()) ? 'dir' : 'file'\n callback(null, type)\n })\n}\n\nfunction symlinkTypeSync (srcpath, type) {\n let stats\n\n if (type) return type\n try {\n stats = fs.lstatSync(srcpath)\n } catch {\n return 'file'\n }\n return (stats && stats.isDirectory()) ? 'dir' : 'file'\n}\n\nmodule.exports = {\n symlinkType,\n symlinkTypeSync\n}\n","'use strict'\n\nconst u = require('universalify').fromCallback\nconst path = require('path')\nconst fs = require('graceful-fs')\nconst _mkdirs = require('../mkdirs')\nconst mkdirs = _mkdirs.mkdirs\nconst mkdirsSync = _mkdirs.mkdirsSync\n\nconst _symlinkPaths = require('./symlink-paths')\nconst symlinkPaths = _symlinkPaths.symlinkPaths\nconst symlinkPathsSync = _symlinkPaths.symlinkPathsSync\n\nconst _symlinkType = require('./symlink-type')\nconst symlinkType = _symlinkType.symlinkType\nconst symlinkTypeSync = _symlinkType.symlinkTypeSync\n\nconst pathExists = require('../path-exists').pathExists\n\nfunction createSymlink (srcpath, dstpath, type, callback) {\n callback = (typeof type === 'function') ? type : callback\n type = (typeof type === 'function') ? false : type\n\n pathExists(dstpath, (err, destinationExists) => {\n if (err) return callback(err)\n if (destinationExists) return callback(null)\n symlinkPaths(srcpath, dstpath, (err, relative) => {\n if (err) return callback(err)\n srcpath = relative.toDst\n symlinkType(relative.toCwd, type, (err, type) => {\n if (err) return callback(err)\n const dir = path.dirname(dstpath)\n pathExists(dir, (err, dirExists) => {\n if (err) return callback(err)\n if (dirExists) return fs.symlink(srcpath, dstpath, type, callback)\n mkdirs(dir, err => {\n if (err) return callback(err)\n fs.symlink(srcpath, dstpath, type, callback)\n })\n })\n })\n })\n })\n}\n\nfunction createSymlinkSync (srcpath, dstpath, type) {\n const destinationExists = fs.existsSync(dstpath)\n if (destinationExists) return undefined\n\n const relative = symlinkPathsSync(srcpath, dstpath)\n srcpath = relative.toDst\n type = symlinkTypeSync(relative.toCwd, type)\n const dir = path.dirname(dstpath)\n const exists = fs.existsSync(dir)\n if (exists) return fs.symlinkSync(srcpath, dstpath, type)\n mkdirsSync(dir)\n return fs.symlinkSync(srcpath, dstpath, type)\n}\n\nmodule.exports = {\n createSymlink: u(createSymlink),\n createSymlinkSync\n}\n","'use strict'\n// This is adapted from https://github.com/normalize/mz\n// Copyright (c) 2014-2016 Jonathan Ong me@jongleberry.com and Contributors\nconst u = require('universalify').fromCallback\nconst fs = require('graceful-fs')\n\nconst api = [\n 'access',\n 'appendFile',\n 'chmod',\n 'chown',\n 'close',\n 'copyFile',\n 'fchmod',\n 'fchown',\n 'fdatasync',\n 'fstat',\n 'fsync',\n 'ftruncate',\n 'futimes',\n 'lchmod',\n 'lchown',\n 'link',\n 'lstat',\n 'mkdir',\n 'mkdtemp',\n 'open',\n 'opendir',\n 'readdir',\n 'readFile',\n 'readlink',\n 'realpath',\n 'rename',\n 'rmdir',\n 'stat',\n 'symlink',\n 'truncate',\n 'unlink',\n 'utimes',\n 'writeFile'\n].filter(key => {\n // Some commands are not available on some systems. Ex:\n // fs.opendir was added in Node.js v12.12.0\n // fs.lchown is not available on at least some Linux\n return typeof fs[key] === 'function'\n})\n\n// Export all keys:\nObject.keys(fs).forEach(key => {\n if (key === 'promises') {\n // fs.promises is a getter property that triggers ExperimentalWarning\n // Don't re-export it here, the getter is defined in \"lib/index.js\"\n return\n }\n exports[key] = fs[key]\n})\n\n// Universalify async methods:\napi.forEach(method => {\n exports[method] = u(fs[method])\n})\n\n// We differ from mz/fs in that we still ship the old, broken, fs.exists()\n// since we are a drop-in replacement for the native module\nexports.exists = function (filename, callback) {\n if (typeof callback === 'function') {\n return fs.exists(filename, callback)\n }\n return new Promise(resolve => {\n return fs.exists(filename, resolve)\n })\n}\n\n// fs.read(), fs.write(), & fs.writev() need special treatment due to multiple callback args\n\nexports.read = function (fd, buffer, offset, length, position, callback) {\n if (typeof callback === 'function') {\n return fs.read(fd, buffer, offset, length, position, callback)\n }\n return new Promise((resolve, reject) => {\n fs.read(fd, buffer, offset, length, position, (err, bytesRead, buffer) => {\n if (err) return reject(err)\n resolve({ bytesRead, buffer })\n })\n })\n}\n\n// Function signature can be\n// fs.write(fd, buffer[, offset[, length[, position]]], callback)\n// OR\n// fs.write(fd, string[, position[, encoding]], callback)\n// We need to handle both cases, so we use ...args\nexports.write = function (fd, buffer, ...args) {\n if (typeof args[args.length - 1] === 'function') {\n return fs.write(fd, buffer, ...args)\n }\n\n return new Promise((resolve, reject) => {\n fs.write(fd, buffer, ...args, (err, bytesWritten, buffer) => {\n if (err) return reject(err)\n resolve({ bytesWritten, buffer })\n })\n })\n}\n\n// fs.writev only available in Node v12.9.0+\nif (typeof fs.writev === 'function') {\n // Function signature is\n // s.writev(fd, buffers[, position], callback)\n // We need to handle the optional arg, so we use ...args\n exports.writev = function (fd, buffers, ...args) {\n if (typeof args[args.length - 1] === 'function') {\n return fs.writev(fd, buffers, ...args)\n }\n\n return new Promise((resolve, reject) => {\n fs.writev(fd, buffers, ...args, (err, bytesWritten, buffers) => {\n if (err) return reject(err)\n resolve({ bytesWritten, buffers })\n })\n })\n }\n}\n\n// fs.realpath.native only available in Node v9.2+\nif (typeof fs.realpath.native === 'function') {\n exports.realpath.native = u(fs.realpath.native)\n}\n","'use strict'\n\nmodule.exports = {\n // Export promiseified graceful-fs:\n ...require('./fs'),\n // Export extra methods:\n ...require('./copy-sync'),\n ...require('./copy'),\n ...require('./empty'),\n ...require('./ensure'),\n ...require('./json'),\n ...require('./mkdirs'),\n ...require('./move-sync'),\n ...require('./move'),\n ...require('./output'),\n ...require('./path-exists'),\n ...require('./remove')\n}\n\n// Export fs.promises as a getter property so that we don't trigger\n// ExperimentalWarning before fs.promises is actually accessed.\nconst fs = require('fs')\nif (Object.getOwnPropertyDescriptor(fs, 'promises')) {\n Object.defineProperty(module.exports, 'promises', {\n get () { return fs.promises }\n })\n}\n","'use strict'\n\nconst u = require('universalify').fromPromise\nconst jsonFile = require('./jsonfile')\n\njsonFile.outputJson = u(require('./output-json'))\njsonFile.outputJsonSync = require('./output-json-sync')\n// aliases\njsonFile.outputJSON = jsonFile.outputJson\njsonFile.outputJSONSync = jsonFile.outputJsonSync\njsonFile.writeJSON = jsonFile.writeJson\njsonFile.writeJSONSync = jsonFile.writeJsonSync\njsonFile.readJSON = jsonFile.readJson\njsonFile.readJSONSync = jsonFile.readJsonSync\n\nmodule.exports = jsonFile\n","'use strict'\n\nconst jsonFile = require('jsonfile')\n\nmodule.exports = {\n // jsonfile exports\n readJson: jsonFile.readFile,\n readJsonSync: jsonFile.readFileSync,\n writeJson: jsonFile.writeFile,\n writeJsonSync: jsonFile.writeFileSync\n}\n","'use strict'\n\nconst { stringify } = require('jsonfile/utils')\nconst { outputFileSync } = require('../output')\n\nfunction outputJsonSync (file, data, options) {\n const str = stringify(data, options)\n\n outputFileSync(file, str, options)\n}\n\nmodule.exports = outputJsonSync\n","'use strict'\n\nconst { stringify } = require('jsonfile/utils')\nconst { outputFile } = require('../output')\n\nasync function outputJson (file, data, options = {}) {\n const str = stringify(data, options)\n\n await outputFile(file, str, options)\n}\n\nmodule.exports = outputJson\n","'use strict'\nconst u = require('universalify').fromPromise\nconst { makeDir: _makeDir, makeDirSync } = require('./make-dir')\nconst makeDir = u(_makeDir)\n\nmodule.exports = {\n mkdirs: makeDir,\n mkdirsSync: makeDirSync,\n // alias\n mkdirp: makeDir,\n mkdirpSync: makeDirSync,\n ensureDir: makeDir,\n ensureDirSync: makeDirSync\n}\n","// Adapted from https://github.com/sindresorhus/make-dir\n// Copyright (c) Sindre Sorhus (sindresorhus.com)\n// Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the \"Software\"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:\n// The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.\n// THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.\n'use strict'\nconst fs = require('../fs')\nconst path = require('path')\nconst atLeastNode = require('at-least-node')\n\nconst useNativeRecursiveOption = atLeastNode('10.12.0')\n\n// https://github.com/nodejs/node/issues/8987\n// https://github.com/libuv/libuv/pull/1088\nconst checkPath = pth => {\n if (process.platform === 'win32') {\n const pathHasInvalidWinCharacters = /[<>:\"|?*]/.test(pth.replace(path.parse(pth).root, ''))\n\n if (pathHasInvalidWinCharacters) {\n const error = new Error(`Path contains invalid characters: ${pth}`)\n error.code = 'EINVAL'\n throw error\n }\n }\n}\n\nconst processOptions = options => {\n const defaults = { mode: 0o777 }\n if (typeof options === 'number') options = { mode: options }\n return { ...defaults, ...options }\n}\n\nconst permissionError = pth => {\n // This replicates the exception of `fs.mkdir` with native the\n // `recusive` option when run on an invalid drive under Windows.\n const error = new Error(`operation not permitted, mkdir '${pth}'`)\n error.code = 'EPERM'\n error.errno = -4048\n error.path = pth\n error.syscall = 'mkdir'\n return error\n}\n\nmodule.exports.makeDir = async (input, options) => {\n checkPath(input)\n options = processOptions(options)\n\n if (useNativeRecursiveOption) {\n const pth = path.resolve(input)\n\n return fs.mkdir(pth, {\n mode: options.mode,\n recursive: true\n })\n }\n\n const make = async pth => {\n try {\n await fs.mkdir(pth, options.mode)\n } catch (error) {\n if (error.code === 'EPERM') {\n throw error\n }\n\n if (error.code === 'ENOENT') {\n if (path.dirname(pth) === pth) {\n throw permissionError(pth)\n }\n\n if (error.message.includes('null bytes')) {\n throw error\n }\n\n await make(path.dirname(pth))\n return make(pth)\n }\n\n try {\n const stats = await fs.stat(pth)\n if (!stats.isDirectory()) {\n // This error is never exposed to the user\n // it is caught below, and the original error is thrown\n throw new Error('The path is not a directory')\n }\n } catch {\n throw error\n }\n }\n }\n\n return make(path.resolve(input))\n}\n\nmodule.exports.makeDirSync = (input, options) => {\n checkPath(input)\n options = processOptions(options)\n\n if (useNativeRecursiveOption) {\n const pth = path.resolve(input)\n\n return fs.mkdirSync(pth, {\n mode: options.mode,\n recursive: true\n })\n }\n\n const make = pth => {\n try {\n fs.mkdirSync(pth, options.mode)\n } catch (error) {\n if (error.code === 'EPERM') {\n throw error\n }\n\n if (error.code === 'ENOENT') {\n if (path.dirname(pth) === pth) {\n throw permissionError(pth)\n }\n\n if (error.message.includes('null bytes')) {\n throw error\n }\n\n make(path.dirname(pth))\n return make(pth)\n }\n\n try {\n if (!fs.statSync(pth).isDirectory()) {\n // This error is never exposed to the user\n // it is caught below, and the original error is thrown\n throw new Error('The path is not a directory')\n }\n } catch {\n throw error\n }\n }\n }\n\n return make(path.resolve(input))\n}\n","'use strict'\n\nmodule.exports = {\n moveSync: require('./move-sync')\n}\n","'use strict'\n\nconst fs = require('graceful-fs')\nconst path = require('path')\nconst copySync = require('../copy-sync').copySync\nconst removeSync = require('../remove').removeSync\nconst mkdirpSync = require('../mkdirs').mkdirpSync\nconst stat = require('../util/stat')\n\nfunction moveSync (src, dest, opts) {\n opts = opts || {}\n const overwrite = opts.overwrite || opts.clobber || false\n\n const { srcStat } = stat.checkPathsSync(src, dest, 'move')\n stat.checkParentPathsSync(src, srcStat, dest, 'move')\n mkdirpSync(path.dirname(dest))\n return doRename(src, dest, overwrite)\n}\n\nfunction doRename (src, dest, overwrite) {\n if (overwrite) {\n removeSync(dest)\n return rename(src, dest, overwrite)\n }\n if (fs.existsSync(dest)) throw new Error('dest already exists.')\n return rename(src, dest, overwrite)\n}\n\nfunction rename (src, dest, overwrite) {\n try {\n fs.renameSync(src, dest)\n } catch (err) {\n if (err.code !== 'EXDEV') throw err\n return moveAcrossDevice(src, dest, overwrite)\n }\n}\n\nfunction moveAcrossDevice (src, dest, overwrite) {\n const opts = {\n overwrite,\n errorOnExist: true\n }\n copySync(src, dest, opts)\n return removeSync(src)\n}\n\nmodule.exports = moveSync\n","'use strict'\n\nconst u = require('universalify').fromCallback\nmodule.exports = {\n move: u(require('./move'))\n}\n","'use strict'\n\nconst fs = require('graceful-fs')\nconst path = require('path')\nconst copy = require('../copy').copy\nconst remove = require('../remove').remove\nconst mkdirp = require('../mkdirs').mkdirp\nconst pathExists = require('../path-exists').pathExists\nconst stat = require('../util/stat')\n\nfunction move (src, dest, opts, cb) {\n if (typeof opts === 'function') {\n cb = opts\n opts = {}\n }\n\n const overwrite = opts.overwrite || opts.clobber || false\n\n stat.checkPaths(src, dest, 'move', (err, stats) => {\n if (err) return cb(err)\n const { srcStat } = stats\n stat.checkParentPaths(src, srcStat, dest, 'move', err => {\n if (err) return cb(err)\n mkdirp(path.dirname(dest), err => {\n if (err) return cb(err)\n return doRename(src, dest, overwrite, cb)\n })\n })\n })\n}\n\nfunction doRename (src, dest, overwrite, cb) {\n if (overwrite) {\n return remove(dest, err => {\n if (err) return cb(err)\n return rename(src, dest, overwrite, cb)\n })\n }\n pathExists(dest, (err, destExists) => {\n if (err) return cb(err)\n if (destExists) return cb(new Error('dest already exists.'))\n return rename(src, dest, overwrite, cb)\n })\n}\n\nfunction rename (src, dest, overwrite, cb) {\n fs.rename(src, dest, err => {\n if (!err) return cb()\n if (err.code !== 'EXDEV') return cb(err)\n return moveAcrossDevice(src, dest, overwrite, cb)\n })\n}\n\nfunction moveAcrossDevice (src, dest, overwrite, cb) {\n const opts = {\n overwrite,\n errorOnExist: true\n }\n copy(src, dest, opts, err => {\n if (err) return cb(err)\n return remove(src, cb)\n })\n}\n\nmodule.exports = move\n","'use strict'\n\nconst u = require('universalify').fromCallback\nconst fs = require('graceful-fs')\nconst path = require('path')\nconst mkdir = require('../mkdirs')\nconst pathExists = require('../path-exists').pathExists\n\nfunction outputFile (file, data, encoding, callback) {\n if (typeof encoding === 'function') {\n callback = encoding\n encoding = 'utf8'\n }\n\n const dir = path.dirname(file)\n pathExists(dir, (err, itDoes) => {\n if (err) return callback(err)\n if (itDoes) return fs.writeFile(file, data, encoding, callback)\n\n mkdir.mkdirs(dir, err => {\n if (err) return callback(err)\n\n fs.writeFile(file, data, encoding, callback)\n })\n })\n}\n\nfunction outputFileSync (file, ...args) {\n const dir = path.dirname(file)\n if (fs.existsSync(dir)) {\n return fs.writeFileSync(file, ...args)\n }\n mkdir.mkdirsSync(dir)\n fs.writeFileSync(file, ...args)\n}\n\nmodule.exports = {\n outputFile: u(outputFile),\n outputFileSync\n}\n","'use strict'\nconst u = require('universalify').fromPromise\nconst fs = require('../fs')\n\nfunction pathExists (path) {\n return fs.access(path).then(() => true).catch(() => false)\n}\n\nmodule.exports = {\n pathExists: u(pathExists),\n pathExistsSync: fs.existsSync\n}\n","'use strict'\n\nconst u = require('universalify').fromCallback\nconst rimraf = require('./rimraf')\n\nmodule.exports = {\n remove: u(rimraf),\n removeSync: rimraf.sync\n}\n","'use strict'\n\nconst fs = require('graceful-fs')\nconst path = require('path')\nconst assert = require('assert')\n\nconst isWindows = (process.platform === 'win32')\n\nfunction defaults (options) {\n const methods = [\n 'unlink',\n 'chmod',\n 'stat',\n 'lstat',\n 'rmdir',\n 'readdir'\n ]\n methods.forEach(m => {\n options[m] = options[m] || fs[m]\n m = m + 'Sync'\n options[m] = options[m] || fs[m]\n })\n\n options.maxBusyTries = options.maxBusyTries || 3\n}\n\nfunction rimraf (p, options, cb) {\n let busyTries = 0\n\n if (typeof options === 'function') {\n cb = options\n options = {}\n }\n\n assert(p, 'rimraf: missing path')\n assert.strictEqual(typeof p, 'string', 'rimraf: path should be a string')\n assert.strictEqual(typeof cb, 'function', 'rimraf: callback function required')\n assert(options, 'rimraf: invalid options argument provided')\n assert.strictEqual(typeof options, 'object', 'rimraf: options should be object')\n\n defaults(options)\n\n rimraf_(p, options, function CB (er) {\n if (er) {\n if ((er.code === 'EBUSY' || er.code === 'ENOTEMPTY' || er.code === 'EPERM') &&\n busyTries < options.maxBusyTries) {\n busyTries++\n const time = busyTries * 100\n // try again, with the same exact callback as this one.\n return setTimeout(() => rimraf_(p, options, CB), time)\n }\n\n // already gone\n if (er.code === 'ENOENT') er = null\n }\n\n cb(er)\n })\n}\n\n// Two possible strategies.\n// 1. Assume it's a file. unlink it, then do the dir stuff on EPERM or EISDIR\n// 2. Assume it's a directory. readdir, then do the file stuff on ENOTDIR\n//\n// Both result in an extra syscall when you guess wrong. However, there\n// are likely far more normal files in the world than directories. This\n// is based on the assumption that a the average number of files per\n// directory is >= 1.\n//\n// If anyone ever complains about this, then I guess the strategy could\n// be made configurable somehow. But until then, YAGNI.\nfunction rimraf_ (p, options, cb) {\n assert(p)\n assert(options)\n assert(typeof cb === 'function')\n\n // sunos lets the root user unlink directories, which is... weird.\n // so we have to lstat here and make sure it's not a dir.\n options.lstat(p, (er, st) => {\n if (er && er.code === 'ENOENT') {\n return cb(null)\n }\n\n // Windows can EPERM on stat. Life is suffering.\n if (er && er.code === 'EPERM' && isWindows) {\n return fixWinEPERM(p, options, er, cb)\n }\n\n if (st && st.isDirectory()) {\n return rmdir(p, options, er, cb)\n }\n\n options.unlink(p, er => {\n if (er) {\n if (er.code === 'ENOENT') {\n return cb(null)\n }\n if (er.code === 'EPERM') {\n return (isWindows)\n ? fixWinEPERM(p, options, er, cb)\n : rmdir(p, options, er, cb)\n }\n if (er.code === 'EISDIR') {\n return rmdir(p, options, er, cb)\n }\n }\n return cb(er)\n })\n })\n}\n\nfunction fixWinEPERM (p, options, er, cb) {\n assert(p)\n assert(options)\n assert(typeof cb === 'function')\n\n options.chmod(p, 0o666, er2 => {\n if (er2) {\n cb(er2.code === 'ENOENT' ? null : er)\n } else {\n options.stat(p, (er3, stats) => {\n if (er3) {\n cb(er3.code === 'ENOENT' ? null : er)\n } else if (stats.isDirectory()) {\n rmdir(p, options, er, cb)\n } else {\n options.unlink(p, cb)\n }\n })\n }\n })\n}\n\nfunction fixWinEPERMSync (p, options, er) {\n let stats\n\n assert(p)\n assert(options)\n\n try {\n options.chmodSync(p, 0o666)\n } catch (er2) {\n if (er2.code === 'ENOENT') {\n return\n } else {\n throw er\n }\n }\n\n try {\n stats = options.statSync(p)\n } catch (er3) {\n if (er3.code === 'ENOENT') {\n return\n } else {\n throw er\n }\n }\n\n if (stats.isDirectory()) {\n rmdirSync(p, options, er)\n } else {\n options.unlinkSync(p)\n }\n}\n\nfunction rmdir (p, options, originalEr, cb) {\n assert(p)\n assert(options)\n assert(typeof cb === 'function')\n\n // try to rmdir first, and only readdir on ENOTEMPTY or EEXIST (SunOS)\n // if we guessed wrong, and it's not a directory, then\n // raise the original error.\n options.rmdir(p, er => {\n if (er && (er.code === 'ENOTEMPTY' || er.code === 'EEXIST' || er.code === 'EPERM')) {\n rmkids(p, options, cb)\n } else if (er && er.code === 'ENOTDIR') {\n cb(originalEr)\n } else {\n cb(er)\n }\n })\n}\n\nfunction rmkids (p, options, cb) {\n assert(p)\n assert(options)\n assert(typeof cb === 'function')\n\n options.readdir(p, (er, files) => {\n if (er) return cb(er)\n\n let n = files.length\n let errState\n\n if (n === 0) return options.rmdir(p, cb)\n\n files.forEach(f => {\n rimraf(path.join(p, f), options, er => {\n if (errState) {\n return\n }\n if (er) return cb(errState = er)\n if (--n === 0) {\n options.rmdir(p, cb)\n }\n })\n })\n })\n}\n\n// this looks simpler, and is strictly *faster*, but will\n// tie up the JavaScript thread and fail on excessively\n// deep directory trees.\nfunction rimrafSync (p, options) {\n let st\n\n options = options || {}\n defaults(options)\n\n assert(p, 'rimraf: missing path')\n assert.strictEqual(typeof p, 'string', 'rimraf: path should be a string')\n assert(options, 'rimraf: missing options')\n assert.strictEqual(typeof options, 'object', 'rimraf: options should be object')\n\n try {\n st = options.lstatSync(p)\n } catch (er) {\n if (er.code === 'ENOENT') {\n return\n }\n\n // Windows can EPERM on stat. Life is suffering.\n if (er.code === 'EPERM' && isWindows) {\n fixWinEPERMSync(p, options, er)\n }\n }\n\n try {\n // sunos lets the root user unlink directories, which is... weird.\n if (st && st.isDirectory()) {\n rmdirSync(p, options, null)\n } else {\n options.unlinkSync(p)\n }\n } catch (er) {\n if (er.code === 'ENOENT') {\n return\n } else if (er.code === 'EPERM') {\n return isWindows ? fixWinEPERMSync(p, options, er) : rmdirSync(p, options, er)\n } else if (er.code !== 'EISDIR') {\n throw er\n }\n rmdirSync(p, options, er)\n }\n}\n\nfunction rmdirSync (p, options, originalEr) {\n assert(p)\n assert(options)\n\n try {\n options.rmdirSync(p)\n } catch (er) {\n if (er.code === 'ENOTDIR') {\n throw originalEr\n } else if (er.code === 'ENOTEMPTY' || er.code === 'EEXIST' || er.code === 'EPERM') {\n rmkidsSync(p, options)\n } else if (er.code !== 'ENOENT') {\n throw er\n }\n }\n}\n\nfunction rmkidsSync (p, options) {\n assert(p)\n assert(options)\n options.readdirSync(p).forEach(f => rimrafSync(path.join(p, f), options))\n\n if (isWindows) {\n // We only end up here once we got ENOTEMPTY at least once, and\n // at this point, we are guaranteed to have removed all the kids.\n // So, we know that it won't be ENOENT or ENOTDIR or anything else.\n // try really hard to delete stuff on windows, because it has a\n // PROFOUNDLY annoying habit of not closing handles promptly when\n // files are deleted, resulting in spurious ENOTEMPTY errors.\n const startTime = Date.now()\n do {\n try {\n const ret = options.rmdirSync(p, options)\n return ret\n } catch {}\n } while (Date.now() - startTime < 500) // give up after 500ms\n } else {\n const ret = options.rmdirSync(p, options)\n return ret\n }\n}\n\nmodule.exports = rimraf\nrimraf.sync = rimrafSync\n","'use strict'\n\nconst fs = require('../fs')\nconst path = require('path')\nconst util = require('util')\nconst atLeastNode = require('at-least-node')\n\nconst nodeSupportsBigInt = atLeastNode('10.5.0')\nconst stat = (file) => nodeSupportsBigInt ? fs.stat(file, { bigint: true }) : fs.stat(file)\nconst statSync = (file) => nodeSupportsBigInt ? fs.statSync(file, { bigint: true }) : fs.statSync(file)\n\nfunction getStats (src, dest) {\n return Promise.all([\n stat(src),\n stat(dest).catch(err => {\n if (err.code === 'ENOENT') return null\n throw err\n })\n ]).then(([srcStat, destStat]) => ({ srcStat, destStat }))\n}\n\nfunction getStatsSync (src, dest) {\n let destStat\n const srcStat = statSync(src)\n try {\n destStat = statSync(dest)\n } catch (err) {\n if (err.code === 'ENOENT') return { srcStat, destStat: null }\n throw err\n }\n return { srcStat, destStat }\n}\n\nfunction checkPaths (src, dest, funcName, cb) {\n util.callbackify(getStats)(src, dest, (err, stats) => {\n if (err) return cb(err)\n const { srcStat, destStat } = stats\n if (destStat && areIdentical(srcStat, destStat)) {\n return cb(new Error('Source and destination must not be the same.'))\n }\n if (srcStat.isDirectory() && isSrcSubdir(src, dest)) {\n return cb(new Error(errMsg(src, dest, funcName)))\n }\n return cb(null, { srcStat, destStat })\n })\n}\n\nfunction checkPathsSync (src, dest, funcName) {\n const { srcStat, destStat } = getStatsSync(src, dest)\n if (destStat && areIdentical(srcStat, destStat)) {\n throw new Error('Source and destination must not be the same.')\n }\n if (srcStat.isDirectory() && isSrcSubdir(src, dest)) {\n throw new Error(errMsg(src, dest, funcName))\n }\n return { srcStat, destStat }\n}\n\n// recursively check if dest parent is a subdirectory of src.\n// It works for all file types including symlinks since it\n// checks the src and dest inodes. It starts from the deepest\n// parent and stops once it reaches the src parent or the root path.\nfunction checkParentPaths (src, srcStat, dest, funcName, cb) {\n const srcParent = path.resolve(path.dirname(src))\n const destParent = path.resolve(path.dirname(dest))\n if (destParent === srcParent || destParent === path.parse(destParent).root) return cb()\n const callback = (err, destStat) => {\n if (err) {\n if (err.code === 'ENOENT') return cb()\n return cb(err)\n }\n if (areIdentical(srcStat, destStat)) {\n return cb(new Error(errMsg(src, dest, funcName)))\n }\n return checkParentPaths(src, srcStat, destParent, funcName, cb)\n }\n if (nodeSupportsBigInt) fs.stat(destParent, { bigint: true }, callback)\n else fs.stat(destParent, callback)\n}\n\nfunction checkParentPathsSync (src, srcStat, dest, funcName) {\n const srcParent = path.resolve(path.dirname(src))\n const destParent = path.resolve(path.dirname(dest))\n if (destParent === srcParent || destParent === path.parse(destParent).root) return\n let destStat\n try {\n destStat = statSync(destParent)\n } catch (err) {\n if (err.code === 'ENOENT') return\n throw err\n }\n if (areIdentical(srcStat, destStat)) {\n throw new Error(errMsg(src, dest, funcName))\n }\n return checkParentPathsSync(src, srcStat, destParent, funcName)\n}\n\nfunction areIdentical (srcStat, destStat) {\n if (destStat.ino && destStat.dev && destStat.ino === srcStat.ino && destStat.dev === srcStat.dev) {\n if (nodeSupportsBigInt || destStat.ino < Number.MAX_SAFE_INTEGER) {\n // definitive answer\n return true\n }\n // Use additional heuristics if we can't use 'bigint'.\n // Different 'ino' could be represented the same if they are >= Number.MAX_SAFE_INTEGER\n // See issue 657\n if (destStat.size === srcStat.size &&\n destStat.mode === srcStat.mode &&\n destStat.nlink === srcStat.nlink &&\n destStat.atimeMs === srcStat.atimeMs &&\n destStat.mtimeMs === srcStat.mtimeMs &&\n destStat.ctimeMs === srcStat.ctimeMs &&\n destStat.birthtimeMs === srcStat.birthtimeMs) {\n // heuristic answer\n return true\n }\n }\n return false\n}\n\n// return true if dest is a subdir of src, otherwise false.\n// It only checks the path strings.\nfunction isSrcSubdir (src, dest) {\n const srcArr = path.resolve(src).split(path.sep).filter(i => i)\n const destArr = path.resolve(dest).split(path.sep).filter(i => i)\n return srcArr.reduce((acc, cur, i) => acc && destArr[i] === cur, true)\n}\n\nfunction errMsg (src, dest, funcName) {\n return `Cannot ${funcName} '${src}' to a subdirectory of itself, '${dest}'.`\n}\n\nmodule.exports = {\n checkPaths,\n checkPathsSync,\n checkParentPaths,\n checkParentPathsSync,\n isSrcSubdir\n}\n","'use strict'\n\nconst fs = require('graceful-fs')\n\nfunction utimesMillis (path, atime, mtime, callback) {\n // if (!HAS_MILLIS_RES) return fs.utimes(path, atime, mtime, callback)\n fs.open(path, 'r+', (err, fd) => {\n if (err) return callback(err)\n fs.futimes(fd, atime, mtime, futimesErr => {\n fs.close(fd, closeErr => {\n if (callback) callback(futimesErr || closeErr)\n })\n })\n })\n}\n\nfunction utimesMillisSync (path, atime, mtime) {\n const fd = fs.openSync(path, 'r+')\n fs.futimesSync(fd, atime, mtime)\n return fs.closeSync(fd)\n}\n\nmodule.exports = {\n utimesMillis,\n utimesMillisSync\n}\n","'use strict'\n\nmodule.exports = clone\n\nfunction clone (obj) {\n if (obj === null || typeof obj !== 'object')\n return obj\n\n if (obj instanceof Object)\n var copy = { __proto__: obj.__proto__ }\n else\n var copy = Object.create(null)\n\n Object.getOwnPropertyNames(obj).forEach(function (key) {\n Object.defineProperty(copy, key, Object.getOwnPropertyDescriptor(obj, key))\n })\n\n return copy\n}\n","var fs = require('fs')\nvar polyfills = require('./polyfills.js')\nvar legacy = require('./legacy-streams.js')\nvar clone = require('./clone.js')\n\nvar util = require('util')\n\n/* istanbul ignore next - node 0.x polyfill */\nvar gracefulQueue\nvar previousSymbol\n\n/* istanbul ignore else - node 0.x polyfill */\nif (typeof Symbol === 'function' && typeof Symbol.for === 'function') {\n gracefulQueue = Symbol.for('graceful-fs.queue')\n // This is used in testing by future versions\n previousSymbol = Symbol.for('graceful-fs.previous')\n} else {\n gracefulQueue = '___graceful-fs.queue'\n previousSymbol = '___graceful-fs.previous'\n}\n\nfunction noop () {}\n\nfunction publishQueue(context, queue) {\n Object.defineProperty(context, gracefulQueue, {\n get: function() {\n return queue\n }\n })\n}\n\nvar debug = noop\nif (util.debuglog)\n debug = util.debuglog('gfs4')\nelse if (/\\bgfs4\\b/i.test(process.env.NODE_DEBUG || ''))\n debug = function() {\n var m = util.format.apply(util, arguments)\n m = 'GFS4: ' + m.split(/\\n/).join('\\nGFS4: ')\n console.error(m)\n }\n\n// Once time initialization\nif (!fs[gracefulQueue]) {\n // This queue can be shared by multiple loaded instances\n var queue = global[gracefulQueue] || []\n publishQueue(fs, queue)\n\n // Patch fs.close/closeSync to shared queue version, because we need\n // to retry() whenever a close happens *anywhere* in the program.\n // This is essential when multiple graceful-fs instances are\n // in play at the same time.\n fs.close = (function (fs$close) {\n function close (fd, cb) {\n return fs$close.call(fs, fd, function (err) {\n // This function uses the graceful-fs shared queue\n if (!err) {\n retry()\n }\n\n if (typeof cb === 'function')\n cb.apply(this, arguments)\n })\n }\n\n Object.defineProperty(close, previousSymbol, {\n value: fs$close\n })\n return close\n })(fs.close)\n\n fs.closeSync = (function (fs$closeSync) {\n function closeSync (fd) {\n // This function uses the graceful-fs shared queue\n fs$closeSync.apply(fs, arguments)\n retry()\n }\n\n Object.defineProperty(closeSync, previousSymbol, {\n value: fs$closeSync\n })\n return closeSync\n })(fs.closeSync)\n\n if (/\\bgfs4\\b/i.test(process.env.NODE_DEBUG || '')) {\n process.on('exit', function() {\n debug(fs[gracefulQueue])\n require('assert').equal(fs[gracefulQueue].length, 0)\n })\n }\n}\n\nif (!global[gracefulQueue]) {\n publishQueue(global, fs[gracefulQueue]);\n}\n\nmodule.exports = patch(clone(fs))\nif (process.env.TEST_GRACEFUL_FS_GLOBAL_PATCH && !fs.__patched) {\n module.exports = patch(fs)\n fs.__patched = true;\n}\n\nfunction patch (fs) {\n // Everything that references the open() function needs to be in here\n polyfills(fs)\n fs.gracefulify = patch\n\n fs.createReadStream = createReadStream\n fs.createWriteStream = createWriteStream\n var fs$readFile = fs.readFile\n fs.readFile = readFile\n function readFile (path, options, cb) {\n if (typeof options === 'function')\n cb = options, options = null\n\n return go$readFile(path, options, cb)\n\n function go$readFile (path, options, cb) {\n return fs$readFile(path, options, function (err) {\n if (err && (err.code === 'EMFILE' || err.code === 'ENFILE'))\n enqueue([go$readFile, [path, options, cb]])\n else {\n if (typeof cb === 'function')\n cb.apply(this, arguments)\n retry()\n }\n })\n }\n }\n\n var fs$writeFile = fs.writeFile\n fs.writeFile = writeFile\n function writeFile (path, data, options, cb) {\n if (typeof options === 'function')\n cb = options, options = null\n\n return go$writeFile(path, data, options, cb)\n\n function go$writeFile (path, data, options, cb) {\n return fs$writeFile(path, data, options, function (err) {\n if (err && (err.code === 'EMFILE' || err.code === 'ENFILE'))\n enqueue([go$writeFile, [path, data, options, cb]])\n else {\n if (typeof cb === 'function')\n cb.apply(this, arguments)\n retry()\n }\n })\n }\n }\n\n var fs$appendFile = fs.appendFile\n if (fs$appendFile)\n fs.appendFile = appendFile\n function appendFile (path, data, options, cb) {\n if (typeof options === 'function')\n cb = options, options = null\n\n return go$appendFile(path, data, options, cb)\n\n function go$appendFile (path, data, options, cb) {\n return fs$appendFile(path, data, options, function (err) {\n if (err && (err.code === 'EMFILE' || err.code === 'ENFILE'))\n enqueue([go$appendFile, [path, data, options, cb]])\n else {\n if (typeof cb === 'function')\n cb.apply(this, arguments)\n retry()\n }\n })\n }\n }\n\n var fs$readdir = fs.readdir\n fs.readdir = readdir\n function readdir (path, options, cb) {\n var args = [path]\n if (typeof options !== 'function') {\n args.push(options)\n } else {\n cb = options\n }\n args.push(go$readdir$cb)\n\n return go$readdir(args)\n\n function go$readdir$cb (err, files) {\n if (files && files.sort)\n files.sort()\n\n if (err && (err.code === 'EMFILE' || err.code === 'ENFILE'))\n enqueue([go$readdir, [args]])\n\n else {\n if (typeof cb === 'function')\n cb.apply(this, arguments)\n retry()\n }\n }\n }\n\n function go$readdir (args) {\n return fs$readdir.apply(fs, args)\n }\n\n if (process.version.substr(0, 4) === 'v0.8') {\n var legStreams = legacy(fs)\n ReadStream = legStreams.ReadStream\n WriteStream = legStreams.WriteStream\n }\n\n var fs$ReadStream = fs.ReadStream\n if (fs$ReadStream) {\n ReadStream.prototype = Object.create(fs$ReadStream.prototype)\n ReadStream.prototype.open = ReadStream$open\n }\n\n var fs$WriteStream = fs.WriteStream\n if (fs$WriteStream) {\n WriteStream.prototype = Object.create(fs$WriteStream.prototype)\n WriteStream.prototype.open = WriteStream$open\n }\n\n Object.defineProperty(fs, 'ReadStream', {\n get: function () {\n return ReadStream\n },\n set: function (val) {\n ReadStream = val\n },\n enumerable: true,\n configurable: true\n })\n Object.defineProperty(fs, 'WriteStream', {\n get: function () {\n return WriteStream\n },\n set: function (val) {\n WriteStream = val\n },\n enumerable: true,\n configurable: true\n })\n\n // legacy names\n var FileReadStream = ReadStream\n Object.defineProperty(fs, 'FileReadStream', {\n get: function () {\n return FileReadStream\n },\n set: function (val) {\n FileReadStream = val\n },\n enumerable: true,\n configurable: true\n })\n var FileWriteStream = WriteStream\n Object.defineProperty(fs, 'FileWriteStream', {\n get: function () {\n return FileWriteStream\n },\n set: function (val) {\n FileWriteStream = val\n },\n enumerable: true,\n configurable: true\n })\n\n function ReadStream (path, options) {\n if (this instanceof ReadStream)\n return fs$ReadStream.apply(this, arguments), this\n else\n return ReadStream.apply(Object.create(ReadStream.prototype), arguments)\n }\n\n function ReadStream$open () {\n var that = this\n open(that.path, that.flags, that.mode, function (err, fd) {\n if (err) {\n if (that.autoClose)\n that.destroy()\n\n that.emit('error', err)\n } else {\n that.fd = fd\n that.emit('open', fd)\n that.read()\n }\n })\n }\n\n function WriteStream (path, options) {\n if (this instanceof WriteStream)\n return fs$WriteStream.apply(this, arguments), this\n else\n return WriteStream.apply(Object.create(WriteStream.prototype), arguments)\n }\n\n function WriteStream$open () {\n var that = this\n open(that.path, that.flags, that.mode, function (err, fd) {\n if (err) {\n that.destroy()\n that.emit('error', err)\n } else {\n that.fd = fd\n that.emit('open', fd)\n }\n })\n }\n\n function createReadStream (path, options) {\n return new fs.ReadStream(path, options)\n }\n\n function createWriteStream (path, options) {\n return new fs.WriteStream(path, options)\n }\n\n var fs$open = fs.open\n fs.open = open\n function open (path, flags, mode, cb) {\n if (typeof mode === 'function')\n cb = mode, mode = null\n\n return go$open(path, flags, mode, cb)\n\n function go$open (path, flags, mode, cb) {\n return fs$open(path, flags, mode, function (err, fd) {\n if (err && (err.code === 'EMFILE' || err.code === 'ENFILE'))\n enqueue([go$open, [path, flags, mode, cb]])\n else {\n if (typeof cb === 'function')\n cb.apply(this, arguments)\n retry()\n }\n })\n }\n }\n\n return fs\n}\n\nfunction enqueue (elem) {\n debug('ENQUEUE', elem[0].name, elem[1])\n fs[gracefulQueue].push(elem)\n}\n\nfunction retry () {\n var elem = fs[gracefulQueue].shift()\n if (elem) {\n debug('RETRY', elem[0].name, elem[1])\n elem[0].apply(null, elem[1])\n }\n}\n","var Stream = require('stream').Stream\n\nmodule.exports = legacy\n\nfunction legacy (fs) {\n return {\n ReadStream: ReadStream,\n WriteStream: WriteStream\n }\n\n function ReadStream (path, options) {\n if (!(this instanceof ReadStream)) return new ReadStream(path, options);\n\n Stream.call(this);\n\n var self = this;\n\n this.path = path;\n this.fd = null;\n this.readable = true;\n this.paused = false;\n\n this.flags = 'r';\n this.mode = 438; /*=0666*/\n this.bufferSize = 64 * 1024;\n\n options = options || {};\n\n // Mixin options into this\n var keys = Object.keys(options);\n for (var index = 0, length = keys.length; index < length; index++) {\n var key = keys[index];\n this[key] = options[key];\n }\n\n if (this.encoding) this.setEncoding(this.encoding);\n\n if (this.start !== undefined) {\n if ('number' !== typeof this.start) {\n throw TypeError('start must be a Number');\n }\n if (this.end === undefined) {\n this.end = Infinity;\n } else if ('number' !== typeof this.end) {\n throw TypeError('end must be a Number');\n }\n\n if (this.start > this.end) {\n throw new Error('start must be <= end');\n }\n\n this.pos = this.start;\n }\n\n if (this.fd !== null) {\n process.nextTick(function() {\n self._read();\n });\n return;\n }\n\n fs.open(this.path, this.flags, this.mode, function (err, fd) {\n if (err) {\n self.emit('error', err);\n self.readable = false;\n return;\n }\n\n self.fd = fd;\n self.emit('open', fd);\n self._read();\n })\n }\n\n function WriteStream (path, options) {\n if (!(this instanceof WriteStream)) return new WriteStream(path, options);\n\n Stream.call(this);\n\n this.path = path;\n this.fd = null;\n this.writable = true;\n\n this.flags = 'w';\n this.encoding = 'binary';\n this.mode = 438; /*=0666*/\n this.bytesWritten = 0;\n\n options = options || {};\n\n // Mixin options into this\n var keys = Object.keys(options);\n for (var index = 0, length = keys.length; index < length; index++) {\n var key = keys[index];\n this[key] = options[key];\n }\n\n if (this.start !== undefined) {\n if ('number' !== typeof this.start) {\n throw TypeError('start must be a Number');\n }\n if (this.start < 0) {\n throw new Error('start must be >= zero');\n }\n\n this.pos = this.start;\n }\n\n this.busy = false;\n this._queue = [];\n\n if (this.fd === null) {\n this._open = fs.open;\n this._queue.push([this._open, this.path, this.flags, this.mode, undefined]);\n this.flush();\n }\n }\n}\n","var constants = require('constants')\n\nvar origCwd = process.cwd\nvar cwd = null\n\nvar platform = process.env.GRACEFUL_FS_PLATFORM || process.platform\n\nprocess.cwd = function() {\n if (!cwd)\n cwd = origCwd.call(process)\n return cwd\n}\ntry {\n process.cwd()\n} catch (er) {}\n\nvar chdir = process.chdir\nprocess.chdir = function(d) {\n cwd = null\n chdir.call(process, d)\n}\n\nmodule.exports = patch\n\nfunction patch (fs) {\n // (re-)implement some things that are known busted or missing.\n\n // lchmod, broken prior to 0.6.2\n // back-port the fix here.\n if (constants.hasOwnProperty('O_SYMLINK') &&\n process.version.match(/^v0\\.6\\.[0-2]|^v0\\.5\\./)) {\n patchLchmod(fs)\n }\n\n // lutimes implementation, or no-op\n if (!fs.lutimes) {\n patchLutimes(fs)\n }\n\n // https://github.com/isaacs/node-graceful-fs/issues/4\n // Chown should not fail on einval or eperm if non-root.\n // It should not fail on enosys ever, as this just indicates\n // that a fs doesn't support the intended operation.\n\n fs.chown = chownFix(fs.chown)\n fs.fchown = chownFix(fs.fchown)\n fs.lchown = chownFix(fs.lchown)\n\n fs.chmod = chmodFix(fs.chmod)\n fs.fchmod = chmodFix(fs.fchmod)\n fs.lchmod = chmodFix(fs.lchmod)\n\n fs.chownSync = chownFixSync(fs.chownSync)\n fs.fchownSync = chownFixSync(fs.fchownSync)\n fs.lchownSync = chownFixSync(fs.lchownSync)\n\n fs.chmodSync = chmodFixSync(fs.chmodSync)\n fs.fchmodSync = chmodFixSync(fs.fchmodSync)\n fs.lchmodSync = chmodFixSync(fs.lchmodSync)\n\n fs.stat = statFix(fs.stat)\n fs.fstat = statFix(fs.fstat)\n fs.lstat = statFix(fs.lstat)\n\n fs.statSync = statFixSync(fs.statSync)\n fs.fstatSync = statFixSync(fs.fstatSync)\n fs.lstatSync = statFixSync(fs.lstatSync)\n\n // if lchmod/lchown do not exist, then make them no-ops\n if (!fs.lchmod) {\n fs.lchmod = function (path, mode, cb) {\n if (cb) process.nextTick(cb)\n }\n fs.lchmodSync = function () {}\n }\n if (!fs.lchown) {\n fs.lchown = function (path, uid, gid, cb) {\n if (cb) process.nextTick(cb)\n }\n fs.lchownSync = function () {}\n }\n\n // on Windows, A/V software can lock the directory, causing this\n // to fail with an EACCES or EPERM if the directory contains newly\n // created files. Try again on failure, for up to 60 seconds.\n\n // Set the timeout this long because some Windows Anti-Virus, such as Parity\n // bit9, may lock files for up to a minute, causing npm package install\n // failures. Also, take care to yield the scheduler. Windows scheduling gives\n // CPU to a busy looping process, which can cause the program causing the lock\n // contention to be starved of CPU by node, so the contention doesn't resolve.\n if (platform === \"win32\") {\n fs.rename = (function (fs$rename) { return function (from, to, cb) {\n var start = Date.now()\n var backoff = 0;\n fs$rename(from, to, function CB (er) {\n if (er\n && (er.code === \"EACCES\" || er.code === \"EPERM\")\n && Date.now() - start < 60000) {\n setTimeout(function() {\n fs.stat(to, function (stater, st) {\n if (stater && stater.code === \"ENOENT\")\n fs$rename(from, to, CB);\n else\n cb(er)\n })\n }, backoff)\n if (backoff < 100)\n backoff += 10;\n return;\n }\n if (cb) cb(er)\n })\n }})(fs.rename)\n }\n\n // if read() returns EAGAIN, then just try it again.\n fs.read = (function (fs$read) {\n function read (fd, buffer, offset, length, position, callback_) {\n var callback\n if (callback_ && typeof callback_ === 'function') {\n var eagCounter = 0\n callback = function (er, _, __) {\n if (er && er.code === 'EAGAIN' && eagCounter < 10) {\n eagCounter ++\n return fs$read.call(fs, fd, buffer, offset, length, position, callback)\n }\n callback_.apply(this, arguments)\n }\n }\n return fs$read.call(fs, fd, buffer, offset, length, position, callback)\n }\n\n // This ensures `util.promisify` works as it does for native `fs.read`.\n read.__proto__ = fs$read\n return read\n })(fs.read)\n\n fs.readSync = (function (fs$readSync) { return function (fd, buffer, offset, length, position) {\n var eagCounter = 0\n while (true) {\n try {\n return fs$readSync.call(fs, fd, buffer, offset, length, position)\n } catch (er) {\n if (er.code === 'EAGAIN' && eagCounter < 10) {\n eagCounter ++\n continue\n }\n throw er\n }\n }\n }})(fs.readSync)\n\n function patchLchmod (fs) {\n fs.lchmod = function (path, mode, callback) {\n fs.open( path\n , constants.O_WRONLY | constants.O_SYMLINK\n , mode\n , function (err, fd) {\n if (err) {\n if (callback) callback(err)\n return\n }\n // prefer to return the chmod error, if one occurs,\n // but still try to close, and report closing errors if they occur.\n fs.fchmod(fd, mode, function (err) {\n fs.close(fd, function(err2) {\n if (callback) callback(err || err2)\n })\n })\n })\n }\n\n fs.lchmodSync = function (path, mode) {\n var fd = fs.openSync(path, constants.O_WRONLY | constants.O_SYMLINK, mode)\n\n // prefer to return the chmod error, if one occurs,\n // but still try to close, and report closing errors if they occur.\n var threw = true\n var ret\n try {\n ret = fs.fchmodSync(fd, mode)\n threw = false\n } finally {\n if (threw) {\n try {\n fs.closeSync(fd)\n } catch (er) {}\n } else {\n fs.closeSync(fd)\n }\n }\n return ret\n }\n }\n\n function patchLutimes (fs) {\n if (constants.hasOwnProperty(\"O_SYMLINK\")) {\n fs.lutimes = function (path, at, mt, cb) {\n fs.open(path, constants.O_SYMLINK, function (er, fd) {\n if (er) {\n if (cb) cb(er)\n return\n }\n fs.futimes(fd, at, mt, function (er) {\n fs.close(fd, function (er2) {\n if (cb) cb(er || er2)\n })\n })\n })\n }\n\n fs.lutimesSync = function (path, at, mt) {\n var fd = fs.openSync(path, constants.O_SYMLINK)\n var ret\n var threw = true\n try {\n ret = fs.futimesSync(fd, at, mt)\n threw = false\n } finally {\n if (threw) {\n try {\n fs.closeSync(fd)\n } catch (er) {}\n } else {\n fs.closeSync(fd)\n }\n }\n return ret\n }\n\n } else {\n fs.lutimes = function (_a, _b, _c, cb) { if (cb) process.nextTick(cb) }\n fs.lutimesSync = function () {}\n }\n }\n\n function chmodFix (orig) {\n if (!orig) return orig\n return function (target, mode, cb) {\n return orig.call(fs, target, mode, function (er) {\n if (chownErOk(er)) er = null\n if (cb) cb.apply(this, arguments)\n })\n }\n }\n\n function chmodFixSync (orig) {\n if (!orig) return orig\n return function (target, mode) {\n try {\n return orig.call(fs, target, mode)\n } catch (er) {\n if (!chownErOk(er)) throw er\n }\n }\n }\n\n\n function chownFix (orig) {\n if (!orig) return orig\n return function (target, uid, gid, cb) {\n return orig.call(fs, target, uid, gid, function (er) {\n if (chownErOk(er)) er = null\n if (cb) cb.apply(this, arguments)\n })\n }\n }\n\n function chownFixSync (orig) {\n if (!orig) return orig\n return function (target, uid, gid) {\n try {\n return orig.call(fs, target, uid, gid)\n } catch (er) {\n if (!chownErOk(er)) throw er\n }\n }\n }\n\n function statFix (orig) {\n if (!orig) return orig\n // Older versions of Node erroneously returned signed integers for\n // uid + gid.\n return function (target, options, cb) {\n if (typeof options === 'function') {\n cb = options\n options = null\n }\n function callback (er, stats) {\n if (stats) {\n if (stats.uid < 0) stats.uid += 0x100000000\n if (stats.gid < 0) stats.gid += 0x100000000\n }\n if (cb) cb.apply(this, arguments)\n }\n return options ? orig.call(fs, target, options, callback)\n : orig.call(fs, target, callback)\n }\n }\n\n function statFixSync (orig) {\n if (!orig) return orig\n // Older versions of Node erroneously returned signed integers for\n // uid + gid.\n return function (target, options) {\n var stats = options ? orig.call(fs, target, options)\n : orig.call(fs, target)\n if (stats.uid < 0) stats.uid += 0x100000000\n if (stats.gid < 0) stats.gid += 0x100000000\n return stats;\n }\n }\n\n // ENOSYS means that the fs doesn't support the op. Just ignore\n // that, because it doesn't matter.\n //\n // if there's no getuid, or if getuid() is something other\n // than 0, and the error is EINVAL or EPERM, then just ignore\n // it.\n //\n // This specific case is a silent failure in cp, install, tar,\n // and most other unix tools that manage permissions.\n //\n // When running as root, or if other types of errors are\n // encountered, then it's strict.\n function chownErOk (er) {\n if (!er)\n return true\n\n if (er.code === \"ENOSYS\")\n return true\n\n var nonroot = !process.getuid || process.getuid() !== 0\n if (nonroot) {\n if (er.code === \"EINVAL\" || er.code === \"EPERM\")\n return true\n }\n\n return false\n }\n}\n","let _fs\ntry {\n _fs = require('graceful-fs')\n} catch (_) {\n _fs = require('fs')\n}\nconst universalify = require('universalify')\nconst { stringify, stripBom } = require('./utils')\n\nasync function _readFile (file, options = {}) {\n if (typeof options === 'string') {\n options = { encoding: options }\n }\n\n const fs = options.fs || _fs\n\n const shouldThrow = 'throws' in options ? options.throws : true\n\n let data = await universalify.fromCallback(fs.readFile)(file, options)\n\n data = stripBom(data)\n\n let obj\n try {\n obj = JSON.parse(data, options ? options.reviver : null)\n } catch (err) {\n if (shouldThrow) {\n err.message = `${file}: ${err.message}`\n throw err\n } else {\n return null\n }\n }\n\n return obj\n}\n\nconst readFile = universalify.fromPromise(_readFile)\n\nfunction readFileSync (file, options = {}) {\n if (typeof options === 'string') {\n options = { encoding: options }\n }\n\n const fs = options.fs || _fs\n\n const shouldThrow = 'throws' in options ? options.throws : true\n\n try {\n let content = fs.readFileSync(file, options)\n content = stripBom(content)\n return JSON.parse(content, options.reviver)\n } catch (err) {\n if (shouldThrow) {\n err.message = `${file}: ${err.message}`\n throw err\n } else {\n return null\n }\n }\n}\n\nasync function _writeFile (file, obj, options = {}) {\n const fs = options.fs || _fs\n\n const str = stringify(obj, options)\n\n await universalify.fromCallback(fs.writeFile)(file, str, options)\n}\n\nconst writeFile = universalify.fromPromise(_writeFile)\n\nfunction writeFileSync (file, obj, options = {}) {\n const fs = options.fs || _fs\n\n const str = stringify(obj, options)\n // not sure if fs.writeFileSync returns anything, but just in case\n return fs.writeFileSync(file, str, options)\n}\n\nconst jsonfile = {\n readFile,\n readFileSync,\n writeFile,\n writeFileSync\n}\n\nmodule.exports = jsonfile\n","'use strict'\n\nexports.fromCallback = function (fn) {\n return Object.defineProperty(function (...args) {\n if (typeof args[args.length - 1] === 'function') fn.apply(this, args)\n else {\n return new Promise((resolve, reject) => {\n fn.call(\n this,\n ...args,\n (err, res) => (err != null) ? reject(err) : resolve(res)\n )\n })\n }\n }, 'name', { value: fn.name })\n}\n\nexports.fromPromise = function (fn) {\n return Object.defineProperty(function (...args) {\n const cb = args[args.length - 1]\n if (typeof cb !== 'function') return fn.apply(this, args)\n else fn.apply(this, args.slice(0, -1)).then(r => cb(null, r), cb)\n }, 'name', { value: fn.name })\n}\n","function stringify (obj, { EOL = '\\n', finalEOL = true, replacer = null, spaces } = {}) {\n const EOF = finalEOL ? EOL : ''\n const str = JSON.stringify(obj, replacer, spaces)\n\n return str.replace(/\\n/g, EOL) + EOF\n}\n\nfunction stripBom (content) {\n // we do this because JSON.parse would convert it to a utf8 string if encoding wasn't specified\n if (Buffer.isBuffer(content)) content = content.toString('utf8')\n return content.replace(/^\\uFEFF/, '')\n}\n\nmodule.exports = { stringify, stripBom }\n","\nvar Promise = require('any-promise')\nvar fs\ntry {\n fs = require('graceful-fs')\n} catch(err) {\n fs = require('fs')\n}\n\nvar api = [\n 'appendFile',\n 'chmod',\n 'chown',\n 'close',\n 'fchmod',\n 'fchown',\n 'fdatasync',\n 'fstat',\n 'fsync',\n 'ftruncate',\n 'futimes',\n 'lchown',\n 'link',\n 'lstat',\n 'mkdir',\n 'open',\n 'read',\n 'readFile',\n 'readdir',\n 'readlink',\n 'realpath',\n 'rename',\n 'rmdir',\n 'stat',\n 'symlink',\n 'truncate',\n 'unlink',\n 'utimes',\n 'write',\n 'writeFile'\n]\n\ntypeof fs.access === 'function' && api.push('access')\ntypeof fs.copyFile === 'function' && api.push('copyFile')\ntypeof fs.mkdtemp === 'function' && api.push('mkdtemp')\n\nrequire('thenify-all').withCallback(fs, exports, api)\n\nexports.exists = function (filename, callback) {\n // callback\n if (typeof callback === 'function') {\n return fs.stat(filename, function (err) {\n callback(null, !err);\n })\n }\n // or promise\n return new Promise(function (resolve) {\n fs.stat(filename, function (err) {\n resolve(!err)\n })\n })\n}\n","\"use strict\";var fs=require(\"mz/fs\");module.exports={/**\n\t * Read in the last `n` lines of a file\n\t * @param {string} input_file_path - file (direct or relative path to file.)\n\t * @param {int} maxLineCount - max number of lines to read in.\n\t * @param {encoding} encoding - specifies the character encoding to be used, or 'buffer'. defaults to 'utf8'.\n\t *\n\t * @return {promise} a promise resolved with the lines or rejected with an error.\n\t */read:function f(a,b,c){var d=[\"\\n\"];null==c&&(c=\"utf8\");var e=function(a,b,c){return fs.read(b,Buffer.alloc(1),0,1,a.size-1-c).then(function(a){return String.fromCharCode(a[1][0])})};return new Promise(function(f,g){var h={stat:null,file:null};fs.exists(a).then(function(a){if(!a)throw new Error(\"file does not exist\")}).then(function(){var b=[fs.stat(a).then(function(a){return h.stat=a}),fs.open(a,\"r\").then(function(a){return h.file=a})];// Load file Stats.\nreturn Promise.all(b)}).then(function(){var a=0,g=0,i=\"\",j=function(){return i.length>h.stat.size&&(i=i.substring(i.length-h.stat.size)),i.length>=h.stat.size||g>=b?(d.includes(i.substring(0,1))&&(i=i.substring(1)),fs.close(h.file),\"buffer\"===c?f(Buffer.from(i,\"binary\")):f(Buffer.from(i,\"binary\").toString(c))):e(h.stat,h.file,a).then(function(b){i=b+i,d.includes(b)&&1 {\n fn.apply(\n this,\n args.concat([(err, res) => err ? reject(err) : resolve(res)])\n )\n })\n }\n }, 'name', { value: fn.name })\n}\n\nexports.fromPromise = function (fn) {\n return Object.defineProperty(function (...args) {\n const cb = args[args.length - 1]\n if (typeof cb !== 'function') return fn.apply(this, args)\n else fn.apply(this, args.slice(0, -1)).then(r => cb(null, r), cb)\n }, 'name', { value: fn.name })\n}\n","\"use strict\";\nvar __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {\n if (k2 === undefined) k2 = k;\n Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });\n}) : (function(o, m, k, k2) {\n if (k2 === undefined) k2 = k;\n o[k2] = m[k];\n}));\nvar __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {\n Object.defineProperty(o, \"default\", { enumerable: true, value: v });\n}) : function(o, v) {\n o[\"default\"] = v;\n});\nvar __importStar = (this && this.__importStar) || function (mod) {\n if (mod && mod.__esModule) return mod;\n var result = {};\n if (mod != null) for (var k in mod) if (k !== \"default\" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);\n __setModuleDefault(result, mod);\n return result;\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nconst core = __importStar(require(\"@actions/core\"));\nconst path_1 = require(\"path\");\nconst fs_extra_1 = require(\"fs-extra\");\nconst fs_1 = require(\"fs\");\nconst utils_1 = require(\"./utils\");\nconst async_1 = require(\"async\");\nconst rll = require('read-last-lines');\n/* GitHub Actions inputs */\nconst versions = utils_1.fixArgArr((core.getInput('versions') || 'latest').split(','));\nconst target = utils_1.fixArgArr((core.getInput('target') || 'Spigot').toUpperCase().split(','));\nconst generateSrc = core.getInput('generateSrc') == 'true';\nconst generateDoc = core.getInput('generateDoc') == 'true';\nconst disableJavaCheck = core.getInput('disableJavaCheck') == 'true';\nconst forceRun = core.getInput('forceRun') == 'true'; // TODO\nconst threadCount = utils_1.isNumeric(core.getInput('threads')) ? parseInt(core.getInput('threads')) : utils_1.cpuCount;\nconst workingDir = utils_1.resetWorkingDir();\nasync function run() {\n return new Promise(async (resolve, reject) => {\n if (versions.length == 0)\n return resolve({ code: 0, msg: 'No version(s) provided to build' });\n if (target.length == 0)\n return resolve({ code: 0, msg: 'No target(s) provided to build' });\n const appLogFile = path_1.join(workingDir.logs, 'SpraxDev_Actions-SpigotMC.log');\n console.log('Installed Java-Version:');\n await utils_1.runCmd('java', ['-version'], workingDir.base, appLogFile);\n console.log(`Downloading BuildTools.jar from 'hub.spigotmc.org'...`);\n await utils_1.downloadFile('https://hub.spigotmc.org/jenkins/job/BuildTools/lastSuccessfulBuild/artifact/target/BuildTools.jar', path_1.join(workingDir.cache, 'BuildTools.jar'));\n const gotTemplateDirectory = versions.length != 1;\n // Prepare template directory if more than one version is provided\n if (gotTemplateDirectory) {\n console.log('Prepare for future tasks by running BuildTools...');\n try {\n await core.group('Prepare BuildTools', async () => {\n return utils_1.runCmd('java', ['-jar', 'BuildTools.jar', '--compile', 'NONE'], workingDir.cache, appLogFile);\n });\n }\n catch (err) {\n console.error(err);\n console.error(`\\nPrinting last 25 lines from '${path_1.resolve(appLogFile)}':`);\n for (const line of (await rll.read(appLogFile, 25))) {\n console.error(line);\n }\n return utils_1.exit(1);\n }\n }\n const buildToolsArgs = ['-jar', 'BuildTools.jar', '--compile', target.join(',')];\n if (generateSrc) {\n buildToolsArgs.push('--generate-source');\n }\n if (generateDoc) {\n buildToolsArgs.push('--generate-docs');\n }\n if (disableJavaCheck) {\n buildToolsArgs.push('--disable-java-check');\n }\n const tasks = [];\n for (const ver of versions) {\n tasks.push((callback) => {\n try {\n const start = Date.now();\n const logFile = path_1.join(workingDir.logs, `${ver}.log`);\n console.log(`Building version '${ver}'...`);\n // If there is only one version to build, the cache directory is used instead of copying it first\n const versionDir = gotTemplateDirectory ? path_1.join(workingDir.base, `${ver}`) : workingDir.cache;\n if (gotTemplateDirectory) {\n fs_extra_1.copy(workingDir.cache, versionDir)\n .then(() => {\n utils_1.runCmd('java', [...buildToolsArgs, '--rev', ver], versionDir, logFile, true) // set to silent because multiple builds can run at once\n .then(() => {\n fs_1.rmdirSync(versionDir, { recursive: true }); // delete our task dir\n const end = Date.now();\n console.log(`Finished building '${ver}' in ${((end - start) / 60000)} minutes`);\n callback();\n });\n })\n .catch((err) => {\n console.log(`An error occurred while building '${ver}'`);\n console.error(err);\n console.error(`\\nPrinting last 25 lines from '${path_1.resolve(logFile)}':`);\n rll.read(logFile, 25)\n .then((lines) => {\n for (const line of lines) {\n console.error(line);\n }\n })\n .catch(console.error)\n .finally(() => callback(err));\n });\n }\n }\n catch (err) {\n callback(err);\n }\n });\n }\n async_1.parallelLimit(tasks, threadCount) // Valid according to docs - types outdated?\n .then(() => resolve({ code: 0 }))\n .catch(reject);\n });\n}\nrun()\n .then((result) => utils_1.exit(result.code, result.msg))\n .catch((err) => utils_1.exit(1, err));\n",null,"module.exports = require(\"assert\");","module.exports = require(\"child_process\");","module.exports = require(\"constants\");","module.exports = require(\"fs\");","module.exports = require(\"http\");","module.exports = require(\"https\");","module.exports = require(\"os\");","module.exports = require(\"path\");","module.exports = require(\"stream\");","module.exports = require(\"util\");","// The module cache\nvar __webpack_module_cache__ = {};\n\n// The require function\nfunction __webpack_require__(moduleId) {\n\t// Check if module is in cache\n\tif(__webpack_module_cache__[moduleId]) {\n\t\treturn __webpack_module_cache__[moduleId].exports;\n\t}\n\t// Create a new module (and put it into the cache)\n\tvar module = __webpack_module_cache__[moduleId] = {\n\t\t// no module.id needed\n\t\t// no module.loaded needed\n\t\texports: {}\n\t};\n\n\t// Execute the module function\n\tvar threw = true;\n\ttry {\n\t\t__webpack_modules__[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\t\tthrew = false;\n\t} finally {\n\t\tif(threw) delete __webpack_module_cache__[moduleId];\n\t}\n\n\t// Return the exports of the module\n\treturn module.exports;\n}\n\n","\n__webpack_require__.ab = __dirname + \"/\";","// module exports must be returned from runtime so entry inlining is disabled\n// startup\n// Load entry module and return exports\nreturn __webpack_require__(6144);\n"]} \ No newline at end of file diff --git a/dist/package.json b/dist/package.json new file mode 100644 index 0000000..98aef33 --- /dev/null +++ b/dist/package.json @@ -0,0 +1,47 @@ +{ + "name": "action-spigotmc", + "version": "0.0.1", + "description": "", + "keywords": [], + "homepage": "https://github.com/SpraxDev/Action-SpigotMC#readme", + "main": "dist/index.js", + "private": true, + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1", + "build": "ncc build src/index.ts -s -m", + "start": "node dist/index.js", + "dev": "ncc run src/index.ts" + }, + "author": { + "name": "Christian Koop", + "url": "https://Sprax2013.de", + "email": "developer@sprax2013.de" + }, + "contributors": [], + "license": "MIT", + "repository": { + "type": "git", + "url": "https://github.com/SpraxDev/Action-SpigotMC.git" + }, + "bugs": { + "url": "https://github.com/SpraxDev/Action-SpigotMC/issues" + }, + "engines": { + "node": ">=12.0.0" + }, + "dependencies": { + "@actions/core": "^1.2.6", + "async": "^3.2.0", + "fs-extra": "^9.0.1", + "read-last-lines": "^1.7.2" + }, + "devDependencies": { + "@tsconfig/node12": "^1.0.7", + "@types/async": "^3.2.3", + "@types/fs-extra": "^9.0.2", + "@types/node": "~12.19.2", + "@vercel/ncc": "^0.24.1", + "ts-node": "^9.0.0", + "typescript": "^4.0.5" + } +} diff --git a/dist/sourcemap-register.js b/dist/sourcemap-register.js new file mode 100644 index 0000000..e822564 --- /dev/null +++ b/dist/sourcemap-register.js @@ -0,0 +1,3910 @@ +module.exports = +/******/ (() => { // webpackBootstrap +/******/ var __webpack_modules__ = ({ + +/***/ 650: +/***/ ((module) => { + +var toString = Object.prototype.toString + +var isModern = ( + typeof Buffer.alloc === 'function' && + typeof Buffer.allocUnsafe === 'function' && + typeof Buffer.from === 'function' +) + +function isArrayBuffer (input) { + return toString.call(input).slice(8, -1) === 'ArrayBuffer' +} + +function fromArrayBuffer (obj, byteOffset, length) { + byteOffset >>>= 0 + + var maxLength = obj.byteLength - byteOffset + + if (maxLength < 0) { + throw new RangeError("'offset' is out of bounds") + } + + if (length === undefined) { + length = maxLength + } else { + length >>>= 0 + + if (length > maxLength) { + throw new RangeError("'length' is out of bounds") + } + } + + return isModern + ? Buffer.from(obj.slice(byteOffset, byteOffset + length)) + : new Buffer(new Uint8Array(obj.slice(byteOffset, byteOffset + length))) +} + +function fromString (string, encoding) { + if (typeof encoding !== 'string' || encoding === '') { + encoding = 'utf8' + } + + if (!Buffer.isEncoding(encoding)) { + throw new TypeError('"encoding" must be a valid string encoding') + } + + return isModern + ? Buffer.from(string, encoding) + : new Buffer(string, encoding) +} + +function bufferFrom (value, encodingOrOffset, length) { + if (typeof value === 'number') { + throw new TypeError('"value" argument must not be a number') + } + + if (isArrayBuffer(value)) { + return fromArrayBuffer(value, encodingOrOffset, length) + } + + if (typeof value === 'string') { + return fromString(value, encodingOrOffset) + } + + return isModern + ? Buffer.from(value) + : new Buffer(value) +} + +module.exports = bufferFrom + + +/***/ }), + +/***/ 645: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => { + +__webpack_require__(284).install(); + + +/***/ }), + +/***/ 284: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +var SourceMapConsumer = __webpack_require__(596).SourceMapConsumer; +var path = __webpack_require__(622); + +var fs; +try { + fs = __webpack_require__(747); + if (!fs.existsSync || !fs.readFileSync) { + // fs doesn't have all methods we need + fs = null; + } +} catch (err) { + /* nop */ +} + +var bufferFrom = __webpack_require__(650); + +// Only install once if called multiple times +var errorFormatterInstalled = false; +var uncaughtShimInstalled = false; + +// If true, the caches are reset before a stack trace formatting operation +var emptyCacheBetweenOperations = false; + +// Supports {browser, node, auto} +var environment = "auto"; + +// Maps a file path to a string containing the file contents +var fileContentsCache = {}; + +// Maps a file path to a source map for that file +var sourceMapCache = {}; + +// Regex for detecting source maps +var reSourceMap = /^data:application\/json[^,]+base64,/; + +// Priority list of retrieve handlers +var retrieveFileHandlers = []; +var retrieveMapHandlers = []; + +function isInBrowser() { + if (environment === "browser") + return true; + if (environment === "node") + return false; + return ((typeof window !== 'undefined') && (typeof XMLHttpRequest === 'function') && !(window.require && window.module && window.process && window.process.type === "renderer")); +} + +function hasGlobalProcessEventEmitter() { + return ((typeof process === 'object') && (process !== null) && (typeof process.on === 'function')); +} + +function handlerExec(list) { + return function(arg) { + for (var i = 0; i < list.length; i++) { + var ret = list[i](arg); + if (ret) { + return ret; + } + } + return null; + }; +} + +var retrieveFile = handlerExec(retrieveFileHandlers); + +retrieveFileHandlers.push(function(path) { + // Trim the path to make sure there is no extra whitespace. + path = path.trim(); + if (/^file:/.test(path)) { + // existsSync/readFileSync can't handle file protocol, but once stripped, it works + path = path.replace(/file:\/\/\/(\w:)?/, function(protocol, drive) { + return drive ? + '' : // file:///C:/dir/file -> C:/dir/file + '/'; // file:///root-dir/file -> /root-dir/file + }); + } + if (path in fileContentsCache) { + return fileContentsCache[path]; + } + + var contents = ''; + try { + if (!fs) { + // Use SJAX if we are in the browser + var xhr = new XMLHttpRequest(); + xhr.open('GET', path, /** async */ false); + xhr.send(null); + if (xhr.readyState === 4 && xhr.status === 200) { + contents = xhr.responseText; + } + } else if (fs.existsSync(path)) { + // Otherwise, use the filesystem + contents = fs.readFileSync(path, 'utf8'); + } + } catch (er) { + /* ignore any errors */ + } + + return fileContentsCache[path] = contents; +}); + +// Support URLs relative to a directory, but be careful about a protocol prefix +// in case we are in the browser (i.e. directories may start with "http://" or "file:///") +function supportRelativeURL(file, url) { + if (!file) return url; + var dir = path.dirname(file); + var match = /^\w+:\/\/[^\/]*/.exec(dir); + var protocol = match ? match[0] : ''; + var startPath = dir.slice(protocol.length); + if (protocol && /^\/\w\:/.test(startPath)) { + // handle file:///C:/ paths + protocol += '/'; + return protocol + path.resolve(dir.slice(protocol.length), url).replace(/\\/g, '/'); + } + return protocol + path.resolve(dir.slice(protocol.length), url); +} + +function retrieveSourceMapURL(source) { + var fileData; + + if (isInBrowser()) { + try { + var xhr = new XMLHttpRequest(); + xhr.open('GET', source, false); + xhr.send(null); + fileData = xhr.readyState === 4 ? xhr.responseText : null; + + // Support providing a sourceMappingURL via the SourceMap header + var sourceMapHeader = xhr.getResponseHeader("SourceMap") || + xhr.getResponseHeader("X-SourceMap"); + if (sourceMapHeader) { + return sourceMapHeader; + } + } catch (e) { + } + } + + // Get the URL of the source map + fileData = retrieveFile(source); + var re = /(?:\/\/[@#][ \t]+sourceMappingURL=([^\s'"]+?)[ \t]*$)|(?:\/\*[@#][ \t]+sourceMappingURL=([^\*]+?)[ \t]*(?:\*\/)[ \t]*$)/mg; + // Keep executing the search to find the *last* sourceMappingURL to avoid + // picking up sourceMappingURLs from comments, strings, etc. + var lastMatch, match; + while (match = re.exec(fileData)) lastMatch = match; + if (!lastMatch) return null; + return lastMatch[1]; +}; + +// Can be overridden by the retrieveSourceMap option to install. Takes a +// generated source filename; returns a {map, optional url} object, or null if +// there is no source map. The map field may be either a string or the parsed +// JSON object (ie, it must be a valid argument to the SourceMapConsumer +// constructor). +var retrieveSourceMap = handlerExec(retrieveMapHandlers); +retrieveMapHandlers.push(function(source) { + var sourceMappingURL = retrieveSourceMapURL(source); + if (!sourceMappingURL) return null; + + // Read the contents of the source map + var sourceMapData; + if (reSourceMap.test(sourceMappingURL)) { + // Support source map URL as a data url + var rawData = sourceMappingURL.slice(sourceMappingURL.indexOf(',') + 1); + sourceMapData = bufferFrom(rawData, "base64").toString(); + sourceMappingURL = source; + } else { + // Support source map URLs relative to the source URL + sourceMappingURL = supportRelativeURL(source, sourceMappingURL); + sourceMapData = retrieveFile(sourceMappingURL); + } + + if (!sourceMapData) { + return null; + } + + return { + url: sourceMappingURL, + map: sourceMapData + }; +}); + +function mapSourcePosition(position) { + var sourceMap = sourceMapCache[position.source]; + if (!sourceMap) { + // Call the (overrideable) retrieveSourceMap function to get the source map. + var urlAndMap = retrieveSourceMap(position.source); + if (urlAndMap) { + sourceMap = sourceMapCache[position.source] = { + url: urlAndMap.url, + map: new SourceMapConsumer(urlAndMap.map) + }; + + // Load all sources stored inline with the source map into the file cache + // to pretend like they are already loaded. They may not exist on disk. + if (sourceMap.map.sourcesContent) { + sourceMap.map.sources.forEach(function(source, i) { + var contents = sourceMap.map.sourcesContent[i]; + if (contents) { + var url = supportRelativeURL(sourceMap.url, source); + fileContentsCache[url] = contents; + } + }); + } + } else { + sourceMap = sourceMapCache[position.source] = { + url: null, + map: null + }; + } + } + + // Resolve the source URL relative to the URL of the source map + if (sourceMap && sourceMap.map) { + var originalPosition = sourceMap.map.originalPositionFor(position); + + // Only return the original position if a matching line was found. If no + // matching line is found then we return position instead, which will cause + // the stack trace to print the path and line for the compiled file. It is + // better to give a precise location in the compiled file than a vague + // location in the original file. + if (originalPosition.source !== null) { + originalPosition.source = supportRelativeURL( + sourceMap.url, originalPosition.source); + return originalPosition; + } + } + + return position; +} + +// Parses code generated by FormatEvalOrigin(), a function inside V8: +// https://code.google.com/p/v8/source/browse/trunk/src/messages.js +function mapEvalOrigin(origin) { + // Most eval() calls are in this format + var match = /^eval at ([^(]+) \((.+):(\d+):(\d+)\)$/.exec(origin); + if (match) { + var position = mapSourcePosition({ + source: match[2], + line: +match[3], + column: match[4] - 1 + }); + return 'eval at ' + match[1] + ' (' + position.source + ':' + + position.line + ':' + (position.column + 1) + ')'; + } + + // Parse nested eval() calls using recursion + match = /^eval at ([^(]+) \((.+)\)$/.exec(origin); + if (match) { + return 'eval at ' + match[1] + ' (' + mapEvalOrigin(match[2]) + ')'; + } + + // Make sure we still return useful information if we didn't find anything + return origin; +} + +// This is copied almost verbatim from the V8 source code at +// https://code.google.com/p/v8/source/browse/trunk/src/messages.js. The +// implementation of wrapCallSite() used to just forward to the actual source +// code of CallSite.prototype.toString but unfortunately a new release of V8 +// did something to the prototype chain and broke the shim. The only fix I +// could find was copy/paste. +function CallSiteToString() { + var fileName; + var fileLocation = ""; + if (this.isNative()) { + fileLocation = "native"; + } else { + fileName = this.getScriptNameOrSourceURL(); + if (!fileName && this.isEval()) { + fileLocation = this.getEvalOrigin(); + fileLocation += ", "; // Expecting source position to follow. + } + + if (fileName) { + fileLocation += fileName; + } else { + // Source code does not originate from a file and is not native, but we + // can still get the source position inside the source string, e.g. in + // an eval string. + fileLocation += ""; + } + var lineNumber = this.getLineNumber(); + if (lineNumber != null) { + fileLocation += ":" + lineNumber; + var columnNumber = this.getColumnNumber(); + if (columnNumber) { + fileLocation += ":" + columnNumber; + } + } + } + + var line = ""; + var functionName = this.getFunctionName(); + var addSuffix = true; + var isConstructor = this.isConstructor(); + var isMethodCall = !(this.isToplevel() || isConstructor); + if (isMethodCall) { + var typeName = this.getTypeName(); + // Fixes shim to be backward compatable with Node v0 to v4 + if (typeName === "[object Object]") { + typeName = "null"; + } + var methodName = this.getMethodName(); + if (functionName) { + if (typeName && functionName.indexOf(typeName) != 0) { + line += typeName + "."; + } + line += functionName; + if (methodName && functionName.indexOf("." + methodName) != functionName.length - methodName.length - 1) { + line += " [as " + methodName + "]"; + } + } else { + line += typeName + "." + (methodName || ""); + } + } else if (isConstructor) { + line += "new " + (functionName || ""); + } else if (functionName) { + line += functionName; + } else { + line += fileLocation; + addSuffix = false; + } + if (addSuffix) { + line += " (" + fileLocation + ")"; + } + return line; +} + +function cloneCallSite(frame) { + var object = {}; + Object.getOwnPropertyNames(Object.getPrototypeOf(frame)).forEach(function(name) { + object[name] = /^(?:is|get)/.test(name) ? function() { return frame[name].call(frame); } : frame[name]; + }); + object.toString = CallSiteToString; + return object; +} + +function wrapCallSite(frame) { + if(frame.isNative()) { + return frame; + } + + // Most call sites will return the source file from getFileName(), but code + // passed to eval() ending in "//# sourceURL=..." will return the source file + // from getScriptNameOrSourceURL() instead + var source = frame.getFileName() || frame.getScriptNameOrSourceURL(); + if (source) { + var line = frame.getLineNumber(); + var column = frame.getColumnNumber() - 1; + + // Fix position in Node where some (internal) code is prepended. + // See https://github.com/evanw/node-source-map-support/issues/36 + var headerLength = 62; + if (line === 1 && column > headerLength && !isInBrowser() && !frame.isEval()) { + column -= headerLength; + } + + var position = mapSourcePosition({ + source: source, + line: line, + column: column + }); + frame = cloneCallSite(frame); + var originalFunctionName = frame.getFunctionName; + frame.getFunctionName = function() { return position.name || originalFunctionName(); }; + frame.getFileName = function() { return position.source; }; + frame.getLineNumber = function() { return position.line; }; + frame.getColumnNumber = function() { return position.column + 1; }; + frame.getScriptNameOrSourceURL = function() { return position.source; }; + return frame; + } + + // Code called using eval() needs special handling + var origin = frame.isEval() && frame.getEvalOrigin(); + if (origin) { + origin = mapEvalOrigin(origin); + frame = cloneCallSite(frame); + frame.getEvalOrigin = function() { return origin; }; + return frame; + } + + // If we get here then we were unable to change the source position + return frame; +} + +// This function is part of the V8 stack trace API, for more info see: +// http://code.google.com/p/v8/wiki/JavaScriptStackTraceApi +function prepareStackTrace(error, stack) { + if (emptyCacheBetweenOperations) { + fileContentsCache = {}; + sourceMapCache = {}; + } + + return error + stack.map(function(frame) { + return '\n at ' + wrapCallSite(frame); + }).join(''); +} + +// Generate position and snippet of original source with pointer +function getErrorSource(error) { + var match = /\n at [^(]+ \((.*):(\d+):(\d+)\)/.exec(error.stack); + if (match) { + var source = match[1]; + var line = +match[2]; + var column = +match[3]; + + // Support the inline sourceContents inside the source map + var contents = fileContentsCache[source]; + + // Support files on disk + if (!contents && fs && fs.existsSync(source)) { + try { + contents = fs.readFileSync(source, 'utf8'); + } catch (er) { + contents = ''; + } + } + + // Format the line from the original source code like node does + if (contents) { + var code = contents.split(/(?:\r\n|\r|\n)/)[line - 1]; + if (code) { + return source + ':' + line + '\n' + code + '\n' + + new Array(column).join(' ') + '^'; + } + } + } + return null; +} + +function printErrorAndExit (error) { + var source = getErrorSource(error); + + // Ensure error is printed synchronously and not truncated + if (process.stderr._handle && process.stderr._handle.setBlocking) { + process.stderr._handle.setBlocking(true); + } + + if (source) { + console.error(); + console.error(source); + } + + console.error(error.stack); + process.exit(1); +} + +function shimEmitUncaughtException () { + var origEmit = process.emit; + + process.emit = function (type) { + if (type === 'uncaughtException') { + var hasStack = (arguments[1] && arguments[1].stack); + var hasListeners = (this.listeners(type).length > 0); + + if (hasStack && !hasListeners) { + return printErrorAndExit(arguments[1]); + } + } + + return origEmit.apply(this, arguments); + }; +} + +var originalRetrieveFileHandlers = retrieveFileHandlers.slice(0); +var originalRetrieveMapHandlers = retrieveMapHandlers.slice(0); + +exports.wrapCallSite = wrapCallSite; +exports.getErrorSource = getErrorSource; +exports.mapSourcePosition = mapSourcePosition; +exports.retrieveSourceMap = retrieveSourceMap; + +exports.install = function(options) { + options = options || {}; + + if (options.environment) { + environment = options.environment; + if (["node", "browser", "auto"].indexOf(environment) === -1) { + throw new Error("environment " + environment + " was unknown. Available options are {auto, browser, node}") + } + } + + // Allow sources to be found by methods other than reading the files + // directly from disk. + if (options.retrieveFile) { + if (options.overrideRetrieveFile) { + retrieveFileHandlers.length = 0; + } + + retrieveFileHandlers.unshift(options.retrieveFile); + } + + // Allow source maps to be found by methods other than reading the files + // directly from disk. + if (options.retrieveSourceMap) { + if (options.overrideRetrieveSourceMap) { + retrieveMapHandlers.length = 0; + } + + retrieveMapHandlers.unshift(options.retrieveSourceMap); + } + + // Support runtime transpilers that include inline source maps + if (options.hookRequire && !isInBrowser()) { + var Module; + try { + Module = __webpack_require__(282); + } catch (err) { + // NOP: Loading in catch block to convert webpack error to warning. + } + var $compile = Module.prototype._compile; + + if (!$compile.__sourceMapSupport) { + Module.prototype._compile = function(content, filename) { + fileContentsCache[filename] = content; + sourceMapCache[filename] = undefined; + return $compile.call(this, content, filename); + }; + + Module.prototype._compile.__sourceMapSupport = true; + } + } + + // Configure options + if (!emptyCacheBetweenOperations) { + emptyCacheBetweenOperations = 'emptyCacheBetweenOperations' in options ? + options.emptyCacheBetweenOperations : false; + } + + // Install the error reformatter + if (!errorFormatterInstalled) { + errorFormatterInstalled = true; + Error.prepareStackTrace = prepareStackTrace; + } + + if (!uncaughtShimInstalled) { + var installHandler = 'handleUncaughtExceptions' in options ? + options.handleUncaughtExceptions : true; + + // Provide the option to not install the uncaught exception handler. This is + // to support other uncaught exception handlers (in test frameworks, for + // example). If this handler is not installed and there are no other uncaught + // exception handlers, uncaught exceptions will be caught by node's built-in + // exception handler and the process will still be terminated. However, the + // generated JavaScript code will be shown above the stack trace instead of + // the original source code. + if (installHandler && hasGlobalProcessEventEmitter()) { + uncaughtShimInstalled = true; + shimEmitUncaughtException(); + } + } +}; + +exports.resetRetrieveHandlers = function() { + retrieveFileHandlers.length = 0; + retrieveMapHandlers.length = 0; + + retrieveFileHandlers = originalRetrieveFileHandlers.slice(0); + retrieveMapHandlers = originalRetrieveMapHandlers.slice(0); +} + + +/***/ }), + +/***/ 837: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var util = __webpack_require__(983); +var has = Object.prototype.hasOwnProperty; +var hasNativeMap = typeof Map !== "undefined"; + +/** + * A data structure which is a combination of an array and a set. Adding a new + * member is O(1), testing for membership is O(1), and finding the index of an + * element is O(1). Removing elements from the set is not supported. Only + * strings are supported for membership. + */ +function ArraySet() { + this._array = []; + this._set = hasNativeMap ? new Map() : Object.create(null); +} + +/** + * Static method for creating ArraySet instances from an existing array. + */ +ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) { + var set = new ArraySet(); + for (var i = 0, len = aArray.length; i < len; i++) { + set.add(aArray[i], aAllowDuplicates); + } + return set; +}; + +/** + * Return how many unique items are in this ArraySet. If duplicates have been + * added, than those do not count towards the size. + * + * @returns Number + */ +ArraySet.prototype.size = function ArraySet_size() { + return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length; +}; + +/** + * Add the given string to this set. + * + * @param String aStr + */ +ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) { + var sStr = hasNativeMap ? aStr : util.toSetString(aStr); + var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr); + var idx = this._array.length; + if (!isDuplicate || aAllowDuplicates) { + this._array.push(aStr); + } + if (!isDuplicate) { + if (hasNativeMap) { + this._set.set(aStr, idx); + } else { + this._set[sStr] = idx; + } + } +}; + +/** + * Is the given string a member of this set? + * + * @param String aStr + */ +ArraySet.prototype.has = function ArraySet_has(aStr) { + if (hasNativeMap) { + return this._set.has(aStr); + } else { + var sStr = util.toSetString(aStr); + return has.call(this._set, sStr); + } +}; + +/** + * What is the index of the given string in the array? + * + * @param String aStr + */ +ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) { + if (hasNativeMap) { + var idx = this._set.get(aStr); + if (idx >= 0) { + return idx; + } + } else { + var sStr = util.toSetString(aStr); + if (has.call(this._set, sStr)) { + return this._set[sStr]; + } + } + + throw new Error('"' + aStr + '" is not in the set.'); +}; + +/** + * What is the element at the given index? + * + * @param Number aIdx + */ +ArraySet.prototype.at = function ArraySet_at(aIdx) { + if (aIdx >= 0 && aIdx < this._array.length) { + return this._array[aIdx]; + } + throw new Error('No element indexed by ' + aIdx); +}; + +/** + * Returns the array representation of this set (which has the proper indices + * indicated by indexOf). Note that this is a copy of the internal array used + * for storing the members so that no one can mess with internal state. + */ +ArraySet.prototype.toArray = function ArraySet_toArray() { + return this._array.slice(); +}; + +exports.I = ArraySet; + + +/***/ }), + +/***/ 215: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + * + * Based on the Base 64 VLQ implementation in Closure Compiler: + * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java + * + * Copyright 2011 The Closure Compiler Authors. All rights reserved. + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are + * met: + * + * * Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * * Redistributions in binary form must reproduce the above + * copyright notice, this list of conditions and the following + * disclaimer in the documentation and/or other materials provided + * with the distribution. + * * Neither the name of Google Inc. nor the names of its + * contributors may be used to endorse or promote products derived + * from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +var base64 = __webpack_require__(537); + +// A single base 64 digit can contain 6 bits of data. For the base 64 variable +// length quantities we use in the source map spec, the first bit is the sign, +// the next four bits are the actual value, and the 6th bit is the +// continuation bit. The continuation bit tells us whether there are more +// digits in this value following this digit. +// +// Continuation +// | Sign +// | | +// V V +// 101011 + +var VLQ_BASE_SHIFT = 5; + +// binary: 100000 +var VLQ_BASE = 1 << VLQ_BASE_SHIFT; + +// binary: 011111 +var VLQ_BASE_MASK = VLQ_BASE - 1; + +// binary: 100000 +var VLQ_CONTINUATION_BIT = VLQ_BASE; + +/** + * Converts from a two-complement value to a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 1 becomes 2 (10 binary), -1 becomes 3 (11 binary) + * 2 becomes 4 (100 binary), -2 becomes 5 (101 binary) + */ +function toVLQSigned(aValue) { + return aValue < 0 + ? ((-aValue) << 1) + 1 + : (aValue << 1) + 0; +} + +/** + * Converts to a two-complement value from a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 2 (10 binary) becomes 1, 3 (11 binary) becomes -1 + * 4 (100 binary) becomes 2, 5 (101 binary) becomes -2 + */ +function fromVLQSigned(aValue) { + var isNegative = (aValue & 1) === 1; + var shifted = aValue >> 1; + return isNegative + ? -shifted + : shifted; +} + +/** + * Returns the base 64 VLQ encoded value. + */ +exports.encode = function base64VLQ_encode(aValue) { + var encoded = ""; + var digit; + + var vlq = toVLQSigned(aValue); + + do { + digit = vlq & VLQ_BASE_MASK; + vlq >>>= VLQ_BASE_SHIFT; + if (vlq > 0) { + // There are still more digits in this value, so we must make sure the + // continuation bit is marked. + digit |= VLQ_CONTINUATION_BIT; + } + encoded += base64.encode(digit); + } while (vlq > 0); + + return encoded; +}; + +/** + * Decodes the next base 64 VLQ value from the given string and returns the + * value and the rest of the string via the out parameter. + */ +exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) { + var strLen = aStr.length; + var result = 0; + var shift = 0; + var continuation, digit; + + do { + if (aIndex >= strLen) { + throw new Error("Expected more digits in base 64 VLQ value."); + } + + digit = base64.decode(aStr.charCodeAt(aIndex++)); + if (digit === -1) { + throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1)); + } + + continuation = !!(digit & VLQ_CONTINUATION_BIT); + digit &= VLQ_BASE_MASK; + result = result + (digit << shift); + shift += VLQ_BASE_SHIFT; + } while (continuation); + + aOutParam.value = fromVLQSigned(result); + aOutParam.rest = aIndex; +}; + + +/***/ }), + +/***/ 537: +/***/ ((__unused_webpack_module, exports) => { + +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split(''); + +/** + * Encode an integer in the range of 0 to 63 to a single base 64 digit. + */ +exports.encode = function (number) { + if (0 <= number && number < intToCharMap.length) { + return intToCharMap[number]; + } + throw new TypeError("Must be between 0 and 63: " + number); +}; + +/** + * Decode a single base 64 character code digit to an integer. Returns -1 on + * failure. + */ +exports.decode = function (charCode) { + var bigA = 65; // 'A' + var bigZ = 90; // 'Z' + + var littleA = 97; // 'a' + var littleZ = 122; // 'z' + + var zero = 48; // '0' + var nine = 57; // '9' + + var plus = 43; // '+' + var slash = 47; // '/' + + var littleOffset = 26; + var numberOffset = 52; + + // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ + if (bigA <= charCode && charCode <= bigZ) { + return (charCode - bigA); + } + + // 26 - 51: abcdefghijklmnopqrstuvwxyz + if (littleA <= charCode && charCode <= littleZ) { + return (charCode - littleA + littleOffset); + } + + // 52 - 61: 0123456789 + if (zero <= charCode && charCode <= nine) { + return (charCode - zero + numberOffset); + } + + // 62: + + if (charCode == plus) { + return 62; + } + + // 63: / + if (charCode == slash) { + return 63; + } + + // Invalid base64 digit. + return -1; +}; + + +/***/ }), + +/***/ 164: +/***/ ((__unused_webpack_module, exports) => { + +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +exports.GREATEST_LOWER_BOUND = 1; +exports.LEAST_UPPER_BOUND = 2; + +/** + * Recursive implementation of binary search. + * + * @param aLow Indices here and lower do not contain the needle. + * @param aHigh Indices here and higher do not contain the needle. + * @param aNeedle The element being searched for. + * @param aHaystack The non-empty array being searched. + * @param aCompare Function which takes two elements and returns -1, 0, or 1. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + */ +function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) { + // This function terminates when one of the following is true: + // + // 1. We find the exact element we are looking for. + // + // 2. We did not find the exact element, but we can return the index of + // the next-closest element. + // + // 3. We did not find the exact element, and there is no next-closest + // element than the one we are searching for, so we return -1. + var mid = Math.floor((aHigh - aLow) / 2) + aLow; + var cmp = aCompare(aNeedle, aHaystack[mid], true); + if (cmp === 0) { + // Found the element we are looking for. + return mid; + } + else if (cmp > 0) { + // Our needle is greater than aHaystack[mid]. + if (aHigh - mid > 1) { + // The element is in the upper half. + return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias); + } + + // The exact needle element was not found in this haystack. Determine if + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return aHigh < aHaystack.length ? aHigh : -1; + } else { + return mid; + } + } + else { + // Our needle is less than aHaystack[mid]. + if (mid - aLow > 1) { + // The element is in the lower half. + return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias); + } + + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return mid; + } else { + return aLow < 0 ? -1 : aLow; + } + } +} + +/** + * This is an implementation of binary search which will always try and return + * the index of the closest element if there is no exact hit. This is because + * mappings between original and generated line/col pairs are single points, + * and there is an implicit region between each of them, so a miss just means + * that you aren't on the very start of a region. + * + * @param aNeedle The element you are looking for. + * @param aHaystack The array that is being searched. + * @param aCompare A function which takes the needle and an element in the + * array and returns -1, 0, or 1 depending on whether the needle is less + * than, equal to, or greater than the element, respectively. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'binarySearch.GREATEST_LOWER_BOUND'. + */ +exports.search = function search(aNeedle, aHaystack, aCompare, aBias) { + if (aHaystack.length === 0) { + return -1; + } + + var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack, + aCompare, aBias || exports.GREATEST_LOWER_BOUND); + if (index < 0) { + return -1; + } + + // We have found either the exact element, or the next-closest element than + // the one we are searching for. However, there may be more than one such + // element. Make sure we always return the smallest of these. + while (index - 1 >= 0) { + if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) { + break; + } + --index; + } + + return index; +}; + + +/***/ }), + +/***/ 740: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2014 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var util = __webpack_require__(983); + +/** + * Determine whether mappingB is after mappingA with respect to generated + * position. + */ +function generatedPositionAfter(mappingA, mappingB) { + // Optimized for most common case + var lineA = mappingA.generatedLine; + var lineB = mappingB.generatedLine; + var columnA = mappingA.generatedColumn; + var columnB = mappingB.generatedColumn; + return lineB > lineA || lineB == lineA && columnB >= columnA || + util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0; +} + +/** + * A data structure to provide a sorted view of accumulated mappings in a + * performance conscious manner. It trades a neglibable overhead in general + * case for a large speedup in case of mappings being added in order. + */ +function MappingList() { + this._array = []; + this._sorted = true; + // Serves as infimum + this._last = {generatedLine: -1, generatedColumn: 0}; +} + +/** + * Iterate through internal items. This method takes the same arguments that + * `Array.prototype.forEach` takes. + * + * NOTE: The order of the mappings is NOT guaranteed. + */ +MappingList.prototype.unsortedForEach = + function MappingList_forEach(aCallback, aThisArg) { + this._array.forEach(aCallback, aThisArg); + }; + +/** + * Add the given source mapping. + * + * @param Object aMapping + */ +MappingList.prototype.add = function MappingList_add(aMapping) { + if (generatedPositionAfter(this._last, aMapping)) { + this._last = aMapping; + this._array.push(aMapping); + } else { + this._sorted = false; + this._array.push(aMapping); + } +}; + +/** + * Returns the flat, sorted array of mappings. The mappings are sorted by + * generated position. + * + * WARNING: This method returns internal data without copying, for + * performance. The return value must NOT be mutated, and should be treated as + * an immutable borrow. If you want to take ownership, you must make your own + * copy. + */ +MappingList.prototype.toArray = function MappingList_toArray() { + if (!this._sorted) { + this._array.sort(util.compareByGeneratedPositionsInflated); + this._sorted = true; + } + return this._array; +}; + +exports.H = MappingList; + + +/***/ }), + +/***/ 226: +/***/ ((__unused_webpack_module, exports) => { + +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +// It turns out that some (most?) JavaScript engines don't self-host +// `Array.prototype.sort`. This makes sense because C++ will likely remain +// faster than JS when doing raw CPU-intensive sorting. However, when using a +// custom comparator function, calling back and forth between the VM's C++ and +// JIT'd JS is rather slow *and* loses JIT type information, resulting in +// worse generated code for the comparator function than would be optimal. In +// fact, when sorting with a comparator, these costs outweigh the benefits of +// sorting in C++. By using our own JS-implemented Quick Sort (below), we get +// a ~3500ms mean speed-up in `bench/bench.html`. + +/** + * Swap the elements indexed by `x` and `y` in the array `ary`. + * + * @param {Array} ary + * The array. + * @param {Number} x + * The index of the first item. + * @param {Number} y + * The index of the second item. + */ +function swap(ary, x, y) { + var temp = ary[x]; + ary[x] = ary[y]; + ary[y] = temp; +} + +/** + * Returns a random integer within the range `low .. high` inclusive. + * + * @param {Number} low + * The lower bound on the range. + * @param {Number} high + * The upper bound on the range. + */ +function randomIntInRange(low, high) { + return Math.round(low + (Math.random() * (high - low))); +} + +/** + * The Quick Sort algorithm. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + * @param {Number} p + * Start index of the array + * @param {Number} r + * End index of the array + */ +function doQuickSort(ary, comparator, p, r) { + // If our lower bound is less than our upper bound, we (1) partition the + // array into two pieces and (2) recurse on each half. If it is not, this is + // the empty array and our base case. + + if (p < r) { + // (1) Partitioning. + // + // The partitioning chooses a pivot between `p` and `r` and moves all + // elements that are less than or equal to the pivot to the before it, and + // all the elements that are greater than it after it. The effect is that + // once partition is done, the pivot is in the exact place it will be when + // the array is put in sorted order, and it will not need to be moved + // again. This runs in O(n) time. + + // Always choose a random pivot so that an input array which is reverse + // sorted does not cause O(n^2) running time. + var pivotIndex = randomIntInRange(p, r); + var i = p - 1; + + swap(ary, pivotIndex, r); + var pivot = ary[r]; + + // Immediately after `j` is incremented in this loop, the following hold + // true: + // + // * Every element in `ary[p .. i]` is less than or equal to the pivot. + // + // * Every element in `ary[i+1 .. j-1]` is greater than the pivot. + for (var j = p; j < r; j++) { + if (comparator(ary[j], pivot) <= 0) { + i += 1; + swap(ary, i, j); + } + } + + swap(ary, i + 1, j); + var q = i + 1; + + // (2) Recurse on each half. + + doQuickSort(ary, comparator, p, q - 1); + doQuickSort(ary, comparator, q + 1, r); + } +} + +/** + * Sort the given array in-place with the given comparator function. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + */ +exports.U = function (ary, comparator) { + doQuickSort(ary, comparator, 0, ary.length - 1); +}; + + +/***/ }), + +/***/ 327: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +var __webpack_unused_export__; +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var util = __webpack_require__(983); +var binarySearch = __webpack_require__(164); +var ArraySet = __webpack_require__(837)/* .ArraySet */ .I; +var base64VLQ = __webpack_require__(215); +var quickSort = __webpack_require__(226)/* .quickSort */ .U; + +function SourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + return sourceMap.sections != null + ? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL) + : new BasicSourceMapConsumer(sourceMap, aSourceMapURL); +} + +SourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) { + return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL); +} + +/** + * The version of the source mapping spec that we are consuming. + */ +SourceMapConsumer.prototype._version = 3; + +// `__generatedMappings` and `__originalMappings` are arrays that hold the +// parsed mapping coordinates from the source map's "mappings" attribute. They +// are lazily instantiated, accessed via the `_generatedMappings` and +// `_originalMappings` getters respectively, and we only parse the mappings +// and create these arrays once queried for a source location. We jump through +// these hoops because there can be many thousands of mappings, and parsing +// them is expensive, so we only want to do it if we must. +// +// Each object in the arrays is of the form: +// +// { +// generatedLine: The line number in the generated code, +// generatedColumn: The column number in the generated code, +// source: The path to the original source file that generated this +// chunk of code, +// originalLine: The line number in the original source that +// corresponds to this chunk of generated code, +// originalColumn: The column number in the original source that +// corresponds to this chunk of generated code, +// name: The name of the original symbol which generated this chunk of +// code. +// } +// +// All properties except for `generatedLine` and `generatedColumn` can be +// `null`. +// +// `_generatedMappings` is ordered by the generated positions. +// +// `_originalMappings` is ordered by the original positions. + +SourceMapConsumer.prototype.__generatedMappings = null; +Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__generatedMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__generatedMappings; + } +}); + +SourceMapConsumer.prototype.__originalMappings = null; +Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__originalMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__originalMappings; + } +}); + +SourceMapConsumer.prototype._charIsMappingSeparator = + function SourceMapConsumer_charIsMappingSeparator(aStr, index) { + var c = aStr.charAt(index); + return c === ";" || c === ","; + }; + +/** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ +SourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + throw new Error("Subclasses must implement _parseMappings"); + }; + +SourceMapConsumer.GENERATED_ORDER = 1; +SourceMapConsumer.ORIGINAL_ORDER = 2; + +SourceMapConsumer.GREATEST_LOWER_BOUND = 1; +SourceMapConsumer.LEAST_UPPER_BOUND = 2; + +/** + * Iterate over each mapping between an original source/line/column and a + * generated line/column in this source map. + * + * @param Function aCallback + * The function that is called with each mapping. + * @param Object aContext + * Optional. If specified, this object will be the value of `this` every + * time that `aCallback` is called. + * @param aOrder + * Either `SourceMapConsumer.GENERATED_ORDER` or + * `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to + * iterate over the mappings sorted by the generated file's line/column + * order or the original's source/line/column order, respectively. Defaults to + * `SourceMapConsumer.GENERATED_ORDER`. + */ +SourceMapConsumer.prototype.eachMapping = + function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) { + var context = aContext || null; + var order = aOrder || SourceMapConsumer.GENERATED_ORDER; + + var mappings; + switch (order) { + case SourceMapConsumer.GENERATED_ORDER: + mappings = this._generatedMappings; + break; + case SourceMapConsumer.ORIGINAL_ORDER: + mappings = this._originalMappings; + break; + default: + throw new Error("Unknown order of iteration."); + } + + var sourceRoot = this.sourceRoot; + mappings.map(function (mapping) { + var source = mapping.source === null ? null : this._sources.at(mapping.source); + source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL); + return { + source: source, + generatedLine: mapping.generatedLine, + generatedColumn: mapping.generatedColumn, + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: mapping.name === null ? null : this._names.at(mapping.name) + }; + }, this).forEach(aCallback, context); + }; + +/** + * Returns all generated line and column information for the original source, + * line, and column provided. If no column is provided, returns all mappings + * corresponding to a either the line we are searching for or the next + * closest line that has any mappings. Otherwise, returns all mappings + * corresponding to the given line and either the column we are searching for + * or the next closest column that has any offsets. + * + * The only argument is an object with the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number is 1-based. + * - column: Optional. the column number in the original source. + * The column number is 0-based. + * + * and an array of objects is returned, each with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ +SourceMapConsumer.prototype.allGeneratedPositionsFor = + function SourceMapConsumer_allGeneratedPositionsFor(aArgs) { + var line = util.getArg(aArgs, 'line'); + + // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping + // returns the index of the closest mapping less than the needle. By + // setting needle.originalColumn to 0, we thus find the last mapping for + // the given line, provided such a mapping exists. + var needle = { + source: util.getArg(aArgs, 'source'), + originalLine: line, + originalColumn: util.getArg(aArgs, 'column', 0) + }; + + needle.source = this._findSourceIndex(needle.source); + if (needle.source < 0) { + return []; + } + + var mappings = []; + + var index = this._findMapping(needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + binarySearch.LEAST_UPPER_BOUND); + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (aArgs.column === undefined) { + var originalLine = mapping.originalLine; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we found. Since + // mappings are sorted, this is guaranteed to find all mappings for + // the line we found. + while (mapping && mapping.originalLine === originalLine) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } else { + var originalColumn = mapping.originalColumn; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we were searching for. + // Since mappings are sorted, this is guaranteed to find all mappings for + // the line we are searching for. + while (mapping && + mapping.originalLine === line && + mapping.originalColumn == originalColumn) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } + } + + return mappings; + }; + +exports.SourceMapConsumer = SourceMapConsumer; + +/** + * A BasicSourceMapConsumer instance represents a parsed source map which we can + * query for information about the original file positions by giving it a file + * position in the generated source. + * + * The first parameter is the raw source map (either as a JSON string, or + * already parsed to an object). According to the spec, source maps have the + * following attributes: + * + * - version: Which version of the source map spec this map is following. + * - sources: An array of URLs to the original source files. + * - names: An array of identifiers which can be referrenced by individual mappings. + * - sourceRoot: Optional. The URL root from which all sources are relative. + * - sourcesContent: Optional. An array of contents of the original source files. + * - mappings: A string of base64 VLQs which contain the actual mappings. + * - file: Optional. The generated file this source map is associated with. + * + * Here is an example source map, taken from the source map spec[0]: + * + * { + * version : 3, + * file: "out.js", + * sourceRoot : "", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AA,AB;;ABCDE;" + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1# + */ +function BasicSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sources = util.getArg(sourceMap, 'sources'); + // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which + // requires the array) to play nice here. + var names = util.getArg(sourceMap, 'names', []); + var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null); + var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null); + var mappings = util.getArg(sourceMap, 'mappings'); + var file = util.getArg(sourceMap, 'file', null); + + // Once again, Sass deviates from the spec and supplies the version as a + // string rather than a number, so we use loose equality checking here. + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + if (sourceRoot) { + sourceRoot = util.normalize(sourceRoot); + } + + sources = sources + .map(String) + // Some source maps produce relative source paths like "./foo.js" instead of + // "foo.js". Normalize these first so that future comparisons will succeed. + // See bugzil.la/1090768. + .map(util.normalize) + // Always ensure that absolute sources are internally stored relative to + // the source root, if the source root is absolute. Not doing this would + // be particularly problematic when the source root is a prefix of the + // source (valid, but why??). See github issue #199 and bugzil.la/1188982. + .map(function (source) { + return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source) + ? util.relative(sourceRoot, source) + : source; + }); + + // Pass `true` below to allow duplicate names and sources. While source maps + // are intended to be compressed and deduplicated, the TypeScript compiler + // sometimes generates source maps with duplicates in them. See Github issue + // #72 and bugzil.la/889492. + this._names = ArraySet.fromArray(names.map(String), true); + this._sources = ArraySet.fromArray(sources, true); + + this._absoluteSources = this._sources.toArray().map(function (s) { + return util.computeSourceURL(sourceRoot, s, aSourceMapURL); + }); + + this.sourceRoot = sourceRoot; + this.sourcesContent = sourcesContent; + this._mappings = mappings; + this._sourceMapURL = aSourceMapURL; + this.file = file; +} + +BasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); +BasicSourceMapConsumer.prototype.consumer = SourceMapConsumer; + +/** + * Utility function to find the index of a source. Returns -1 if not + * found. + */ +BasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) { + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + if (this._sources.has(relativeSource)) { + return this._sources.indexOf(relativeSource); + } + + // Maybe aSource is an absolute URL as returned by |sources|. In + // this case we can't simply undo the transform. + var i; + for (i = 0; i < this._absoluteSources.length; ++i) { + if (this._absoluteSources[i] == aSource) { + return i; + } + } + + return -1; +}; + +/** + * Create a BasicSourceMapConsumer from a SourceMapGenerator. + * + * @param SourceMapGenerator aSourceMap + * The source map that will be consumed. + * @param String aSourceMapURL + * The URL at which the source map can be found (optional) + * @returns BasicSourceMapConsumer + */ +BasicSourceMapConsumer.fromSourceMap = + function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) { + var smc = Object.create(BasicSourceMapConsumer.prototype); + + var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true); + var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true); + smc.sourceRoot = aSourceMap._sourceRoot; + smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(), + smc.sourceRoot); + smc.file = aSourceMap._file; + smc._sourceMapURL = aSourceMapURL; + smc._absoluteSources = smc._sources.toArray().map(function (s) { + return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL); + }); + + // Because we are modifying the entries (by converting string sources and + // names to indices into the sources and names ArraySets), we have to make + // a copy of the entry or else bad things happen. Shared mutable state + // strikes again! See github issue #191. + + var generatedMappings = aSourceMap._mappings.toArray().slice(); + var destGeneratedMappings = smc.__generatedMappings = []; + var destOriginalMappings = smc.__originalMappings = []; + + for (var i = 0, length = generatedMappings.length; i < length; i++) { + var srcMapping = generatedMappings[i]; + var destMapping = new Mapping; + destMapping.generatedLine = srcMapping.generatedLine; + destMapping.generatedColumn = srcMapping.generatedColumn; + + if (srcMapping.source) { + destMapping.source = sources.indexOf(srcMapping.source); + destMapping.originalLine = srcMapping.originalLine; + destMapping.originalColumn = srcMapping.originalColumn; + + if (srcMapping.name) { + destMapping.name = names.indexOf(srcMapping.name); + } + + destOriginalMappings.push(destMapping); + } + + destGeneratedMappings.push(destMapping); + } + + quickSort(smc.__originalMappings, util.compareByOriginalPositions); + + return smc; + }; + +/** + * The version of the source mapping spec that we are consuming. + */ +BasicSourceMapConsumer.prototype._version = 3; + +/** + * The list of original sources. + */ +Object.defineProperty(BasicSourceMapConsumer.prototype, 'sources', { + get: function () { + return this._absoluteSources.slice(); + } +}); + +/** + * Provide the JIT with a nice shape / hidden class. + */ +function Mapping() { + this.generatedLine = 0; + this.generatedColumn = 0; + this.source = null; + this.originalLine = null; + this.originalColumn = null; + this.name = null; +} + +/** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ +BasicSourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + var generatedLine = 1; + var previousGeneratedColumn = 0; + var previousOriginalLine = 0; + var previousOriginalColumn = 0; + var previousSource = 0; + var previousName = 0; + var length = aStr.length; + var index = 0; + var cachedSegments = {}; + var temp = {}; + var originalMappings = []; + var generatedMappings = []; + var mapping, str, segment, end, value; + + while (index < length) { + if (aStr.charAt(index) === ';') { + generatedLine++; + index++; + previousGeneratedColumn = 0; + } + else if (aStr.charAt(index) === ',') { + index++; + } + else { + mapping = new Mapping(); + mapping.generatedLine = generatedLine; + + // Because each offset is encoded relative to the previous one, + // many segments often have the same encoding. We can exploit this + // fact by caching the parsed variable length fields of each segment, + // allowing us to avoid a second parse if we encounter the same + // segment again. + for (end = index; end < length; end++) { + if (this._charIsMappingSeparator(aStr, end)) { + break; + } + } + str = aStr.slice(index, end); + + segment = cachedSegments[str]; + if (segment) { + index += str.length; + } else { + segment = []; + while (index < end) { + base64VLQ.decode(aStr, index, temp); + value = temp.value; + index = temp.rest; + segment.push(value); + } + + if (segment.length === 2) { + throw new Error('Found a source, but no line and column'); + } + + if (segment.length === 3) { + throw new Error('Found a source and line, but no column'); + } + + cachedSegments[str] = segment; + } + + // Generated column. + mapping.generatedColumn = previousGeneratedColumn + segment[0]; + previousGeneratedColumn = mapping.generatedColumn; + + if (segment.length > 1) { + // Original source. + mapping.source = previousSource + segment[1]; + previousSource += segment[1]; + + // Original line. + mapping.originalLine = previousOriginalLine + segment[2]; + previousOriginalLine = mapping.originalLine; + // Lines are stored 0-based + mapping.originalLine += 1; + + // Original column. + mapping.originalColumn = previousOriginalColumn + segment[3]; + previousOriginalColumn = mapping.originalColumn; + + if (segment.length > 4) { + // Original name. + mapping.name = previousName + segment[4]; + previousName += segment[4]; + } + } + + generatedMappings.push(mapping); + if (typeof mapping.originalLine === 'number') { + originalMappings.push(mapping); + } + } + } + + quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated); + this.__generatedMappings = generatedMappings; + + quickSort(originalMappings, util.compareByOriginalPositions); + this.__originalMappings = originalMappings; + }; + +/** + * Find the mapping that best matches the hypothetical "needle" mapping that + * we are searching for in the given "haystack" of mappings. + */ +BasicSourceMapConsumer.prototype._findMapping = + function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName, + aColumnName, aComparator, aBias) { + // To return the position we are searching for, we must first find the + // mapping for the given position and then return the opposite position it + // points to. Because the mappings are sorted, we can use binary search to + // find the best mapping. + + if (aNeedle[aLineName] <= 0) { + throw new TypeError('Line must be greater than or equal to 1, got ' + + aNeedle[aLineName]); + } + if (aNeedle[aColumnName] < 0) { + throw new TypeError('Column must be greater than or equal to 0, got ' + + aNeedle[aColumnName]); + } + + return binarySearch.search(aNeedle, aMappings, aComparator, aBias); + }; + +/** + * Compute the last column for each generated mapping. The last column is + * inclusive. + */ +BasicSourceMapConsumer.prototype.computeColumnSpans = + function SourceMapConsumer_computeColumnSpans() { + for (var index = 0; index < this._generatedMappings.length; ++index) { + var mapping = this._generatedMappings[index]; + + // Mappings do not contain a field for the last generated columnt. We + // can come up with an optimistic estimate, however, by assuming that + // mappings are contiguous (i.e. given two consecutive mappings, the + // first mapping ends where the second one starts). + if (index + 1 < this._generatedMappings.length) { + var nextMapping = this._generatedMappings[index + 1]; + + if (mapping.generatedLine === nextMapping.generatedLine) { + mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1; + continue; + } + } + + // The last mapping for each line spans the entire line. + mapping.lastGeneratedColumn = Infinity; + } + }; + +/** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ +BasicSourceMapConsumer.prototype.originalPositionFor = + function SourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._generatedMappings, + "generatedLine", + "generatedColumn", + util.compareByGeneratedPositionsDeflated, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._generatedMappings[index]; + + if (mapping.generatedLine === needle.generatedLine) { + var source = util.getArg(mapping, 'source', null); + if (source !== null) { + source = this._sources.at(source); + source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL); + } + var name = util.getArg(mapping, 'name', null); + if (name !== null) { + name = this._names.at(name); + } + return { + source: source, + line: util.getArg(mapping, 'originalLine', null), + column: util.getArg(mapping, 'originalColumn', null), + name: name + }; + } + } + + return { + source: null, + line: null, + column: null, + name: null + }; + }; + +/** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ +BasicSourceMapConsumer.prototype.hasContentsOfAllSources = + function BasicSourceMapConsumer_hasContentsOfAllSources() { + if (!this.sourcesContent) { + return false; + } + return this.sourcesContent.length >= this._sources.size() && + !this.sourcesContent.some(function (sc) { return sc == null; }); + }; + +/** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ +BasicSourceMapConsumer.prototype.sourceContentFor = + function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + if (!this.sourcesContent) { + return null; + } + + var index = this._findSourceIndex(aSource); + if (index >= 0) { + return this.sourcesContent[index]; + } + + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + var url; + if (this.sourceRoot != null + && (url = util.urlParse(this.sourceRoot))) { + // XXX: file:// URIs and absolute paths lead to unexpected behavior for + // many users. We can help them out when they expect file:// URIs to + // behave like it would if they were running a local HTTP server. See + // https://bugzilla.mozilla.org/show_bug.cgi?id=885597. + var fileUriAbsPath = relativeSource.replace(/^file:\/\//, ""); + if (url.scheme == "file" + && this._sources.has(fileUriAbsPath)) { + return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)] + } + + if ((!url.path || url.path == "/") + && this._sources.has("/" + relativeSource)) { + return this.sourcesContent[this._sources.indexOf("/" + relativeSource)]; + } + } + + // This function is used recursively from + // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we + // don't want to throw if we can't find the source - we just want to + // return null, so we provide a flag to exit gracefully. + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + relativeSource + '" is not in the SourceMap.'); + } + }; + +/** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ +BasicSourceMapConsumer.prototype.generatedPositionFor = + function SourceMapConsumer_generatedPositionFor(aArgs) { + var source = util.getArg(aArgs, 'source'); + source = this._findSourceIndex(source); + if (source < 0) { + return { + line: null, + column: null, + lastColumn: null + }; + } + + var needle = { + source: source, + originalLine: util.getArg(aArgs, 'line'), + originalColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (mapping.source === needle.source) { + return { + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }; + } + } + + return { + line: null, + column: null, + lastColumn: null + }; + }; + +__webpack_unused_export__ = BasicSourceMapConsumer; + +/** + * An IndexedSourceMapConsumer instance represents a parsed source map which + * we can query for information. It differs from BasicSourceMapConsumer in + * that it takes "indexed" source maps (i.e. ones with a "sections" field) as + * input. + * + * The first parameter is a raw source map (either as a JSON string, or already + * parsed to an object). According to the spec for indexed source maps, they + * have the following attributes: + * + * - version: Which version of the source map spec this map is following. + * - file: Optional. The generated file this source map is associated with. + * - sections: A list of section definitions. + * + * Each value under the "sections" field has two fields: + * - offset: The offset into the original specified at which this section + * begins to apply, defined as an object with a "line" and "column" + * field. + * - map: A source map definition. This source map could also be indexed, + * but doesn't have to be. + * + * Instead of the "map" field, it's also possible to have a "url" field + * specifying a URL to retrieve a source map from, but that's currently + * unsupported. + * + * Here's an example source map, taken from the source map spec[0], but + * modified to omit a section which uses the "url" field. + * + * { + * version : 3, + * file: "app.js", + * sections: [{ + * offset: {line:100, column:10}, + * map: { + * version : 3, + * file: "section.js", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AAAA,E;;ABCDE;" + * } + * }], + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt + */ +function IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sections = util.getArg(sourceMap, 'sections'); + + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + this._sources = new ArraySet(); + this._names = new ArraySet(); + + var lastOffset = { + line: -1, + column: 0 + }; + this._sections = sections.map(function (s) { + if (s.url) { + // The url field will require support for asynchronicity. + // See https://github.com/mozilla/source-map/issues/16 + throw new Error('Support for url field in sections not implemented.'); + } + var offset = util.getArg(s, 'offset'); + var offsetLine = util.getArg(offset, 'line'); + var offsetColumn = util.getArg(offset, 'column'); + + if (offsetLine < lastOffset.line || + (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) { + throw new Error('Section offsets must be ordered and non-overlapping.'); + } + lastOffset = offset; + + return { + generatedOffset: { + // The offset fields are 0-based, but we use 1-based indices when + // encoding/decoding from VLQ. + generatedLine: offsetLine + 1, + generatedColumn: offsetColumn + 1 + }, + consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL) + } + }); +} + +IndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); +IndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer; + +/** + * The version of the source mapping spec that we are consuming. + */ +IndexedSourceMapConsumer.prototype._version = 3; + +/** + * The list of original sources. + */ +Object.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', { + get: function () { + var sources = []; + for (var i = 0; i < this._sections.length; i++) { + for (var j = 0; j < this._sections[i].consumer.sources.length; j++) { + sources.push(this._sections[i].consumer.sources[j]); + } + } + return sources; + } +}); + +/** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ +IndexedSourceMapConsumer.prototype.originalPositionFor = + function IndexedSourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + // Find the section containing the generated position we're trying to map + // to an original position. + var sectionIndex = binarySearch.search(needle, this._sections, + function(needle, section) { + var cmp = needle.generatedLine - section.generatedOffset.generatedLine; + if (cmp) { + return cmp; + } + + return (needle.generatedColumn - + section.generatedOffset.generatedColumn); + }); + var section = this._sections[sectionIndex]; + + if (!section) { + return { + source: null, + line: null, + column: null, + name: null + }; + } + + return section.consumer.originalPositionFor({ + line: needle.generatedLine - + (section.generatedOffset.generatedLine - 1), + column: needle.generatedColumn - + (section.generatedOffset.generatedLine === needle.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + bias: aArgs.bias + }); + }; + +/** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ +IndexedSourceMapConsumer.prototype.hasContentsOfAllSources = + function IndexedSourceMapConsumer_hasContentsOfAllSources() { + return this._sections.every(function (s) { + return s.consumer.hasContentsOfAllSources(); + }); + }; + +/** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ +IndexedSourceMapConsumer.prototype.sourceContentFor = + function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + var content = section.consumer.sourceContentFor(aSource, true); + if (content) { + return content; + } + } + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + aSource + '" is not in the SourceMap.'); + } + }; + +/** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ +IndexedSourceMapConsumer.prototype.generatedPositionFor = + function IndexedSourceMapConsumer_generatedPositionFor(aArgs) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + // Only consider this section if the requested source is in the list of + // sources of the consumer. + if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) { + continue; + } + var generatedPosition = section.consumer.generatedPositionFor(aArgs); + if (generatedPosition) { + var ret = { + line: generatedPosition.line + + (section.generatedOffset.generatedLine - 1), + column: generatedPosition.column + + (section.generatedOffset.generatedLine === generatedPosition.line + ? section.generatedOffset.generatedColumn - 1 + : 0) + }; + return ret; + } + } + + return { + line: null, + column: null + }; + }; + +/** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ +IndexedSourceMapConsumer.prototype._parseMappings = + function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) { + this.__generatedMappings = []; + this.__originalMappings = []; + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + var sectionMappings = section.consumer._generatedMappings; + for (var j = 0; j < sectionMappings.length; j++) { + var mapping = sectionMappings[j]; + + var source = section.consumer._sources.at(mapping.source); + source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL); + this._sources.add(source); + source = this._sources.indexOf(source); + + var name = null; + if (mapping.name) { + name = section.consumer._names.at(mapping.name); + this._names.add(name); + name = this._names.indexOf(name); + } + + // The mappings coming from the consumer for the section have + // generated positions relative to the start of the section, so we + // need to offset them to be relative to the start of the concatenated + // generated file. + var adjustedMapping = { + source: source, + generatedLine: mapping.generatedLine + + (section.generatedOffset.generatedLine - 1), + generatedColumn: mapping.generatedColumn + + (section.generatedOffset.generatedLine === mapping.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: name + }; + + this.__generatedMappings.push(adjustedMapping); + if (typeof adjustedMapping.originalLine === 'number') { + this.__originalMappings.push(adjustedMapping); + } + } + } + + quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated); + quickSort(this.__originalMappings, util.compareByOriginalPositions); + }; + +__webpack_unused_export__ = IndexedSourceMapConsumer; + + +/***/ }), + +/***/ 341: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var base64VLQ = __webpack_require__(215); +var util = __webpack_require__(983); +var ArraySet = __webpack_require__(837)/* .ArraySet */ .I; +var MappingList = __webpack_require__(740)/* .MappingList */ .H; + +/** + * An instance of the SourceMapGenerator represents a source map which is + * being built incrementally. You may pass an object with the following + * properties: + * + * - file: The filename of the generated source. + * - sourceRoot: A root for all relative URLs in this source map. + */ +function SourceMapGenerator(aArgs) { + if (!aArgs) { + aArgs = {}; + } + this._file = util.getArg(aArgs, 'file', null); + this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null); + this._skipValidation = util.getArg(aArgs, 'skipValidation', false); + this._sources = new ArraySet(); + this._names = new ArraySet(); + this._mappings = new MappingList(); + this._sourcesContents = null; +} + +SourceMapGenerator.prototype._version = 3; + +/** + * Creates a new SourceMapGenerator based on a SourceMapConsumer + * + * @param aSourceMapConsumer The SourceMap. + */ +SourceMapGenerator.fromSourceMap = + function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) { + var sourceRoot = aSourceMapConsumer.sourceRoot; + var generator = new SourceMapGenerator({ + file: aSourceMapConsumer.file, + sourceRoot: sourceRoot + }); + aSourceMapConsumer.eachMapping(function (mapping) { + var newMapping = { + generated: { + line: mapping.generatedLine, + column: mapping.generatedColumn + } + }; + + if (mapping.source != null) { + newMapping.source = mapping.source; + if (sourceRoot != null) { + newMapping.source = util.relative(sourceRoot, newMapping.source); + } + + newMapping.original = { + line: mapping.originalLine, + column: mapping.originalColumn + }; + + if (mapping.name != null) { + newMapping.name = mapping.name; + } + } + + generator.addMapping(newMapping); + }); + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var sourceRelative = sourceFile; + if (sourceRoot !== null) { + sourceRelative = util.relative(sourceRoot, sourceFile); + } + + if (!generator._sources.has(sourceRelative)) { + generator._sources.add(sourceRelative); + } + + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + generator.setSourceContent(sourceFile, content); + } + }); + return generator; + }; + +/** + * Add a single mapping from original source line and column to the generated + * source's line and column for this source map being created. The mapping + * object should have the following properties: + * + * - generated: An object with the generated line and column positions. + * - original: An object with the original line and column positions. + * - source: The original source file (relative to the sourceRoot). + * - name: An optional original token name for this mapping. + */ +SourceMapGenerator.prototype.addMapping = + function SourceMapGenerator_addMapping(aArgs) { + var generated = util.getArg(aArgs, 'generated'); + var original = util.getArg(aArgs, 'original', null); + var source = util.getArg(aArgs, 'source', null); + var name = util.getArg(aArgs, 'name', null); + + if (!this._skipValidation) { + this._validateMapping(generated, original, source, name); + } + + if (source != null) { + source = String(source); + if (!this._sources.has(source)) { + this._sources.add(source); + } + } + + if (name != null) { + name = String(name); + if (!this._names.has(name)) { + this._names.add(name); + } + } + + this._mappings.add({ + generatedLine: generated.line, + generatedColumn: generated.column, + originalLine: original != null && original.line, + originalColumn: original != null && original.column, + source: source, + name: name + }); + }; + +/** + * Set the source content for a source file. + */ +SourceMapGenerator.prototype.setSourceContent = + function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) { + var source = aSourceFile; + if (this._sourceRoot != null) { + source = util.relative(this._sourceRoot, source); + } + + if (aSourceContent != null) { + // Add the source content to the _sourcesContents map. + // Create a new _sourcesContents map if the property is null. + if (!this._sourcesContents) { + this._sourcesContents = Object.create(null); + } + this._sourcesContents[util.toSetString(source)] = aSourceContent; + } else if (this._sourcesContents) { + // Remove the source file from the _sourcesContents map. + // If the _sourcesContents map is empty, set the property to null. + delete this._sourcesContents[util.toSetString(source)]; + if (Object.keys(this._sourcesContents).length === 0) { + this._sourcesContents = null; + } + } + }; + +/** + * Applies the mappings of a sub-source-map for a specific source file to the + * source map being generated. Each mapping to the supplied source file is + * rewritten using the supplied source map. Note: The resolution for the + * resulting mappings is the minimium of this map and the supplied map. + * + * @param aSourceMapConsumer The source map to be applied. + * @param aSourceFile Optional. The filename of the source file. + * If omitted, SourceMapConsumer's file property will be used. + * @param aSourceMapPath Optional. The dirname of the path to the source map + * to be applied. If relative, it is relative to the SourceMapConsumer. + * This parameter is needed when the two source maps aren't in the same + * directory, and the source map to be applied contains relative source + * paths. If so, those relative source paths need to be rewritten + * relative to the SourceMapGenerator. + */ +SourceMapGenerator.prototype.applySourceMap = + function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) { + var sourceFile = aSourceFile; + // If aSourceFile is omitted, we will use the file property of the SourceMap + if (aSourceFile == null) { + if (aSourceMapConsumer.file == null) { + throw new Error( + 'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' + + 'or the source map\'s "file" property. Both were omitted.' + ); + } + sourceFile = aSourceMapConsumer.file; + } + var sourceRoot = this._sourceRoot; + // Make "sourceFile" relative if an absolute Url is passed. + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + // Applying the SourceMap can add and remove items from the sources and + // the names array. + var newSources = new ArraySet(); + var newNames = new ArraySet(); + + // Find mappings for the "sourceFile" + this._mappings.unsortedForEach(function (mapping) { + if (mapping.source === sourceFile && mapping.originalLine != null) { + // Check if it can be mapped by the source map, then update the mapping. + var original = aSourceMapConsumer.originalPositionFor({ + line: mapping.originalLine, + column: mapping.originalColumn + }); + if (original.source != null) { + // Copy mapping + mapping.source = original.source; + if (aSourceMapPath != null) { + mapping.source = util.join(aSourceMapPath, mapping.source) + } + if (sourceRoot != null) { + mapping.source = util.relative(sourceRoot, mapping.source); + } + mapping.originalLine = original.line; + mapping.originalColumn = original.column; + if (original.name != null) { + mapping.name = original.name; + } + } + } + + var source = mapping.source; + if (source != null && !newSources.has(source)) { + newSources.add(source); + } + + var name = mapping.name; + if (name != null && !newNames.has(name)) { + newNames.add(name); + } + + }, this); + this._sources = newSources; + this._names = newNames; + + // Copy sourcesContents of applied map. + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aSourceMapPath != null) { + sourceFile = util.join(aSourceMapPath, sourceFile); + } + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + this.setSourceContent(sourceFile, content); + } + }, this); + }; + +/** + * A mapping can have one of the three levels of data: + * + * 1. Just the generated position. + * 2. The Generated position, original position, and original source. + * 3. Generated and original position, original source, as well as a name + * token. + * + * To maintain consistency, we validate that any new mapping being added falls + * in to one of these categories. + */ +SourceMapGenerator.prototype._validateMapping = + function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource, + aName) { + // When aOriginal is truthy but has empty values for .line and .column, + // it is most likely a programmer error. In this case we throw a very + // specific error message to try to guide them the right way. + // For example: https://github.com/Polymer/polymer-bundler/pull/519 + if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') { + throw new Error( + 'original.line and original.column are not numbers -- you probably meant to omit ' + + 'the original mapping entirely and only map the generated position. If so, pass ' + + 'null for the original mapping instead of an object with empty or null values.' + ); + } + + if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aGenerated.line > 0 && aGenerated.column >= 0 + && !aOriginal && !aSource && !aName) { + // Case 1. + return; + } + else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aOriginal && 'line' in aOriginal && 'column' in aOriginal + && aGenerated.line > 0 && aGenerated.column >= 0 + && aOriginal.line > 0 && aOriginal.column >= 0 + && aSource) { + // Cases 2 and 3. + return; + } + else { + throw new Error('Invalid mapping: ' + JSON.stringify({ + generated: aGenerated, + source: aSource, + original: aOriginal, + name: aName + })); + } + }; + +/** + * Serialize the accumulated mappings in to the stream of base 64 VLQs + * specified by the source map format. + */ +SourceMapGenerator.prototype._serializeMappings = + function SourceMapGenerator_serializeMappings() { + var previousGeneratedColumn = 0; + var previousGeneratedLine = 1; + var previousOriginalColumn = 0; + var previousOriginalLine = 0; + var previousName = 0; + var previousSource = 0; + var result = ''; + var next; + var mapping; + var nameIdx; + var sourceIdx; + + var mappings = this._mappings.toArray(); + for (var i = 0, len = mappings.length; i < len; i++) { + mapping = mappings[i]; + next = '' + + if (mapping.generatedLine !== previousGeneratedLine) { + previousGeneratedColumn = 0; + while (mapping.generatedLine !== previousGeneratedLine) { + next += ';'; + previousGeneratedLine++; + } + } + else { + if (i > 0) { + if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) { + continue; + } + next += ','; + } + } + + next += base64VLQ.encode(mapping.generatedColumn + - previousGeneratedColumn); + previousGeneratedColumn = mapping.generatedColumn; + + if (mapping.source != null) { + sourceIdx = this._sources.indexOf(mapping.source); + next += base64VLQ.encode(sourceIdx - previousSource); + previousSource = sourceIdx; + + // lines are stored 0-based in SourceMap spec version 3 + next += base64VLQ.encode(mapping.originalLine - 1 + - previousOriginalLine); + previousOriginalLine = mapping.originalLine - 1; + + next += base64VLQ.encode(mapping.originalColumn + - previousOriginalColumn); + previousOriginalColumn = mapping.originalColumn; + + if (mapping.name != null) { + nameIdx = this._names.indexOf(mapping.name); + next += base64VLQ.encode(nameIdx - previousName); + previousName = nameIdx; + } + } + + result += next; + } + + return result; + }; + +SourceMapGenerator.prototype._generateSourcesContent = + function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) { + return aSources.map(function (source) { + if (!this._sourcesContents) { + return null; + } + if (aSourceRoot != null) { + source = util.relative(aSourceRoot, source); + } + var key = util.toSetString(source); + return Object.prototype.hasOwnProperty.call(this._sourcesContents, key) + ? this._sourcesContents[key] + : null; + }, this); + }; + +/** + * Externalize the source map. + */ +SourceMapGenerator.prototype.toJSON = + function SourceMapGenerator_toJSON() { + var map = { + version: this._version, + sources: this._sources.toArray(), + names: this._names.toArray(), + mappings: this._serializeMappings() + }; + if (this._file != null) { + map.file = this._file; + } + if (this._sourceRoot != null) { + map.sourceRoot = this._sourceRoot; + } + if (this._sourcesContents) { + map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot); + } + + return map; + }; + +/** + * Render the source map being generated to a string. + */ +SourceMapGenerator.prototype.toString = + function SourceMapGenerator_toString() { + return JSON.stringify(this.toJSON()); + }; + +exports.h = SourceMapGenerator; + + +/***/ }), + +/***/ 990: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +var __webpack_unused_export__; +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var SourceMapGenerator = __webpack_require__(341)/* .SourceMapGenerator */ .h; +var util = __webpack_require__(983); + +// Matches a Windows-style `\r\n` newline or a `\n` newline used by all other +// operating systems these days (capturing the result). +var REGEX_NEWLINE = /(\r?\n)/; + +// Newline character code for charCodeAt() comparisons +var NEWLINE_CODE = 10; + +// Private symbol for identifying `SourceNode`s when multiple versions of +// the source-map library are loaded. This MUST NOT CHANGE across +// versions! +var isSourceNode = "$$$isSourceNode$$$"; + +/** + * SourceNodes provide a way to abstract over interpolating/concatenating + * snippets of generated JavaScript source code while maintaining the line and + * column information associated with the original source code. + * + * @param aLine The original line number. + * @param aColumn The original column number. + * @param aSource The original source's filename. + * @param aChunks Optional. An array of strings which are snippets of + * generated JS, or other SourceNodes. + * @param aName The original identifier. + */ +function SourceNode(aLine, aColumn, aSource, aChunks, aName) { + this.children = []; + this.sourceContents = {}; + this.line = aLine == null ? null : aLine; + this.column = aColumn == null ? null : aColumn; + this.source = aSource == null ? null : aSource; + this.name = aName == null ? null : aName; + this[isSourceNode] = true; + if (aChunks != null) this.add(aChunks); +} + +/** + * Creates a SourceNode from generated code and a SourceMapConsumer. + * + * @param aGeneratedCode The generated code + * @param aSourceMapConsumer The SourceMap for the generated code + * @param aRelativePath Optional. The path that relative sources in the + * SourceMapConsumer should be relative to. + */ +SourceNode.fromStringWithSourceMap = + function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) { + // The SourceNode we want to fill with the generated code + // and the SourceMap + var node = new SourceNode(); + + // All even indices of this array are one line of the generated code, + // while all odd indices are the newlines between two adjacent lines + // (since `REGEX_NEWLINE` captures its match). + // Processed fragments are accessed by calling `shiftNextLine`. + var remainingLines = aGeneratedCode.split(REGEX_NEWLINE); + var remainingLinesIndex = 0; + var shiftNextLine = function() { + var lineContents = getNextLine(); + // The last line of a file might not have a newline. + var newLine = getNextLine() || ""; + return lineContents + newLine; + + function getNextLine() { + return remainingLinesIndex < remainingLines.length ? + remainingLines[remainingLinesIndex++] : undefined; + } + }; + + // We need to remember the position of "remainingLines" + var lastGeneratedLine = 1, lastGeneratedColumn = 0; + + // The generate SourceNodes we need a code range. + // To extract it current and last mapping is used. + // Here we store the last mapping. + var lastMapping = null; + + aSourceMapConsumer.eachMapping(function (mapping) { + if (lastMapping !== null) { + // We add the code from "lastMapping" to "mapping": + // First check if there is a new line in between. + if (lastGeneratedLine < mapping.generatedLine) { + // Associate first line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + lastGeneratedLine++; + lastGeneratedColumn = 0; + // The remaining code is added without mapping + } else { + // There is no new line in between. + // Associate the code between "lastGeneratedColumn" and + // "mapping.generatedColumn" with "lastMapping" + var nextLine = remainingLines[remainingLinesIndex] || ''; + var code = nextLine.substr(0, mapping.generatedColumn - + lastGeneratedColumn); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn - + lastGeneratedColumn); + lastGeneratedColumn = mapping.generatedColumn; + addMappingWithCode(lastMapping, code); + // No more remaining code, continue + lastMapping = mapping; + return; + } + } + // We add the generated code until the first mapping + // to the SourceNode without any mapping. + // Each line is added as separate string. + while (lastGeneratedLine < mapping.generatedLine) { + node.add(shiftNextLine()); + lastGeneratedLine++; + } + if (lastGeneratedColumn < mapping.generatedColumn) { + var nextLine = remainingLines[remainingLinesIndex] || ''; + node.add(nextLine.substr(0, mapping.generatedColumn)); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn); + lastGeneratedColumn = mapping.generatedColumn; + } + lastMapping = mapping; + }, this); + // We have processed all mappings. + if (remainingLinesIndex < remainingLines.length) { + if (lastMapping) { + // Associate the remaining code in the current line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + } + // and add the remaining lines without any mapping + node.add(remainingLines.splice(remainingLinesIndex).join("")); + } + + // Copy sourcesContent into SourceNode + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aRelativePath != null) { + sourceFile = util.join(aRelativePath, sourceFile); + } + node.setSourceContent(sourceFile, content); + } + }); + + return node; + + function addMappingWithCode(mapping, code) { + if (mapping === null || mapping.source === undefined) { + node.add(code); + } else { + var source = aRelativePath + ? util.join(aRelativePath, mapping.source) + : mapping.source; + node.add(new SourceNode(mapping.originalLine, + mapping.originalColumn, + source, + code, + mapping.name)); + } + } + }; + +/** + * Add a chunk of generated JS to this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ +SourceNode.prototype.add = function SourceNode_add(aChunk) { + if (Array.isArray(aChunk)) { + aChunk.forEach(function (chunk) { + this.add(chunk); + }, this); + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + if (aChunk) { + this.children.push(aChunk); + } + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; +}; + +/** + * Add a chunk of generated JS to the beginning of this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ +SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) { + if (Array.isArray(aChunk)) { + for (var i = aChunk.length-1; i >= 0; i--) { + this.prepend(aChunk[i]); + } + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + this.children.unshift(aChunk); + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; +}; + +/** + * Walk over the tree of JS snippets in this node and its children. The + * walking function is called once for each snippet of JS and is passed that + * snippet and the its original associated source's line/column location. + * + * @param aFn The traversal function. + */ +SourceNode.prototype.walk = function SourceNode_walk(aFn) { + var chunk; + for (var i = 0, len = this.children.length; i < len; i++) { + chunk = this.children[i]; + if (chunk[isSourceNode]) { + chunk.walk(aFn); + } + else { + if (chunk !== '') { + aFn(chunk, { source: this.source, + line: this.line, + column: this.column, + name: this.name }); + } + } + } +}; + +/** + * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between + * each of `this.children`. + * + * @param aSep The separator. + */ +SourceNode.prototype.join = function SourceNode_join(aSep) { + var newChildren; + var i; + var len = this.children.length; + if (len > 0) { + newChildren = []; + for (i = 0; i < len-1; i++) { + newChildren.push(this.children[i]); + newChildren.push(aSep); + } + newChildren.push(this.children[i]); + this.children = newChildren; + } + return this; +}; + +/** + * Call String.prototype.replace on the very right-most source snippet. Useful + * for trimming whitespace from the end of a source node, etc. + * + * @param aPattern The pattern to replace. + * @param aReplacement The thing to replace the pattern with. + */ +SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) { + var lastChild = this.children[this.children.length - 1]; + if (lastChild[isSourceNode]) { + lastChild.replaceRight(aPattern, aReplacement); + } + else if (typeof lastChild === 'string') { + this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement); + } + else { + this.children.push(''.replace(aPattern, aReplacement)); + } + return this; +}; + +/** + * Set the source content for a source file. This will be added to the SourceMapGenerator + * in the sourcesContent field. + * + * @param aSourceFile The filename of the source file + * @param aSourceContent The content of the source file + */ +SourceNode.prototype.setSourceContent = + function SourceNode_setSourceContent(aSourceFile, aSourceContent) { + this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent; + }; + +/** + * Walk over the tree of SourceNodes. The walking function is called for each + * source file content and is passed the filename and source content. + * + * @param aFn The traversal function. + */ +SourceNode.prototype.walkSourceContents = + function SourceNode_walkSourceContents(aFn) { + for (var i = 0, len = this.children.length; i < len; i++) { + if (this.children[i][isSourceNode]) { + this.children[i].walkSourceContents(aFn); + } + } + + var sources = Object.keys(this.sourceContents); + for (var i = 0, len = sources.length; i < len; i++) { + aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]); + } + }; + +/** + * Return the string representation of this source node. Walks over the tree + * and concatenates all the various snippets together to one string. + */ +SourceNode.prototype.toString = function SourceNode_toString() { + var str = ""; + this.walk(function (chunk) { + str += chunk; + }); + return str; +}; + +/** + * Returns the string representation of this source node along with a source + * map. + */ +SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) { + var generated = { + code: "", + line: 1, + column: 0 + }; + var map = new SourceMapGenerator(aArgs); + var sourceMappingActive = false; + var lastOriginalSource = null; + var lastOriginalLine = null; + var lastOriginalColumn = null; + var lastOriginalName = null; + this.walk(function (chunk, original) { + generated.code += chunk; + if (original.source !== null + && original.line !== null + && original.column !== null) { + if(lastOriginalSource !== original.source + || lastOriginalLine !== original.line + || lastOriginalColumn !== original.column + || lastOriginalName !== original.name) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + lastOriginalSource = original.source; + lastOriginalLine = original.line; + lastOriginalColumn = original.column; + lastOriginalName = original.name; + sourceMappingActive = true; + } else if (sourceMappingActive) { + map.addMapping({ + generated: { + line: generated.line, + column: generated.column + } + }); + lastOriginalSource = null; + sourceMappingActive = false; + } + for (var idx = 0, length = chunk.length; idx < length; idx++) { + if (chunk.charCodeAt(idx) === NEWLINE_CODE) { + generated.line++; + generated.column = 0; + // Mappings end at eol + if (idx + 1 === length) { + lastOriginalSource = null; + sourceMappingActive = false; + } else if (sourceMappingActive) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + } else { + generated.column++; + } + } + }); + this.walkSourceContents(function (sourceFile, sourceContent) { + map.setSourceContent(sourceFile, sourceContent); + }); + + return { code: generated.code, map: map }; +}; + +__webpack_unused_export__ = SourceNode; + + +/***/ }), + +/***/ 983: +/***/ ((__unused_webpack_module, exports) => { + +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +/** + * This is a helper function for getting values from parameter/options + * objects. + * + * @param args The object we are extracting values from + * @param name The name of the property we are getting. + * @param defaultValue An optional value to return if the property is missing + * from the object. If this is not specified and the property is missing, an + * error will be thrown. + */ +function getArg(aArgs, aName, aDefaultValue) { + if (aName in aArgs) { + return aArgs[aName]; + } else if (arguments.length === 3) { + return aDefaultValue; + } else { + throw new Error('"' + aName + '" is a required argument.'); + } +} +exports.getArg = getArg; + +var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/; +var dataUrlRegexp = /^data:.+\,.+$/; + +function urlParse(aUrl) { + var match = aUrl.match(urlRegexp); + if (!match) { + return null; + } + return { + scheme: match[1], + auth: match[2], + host: match[3], + port: match[4], + path: match[5] + }; +} +exports.urlParse = urlParse; + +function urlGenerate(aParsedUrl) { + var url = ''; + if (aParsedUrl.scheme) { + url += aParsedUrl.scheme + ':'; + } + url += '//'; + if (aParsedUrl.auth) { + url += aParsedUrl.auth + '@'; + } + if (aParsedUrl.host) { + url += aParsedUrl.host; + } + if (aParsedUrl.port) { + url += ":" + aParsedUrl.port + } + if (aParsedUrl.path) { + url += aParsedUrl.path; + } + return url; +} +exports.urlGenerate = urlGenerate; + +/** + * Normalizes a path, or the path portion of a URL: + * + * - Replaces consecutive slashes with one slash. + * - Removes unnecessary '.' parts. + * - Removes unnecessary '/..' parts. + * + * Based on code in the Node.js 'path' core module. + * + * @param aPath The path or url to normalize. + */ +function normalize(aPath) { + var path = aPath; + var url = urlParse(aPath); + if (url) { + if (!url.path) { + return aPath; + } + path = url.path; + } + var isAbsolute = exports.isAbsolute(path); + + var parts = path.split(/\/+/); + for (var part, up = 0, i = parts.length - 1; i >= 0; i--) { + part = parts[i]; + if (part === '.') { + parts.splice(i, 1); + } else if (part === '..') { + up++; + } else if (up > 0) { + if (part === '') { + // The first part is blank if the path is absolute. Trying to go + // above the root is a no-op. Therefore we can remove all '..' parts + // directly after the root. + parts.splice(i + 1, up); + up = 0; + } else { + parts.splice(i, 2); + up--; + } + } + } + path = parts.join('/'); + + if (path === '') { + path = isAbsolute ? '/' : '.'; + } + + if (url) { + url.path = path; + return urlGenerate(url); + } + return path; +} +exports.normalize = normalize; + +/** + * Joins two paths/URLs. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be joined with the root. + * + * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a + * scheme-relative URL: Then the scheme of aRoot, if any, is prepended + * first. + * - Otherwise aPath is a path. If aRoot is a URL, then its path portion + * is updated with the result and aRoot is returned. Otherwise the result + * is returned. + * - If aPath is absolute, the result is aPath. + * - Otherwise the two paths are joined with a slash. + * - Joining for example 'http://' and 'www.example.com' is also supported. + */ +function join(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + if (aPath === "") { + aPath = "."; + } + var aPathUrl = urlParse(aPath); + var aRootUrl = urlParse(aRoot); + if (aRootUrl) { + aRoot = aRootUrl.path || '/'; + } + + // `join(foo, '//www.example.org')` + if (aPathUrl && !aPathUrl.scheme) { + if (aRootUrl) { + aPathUrl.scheme = aRootUrl.scheme; + } + return urlGenerate(aPathUrl); + } + + if (aPathUrl || aPath.match(dataUrlRegexp)) { + return aPath; + } + + // `join('http://', 'www.example.com')` + if (aRootUrl && !aRootUrl.host && !aRootUrl.path) { + aRootUrl.host = aPath; + return urlGenerate(aRootUrl); + } + + var joined = aPath.charAt(0) === '/' + ? aPath + : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath); + + if (aRootUrl) { + aRootUrl.path = joined; + return urlGenerate(aRootUrl); + } + return joined; +} +exports.join = join; + +exports.isAbsolute = function (aPath) { + return aPath.charAt(0) === '/' || urlRegexp.test(aPath); +}; + +/** + * Make a path relative to a URL or another path. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be made relative to aRoot. + */ +function relative(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + + aRoot = aRoot.replace(/\/$/, ''); + + // It is possible for the path to be above the root. In this case, simply + // checking whether the root is a prefix of the path won't work. Instead, we + // need to remove components from the root one by one, until either we find + // a prefix that fits, or we run out of components to remove. + var level = 0; + while (aPath.indexOf(aRoot + '/') !== 0) { + var index = aRoot.lastIndexOf("/"); + if (index < 0) { + return aPath; + } + + // If the only part of the root that is left is the scheme (i.e. http://, + // file:///, etc.), one or more slashes (/), or simply nothing at all, we + // have exhausted all components, so the path is not relative to the root. + aRoot = aRoot.slice(0, index); + if (aRoot.match(/^([^\/]+:\/)?\/*$/)) { + return aPath; + } + + ++level; + } + + // Make sure we add a "../" for each component we removed from the root. + return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1); +} +exports.relative = relative; + +var supportsNullProto = (function () { + var obj = Object.create(null); + return !('__proto__' in obj); +}()); + +function identity (s) { + return s; +} + +/** + * Because behavior goes wacky when you set `__proto__` on objects, we + * have to prefix all the strings in our set with an arbitrary character. + * + * See https://github.com/mozilla/source-map/pull/31 and + * https://github.com/mozilla/source-map/issues/30 + * + * @param String aStr + */ +function toSetString(aStr) { + if (isProtoString(aStr)) { + return '$' + aStr; + } + + return aStr; +} +exports.toSetString = supportsNullProto ? identity : toSetString; + +function fromSetString(aStr) { + if (isProtoString(aStr)) { + return aStr.slice(1); + } + + return aStr; +} +exports.fromSetString = supportsNullProto ? identity : fromSetString; + +function isProtoString(s) { + if (!s) { + return false; + } + + var length = s.length; + + if (length < 9 /* "__proto__".length */) { + return false; + } + + if (s.charCodeAt(length - 1) !== 95 /* '_' */ || + s.charCodeAt(length - 2) !== 95 /* '_' */ || + s.charCodeAt(length - 3) !== 111 /* 'o' */ || + s.charCodeAt(length - 4) !== 116 /* 't' */ || + s.charCodeAt(length - 5) !== 111 /* 'o' */ || + s.charCodeAt(length - 6) !== 114 /* 'r' */ || + s.charCodeAt(length - 7) !== 112 /* 'p' */ || + s.charCodeAt(length - 8) !== 95 /* '_' */ || + s.charCodeAt(length - 9) !== 95 /* '_' */) { + return false; + } + + for (var i = length - 10; i >= 0; i--) { + if (s.charCodeAt(i) !== 36 /* '$' */) { + return false; + } + } + + return true; +} + +/** + * Comparator between two mappings where the original positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same original source/line/column, but different generated + * line and column the same. Useful when searching for a mapping with a + * stubbed out mapping. + */ +function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) { + var cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0 || onlyCompareOriginal) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); +} +exports.compareByOriginalPositions = compareByOriginalPositions; + +/** + * Comparator between two mappings with deflated source and name indices where + * the generated positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same generated line and column, but different + * source/name/original line and column the same. Useful when searching for a + * mapping with a stubbed out mapping. + */ +function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0 || onlyCompareGenerated) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); +} +exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated; + +function strcmp(aStr1, aStr2) { + if (aStr1 === aStr2) { + return 0; + } + + if (aStr1 === null) { + return 1; // aStr2 !== null + } + + if (aStr2 === null) { + return -1; // aStr1 !== null + } + + if (aStr1 > aStr2) { + return 1; + } + + return -1; +} + +/** + * Comparator between two mappings with inflated source and name strings where + * the generated positions are compared. + */ +function compareByGeneratedPositionsInflated(mappingA, mappingB) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); +} +exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated; + +/** + * Strip any JSON XSSI avoidance prefix from the string (as documented + * in the source maps specification), and then parse the string as + * JSON. + */ +function parseSourceMapInput(str) { + return JSON.parse(str.replace(/^\)]}'[^\n]*\n/, '')); +} +exports.parseSourceMapInput = parseSourceMapInput; + +/** + * Compute the URL of a source given the the source root, the source's + * URL, and the source map's URL. + */ +function computeSourceURL(sourceRoot, sourceURL, sourceMapURL) { + sourceURL = sourceURL || ''; + + if (sourceRoot) { + // This follows what Chrome does. + if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') { + sourceRoot += '/'; + } + // The spec says: + // Line 4: An optional source root, useful for relocating source + // files on a server or removing repeated values in the + // “sources” entry. This value is prepended to the individual + // entries in the “source” field. + sourceURL = sourceRoot + sourceURL; + } + + // Historically, SourceMapConsumer did not take the sourceMapURL as + // a parameter. This mode is still somewhat supported, which is why + // this code block is conditional. However, it's preferable to pass + // the source map URL to SourceMapConsumer, so that this function + // can implement the source URL resolution algorithm as outlined in + // the spec. This block is basically the equivalent of: + // new URL(sourceURL, sourceMapURL).toString() + // ... except it avoids using URL, which wasn't available in the + // older releases of node still supported by this library. + // + // The spec says: + // If the sources are not absolute URLs after prepending of the + // “sourceRoot”, the sources are resolved relative to the + // SourceMap (like resolving script src in a html document). + if (sourceMapURL) { + var parsed = urlParse(sourceMapURL); + if (!parsed) { + throw new Error("sourceMapURL could not be parsed"); + } + if (parsed.path) { + // Strip the last path component, but keep the "/". + var index = parsed.path.lastIndexOf('/'); + if (index >= 0) { + parsed.path = parsed.path.substring(0, index + 1); + } + } + sourceURL = join(urlGenerate(parsed), sourceURL); + } + + return normalize(sourceURL); +} +exports.computeSourceURL = computeSourceURL; + + +/***/ }), + +/***/ 596: +/***/ ((__unused_webpack_module, exports, __webpack_require__) => { + +/* + * Copyright 2009-2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE.txt or: + * http://opensource.org/licenses/BSD-3-Clause + */ +/* unused reexport */ __webpack_require__(341)/* .SourceMapGenerator */ .h; +exports.SourceMapConsumer = __webpack_require__(327).SourceMapConsumer; +/* unused reexport */ __webpack_require__(990); + + +/***/ }), + +/***/ 747: +/***/ ((module) => { + +"use strict"; +module.exports = require("fs"); + +/***/ }), + +/***/ 282: +/***/ ((module) => { + +"use strict"; +module.exports = require("module"); + +/***/ }), + +/***/ 622: +/***/ ((module) => { + +"use strict"; +module.exports = require("path"); + +/***/ }) + +/******/ }); +/************************************************************************/ +/******/ // The module cache +/******/ var __webpack_module_cache__ = {}; +/******/ +/******/ // The require function +/******/ function __webpack_require__(moduleId) { +/******/ // Check if module is in cache +/******/ if(__webpack_module_cache__[moduleId]) { +/******/ return __webpack_module_cache__[moduleId].exports; +/******/ } +/******/ // Create a new module (and put it into the cache) +/******/ var module = __webpack_module_cache__[moduleId] = { +/******/ // no module.id needed +/******/ // no module.loaded needed +/******/ exports: {} +/******/ }; +/******/ +/******/ // Execute the module function +/******/ var threw = true; +/******/ try { +/******/ __webpack_modules__[moduleId](module, module.exports, __webpack_require__); +/******/ threw = false; +/******/ } finally { +/******/ if(threw) delete __webpack_module_cache__[moduleId]; +/******/ } +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/************************************************************************/ +/******/ /* webpack/runtime/compat */ +/******/ +/******/ __webpack_require__.ab = __dirname + "/";/************************************************************************/ +/******/ // module exports must be returned from runtime so entry inlining is disabled +/******/ // startup +/******/ // Load entry module and return exports +/******/ return __webpack_require__(645); +/******/ })() +; \ No newline at end of file diff --git a/package-lock.json b/package-lock.json new file mode 100644 index 0000000..77fa5a0 --- /dev/null +++ b/package-lock.json @@ -0,0 +1,202 @@ +{ + "name": "action-spigotmc", + "version": "0.0.1", + "lockfileVersion": 1, + "requires": true, + "dependencies": { + "@actions/core": { + "version": "1.2.6", + "resolved": "https://registry.npmjs.org/@actions/core/-/core-1.2.6.tgz", + "integrity": "sha512-ZQYitnqiyBc3D+k7LsgSBmMDVkOVidaagDG7j3fOym77jNunWRuYx7VSHa9GNfFZh+zh61xsCjRj4JxMZlDqTA==" + }, + "@tsconfig/node12": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/@tsconfig/node12/-/node12-1.0.7.tgz", + "integrity": "sha512-dgasobK/Y0wVMswcipr3k0HpevxFJLijN03A8mYfEPvWvOs14v0ZlYTR4kIgMx8g4+fTyTFv8/jLCIfRqLDJ4A==", + "dev": true + }, + "@types/async": { + "version": "3.2.3", + "resolved": "https://registry.npmjs.org/@types/async/-/async-3.2.3.tgz", + "integrity": "sha512-deXFjLZc1h6SOh3hicVgD+S2EAkhSBGX/vdlD4nTzCjjOFQ+bfNiXocQ21xJjFAUwqaCeyvOQMgrnbg4QEV63A==", + "dev": true + }, + "@types/fs-extra": { + "version": "9.0.2", + "resolved": "https://registry.npmjs.org/@types/fs-extra/-/fs-extra-9.0.2.tgz", + "integrity": "sha512-jp0RI6xfZpi5JL8v7WQwpBEQTq63RqW2kxwTZt+m27LcJqQdPVU1yGnT1ZI4EtCDynQQJtIGyQahkiCGCS7e+A==", + "dev": true, + "requires": { + "@types/node": "*" + } + }, + "@types/node": { + "version": "12.19.3", + "resolved": "https://registry.npmjs.org/@types/node/-/node-12.19.3.tgz", + "integrity": "sha512-8Jduo8wvvwDzEVJCOvS/G6sgilOLvvhn1eMmK3TW8/T217O7u1jdrK6ImKLv80tVryaPSVeKu6sjDEiFjd4/eg==", + "dev": true + }, + "@vercel/ncc": { + "version": "0.24.1", + "resolved": "https://registry.npmjs.org/@vercel/ncc/-/ncc-0.24.1.tgz", + "integrity": "sha512-r9m7brz2hNmq5TF3sxrK4qR/FhXn44XIMglQUir4sT7Sh5GOaYXlMYikHFwJStf8rmQGTlvOoBXt4yHVonRG8A==", + "dev": true + }, + "any-promise": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/any-promise/-/any-promise-1.3.0.tgz", + "integrity": "sha1-q8av7tzqUugJzcA3au0845Y10X8=" + }, + "arg": { + "version": "4.1.3", + "resolved": "https://registry.npmjs.org/arg/-/arg-4.1.3.tgz", + "integrity": "sha512-58S9QDqG0Xx27YwPSt9fJxivjYl432YCwfDMfZ+71RAqUrZef7LrKQZ3LHLOwCS4FLNBplP533Zx895SeOCHvA==", + "dev": true + }, + "async": { + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/async/-/async-3.2.0.tgz", + "integrity": "sha512-TR2mEZFVOj2pLStYxLht7TyfuRzaydfpxr3k9RpHIzMgw7A64dzsdqCxH1WJyQdoe8T10nDXd9wnEigmiuHIZw==" + }, + "at-least-node": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/at-least-node/-/at-least-node-1.0.0.tgz", + "integrity": "sha512-+q/t7Ekv1EDY2l6Gda6LLiX14rU9TV20Wa3ofeQmwPFZbOMo9DXrLbOjFaaclkXKWidIaopwAObQDqwWtGUjqg==" + }, + "buffer-from": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/buffer-from/-/buffer-from-1.1.1.tgz", + "integrity": "sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A==", + "dev": true + }, + "diff": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/diff/-/diff-4.0.2.tgz", + "integrity": "sha512-58lmxKSA4BNyLz+HHMUzlOEpg09FV+ev6ZMe3vJihgdxzgcwZ8VoEEPmALCZG9LmqfVoNMMKpttIYTVG6uDY7A==", + "dev": true + }, + "fs-extra": { + "version": "9.0.1", + "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-9.0.1.tgz", + "integrity": "sha512-h2iAoN838FqAFJY2/qVpzFXy+EBxfVE220PalAqQLDVsFOHLJrZvut5puAbCdNv6WJk+B8ihI+k0c7JK5erwqQ==", + "requires": { + "at-least-node": "^1.0.0", + "graceful-fs": "^4.2.0", + "jsonfile": "^6.0.1", + "universalify": "^1.0.0" + } + }, + "graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==" + }, + "jsonfile": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/jsonfile/-/jsonfile-6.1.0.tgz", + "integrity": "sha512-5dgndWOriYSm5cnYaJNhalLNDKOqFwyDB/rr1E9ZsGciGvKPs8R2xYGCacuf3z6K1YKDz182fd+fY3cn3pMqXQ==", + "requires": { + "graceful-fs": "^4.1.6", + "universalify": "^2.0.0" + }, + "dependencies": { + "universalify": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/universalify/-/universalify-2.0.0.tgz", + "integrity": "sha512-hAZsKq7Yy11Zu1DE0OzWjw7nnLZmJZYTDZZyEFHZdUhV8FkH5MCfoU1XMaxXovpyW5nq5scPqq0ZDP9Zyl04oQ==" + } + } + }, + "make-error": { + "version": "1.3.6", + "resolved": "https://registry.npmjs.org/make-error/-/make-error-1.3.6.tgz", + "integrity": "sha512-s8UhlNe7vPKomQhC1qFelMokr/Sc3AgNbso3n74mVPA5LTZwkB9NlXf4XPamLxJE8h0gh73rM94xvwRT2CVInw==", + "dev": true + }, + "mz": { + "version": "2.7.0", + "resolved": "https://registry.npmjs.org/mz/-/mz-2.7.0.tgz", + "integrity": "sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q==", + "requires": { + "any-promise": "^1.0.0", + "object-assign": "^4.0.1", + "thenify-all": "^1.0.0" + } + }, + "object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=" + }, + "read-last-lines": { + "version": "1.7.2", + "resolved": "https://registry.npmjs.org/read-last-lines/-/read-last-lines-1.7.2.tgz", + "integrity": "sha512-K0yUvTYAYn6qpyLJufaJ7yC6BeL23qpgZ8SKM7/fA1R1rHotCDxB/zDp9i1I2JHvexWBW6/35jkt07iiIKKp4g==", + "requires": { + "mz": "^2.7.0" + } + }, + "source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "dev": true + }, + "source-map-support": { + "version": "0.5.19", + "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.19.tgz", + "integrity": "sha512-Wonm7zOCIJzBGQdB+thsPar0kYuCIzYvxZwlBa87yi/Mdjv7Tip2cyVbLj5o0cFPN4EVkuTwb3GDDyUx2DGnGw==", + "dev": true, + "requires": { + "buffer-from": "^1.0.0", + "source-map": "^0.6.0" + } + }, + "thenify": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/thenify/-/thenify-3.3.1.tgz", + "integrity": "sha512-RVZSIV5IG10Hk3enotrhvz0T9em6cyHBLkH/YAZuKqd8hRkKhSfCGIcP2KUY0EPxndzANBmNllzWPwak+bheSw==", + "requires": { + "any-promise": "^1.0.0" + } + }, + "thenify-all": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/thenify-all/-/thenify-all-1.6.0.tgz", + "integrity": "sha1-GhkY1ALY/D+Y+/I02wvMjMEOlyY=", + "requires": { + "thenify": ">= 3.1.0 < 4" + } + }, + "ts-node": { + "version": "9.0.0", + "resolved": "https://registry.npmjs.org/ts-node/-/ts-node-9.0.0.tgz", + "integrity": "sha512-/TqB4SnererCDR/vb4S/QvSZvzQMJN8daAslg7MeaiHvD8rDZsSfXmNeNumyZZzMned72Xoq/isQljYSt8Ynfg==", + "dev": true, + "requires": { + "arg": "^4.1.0", + "diff": "^4.0.1", + "make-error": "^1.1.1", + "source-map-support": "^0.5.17", + "yn": "3.1.1" + } + }, + "typescript": { + "version": "4.0.5", + "resolved": "https://registry.npmjs.org/typescript/-/typescript-4.0.5.tgz", + "integrity": "sha512-ywmr/VrTVCmNTJ6iV2LwIrfG1P+lv6luD8sUJs+2eI9NLGigaN+nUQc13iHqisq7bra9lnmUSYqbJvegraBOPQ==", + "dev": true + }, + "universalify": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/universalify/-/universalify-1.0.0.tgz", + "integrity": "sha512-rb6X1W158d7pRQBg5gkR8uPaSfiids68LTJQYOtEUhoJUWBdaQHsuT/EUduxXYxcrt4r5PJ4fuHW1MHT6p0qug==" + }, + "yn": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/yn/-/yn-3.1.1.tgz", + "integrity": "sha512-Ux4ygGWsu2c7isFWe8Yu1YluJmqVhxqK2cLXNQA5AcC3QfbGNpM7fu0Y8b/z16pXLnFxZYvWhd3fhBY9DLmC6Q==", + "dev": true + } + } +} diff --git a/package.json b/package.json new file mode 100644 index 0000000..98aef33 --- /dev/null +++ b/package.json @@ -0,0 +1,47 @@ +{ + "name": "action-spigotmc", + "version": "0.0.1", + "description": "", + "keywords": [], + "homepage": "https://github.com/SpraxDev/Action-SpigotMC#readme", + "main": "dist/index.js", + "private": true, + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1", + "build": "ncc build src/index.ts -s -m", + "start": "node dist/index.js", + "dev": "ncc run src/index.ts" + }, + "author": { + "name": "Christian Koop", + "url": "https://Sprax2013.de", + "email": "developer@sprax2013.de" + }, + "contributors": [], + "license": "MIT", + "repository": { + "type": "git", + "url": "https://github.com/SpraxDev/Action-SpigotMC.git" + }, + "bugs": { + "url": "https://github.com/SpraxDev/Action-SpigotMC/issues" + }, + "engines": { + "node": ">=12.0.0" + }, + "dependencies": { + "@actions/core": "^1.2.6", + "async": "^3.2.0", + "fs-extra": "^9.0.1", + "read-last-lines": "^1.7.2" + }, + "devDependencies": { + "@tsconfig/node12": "^1.0.7", + "@types/async": "^3.2.3", + "@types/fs-extra": "^9.0.2", + "@types/node": "~12.19.2", + "@vercel/ncc": "^0.24.1", + "ts-node": "^9.0.0", + "typescript": "^4.0.5" + } +} diff --git a/src/index.ts b/src/index.ts new file mode 100644 index 0000000..278613e --- /dev/null +++ b/src/index.ts @@ -0,0 +1,130 @@ +import * as core from '@actions/core'; +import { join as joinPath, resolve as resolvePath } from 'path'; +import { copy } from 'fs-extra'; +import { rmdirSync } from 'fs'; + +import { cpuCount, downloadFile, exit, fixArgArr, isNumeric, resetWorkingDir, runCmd } from './utils'; +import { parallelLimit } from 'async'; + + +const rll = require('read-last-lines'); + +/* GitHub Actions inputs */ +const versions: string[] = fixArgArr((core.getInput('versions') || 'latest').split(',')); +const target: string[] = fixArgArr((core.getInput('target') || 'Spigot').toUpperCase().split(',')); +const generateSrc: boolean = core.getInput('generateSrc') == 'true'; +const generateDoc: boolean = core.getInput('generateDoc') == 'true'; +const disableJavaCheck: boolean = core.getInput('disableJavaCheck') == 'true'; + +const forceRun: boolean = core.getInput('forceRun') == 'true'; // TODO +const threadCount: number = isNumeric(core.getInput('threads')) ? parseInt(core.getInput('threads')) : cpuCount; + +const workingDir = resetWorkingDir(); + +async function run(): Promise<{ code: number, msg?: string }> { + return new Promise<{ code: number, msg?: string }>(async (resolve, reject): Promise => { + if (versions.length == 0) return resolve({code: 0, msg: 'No version(s) provided to build'}); + if (target.length == 0) return resolve({code: 0, msg: 'No target(s) provided to build'}); + + const appLogFile = joinPath(workingDir.logs, 'SpraxDev_Actions-SpigotMC.log'); + + console.log('Installed Java-Version:'); + await runCmd('java', ['-version'], workingDir.base, appLogFile); + + console.log(`Downloading BuildTools.jar from 'hub.spigotmc.org'...`); + await downloadFile('https://hub.spigotmc.org/jenkins/job/BuildTools/lastSuccessfulBuild/artifact/target/BuildTools.jar', joinPath(workingDir.cache, 'BuildTools.jar')); + + const gotTemplateDirectory = versions.length != 1; + + // Prepare template directory if more than one version is provided + if (gotTemplateDirectory) { + console.log('Prepare for future tasks by running BuildTools...'); + + try { + await core.group('Prepare BuildTools', async (): Promise => { + return runCmd('java', ['-jar', 'BuildTools.jar', '--compile', 'NONE'], + workingDir.cache, appLogFile); + }); + } catch (err) { + console.error(err); + + console.error(`\nPrinting last 25 lines from '${resolvePath(appLogFile)}':`); + for (const line of (await rll.read(appLogFile, 25))) { + console.error(line); + } + + return exit(1); + } + } + + const buildToolsArgs = ['-jar', 'BuildTools.jar', '--compile', target.join(',')]; + + if (generateSrc) { + buildToolsArgs.push('--generate-source'); + } + + if (generateDoc) { + buildToolsArgs.push('--generate-docs'); + } + + if (disableJavaCheck) { + buildToolsArgs.push('--disable-java-check'); + } + + const tasks = []; + for (const ver of versions) { + tasks.push((callback: (err?: Error, result?: unknown) => void) => { + try { + const start = Date.now(); + + const logFile = joinPath(workingDir.logs, `${ver}.log`); + + console.log(`Building version '${ver}'...`); + + // If there is only one version to build, the cache directory is used instead of copying it first + const versionDir = gotTemplateDirectory ? joinPath(workingDir.base, `${ver}`) : workingDir.cache; + + if (gotTemplateDirectory) { + copy(workingDir.cache, versionDir) + .then(() => { + runCmd('java', [...buildToolsArgs, '--rev', ver], + versionDir, logFile, true) // set to silent because multiple builds can run at once + .then(() => { + rmdirSync(versionDir, {recursive: true}); // delete our task dir + + const end = Date.now(); + + console.log(`Finished building '${ver}' in ${((end - start) / 60_000)} minutes`); + callback(); + }); + }) + .catch((err) => { + console.log(`An error occurred while building '${ver}'`); + console.error(err); + + console.error(`\nPrinting last 25 lines from '${resolvePath(logFile)}':`); + rll.read(logFile, 25) + .then((lines: string[]) => { + for (const line of lines) { + console.error(line); + } + }) + .catch(console.error) + .finally(() => callback(err)); + }); + } + } catch (err) { + callback(err); + } + }); + } + + (parallelLimit(tasks, threadCount) as unknown as Promise) // Valid according to docs - types outdated? + .then(() => resolve({code: 0})) + .catch(reject); + }); +} + +run() + .then((result) => exit(result.code, result.msg)) + .catch((err) => exit(1, err)); \ No newline at end of file diff --git a/src/utils.ts b/src/utils.ts new file mode 100644 index 0000000..53ba3c5 --- /dev/null +++ b/src/utils.ts @@ -0,0 +1,138 @@ +import { spawn as spawnProcess } from 'child_process'; +import { join as joinPath } from 'path'; +import { get as httpGet } from 'http'; +import { get as httpsGet } from 'https'; +import { cpus, tmpdir } from 'os'; +import { createWriteStream, mkdirSync, readFileSync, rmdirSync, WriteStream } from 'fs'; + +const packageJson = JSON.parse(readFileSync(joinPath(__dirname, '..', 'package.json'), 'utf-8')); +const userAgent = `${packageJson.name || 'Action-SpigotMC'}/${packageJson.version || 'UNKNOWN_VERSION'} (+${packageJson.homepage || 'https://github.com/SpraxDev/'})`; + +export const cpuCount = cpus().length; + +export function fixArgArr(arr: string[]): string[] { + const result: string[] = []; + + for (const element of arr) { + const newValue = element.trim(); + + if (newValue && !result.includes(newValue)) { + result.push(newValue); + } + } + + return result; +} + +export function isNumeric(str: string): boolean { + return /^[0-9]+$/.test(str); +} + +export async function runCmd(cmd: string, args: string[], workingDir: string, logFile: string, silent: boolean = false): Promise { + return new Promise((resolve, reject) => { + const logStream = createWriteStream(logFile, {encoding: 'utf-8', flags: 'a'}); // Use UTF-8 and append when file exists + const runningProcess = spawnProcess(cmd, args, {shell: true, cwd: workingDir, env: process.env}); + + runningProcess.stdout.on('data', (data) => { + logStream.write(data); + + if (!silent) { + process.stdout.write(data); // Not using console.log to prevent '\n\n' + } + }); + runningProcess.stderr.on('data', (data) => { + logStream.write(data); + + if (!silent) { + process.stderr.write(data); // Not using console.error to prevent '\n\n' + } + }); + + runningProcess.on('close', (code) => { + logStream.close(); + + if (code != 0) { + return reject({err: new Error(`process exited with code ${code}`), cmd, workingDir}); + } + + resolve(); + }); + }); +} + +export async function downloadFile(url: string, dest: string): Promise { + const getURL = url.toLowerCase().startsWith('http://') ? httpGet : httpsGet; + + return new Promise((resolve, reject) => { + let writeStream: WriteStream | null = null; + + const done = function (err: boolean) { + if (writeStream) { + writeStream.close(); + writeStream = null; + + if (err) { + rmdirSync(dest, {recursive: true}); + } + } + }; + + // TODO + getURL(url, { + headers: { + 'User-Agent': userAgent + } + }, (httpRes) => { + if (httpRes.statusCode != 200) { + done(true); + + return reject(new Error(`Server responded with ${httpRes.statusCode}`)); + } + + writeStream = createWriteStream(dest, {encoding: 'binary'}) + .on('finish', () => { + done(false); + + return resolve(); + }) + .on('error', (err) => { + done(true); + + return reject(err); + }); + + httpRes.pipe(writeStream); + }) + .on('error', (err) => { + done(true); + + return reject(err); + }); + }); +} + +export function resetWorkingDir(): { base: string, cache: string, logs: string } { + const baseDir = joinPath(tmpdir(), 'SpraxDev-Action-SpigotMC'); + const cacheDir = joinPath(baseDir, 'cache'); + const logDir = joinPath(baseDir, 'logs'); + + rmdirSync(baseDir, {recursive: true}); // delete dir + + // create directories + mkdirSync(cacheDir, {recursive: true}); + mkdirSync(logDir); + + return {base: baseDir, cache: cacheDir, logs: logDir}; +} + +export function exit(code: number, msg?: string | Error): never { + if (msg) { + if (typeof msg == 'string') { + console.log(msg); + } else { + console.error(msg); + } + } + + return process.exit(code); +} \ No newline at end of file diff --git a/tsconfig.json b/tsconfig.json new file mode 100644 index 0000000..e34a107 --- /dev/null +++ b/tsconfig.json @@ -0,0 +1,6 @@ +{ + "extends": "@tsconfig/node12/tsconfig.json", + "include": [ + "src/**/*.ts" + ] +} \ No newline at end of file